NZ219282A - Glycol monoethers - Google Patents
Glycol monoethersInfo
- Publication number
- NZ219282A NZ219282A NZ219282A NZ21928284A NZ219282A NZ 219282 A NZ219282 A NZ 219282A NZ 219282 A NZ219282 A NZ 219282A NZ 21928284 A NZ21928284 A NZ 21928284A NZ 219282 A NZ219282 A NZ 219282A
- Authority
- NZ
- New Zealand
- Prior art keywords
- formula
- dichlorophenyl
- phenyl
- alkyl
- lorophenyl
- Prior art date
Links
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 title abstract description 24
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 title abstract description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 17
- 238000002360 preparation method Methods 0.000 claims abstract description 17
- 239000002253 acid Substances 0.000 claims abstract description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 10
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 9
- 238000009833 condensation Methods 0.000 claims abstract description 8
- 230000005494 condensation Effects 0.000 claims abstract description 8
- 238000000034 method Methods 0.000 claims abstract description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- -1 cyano, phenyl Chemical group 0.000 claims description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- SSMDZKBRISDURT-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-2-methoxypentan-1-ol Chemical compound CCCC(CO)(OC)C1=CC=C(Cl)C=C1Cl SSMDZKBRISDURT-UHFFFAOYSA-N 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- XDROQJIPODXCMY-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-2-ethoxypentan-1-ol Chemical compound CCCC(CO)(OCC)C1=CC=C(Cl)C=C1Cl XDROQJIPODXCMY-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- RXJJIJHPVOJURK-UHFFFAOYSA-N 2-(4-bromo-2-chlorophenyl)-2-methoxybutan-1-ol Chemical compound CCC(CO)(OC)C1=CC=C(Br)C=C1Cl RXJJIJHPVOJURK-UHFFFAOYSA-N 0.000 claims 1
- YEEKQENAFSTXBT-UHFFFAOYSA-N 2-(4-bromo-2-chlorophenyl)-2-methoxypropan-1-ol Chemical compound COC(C)(CO)C1=CC=C(Br)C=C1Cl YEEKQENAFSTXBT-UHFFFAOYSA-N 0.000 claims 1
- 241001125671 Eretmochelys imbricata Species 0.000 claims 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 claims 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 claims 1
- 239000003377 acid catalyst Substances 0.000 abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 2
- 229910052751 metal Chemical group 0.000 abstract description 2
- 239000002184 metal Chemical group 0.000 abstract description 2
- BHESZOICBTWRPK-UHFFFAOYSA-N 4-[1-[1-(2h-triazol-4-yl)ethoxy]ethyl]-2h-triazole Chemical class C=1NN=NC=1C(C)OC(C)C1=CNN=N1 BHESZOICBTWRPK-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 239000011230 binding agent Substances 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 150000003852 triazoles Chemical class 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 19
- 239000000203 mixture Substances 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 9
- 229910015900 BF3 Inorganic materials 0.000 description 8
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 8
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 8
- 238000004440 column chromatography Methods 0.000 description 8
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 150000002924 oxiranes Chemical class 0.000 description 6
- FUJSJWRORKKPAI-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=C(Cl)C=C1Cl FUJSJWRORKKPAI-UHFFFAOYSA-N 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- ANHYRIRINAFJPT-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-2-propan-2-yloxypentan-1-ol Chemical compound CCCC(CO)(OC(C)C)C1=CC=C(Cl)C=C1Cl ANHYRIRINAFJPT-UHFFFAOYSA-N 0.000 description 2
- HAKOFSDOQLDZBZ-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-2-propyloxirane Chemical compound C=1C=C(Cl)C=C(Cl)C=1C1(CCC)CO1 HAKOFSDOQLDZBZ-UHFFFAOYSA-N 0.000 description 2
- BSCFIWHJBMWXAD-UHFFFAOYSA-N 2-butoxy-2-(4-fluorophenyl)propan-1-ol Chemical compound CCCCOC(C)(CO)C1=CC=C(F)C=C1 BSCFIWHJBMWXAD-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 230000003641 microbiacidal effect Effects 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- ASFCNYFBNGYXOW-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-2-(2-methoxyethoxy)pentan-1-ol Chemical compound COCCOC(CO)(CCC)C1=CC=C(Cl)C=C1Cl ASFCNYFBNGYXOW-UHFFFAOYSA-N 0.000 description 1
- QPMKKBOWFYRTKN-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-2-propoxybutan-1-ol Chemical compound CCCOC(CC)(CO)C1=CC=C(Cl)C=C1Cl QPMKKBOWFYRTKN-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- JDTUPLBMGDDPJS-UHFFFAOYSA-N 2-methoxy-2-phenylethanol Chemical compound COC(CO)C1=CC=CC=C1 JDTUPLBMGDDPJS-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 102000052666 B-Cell Lymphoma 3 Human genes 0.000 description 1
- 108700009171 B-Cell Lymphoma 3 Proteins 0.000 description 1
- 101150072667 Bcl3 gene Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101100113686 Clitocybe nebularis clt4 gene Proteins 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 description 1
- 108010081348 HRT1 protein Hairy Proteins 0.000 description 1
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000011088 calibration curve Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- HFPGRVHMFSJMOL-UHFFFAOYSA-N dibromomethane Chemical compound Br[CH]Br HFPGRVHMFSJMOL-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/178—Unsaturated ethers containing hydroxy or O-metal groups
- C07C43/1782—Unsaturated ethers containing hydroxy or O-metal groups containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Epoxy Compounds (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH273083 | 1983-05-19 | ||
| NZ208209A NZ208209A (en) | 1983-05-19 | 1984-05-18 | Triazole derivatives and microbicidal compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ219282A true NZ219282A (en) | 1988-02-12 |
Family
ID=4240315
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ219282A NZ219282A (en) | 1983-05-19 | 1984-05-18 | Glycol monoethers |
| NZ208209A NZ208209A (en) | 1983-05-19 | 1984-05-18 | Triazole derivatives and microbicidal compositions |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ208209A NZ208209A (en) | 1983-05-19 | 1984-05-18 | Triazole derivatives and microbicidal compositions |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4945100A (enExample) |
| EP (1) | EP0126430B1 (enExample) |
| JP (3) | JPS59222434A (enExample) |
| KR (2) | KR890000533B1 (enExample) |
| AT (1) | ATE66676T1 (enExample) |
| AU (2) | AU572145B2 (enExample) |
| BR (1) | BR8402388A (enExample) |
| CA (1) | CA1223264A (enExample) |
| CS (2) | CS247179B2 (enExample) |
| DD (2) | DD226882A5 (enExample) |
| DE (1) | DE3484968D1 (enExample) |
| DK (1) | DK248184A (enExample) |
| ES (1) | ES8600635A1 (enExample) |
| GB (2) | GB2143815B (enExample) |
| GR (1) | GR79954B (enExample) |
| HU (1) | HU196693B (enExample) |
| IE (2) | IE57489B1 (enExample) |
| IL (3) | IL71862A (enExample) |
| MX (1) | MX5769A (enExample) |
| MY (1) | MY102774A (enExample) |
| NZ (2) | NZ219282A (enExample) |
| PH (3) | PH20959A (enExample) |
| PT (1) | PT78602A (enExample) |
| TR (1) | TR22379A (enExample) |
| ZA (1) | ZA843774B (enExample) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE66676T1 (de) * | 1983-05-19 | 1991-09-15 | Ciba Geigy Ag | Verfahren zur herstellung von 1triazolylethylether-derivaten, sowie mikrobizide mittel enthaltende neue 1-triazolyl- phenoxyphenylethylether-derivate als wirkstoffe und deren verwendung. |
| DE3579347D1 (de) * | 1984-04-05 | 1990-10-04 | Ici Plc | Azolylpropanole. |
| GB2184113B (en) * | 1985-08-07 | 1989-08-23 | Ici Plc | Heterocyclic compounds |
| GB8603951D0 (en) * | 1986-02-18 | 1986-03-26 | Ici Plc | Heterocyclic compounds |
| ATE54313T1 (de) * | 1987-01-21 | 1990-07-15 | Ciba Geigy Ag | Mikrobizides mittel. |
| DE3732387A1 (de) * | 1987-09-25 | 1989-04-06 | Bayer Ag | Azolylmethylcyclopropyl-derivate enthaltende antimykotische mittel |
| ATE84669T1 (de) * | 1988-08-04 | 1993-02-15 | Ciba Geigy Ag | Mikrobizide mittel. |
| US4940720A (en) * | 1989-08-02 | 1990-07-10 | Ciba-Geigy Corporation | Microbicidal compositions |
| US5358939A (en) * | 1992-06-25 | 1994-10-25 | Rohm And Haas Company | Fungicidal 2-aryl-2,2-disubstituted ethyl-1,2,4-triazoles |
| NZ270418A (en) | 1994-02-07 | 1997-09-22 | Eisai Co Ltd | Polycyclic triazole & imidazole derivatives, antifungal compositions |
| KR20020037652A (ko) * | 2000-11-15 | 2002-05-22 | 김응필 | 비중분리 선광기 |
| MX297198B (es) | 2006-11-22 | 2012-03-16 | Basf Se | Formulaciones agroquimicas liquidas basadas en agua. |
| TW200915984A (en) | 2007-08-08 | 2009-04-16 | Basf Se | Aqueous microemulsions containing organic insecticide compounds |
| JP2011528684A (ja) * | 2008-07-24 | 2011-11-24 | ビーエーエスエフ ソシエタス・ヨーロピア | 溶媒、水、界面活性剤および殺有害生物剤を含む水中油型エマルション |
| TW201018400A (en) | 2008-10-10 | 2010-05-16 | Basf Se | Liquid aqueous plant protection formulations |
| UA106213C2 (ru) | 2008-10-10 | 2014-08-11 | Басф Се | Жидкие препараты для защиты растений, содержащие пираклостробин |
| ES2570187T3 (es) | 2011-07-13 | 2016-05-17 | Basf Agro Bv | Compuestos fungicidas de 2-[2-halogenoalquil-4-(fenoxi)-fenil]-1-[1,2,4]triazol-1-il-etanol sustituido |
| US9137996B2 (en) | 2011-07-15 | 2015-09-22 | Basf Se | Fungicidal alkyl- and aryl-substituted 2[-2-chloro-4-(dihalo-phenoxy)-phenyl]-1-[1,2,4]triazol-1-yl-ethanol compounds |
| WO2013010894A1 (en) | 2011-07-15 | 2013-01-24 | Basf Se | Fungicidal phenylalkyl-substituted 2-[2-chloro-4-(4-chloro-phenoxy)-phenyl]-1-[1,2,4]triazol-1-yl-ethanol compounds |
| US9173402B2 (en) | 2011-07-15 | 2015-11-03 | Basf Se | Fungicidal alkyl-substituted 2[2-chloro-4-(4-chioro-phenoxy)-phenyl]-1[1,2,4]triazol-1-yl-ethanol compounds |
| MX2014000511A (es) * | 2011-08-15 | 2014-02-19 | Basf Se | Compuestos fungicidas de 1-{2-[2-halo-4-(4-halogen-fenoxi)-fenil]- 2-etoxi-etil}-1h-[1,2,4]triazol sustituidos. |
| AU2012296887A1 (en) | 2011-08-15 | 2014-01-30 | Basf Se | Fungicidal substituted 1-{2-[2-halo-4-(4-halogen-phenoxy)-phenyl]-2-alkoxy-3-methyl-butyl}-1H-[1,2,4]triazole compounds |
| MX2014001669A (es) * | 2011-08-15 | 2014-05-27 | Basf Se | Compuestos de fungicidas de 1-{2-[2-halo-4-(4-halogen-fenoxi)-feni l]-2-alcoxi-2-alquinil/alquenil-etil}-1h-[1,2,4]triazol sustituidos. |
| JP2014524431A (ja) * | 2011-08-15 | 2014-09-22 | ビーエーエスエフ ソシエタス・ヨーロピア | 殺菌性置換１−｛２−［２−ハロ−４−（４−ハロゲン−フェノキシ）−フェニル］−２−アルコキシ−ヘキシル｝−１ｈ−［１，２，４］トリアゾール化合物 |
| BR112014003412A2 (pt) | 2011-08-15 | 2017-03-14 | Basf Se | compostos de fórmula i, processo, compostos de fórmula xii, viii e xi, composições agroquímicas, utilização e semente revestida |
| MX2014001671A (es) | 2011-08-15 | 2014-05-27 | Basf Se | Compuestos fungicidas de 1-{2-[2-halo-4-(4-halogen-fenoxi)-fenil]- 2-aluiniloxi-etil}-1h[1,2,4]triazol sustituidos. |
| KR20140054235A (ko) | 2011-08-15 | 2014-05-08 | 바스프 에스이 | 살진균 치환된 1-｛2-［2-할로-4-(4-할로겐-페녹시)-페닐］-2-알콕시-2-시클릴-에틸｝-1h-［1,2,4］트리아졸 화합물 |
| EP2559688A1 (en) | 2011-08-15 | 2013-02-20 | Basf Se | Fungicidal substituted 1-{2-[2-halo-4-(4-halogen-phenoxy)-phenyl]-2-butoxy-ethyl}-1h [1,2,4]triazole compounds |
| US20140308162A1 (en) | 2013-04-15 | 2014-10-16 | Ecolab Usa Inc. | Peroxycarboxylic acid based sanitizing rinse additives for use in ware washing |
| US9752105B2 (en) | 2012-09-13 | 2017-09-05 | Ecolab Usa Inc. | Two step method of cleaning, sanitizing, and rinsing a surface |
| CN105008336A (zh) | 2012-11-27 | 2015-10-28 | 巴斯夫欧洲公司 | 取代2-[苯氧基苯基]-1-[1,2,4]三唑-1-基乙醇化合物及其作为杀真菌剂的用途 |
| EP2735563A1 (en) * | 2012-11-27 | 2014-05-28 | Basf Se | Meta substituted 2-[phenoxy-phenyl]-1-[1,2,4]triazol-1-yl-ethanol compounds and their use as fungicides |
| BR112015012003A2 (pt) * | 2012-11-27 | 2018-05-15 | Basf Se | compostos de fórmula i, composição, utilização de um composto, método para o combate dos fungos nocivos, semente, processo para a preparação dos compostos e compostos intermediários |
| US20150313229A1 (en) | 2012-11-27 | 2015-11-05 | Basf Se | Substituted [1,2,4] Triazole Compounds |
| WO2014082879A1 (en) | 2012-11-27 | 2014-06-05 | Basf Se | Substituted [1,2,4]triazole compounds |
| US20160029630A1 (en) | 2012-11-27 | 2016-02-04 | Basf Se | Substituted 2-[phenoxy-phenyl]-1-[1,2,4]triazol-1-yl-ethanol compounds and their use as fungicides |
| WO2014095548A1 (en) * | 2012-12-19 | 2014-06-26 | Basf Se | Substituted [1,2,4]triazole compounds and their use as fungicides |
| CN104936450A (zh) * | 2012-12-20 | 2015-09-23 | 巴斯夫欧洲公司 | 包含三唑化合物的组合物 |
| BR112015014753B8 (pt) * | 2012-12-20 | 2020-03-03 | Basf Agro Bv | composições, uso de uma composição, método para o combate de fungos fitopatogênicos e uso dos componentes |
| BR112015016446B1 (pt) | 2013-01-09 | 2019-10-29 | Basf Agro Bv | processo para preparar compostos de fórmula ii, solução aquosa e uso da solução aquosa |
| CN104903315A (zh) * | 2013-01-09 | 2015-09-09 | 巴斯夫欧洲公司 | 取代的[1,2,4]三唑和咪唑化合物 |
| WO2014124850A1 (en) | 2013-02-14 | 2014-08-21 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2813499A1 (en) | 2013-06-12 | 2014-12-17 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| WO2014198557A1 (en) * | 2013-06-12 | 2014-12-18 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| WO2014198553A1 (en) * | 2013-06-12 | 2014-12-18 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| BR112016000299B8 (pt) * | 2013-07-08 | 2021-04-20 | Basf Agro Bv | composições, uso de uma composição, método para o combate dos fungos fitopatogênicos e uso dos componentes |
| EP2839745A1 (en) | 2013-08-21 | 2015-02-25 | Basf Se | Agrochemical formulations comprising a 2-ethyl-hexanol alkoxylate |
| WO2015059791A1 (ja) | 2013-10-24 | 2015-04-30 | 三菱電機株式会社 | 情報処理装置及び情報処理方法及びプログラム |
| UA118214C2 (uk) | 2014-02-14 | 2018-12-10 | Басф Агро Б.В. | Здатний до емульгування концентрат, що включає пестицид, жирний амід і лактамід |
| AU2015281187B2 (en) | 2014-06-25 | 2018-10-04 | BASF Agro B.V. | Pesticidal compositions |
| US10053436B2 (en) | 2014-07-08 | 2018-08-21 | BASF Agro B.V. | Process for the preparation of substituted oxiranes and triazoles |
| KR102469841B1 (ko) | 2014-07-14 | 2022-11-22 | 바스프 에스이 | 살충 조성물 |
| UA120628C2 (uk) | 2014-11-07 | 2020-01-10 | Басф Се | Пестицидні суміші |
| EP3028573A1 (en) | 2014-12-05 | 2016-06-08 | Basf Se | Use of a triazole fungicide on transgenic plants |
| WO2016174042A1 (en) | 2015-04-27 | 2016-11-03 | BASF Agro B.V. | Pesticidal compositions |
| WO2016180614A1 (en) | 2015-05-08 | 2016-11-17 | Basf Se | A process for the preparation of limonene-4-ol |
| WO2016180642A1 (en) | 2015-05-08 | 2016-11-17 | BASF Agro B.V. | A process for the preparation of terpinolene epoxide |
| EP3111763A1 (en) | 2015-07-02 | 2017-01-04 | BASF Agro B.V. | Pesticidal compositions comprising a triazole compound |
| CN107809906A (zh) | 2015-07-02 | 2018-03-16 | 巴斯夫农业公司 | 包含三唑化合物的农药组合物 |
| US11241012B2 (en) | 2016-03-16 | 2022-02-08 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on soybean |
| EP3429357B1 (en) | 2016-03-16 | 2025-09-17 | Basf Se | Use of a specific tetrazolinone for combating resistant phytopathogenic fungi on cereals |
| WO2017157920A1 (en) | 2016-03-16 | 2017-09-21 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on fruits |
| KR20190017924A (ko) | 2016-06-15 | 2019-02-20 | 바스프 아그로 비.브이. | 4치환 알켄의 에폭시화 방법 |
| ES2877169T3 (es) | 2016-06-15 | 2021-11-16 | Basf Agro Bv | Procedimiento para la epoxidación de un alqueno tetrasustituido |
| WO2018054829A1 (en) | 2016-09-22 | 2018-03-29 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives and their use as fungicides |
| EP3515907A1 (en) | 2016-09-22 | 2019-07-31 | Bayer CropScience Aktiengesellschaft | Novel triazole derivatives |
| BR112019016241A2 (pt) | 2017-02-08 | 2020-04-07 | Bayer Cropscience Ag | derivados de triazol e seu uso como fungicidas |
| CA3052519A1 (en) | 2017-02-08 | 2018-08-16 | Andreas Gortz | Triazolethione derivatives |
| EP3580218A1 (en) | 2017-02-08 | 2019-12-18 | Bayer CropScience Aktiengesellschaft | Novel triazole derivatives |
| AU2018217749A1 (en) | 2017-02-10 | 2019-08-01 | Bayer Aktiengesellschaft | Composition for controlling harmful microorganisms comprising 1 -(phenoxy-pyridinyl)-2-(1,2,4-triazol-1 -yl)-ethanol derivatives |
| EP3421460A1 (en) | 2018-03-15 | 2019-01-02 | Bayer Aktiengesellschaft | 2-[(4-alkylphenoxy)-pyridinyl]-1-(1,2,4-triazol-1-yl)alkan-2-ol fungicides |
| WO2020020813A1 (en) | 2018-07-25 | 2020-01-30 | Bayer Aktiengesellschaft | Fungicidal active compound combinations |
| WO2020020816A1 (en) | 2018-07-26 | 2020-01-30 | Bayer Aktiengesellschaft | Novel triazole derivatives |
| WO2020070050A1 (en) | 2018-10-01 | 2020-04-09 | Bayer Aktiengesellschaft | Fungicidal 5-substituted imidazol-1-yl carbinol derivatives |
| EP3620053A1 (en) | 2018-12-14 | 2020-03-11 | Bayer Aktiengesellschaft | Fungicidal active compound combinations |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2547953A1 (de) * | 1975-10-27 | 1977-04-28 | Bayer Ag | (1-phenyl-2-triazolyl-aethyl)-aether- derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| AU515134B2 (en) * | 1976-08-10 | 1981-03-19 | Janssen Pharmaceutica N.V. | 1-(2-aryl-2-r-ethyl)-1h-1,2,4-triazoles |
| DE2650831A1 (de) * | 1976-11-06 | 1978-05-11 | Basf Ag | Mittel zur beeinflussung des pflanzenwachstums |
| DE2725214A1 (de) * | 1977-06-03 | 1978-12-14 | Bayer Ag | Metallsalzkomplexe von 1-phenyl-2- triazolyl-aethyl-derivaten, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2725314A1 (de) * | 1977-06-04 | 1978-12-14 | Bayer Ag | 1-(2-phenylaethyl)-triazolium-salze, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| US4654332A (en) * | 1979-03-07 | 1987-03-31 | Imperial Chemical Industries Plc | Heterocyclic compounds |
| CH647513A5 (de) * | 1979-11-13 | 1985-01-31 | Sandoz Ag | Triazol-derivate, deren herstellung und verwendung. |
| AU542623B2 (en) * | 1980-05-16 | 1985-02-28 | Bayer Aktiengesellschaft | 1-hydroxyethyl-azole derivatives |
| EP0047594A3 (en) * | 1980-08-18 | 1982-06-09 | Imperial Chemical Industries Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and plant growth regulators and compositions containing them |
| DE3175673D1 (en) * | 1980-11-19 | 1987-01-15 | Ici Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
| DE3140276A1 (de) * | 1981-10-10 | 1983-04-28 | Bayer Ag, 5090 Leverkusen | Phenoxyphenyl-azolylmethyl-ketone und -carbinole, verfahren zu ihrer herstellung und ihre verwendung als fungizide und als zwischenprodukte |
| EP0082340B1 (de) * | 1981-11-27 | 1990-01-03 | Ciba-Geigy Ag | Mikrobizide Triazolyl-ethyl-äther |
| DE3202604A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Ether-derivate von substituierten 1-hydroxyalkyl-azolen, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und pflanzenwachstumsregulatoren |
| US4610716A (en) * | 1982-12-14 | 1986-09-09 | Ciba-Geigy Corporation | Fluorinated azolyl ethanol growth regulators and microbicides |
| ATE66676T1 (de) * | 1983-05-19 | 1991-09-15 | Ciba Geigy Ag | Verfahren zur herstellung von 1triazolylethylether-derivaten, sowie mikrobizide mittel enthaltende neue 1-triazolyl- phenoxyphenylethylether-derivate als wirkstoffe und deren verwendung. |
-
1984
- 1984-05-16 AT AT84105582T patent/ATE66676T1/de active
- 1984-05-16 GB GB08412506A patent/GB2143815B/en not_active Expired
- 1984-05-16 DE DE8484105582T patent/DE3484968D1/de not_active Expired - Lifetime
- 1984-05-16 EP EP84105582A patent/EP0126430B1/de not_active Expired - Lifetime
- 1984-05-17 IL IL71862A patent/IL71862A/xx unknown
- 1984-05-17 DD DD84263132A patent/DD226882A5/de not_active IP Right Cessation
- 1984-05-17 GR GR74745A patent/GR79954B/el unknown
- 1984-05-17 CA CA000454548A patent/CA1223264A/en not_active Expired
- 1984-05-17 DK DK248184A patent/DK248184A/da not_active Application Discontinuation
- 1984-05-17 PT PT78602A patent/PT78602A/pt not_active IP Right Cessation
- 1984-05-17 IL IL8483707A patent/IL83707A/xx unknown
- 1984-05-17 DD DD84281418A patent/DD248274A5/de not_active IP Right Cessation
- 1984-05-18 NZ NZ219282A patent/NZ219282A/en unknown
- 1984-05-18 ZA ZA843774A patent/ZA843774B/xx unknown
- 1984-05-18 PH PH30696A patent/PH20959A/en unknown
- 1984-05-18 AU AU28358/84A patent/AU572145B2/en not_active Ceased
- 1984-05-18 NZ NZ208209A patent/NZ208209A/en unknown
- 1984-05-18 ES ES532604A patent/ES8600635A1/es not_active Expired
- 1984-05-18 HU HU841926A patent/HU196693B/hu not_active IP Right Cessation
- 1984-05-18 BR BR8402388A patent/BR8402388A/pt not_active IP Right Cessation
- 1984-05-18 IE IE2779/88A patent/IE57489B1/en not_active IP Right Cessation
- 1984-05-18 CS CS843769A patent/CS247179B2/cs unknown
- 1984-05-18 MX MX576984A patent/MX5769A/es unknown
- 1984-05-18 IE IE1247/84A patent/IE57488B1/en not_active IP Right Cessation
- 1984-05-18 TR TR3611/84A patent/TR22379A/xx unknown
- 1984-05-19 KR KR1019840002741A patent/KR890000533B1/ko not_active Expired
- 1984-05-19 JP JP59101625A patent/JPS59222434A/ja active Granted
-
1985
- 1985-08-08 CS CS855782A patent/CS247200B2/cs unknown
- 1985-10-25 PH PH32973A patent/PH21667A/en unknown
- 1985-10-25 PH PH32974A patent/PH22876A/en unknown
-
1986
- 1986-09-22 GB GB08622763A patent/GB2179659B/en not_active Expired
-
1987
- 1987-08-31 IL IL83707A patent/IL83707A0/xx unknown
- 1987-09-30 MY MYPI87002496A patent/MY102774A/en unknown
-
1988
- 1988-05-02 AU AU15504/88A patent/AU607993B2/en not_active Ceased
- 1988-09-02 US US07/240,441 patent/US4945100A/en not_active Expired - Fee Related
- 1988-11-10 KR KR1019880014855A patent/KR900003367B1/ko not_active Expired
-
1989
- 1989-05-01 JP JP1112794A patent/JPH0285265A/ja active Granted
- 1989-05-01 JP JP1112793A patent/JPH0296544A/ja active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4945100A (en) | Process for the preparation of 1-triazolylethyl ether derivatives | |
| FI60194B (fi) | Foerfarande foer framstaellning av bensil-monoketaler | |
| GB2166729A (en) | Fluorine containing oxirane compounds | |
| KR900003302B1 (ko) | 하이드록시알킬-아졸릴 유도체의 제조방법 | |
| GB2158439A (en) | Phenoxy-phenoxy-derivatives | |
| JPH0458474B2 (enExample) | ||
| NZ231735A (en) | Alcohol/ether derivatives, preparation and pharmaceutical compositions thereof | |
| IE48600B1 (en) | Novel 1-(2-aryl-1,3-dioxan-2-ylmethyl)-1h-imidazoles and 1h-1,2,4-triazoles | |
| JPH0582387B2 (enExample) | ||
| DK163179B (da) | Alfa-hydroxyketonacetaler | |
| CA2263267C (en) | Process for the preparation of glycidyl ethers | |
| CA1169434A (en) | Process for the preparation of monochloromethyl ketones | |
| KR0160291B1 (ko) | 1-브로모-3-클로로-1,2-디아릴-2-프로판올,에리트로-1-브로모-3-클로로-1,2-디아릴-2-프로탄올의입체선택적제조및아졸일메틸옥시란으로의그의전환 | |
| US4492795A (en) | Alkylcycloalkyl imidazolylmethyl ketones as fungicide intermediates | |
| US5580992A (en) | Olefinic monomers containing pendant perfluorinated cyclic ether moieties | |
| DK145179B (da) | Analogifremgangsmaade til fremstilling af aryloxyalkyl-forbindelser | |
| US4629814A (en) | Process for preparing bis-bromoalkyl ethers | |
| KR870000276B1 (ko) | 아졸 유도체의 제조방법 | |
| US4267381A (en) | Preparation of side-chain fluorinated 3,3-dimethyl-butan-2-one | |
| Greiner | Extended scope of the grignard reaction of β-haloacetals. Use of acyclic acetals | |
| US4503239A (en) | Process for the preparation of ethylenic halogenoacetals | |
| CA1234139A (en) | Dihydropyrones, processes for producing them, novel starting products used therein, compositions containing the novel dihydropyrones as active ingredients, and the use thereof for combating weeds | |
| CA1231711A (en) | Fluoroazolyl methyl oxiranes | |
| JPH0587511B2 (enExample) | ||
| JPS625412B2 (enExample) |