PL92460B1 - - Google Patents
Download PDFInfo
- Publication number
- PL92460B1 PL92460B1 PL1971181164A PL18116471A PL92460B1 PL 92460 B1 PL92460 B1 PL 92460B1 PL 1971181164 A PL1971181164 A PL 1971181164A PL 18116471 A PL18116471 A PL 18116471A PL 92460 B1 PL92460 B1 PL 92460B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- tetrahydro
- azepine
- thiazolo
- amino
- Prior art date
Links
- -1 hexahydrobenzoyl group Chemical group 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 150000001538 azepines Chemical class 0.000 claims description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical group OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 claims description 6
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 230000009467 reduction Effects 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 229910052987 metal hydride Inorganic materials 0.000 claims description 3
- 150000004681 metal hydrides Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical group [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 150000004678 hydrides Chemical class 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims 3
- 229910052799 carbon Inorganic materials 0.000 claims 2
- 239000003638 chemical reducing agent Substances 0.000 claims 2
- 229910000063 azene Inorganic materials 0.000 claims 1
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 238000002844 melting Methods 0.000 description 38
- 230000008018 melting Effects 0.000 description 38
- 238000000354 decomposition reaction Methods 0.000 description 25
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 5
- 230000003110 anti-inflammatory effect Effects 0.000 description 5
- 230000001624 sedative effect Effects 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- 206010011224 Cough Diseases 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- YMVIOJYYCBEICH-UHFFFAOYSA-N C(C)NC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 Chemical compound C(C)NC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 YMVIOJYYCBEICH-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000004531 blood pressure lowering effect Effects 0.000 description 2
- 230000001914 calming effect Effects 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 229960003424 phenylacetic acid Drugs 0.000 description 2
- 239000003279 phenylacetic acid Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LROQYHLHVBFILK-UHFFFAOYSA-N (2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-(2,6-dichlorophenyl)methanone Chemical compound NC=1SC=2CCN(CCC=2N=1)C(C1=C(C=CC=C1Cl)Cl)=O LROQYHLHVBFILK-UHFFFAOYSA-N 0.000 description 1
- ULPGDQYELFROFQ-UHFFFAOYSA-N (2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-(3,4-dichlorophenyl)methanone Chemical compound NC=1SC=2CCN(CCC=2N=1)C(C1=CC(=C(C=C1)Cl)Cl)=O ULPGDQYELFROFQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PJHKXESPJOFGOA-UHFFFAOYSA-N 1h-azepine;dihydrochloride Chemical compound Cl.Cl.N1C=CC=CC=C1 PJHKXESPJOFGOA-UHFFFAOYSA-N 0.000 description 1
- 125000006280 2-bromobenzyl group Chemical group [H]C1=C([H])C(Br)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- HJTPRRDDSXCLSU-UHFFFAOYSA-N 3,3a,4,5,6,7-hexahydro-2h-[1,3]thiazolo[4,5-d]azepine Chemical compound C1CNCC=C2SCNC21 HJTPRRDDSXCLSU-UHFFFAOYSA-N 0.000 description 1
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- QHNGFZZXGOFXPN-UHFFFAOYSA-N 6-[(4-chlorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CC=2SC(N)=NC=2CCN1CC1=CC=C(Cl)C=C1 QHNGFZZXGOFXPN-UHFFFAOYSA-N 0.000 description 1
- GBQLRACMWOCCOY-UHFFFAOYSA-N 6-[(4-methylphenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)C GBQLRACMWOCCOY-UHFFFAOYSA-N 0.000 description 1
- HERPWIXOKVOUMO-UHFFFAOYSA-N 6-[[3-(trifluoromethyl)phenyl]methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)C(F)(F)F HERPWIXOKVOUMO-UHFFFAOYSA-N 0.000 description 1
- MUXSAUXLYSCZLI-UHFFFAOYSA-N 6-[[4-(trifluoromethyl)phenyl]methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)C(F)(F)F MUXSAUXLYSCZLI-UHFFFAOYSA-N 0.000 description 1
- ZZDGQQSLBXLAHI-UHFFFAOYSA-N 6-benzyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 ZZDGQQSLBXLAHI-UHFFFAOYSA-N 0.000 description 1
- YRAUHPFMNZIJGG-UHFFFAOYSA-N 6-benzyl-N-propan-2-yl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C(C)(C)NC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 YRAUHPFMNZIJGG-UHFFFAOYSA-N 0.000 description 1
- AGQSUEFQXOKJMY-UHFFFAOYSA-N 6-butyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CCCC AGQSUEFQXOKJMY-UHFFFAOYSA-N 0.000 description 1
- RCHRZZVXKQKIQH-UHFFFAOYSA-N 6-ethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CN(CC)CCC2=C1SC(N)=N2 RCHRZZVXKQKIQH-UHFFFAOYSA-N 0.000 description 1
- FRFBYBDFQYKFKP-UHFFFAOYSA-N 6-ethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine;dihydrochloride Chemical compound Cl.Cl.C1CN(CC)CCC2=C1SC(N)=N2 FRFBYBDFQYKFKP-UHFFFAOYSA-N 0.000 description 1
- WDLILJPUTYYQMM-UHFFFAOYSA-N 6-methyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)C WDLILJPUTYYQMM-UHFFFAOYSA-N 0.000 description 1
- JECKWLWVOQPAKJ-UHFFFAOYSA-N 6-propyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CN(CCC)CCC2=C1SC(N)=N2 JECKWLWVOQPAKJ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- CSDJVKBNDXZYLL-UHFFFAOYSA-N Cl.Cl.C(C)NC=1SC=2CCN(CCC2N1)CC Chemical compound Cl.Cl.C(C)NC=1SC=2CCN(CCC2N1)CC CSDJVKBNDXZYLL-UHFFFAOYSA-N 0.000 description 1
- RYWWPRHXSKUQDA-UHFFFAOYSA-N Cl.Cl.C(CC)NC=1SC=2CCN(CCC2N1)CC Chemical compound Cl.Cl.C(CC)NC=1SC=2CCN(CCC2N1)CC RYWWPRHXSKUQDA-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical group C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 101100042676 Mus musculus Skap2 gene Proteins 0.000 description 1
- JCADVWLAEVQLCG-UHFFFAOYSA-N NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)Br Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)Br JCADVWLAEVQLCG-UHFFFAOYSA-N 0.000 description 1
- SNLDSSYNIVAHDX-UHFFFAOYSA-N NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)F Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)F SNLDSSYNIVAHDX-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- GXDVEXJTVGRLNW-UHFFFAOYSA-N [Cr].[Cu] Chemical compound [Cr].[Cu] GXDVEXJTVGRLNW-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000000954 anitussive effect Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- AKPUJVVHYUHGKY-UHFFFAOYSA-N hydron;propan-2-ol;chloride Chemical compound Cl.CC(C)O AKPUJVVHYUHGKY-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2040510A DE2040510C3 (de) | 1970-08-14 | 1970-08-14 | Oxazole- und Thiazole eckige Klammer auf 5,4-d] azepin- Derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL92460B1 true PL92460B1 (member.php) | 1977-04-30 |
Family
ID=5779804
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971181164A PL92460B1 (member.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181163A PL92458B1 (member.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181165A PL92461B1 (member.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181166A PL92462B1 (member.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181167A PL92463B1 (member.php) | 1970-08-14 | 1971-08-13 |
Family Applications After (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971181163A PL92458B1 (member.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181165A PL92461B1 (member.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181166A PL92462B1 (member.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181167A PL92463B1 (member.php) | 1970-08-14 | 1971-08-13 |
Country Status (8)
| Country | Link |
|---|---|
| AT (5) | AT310179B (member.php) |
| CH (4) | CH571009A5 (member.php) |
| DE (1) | DE2040510C3 (member.php) |
| ES (2) | ES396452A1 (member.php) |
| PL (5) | PL92460B1 (member.php) |
| RO (1) | RO59322A (member.php) |
| SU (4) | SU461507A3 (member.php) |
| ZA (1) | ZA715393B (member.php) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795257A (fr) * | 1972-02-10 | 1973-08-09 | Thomae Gmbh Dr K | Nouveaux oxazols |
| GB2173187B (en) * | 1985-03-23 | 1988-05-18 | Erba Farmitalia | Condensed 2-substituted thiazole derivatives |
| US4826686A (en) * | 1985-12-14 | 1989-05-02 | Boehringer Ingelheim Kg | Therapeutic system |
| DE3610388A1 (de) * | 1986-03-27 | 1987-10-01 | Bernhard Dr Wessling | Stabile elektroden auf basis makromolekularer werkstoffe und verfahren zu ihrer verwendung |
| WO2000023066A2 (en) * | 1998-10-20 | 2000-04-27 | Omeros Medical Systems, Inc. | Irrigation solution and method for inhibition of pain and inflammation |
| US7091181B2 (en) | 1994-12-12 | 2006-08-15 | Omeros Corporation | Method of inhibition of pain and inflammation during surgery comprising administration of soluble TNF receptors |
| US7973068B2 (en) | 1998-10-20 | 2011-07-05 | Omeros Corporation | Arthroscopic irrigation solution and method for peripheral vasoconstriction and inhibition of pain and inflammation |
| US20030087962A1 (en) | 1998-10-20 | 2003-05-08 | Omeros Corporation | Arthroscopic irrigation solution and method for peripheral vasoconstriction and inhibition of pain and inflammation |
| WO2014094357A1 (en) * | 2012-12-21 | 2014-06-26 | Abbvie Inc. | Heterocyclic nuclear hormone receptor modulators |
-
1970
- 1970-08-14 DE DE2040510A patent/DE2040510C3/de not_active Expired
-
1971
- 1971-08-04 RO RO70459A patent/RO59322A/ro unknown
- 1971-08-05 SU SU1896325A patent/SU461507A3/ru active
- 1971-08-05 SU SU1896327A patent/SU461508A3/ru active
- 1971-08-05 SU SU1896328A patent/SU474151A3/ru active
- 1971-08-11 CH CH160175A patent/CH571009A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH159975A patent/CH561730A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH160075A patent/CH562829A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH160275A patent/CH562830A5/xx not_active IP Right Cessation
- 1971-08-12 ZA ZA715393A patent/ZA715393B/xx unknown
- 1971-08-13 PL PL1971181164A patent/PL92460B1/pl unknown
- 1971-08-13 PL PL1971181163A patent/PL92458B1/pl unknown
- 1971-08-13 AT AT899072A patent/AT310179B/de active
- 1971-08-13 PL PL1971181165A patent/PL92461B1/pl unknown
- 1971-08-13 PL PL1971181166A patent/PL92462B1/pl unknown
- 1971-08-13 AT AT899372A patent/AT310764B/de not_active IP Right Cessation
- 1971-08-13 AT AT899272A patent/AT310181B/de active
- 1971-08-13 AT AT899172A patent/AT310180B/de active
- 1971-08-13 AT AT899472A patent/AT310182B/de active
- 1971-08-13 PL PL1971181167A patent/PL92463B1/pl unknown
- 1971-10-28 ES ES396452A patent/ES396452A1/es not_active Expired
- 1971-10-28 ES ES396451A patent/ES396451A1/es not_active Expired
-
1973
- 1973-03-20 SU SU1896326A patent/SU503526A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| SU442601A3 (ru) | 1974-09-05 |
| PL92458B1 (member.php) | 1977-04-30 |
| AT310179B (de) | 1973-09-25 |
| SU503526A3 (ru) | 1976-02-15 |
| AT310180B (de) | 1973-09-25 |
| ZA715393B (en) | 1972-05-31 |
| SU474151A3 (ru) | 1975-06-14 |
| SU461508A3 (ru) | 1975-02-25 |
| CH562830A5 (member.php) | 1975-06-13 |
| RO59322A (member.php) | 1976-02-15 |
| AT310182B (de) | 1973-09-25 |
| AT310764B (de) | 1973-10-10 |
| DE2040510C3 (de) | 1980-03-06 |
| CH561730A5 (member.php) | 1975-05-15 |
| ES396452A1 (es) | 1974-05-16 |
| SU461507A3 (ru) | 1975-02-25 |
| CH562829A5 (member.php) | 1975-06-13 |
| DE2040510A1 (de) | 1972-02-17 |
| PL92462B1 (member.php) | 1977-04-30 |
| ES396451A1 (es) | 1974-05-16 |
| CH571009A5 (member.php) | 1975-12-31 |
| DE2040510B2 (de) | 1979-07-05 |
| PL92461B1 (member.php) | 1977-04-30 |
| AT310181B (de) | 1973-09-25 |
| PL92463B1 (member.php) | 1977-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2264163C2 (de) | Substituierte 6,7-Dihydro-1-oxo-1H,5H-benzo[ij]chinolizin-2-carbonsäuren | |
| DE2614406A1 (de) | Tetracyclische verbindungen, verfahren zu deren herstellung und arzneimittel, enthaltend diese verbindungen | |
| CH381706A (de) | Verfahren zur Herstellung von Sulfamylanthranilsäuren | |
| US3272824A (en) | 4-amino-6, 7-di(lower) alkoxyquinolines | |
| DE2345064A1 (de) | 2- oder 4-aminochinazolinderivate und pharmazeutische mittel | |
| US3621025A (en) | Imidazo and pyrimido{8 2,1-{11 {9 quinazoline compounds | |
| US4219649A (en) | Pyrido[1,2-a]pyrimidine derivatives | |
| PL92460B1 (member.php) | ||
| DD224851A5 (de) | Verfahren zur herstellung von imidazolen | |
| NZ207410A (en) | Pyrazolopyridine derivatives and pharmaceutical compositions | |
| DE4228095A1 (de) | Neue 4,5-Dihydro-4-oxo-pyrrolo[1,2-a]chinoxaline und entsprechende Aza-analoga und Verfahren zu deren Herstellung | |
| DE3016647A1 (de) | Pyrazinobenzodiazepine, ihre herstellung und verwendung | |
| DE1793837C2 (de) | N-(Carbalkoxy-acetyl)-diphenylamine | |
| IE46607B1 (en) | 4,5-dihydro-4-oxopyrrolo(1,2-a)quinoxaline-2-carboxylic acids and derivatives | |
| DD253821A5 (de) | Verfahren zur herstellung von pyrrolo-benzimidozolen, pyrrolo-benzooxazolen und pyrrolo-benzthiozole | |
| US2952680A (en) | Derivatives of x-quevazolone | |
| CA1294618C (en) | Pyridopyrimidinediones | |
| US3546227A (en) | 2,3-dihydro-1h-benz(d,e)isoquinoline carboxamidines | |
| US3745216A (en) | Compositions and methods for producing hypotensive activity with imidazo and pyrimido(2,1-b)quinazoline compounds | |
| DE2051962A1 (de) | Benzimidazo eckige Klammer auf l,2d eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu benzodiazepin 6 (5H) one und Verfahren zu deren Her stellung | |
| FI61029B (fi) | Nytt foerfarande foer framstaellning av terapeutiskt anvaendbara dibenso(b,e)(1,4)diazepiner | |
| DD202574A5 (de) | Verfahren zur herstellung von 1,4,9,10-tetrahydro-pyrazolo (4,3-) pyrido (3,2-b) (1,4)- diazepin-10-onen | |
| DE3514843A1 (de) | Iminothiazolidinderivate, verfahren zu deren herstellung und pharmazeutische derivate | |
| PL80193B1 (member.php) | ||
| US4002638A (en) | Benzazepine derivatives |