NO842684L - Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater - Google Patents
Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivaterInfo
- Publication number
- NO842684L NO842684L NO842684A NO842684A NO842684L NO 842684 L NO842684 L NO 842684L NO 842684 A NO842684 A NO 842684A NO 842684 A NO842684 A NO 842684A NO 842684 L NO842684 L NO 842684L
- Authority
- NO
- Norway
- Prior art keywords
- group
- general formula
- imidazo
- phenyl
- methoxy
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 6
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title claims description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical class C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 title description 6
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 37
- 239000002253 acid Substances 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000006239 protecting group Chemical group 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- UBOOKRVGOBKDMM-UHFFFAOYSA-N 3h-imidazo[4,5-c]pyridine Chemical compound C1=NC=C2NC=NC2=C1 UBOOKRVGOBKDMM-UHFFFAOYSA-N 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000002460 imidazoles Chemical class 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 150000001204 N-oxides Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 150000003461 sulfonyl halides Chemical class 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims 1
- CNMIPBGVODYLIH-UHFFFAOYSA-N [3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CCNC(=O)C2=N1 CNMIPBGVODYLIH-UHFFFAOYSA-N 0.000 claims 1
- 125000003302 alkenyloxy group Chemical group 0.000 claims 1
- -1 cyanomethoxy- Chemical class 0.000 description 37
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- 238000002844 melting Methods 0.000 description 34
- 230000008018 melting Effects 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003222 pyridines Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 241000282326 Felis catus Species 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- SJJGPLWZUFYWCR-UHFFFAOYSA-N [3-methoxy-4-(4-methylsulfonyloxy-1h-imidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical group COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=C(OS(C)(=O)=O)N=CC=C2N1 SJJGPLWZUFYWCR-UHFFFAOYSA-N 0.000 description 3
- HKXJXKVCVOTVHV-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC(=O)CC=C2N1 HKXJXKVCVOTVHV-UHFFFAOYSA-N 0.000 description 3
- 125000005336 allyloxy group Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 230000009090 positive inotropic effect Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- MEXHPWWPNJYKEO-UHFFFAOYSA-N 2-(2-methoxy-4-prop-2-ynoxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-4-one Chemical compound COC1=CC(OCC#C)=CC=C1C1=NC2=CCNC(=O)C2=N1 MEXHPWWPNJYKEO-UHFFFAOYSA-N 0.000 description 2
- JRZUKLRCYKYZPQ-UHFFFAOYSA-N 2-(4-hydroxy-2-methoxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-4-one Chemical compound COC1=C(C=CC(=C1)O)C1=NC=2C(C(NCC2)=O)=N1 JRZUKLRCYKYZPQ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- DABCGSNISCRNJM-UHFFFAOYSA-N [2-(4-hydroxy-2-methoxyphenyl)-1H-imidazo[4,5-b]pyridin-5-yl] methanesulfonate Chemical compound COC1=CC(O)=CC=C1C1=NC2=NC(OS(C)(=O)=O)=CC=C2N1 DABCGSNISCRNJM-UHFFFAOYSA-N 0.000 description 2
- HXKMITBUQVIBLB-UHFFFAOYSA-N [3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate;hydrochloride Chemical compound Cl.COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CCNC(=O)C2=N1 HXKMITBUQVIBLB-UHFFFAOYSA-N 0.000 description 2
- KYEODLZUNTVZBT-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-3,6-dihydroimidazo[4,5-b]pyrazin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NCC(=O)N=C2N1 KYEODLZUNTVZBT-UHFFFAOYSA-N 0.000 description 2
- OVGNDXKPXSXHQQ-UHFFFAOYSA-N [3-methoxy-4-(6-methylsulfonyloxy-7h-purin-8-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=NC(OS(C)(=O)=O)=C2N1 OVGNDXKPXSXHQQ-UHFFFAOYSA-N 0.000 description 2
- HFEMDDAFRQKFNR-UHFFFAOYSA-N [3-methoxy-4-(6-oxopurin-8-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=NC(=O)C2=N1 HFEMDDAFRQKFNR-UHFFFAOYSA-N 0.000 description 2
- XWXCBUXGYBVSQR-UHFFFAOYSA-N [4-(2,6-dioxo-3,7-dihydropurin-8-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)NC(=O)N2 XWXCBUXGYBVSQR-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- UKTFBYCJQQKDDX-UHFFFAOYSA-N imidazo[4,5-b]pyrazin-5-one Chemical class O=C1C=NC2=NC=NC2=N1 UKTFBYCJQQKDDX-UHFFFAOYSA-N 0.000 description 2
- BSMNACCHROZNHW-UHFFFAOYSA-N imidazo[4,5-b]pyridin-5-one Chemical class O=C1C=CC2=NC=NC2=N1 BSMNACCHROZNHW-UHFFFAOYSA-N 0.000 description 2
- PPNFWYUJXHAZIN-UHFFFAOYSA-N imidazo[4,5-c]pyridin-4-one Chemical class O=C1N=CC=C2N=CN=C12 PPNFWYUJXHAZIN-UHFFFAOYSA-N 0.000 description 2
- WEWYWHHXRWFWFC-UHFFFAOYSA-N imidazo[4,5-c]pyridin-6-one Chemical class C1=NC(=O)C=C2N=CN=C21 WEWYWHHXRWFWFC-UHFFFAOYSA-N 0.000 description 2
- KVOVCEPPQJRTOB-UHFFFAOYSA-N imidazo[4,5-d]pyridazin-4-one Chemical class O=C1N=NC=C2N=CN=C12 KVOVCEPPQJRTOB-UHFFFAOYSA-N 0.000 description 2
- YFFVDIZCICRYFW-UHFFFAOYSA-N imidazo[4,5-d]triazin-6-one Chemical class C1=NN=NC2=NC(=O)N=C21 YFFVDIZCICRYFW-UHFFFAOYSA-N 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- FMZPGYCNFUIWBY-UHFFFAOYSA-N n-[3-(dimethylamino)-4-(2,6-dioxo-3,7-dihydropurin-8-yl)phenyl]methanesulfonamide Chemical compound CN(C)C1=CC(NS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)NC(=O)N2 FMZPGYCNFUIWBY-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- UFZNZKGKBWOSJG-UHFFFAOYSA-N purin-2-one Chemical class O=C1N=CC2=NC=NC2=N1 UFZNZKGKBWOSJG-UHFFFAOYSA-N 0.000 description 2
- UYLWKSJTHLRFBX-UHFFFAOYSA-N purin-6-one Chemical class O=C1N=CN=C2N=CN=C12 UYLWKSJTHLRFBX-UHFFFAOYSA-N 0.000 description 2
- FAIAJSOSTNJZCI-UHFFFAOYSA-N purine-2,6-dione Chemical class O=C1NC(=O)C2=NC=NC2=N1 FAIAJSOSTNJZCI-UHFFFAOYSA-N 0.000 description 2
- 150000003216 pyrazines Chemical class 0.000 description 2
- 150000004892 pyridazines Chemical class 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- XCPBURWDJUJQPS-UHFFFAOYSA-N (5,6-diaminopyridin-3-yl) acetate Chemical compound CC(=O)OC1=CN=C(N)C(N)=C1 XCPBURWDJUJQPS-UHFFFAOYSA-N 0.000 description 1
- JLKCVUZFBPLUQH-UHFFFAOYSA-N 1h-imidazo[4,5-b]pyridin-6-ol Chemical class OC1=CN=C2N=CNC2=C1 JLKCVUZFBPLUQH-UHFFFAOYSA-N 0.000 description 1
- JEQKTDSQNFCOMT-UHFFFAOYSA-N 2-(4-hydroxy-2-methoxyphenyl)-1,6-dihydroimidazo[4,5-b]pyridin-5-one Chemical compound COC1=C(C=CC(=C1)O)C1=NC=2C(NC(CC2)=O)=N1 JEQKTDSQNFCOMT-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- MVVKCHVGSVDVFT-UHFFFAOYSA-N 2-[3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenoxy]acetonitrile Chemical compound COC1=CC(OCC#N)=CC=C1C1=NC2=CCNC(=O)C2=N1 MVVKCHVGSVDVFT-UHFFFAOYSA-N 0.000 description 1
- OVBFXTADOCCRBP-UHFFFAOYSA-N 2-chloro-1h-imidazo[4,5-b]pyrazine Chemical class C1=CN=C2NC(Cl)=NC2=N1 OVBFXTADOCCRBP-UHFFFAOYSA-N 0.000 description 1
- XUHHSPBXCSZTCP-UHFFFAOYSA-N 2-chloro-1h-imidazo[4,5-d]pyridazine Chemical class N1=NC=C2NC(Cl)=NC2=C1 XUHHSPBXCSZTCP-UHFFFAOYSA-N 0.000 description 1
- JBMBVWROWJGFMG-UHFFFAOYSA-N 2-chloro-7h-purine Chemical class ClC1=NC=C2NC=NC2=N1 JBMBVWROWJGFMG-UHFFFAOYSA-N 0.000 description 1
- MLSNHDGPZWTQPR-UHFFFAOYSA-N 2-chloro-8-(2-methoxy-4-prop-2-ynoxyphenyl)-7h-purine Chemical compound COC1=CC(OCC#C)=CC=C1C1=NC2=NC(Cl)=NC=C2N1 MLSNHDGPZWTQPR-UHFFFAOYSA-N 0.000 description 1
- SYMQORWZHFIDSO-UHFFFAOYSA-N 2-methoxy-8-(2-methoxy-4-prop-2-ynoxyphenyl)-7h-purine Chemical compound N=1C2=NC(OC)=NC=C2NC=1C1=CC=C(OCC#C)C=C1OC SYMQORWZHFIDSO-UHFFFAOYSA-N 0.000 description 1
- BJMSTOPYTOXAFM-UHFFFAOYSA-N 2-methoxy-n-(3-nitro-6-oxo-1h-pyridin-2-yl)-4-phenylmethoxybenzamide Chemical compound C=1C=C(C(=O)NC2=C(C=CC(=O)N2)[N+]([O-])=O)C(OC)=CC=1OCC1=CC=CC=C1 BJMSTOPYTOXAFM-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- XWNKHKFVVGKLJS-UHFFFAOYSA-N 3-chloro-5h-imidazo[4,5-c]pyridazine Chemical class N1=NC(Cl)=CC2=C1N=CN2 XWNKHKFVVGKLJS-UHFFFAOYSA-N 0.000 description 1
- CQEWZNMGBUSCPC-UHFFFAOYSA-N 3h-imidazo[4,5-c]pyridin-7-ol Chemical class OC1=CN=CC2=C1NC=N2 CQEWZNMGBUSCPC-UHFFFAOYSA-N 0.000 description 1
- AKHVPZOYHZAQQC-UHFFFAOYSA-N 4-(methanesulfonamido)-2-methoxybenzoic acid Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C(O)=O AKHVPZOYHZAQQC-UHFFFAOYSA-N 0.000 description 1
- GLHJQPGLPHZVLC-UHFFFAOYSA-N 8-(2-methoxy-4-phenylmethoxyphenyl)-2-phenylmethoxy-7h-purine Chemical compound C=1C=C(C=2NC3=CN=C(OCC=4C=CC=CC=4)N=C3N=2)C(OC)=CC=1OCC1=CC=CC=C1 GLHJQPGLPHZVLC-UHFFFAOYSA-N 0.000 description 1
- KUTIPOUYUZJYDY-UHFFFAOYSA-N 8-(4-hydroxy-2-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione Chemical compound COC1=CC(O)=CC=C1C(N1)=NC2=C1C(=O)N(C)C(=O)N2C KUTIPOUYUZJYDY-UHFFFAOYSA-N 0.000 description 1
- HFSXYEHZVQIGOX-UHFFFAOYSA-N 8-(4-hydroxy-2-methoxyphenyl)purin-2-one Chemical compound COC1=CC(O)=CC=C1C1=NC2=NC(=O)N=CC2=N1 HFSXYEHZVQIGOX-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- WUIDOCJQTMSLGG-UHFFFAOYSA-N COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CC=C2N1 Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CC=C2N1 WUIDOCJQTMSLGG-UHFFFAOYSA-N 0.000 description 1
- NIXXRLPNPRHRGY-UHFFFAOYSA-N COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CN=C2N1 Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=[N+]([O-])C=CN=C2N1 NIXXRLPNPRHRGY-UHFFFAOYSA-N 0.000 description 1
- 208000020446 Cardiac disease Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- AMUJREGSDAHROB-UHFFFAOYSA-N [3-(dimethylamino)-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound CN(C)C1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CCNC(=O)C2=N1 AMUJREGSDAHROB-UHFFFAOYSA-N 0.000 description 1
- WWKVAFXQEFXMQX-UHFFFAOYSA-N [3-ethoxy-4-(2-methoxy-7h-purin-8-yl)phenyl] methanesulfonate Chemical compound CCOC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC(OC)=NC=C2N1 WWKVAFXQEFXMQX-UHFFFAOYSA-N 0.000 description 1
- YHSLXXUFOISCIW-UHFFFAOYSA-N [3-methoxy-4-(4-oxoimidazo[4,5-d]pyridazin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CN=NC(=O)C2=N1 YHSLXXUFOISCIW-UHFFFAOYSA-N 0.000 description 1
- OCJZMRCGDZYZHL-UHFFFAOYSA-N [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazol-2-yl)phenyl] methanesulfonate Chemical compound COC1=C(C=CC(=C1)OS(=O)(=O)C)C=1NC(=CN=1)OS(=O)(=O)C OCJZMRCGDZYZHL-UHFFFAOYSA-N 0.000 description 1
- BPCWNIPQFBVRID-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] butane-1-sulfonate Chemical compound COC1=CC(OS(=O)(=O)CCCC)=CC=C1C1=NC2=CCC(=O)NC2=N1 BPCWNIPQFBVRID-UHFFFAOYSA-N 0.000 description 1
- BSFLSXBSZDZHOS-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] ethanesulfonate Chemical compound COC1=CC(OS(=O)(=O)CC)=CC=C1C1=NC2=NC(=O)CC=C2N1 BSFLSXBSZDZHOS-UHFFFAOYSA-N 0.000 description 1
- UVRNQOOSPBUAEA-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] propane-1-sulfonate Chemical compound COC1=CC(OS(=O)(=O)CCC)=CC=C1C1=NC2=NC(=O)CC=C2N1 UVRNQOOSPBUAEA-UHFFFAOYSA-N 0.000 description 1
- HPDAOXRWNIJVLN-UHFFFAOYSA-N [3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl] propane-2-sulfonate Chemical compound COC1=CC(OS(=O)(=O)C(C)C)=CC=C1C1=NC2=NC(=O)CC=C2N1 HPDAOXRWNIJVLN-UHFFFAOYSA-N 0.000 description 1
- CLIUJTQRPJTGAM-UHFFFAOYSA-N [3-methoxy-4-(6-methoxy-3h-imidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound N=1C=2C=NC(OC)=CC=2NC=1C1=CC=C(OS(C)(=O)=O)C=C1OC CLIUJTQRPJTGAM-UHFFFAOYSA-N 0.000 description 1
- HRFHYARUPZZKNL-UHFFFAOYSA-N [3-methoxy-4-(6-methylsulfonyloxy-1h-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=C(OS(C)(=O)=O)C=C2N1 HRFHYARUPZZKNL-UHFFFAOYSA-N 0.000 description 1
- GOYSDRVJCFLHKV-UHFFFAOYSA-N [3-methoxy-4-(6-oxo-4,5-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CC(=O)NCC2=N1 GOYSDRVJCFLHKV-UHFFFAOYSA-N 0.000 description 1
- AULJMWNNYDFMKN-UHFFFAOYSA-N [4-(1,3-dimethyl-2,6-dioxo-7h-purin-8-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)N(C)C(=O)N2C AULJMWNNYDFMKN-UHFFFAOYSA-N 0.000 description 1
- DMKNGXHLCBNJKM-UHFFFAOYSA-N [4-(1h-imidazo[4,5-b]pyridin-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC=CC=C2N1 DMKNGXHLCBNJKM-UHFFFAOYSA-N 0.000 description 1
- MPYUXYMLZODTOU-UHFFFAOYSA-N [4-(2-methoxy-7h-purin-8-yl)-3-propoxyphenyl] methanesulfonate Chemical compound CCCOC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=NC(OC)=NC=C2N1 MPYUXYMLZODTOU-UHFFFAOYSA-N 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 230000002425 cardiocirculatory effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- YLQDNIMRFKQQEO-UHFFFAOYSA-N ethyl 2-[3-methoxy-4-(4-oxo-5,6-dihydroimidazo[4,5-c]pyridin-2-yl)phenoxy]acetate Chemical compound COC1=CC(OCC(=O)OCC)=CC=C1C1=NC2=CCNC(=O)C2=N1 YLQDNIMRFKQQEO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000010247 heart contraction Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- RZIDZGVHONJKMO-UHFFFAOYSA-N imidazo[4,5-b]pyridin-7-one Chemical class O=C1C=CN=C2N=CN=C12 RZIDZGVHONJKMO-UHFFFAOYSA-N 0.000 description 1
- FIJNUMPUCGUJLV-UHFFFAOYSA-N imidazo[4,5-c]pyridazin-6-one Chemical class C1=CN=NC2=NC(=O)N=C21 FIJNUMPUCGUJLV-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 210000005240 left ventricle Anatomy 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- XMZUQBFADVCNBR-UHFFFAOYSA-N n-(3-amino-6-oxo-1h-pyridin-2-yl)-4-(methanesulfonamido)-2-methoxybenzamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C(=O)NC1=C(N)C=CC(=O)N1 XMZUQBFADVCNBR-UHFFFAOYSA-N 0.000 description 1
- CZOVDZHIUWACHV-UHFFFAOYSA-N n-[3-(dimethylamino)-4-(1,3-dimethyl-2,6-dioxo-7h-purin-8-yl)phenyl]methanesulfonamide Chemical compound CN(C)C1=CC(NS(C)(=O)=O)=CC=C1C(N1)=NC2=C1C(=O)N(C)C(=O)N2C CZOVDZHIUWACHV-UHFFFAOYSA-N 0.000 description 1
- XJBIHDXPFGICHB-UHFFFAOYSA-N n-[3-(dimethylamino)-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl]methanesulfonamide Chemical compound CN(C)C1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=NC(=O)CC=C2N1 XJBIHDXPFGICHB-UHFFFAOYSA-N 0.000 description 1
- ZVYFWZYDQJABKV-UHFFFAOYSA-N n-[3-methoxy-4-(4-oxoimidazo[4,5-d]pyridazin-2-yl)phenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=CN=NC(=O)C2=N1 ZVYFWZYDQJABKV-UHFFFAOYSA-N 0.000 description 1
- WHNHGDBDKOZEAD-UHFFFAOYSA-N n-[3-methoxy-4-(5-oxo-1,6-dihydroimidazo[4,5-b]pyridin-2-yl)phenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=NC(=O)CC=C2N1 WHNHGDBDKOZEAD-UHFFFAOYSA-N 0.000 description 1
- ZKZWLCWFCICZDG-UHFFFAOYSA-N n-[4-(6-hydroxy-1h-imidazo[4,5-b]pyridin-2-yl)-3-methoxyphenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=NC=C(O)C=C2N1 ZKZWLCWFCICZDG-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000500 noncardiotoxic Toxicity 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229960002275 pentobarbital sodium Drugs 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/28—Oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/28—Oxygen atom
- C07D473/30—Oxygen atom attached in position 6, e.g. hypoxanthine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/40—Heterocyclic compounds containing purine ring systems with halogen atoms or perhalogeno-alkyl radicals directly attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Animal Behavior & Ethology (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hospice & Palliative Care (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833324115 DE3324115A1 (de) | 1983-07-05 | 1983-07-05 | Neue imidazole, ihre herstellung und diese verbindungen enthaltende arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO842684L true NO842684L (no) | 1985-01-07 |
Family
ID=6203136
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO842684A NO842684L (no) | 1983-07-05 | 1984-07-03 | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US4670438A (instruction) |
| EP (1) | EP0130461A3 (instruction) |
| JP (1) | JPS6036486A (instruction) |
| KR (1) | KR850001208A (instruction) |
| AU (1) | AU3032384A (instruction) |
| DD (1) | DD224851A5 (instruction) |
| DE (1) | DE3324115A1 (instruction) |
| DK (1) | DK326484A (instruction) |
| ES (4) | ES8506017A1 (instruction) |
| FI (1) | FI842666A7 (instruction) |
| GR (1) | GR82380B (instruction) |
| HU (1) | HU194878B (instruction) |
| IL (1) | IL72298A0 (instruction) |
| NO (1) | NO842684L (instruction) |
| NZ (1) | NZ208779A (instruction) |
| PH (1) | PH21496A (instruction) |
| PT (1) | PT78836B (instruction) |
| ZA (1) | ZA845103B (instruction) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3346640A1 (de) * | 1983-12-23 | 1985-07-04 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazolderivate, deren herstellung und diese verbindungen enthaltende arzneimittel |
| DE3445299A1 (de) * | 1984-12-12 | 1986-06-19 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazoderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| DE3522230A1 (de) * | 1985-06-21 | 1987-01-02 | Thomae Gmbh Dr K | Neue 2-arylimidazole, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| US4783530A (en) * | 1986-11-13 | 1988-11-08 | Marion Laboratories, Inc. | 8-arylxanthines |
| GB8804016D0 (en) * | 1988-02-22 | 1988-03-23 | Boots Co Plc | Therapeutic agents |
| DE3929864A1 (de) * | 1989-09-08 | 1991-03-14 | Nordmark Arzneimittel Gmbh | Verfahren zur herstellung von theophyllin-pellets |
| EP0434038A1 (en) * | 1989-12-22 | 1991-06-26 | Takeda Chemical Industries, Ltd. | Fused imidazole derivatives, their production and use |
| JP2534423B2 (ja) * | 1991-12-26 | 1996-09-18 | コーネル・リサーチ・ファンデーション・インコーポレイテッド | 酸化窒素の過剰生産から生じる血管失調を阻止する阻害剤 |
| US5877176A (en) * | 1991-12-26 | 1999-03-02 | Cornell Research Foundation, Inc. | Blocking induction of tetrahydrobiopterin to block induction of nitric oxide synthesis |
| EP0577025A3 (de) * | 1992-07-01 | 1998-02-04 | Hoechst Aktiengesellschaft | Angiotensin-II-Rezeptorantagonisten zur Behandlung und Prophylaxe von koronaren Herzerkrankungen |
| TW270118B (instruction) * | 1993-02-26 | 1996-02-11 | Schering Corp | |
| CA2131134A1 (en) * | 1993-09-17 | 1995-03-18 | Gerhard Stucky | Process for preparing imidazopyridine derivatives |
| CA2131680C (en) * | 1993-09-17 | 2006-11-07 | Gerhard Stucky | Process for preparing imidazopyridine derivatives |
| US5502050A (en) * | 1993-11-29 | 1996-03-26 | Cornell Research Foundation, Inc. | Blocking utilization of tetrahydrobiopterin to block induction of nitric oxide synthesis |
| US6887690B2 (en) * | 2001-06-22 | 2005-05-03 | Pe Corporation | Dye-labeled ribonucleotide triphosphates |
| JP4127204B2 (ja) * | 2003-12-17 | 2008-07-30 | セイコーエプソン株式会社 | 液晶表示装置の製造方法 |
| AU2007221207A1 (en) * | 2006-02-28 | 2007-09-07 | Merck Sharp & Dohme Corp. | Inhibitors of histone deacetylase |
| JP5501227B2 (ja) * | 2007-06-27 | 2014-05-21 | メルク・シャープ・アンド・ドーム・コーポレーション | ヒストンデアセチラーゼ阻害剤としての4−カルボキシベンジルアミノ誘導体 |
| CA2692153A1 (en) * | 2007-06-27 | 2009-01-08 | Richard W. Heidebrecht, Jr. | Pyridyl and pyrimidinyl derivatives as histone deacetylase inhibitors |
| US20090197880A1 (en) * | 2007-07-13 | 2009-08-06 | Genelabs Technologies, Inc. | Anti-viral compounds, compositions, and methods of use |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660397A (en) * | 1970-04-17 | 1972-05-02 | Merck & Co Inc | Imidazo(4 5-b)pyrazines |
| US3922345A (en) * | 1971-10-29 | 1975-11-25 | Pfizer | Pyrimidinones and hydroxy pyrimidines |
| US3985891A (en) * | 1973-02-03 | 1976-10-12 | Boehringer Ingelheim Gmbh | 2-Phenyl-imidazo (4,5-b)pyridines and salts thereof |
| DE2305339C3 (de) * | 1973-02-03 | 1980-05-08 | Dr. Karl Thomae Gmbh, 7950 Biberach | Imidazo [4,5-b] pyridine, ihre Herstellung und ihre Verwendung als Cardiötonica |
| EP0011399A1 (en) * | 1978-11-11 | 1980-05-28 | FISONS plc | N-substituted theophyllines, processes for their preparation and pharmaceutical compositions containing them |
| DE2927988A1 (de) * | 1979-07-11 | 1981-02-05 | Thomae Gmbh Dr K | Neue 8-phenyl-purine, deren herstellung und deren verwendung als arzneimittel |
| DE2927987A1 (de) * | 1979-07-11 | 1981-02-05 | Thomae Gmbh Dr K | Neue 2-alkoxyphenyl-imidazo eckige klammer auf 4,5-b eckige klammer zu pyridine, deren herstellung und deren verwendung als arzneimittel |
| DE3037464A1 (de) * | 1980-10-03 | 1982-05-19 | Dr. Karl Thomae Gmbh, 7950 Biberach | 6-hydroxy-2-phenyl-imidazo 4,5-b zu pyridine, ihre herstellung und diese sie enthaltende arzneimittel |
| DE3044497A1 (de) * | 1980-11-26 | 1982-06-24 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neues verfahren zur herstellung von imidazo(4,5-b)pyridinen und -pyrimidinen |
| GB2091249A (en) * | 1980-12-23 | 1982-07-28 | Fordonal Sa | Xanthine derivatives |
| DE3273461D1 (en) * | 1981-08-19 | 1986-10-30 | Merck Patent Gmbh | 2-arylimidazopyridines |
| ES517193A0 (es) * | 1981-11-10 | 1983-12-01 | Wellcome Found | Un procedimiento para la preparacion de nuevos derivados de imidazo (4,5-c)piridina. |
| US4452788A (en) * | 1982-04-21 | 1984-06-05 | Warner-Lambert Company | Substituted 8-phenylxanthines |
| RO86850B (ro) * | 1982-05-03 | 1985-05-31 | Eli Lilly And Company | Procedeu pentru prepararea unor 2-fenilimidazo [4,5 c] piridine |
| DE3217583A1 (de) * | 1982-05-11 | 1983-11-17 | Merck Patent Gmbh, 6100 Darmstadt | 2-aryl-tetraazaindene |
| DE3224512A1 (de) * | 1982-07-01 | 1984-01-05 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazolderivate, ihre herstellung und diese verbindungen enthaltende arzneimittel |
-
1983
- 1983-07-05 DE DE19833324115 patent/DE3324115A1/de not_active Withdrawn
-
1984
- 1984-06-19 EP EP84107002A patent/EP0130461A3/de not_active Withdrawn
- 1984-06-22 US US06/623,718 patent/US4670438A/en not_active Expired - Fee Related
- 1984-06-29 PH PH30905A patent/PH21496A/en unknown
- 1984-07-02 GR GR75159A patent/GR82380B/el unknown
- 1984-07-03 PT PT78836A patent/PT78836B/pt unknown
- 1984-07-03 NO NO842684A patent/NO842684L/no unknown
- 1984-07-03 FI FI842666A patent/FI842666A7/fi not_active Application Discontinuation
- 1984-07-03 DK DK326484A patent/DK326484A/da not_active Application Discontinuation
- 1984-07-03 DD DD84264889A patent/DD224851A5/de unknown
- 1984-07-04 NZ NZ208779A patent/NZ208779A/en unknown
- 1984-07-04 ZA ZA845103A patent/ZA845103B/xx unknown
- 1984-07-04 KR KR1019840003852A patent/KR850001208A/ko not_active Withdrawn
- 1984-07-04 HU HU842616A patent/HU194878B/hu unknown
- 1984-07-04 ES ES533995A patent/ES8506017A1/es not_active Expired
- 1984-07-04 JP JP59137395A patent/JPS6036486A/ja active Pending
- 1984-07-04 IL IL72298A patent/IL72298A0/xx unknown
- 1984-07-05 AU AU30323/84A patent/AU3032384A/en not_active Abandoned
-
1985
- 1985-03-28 ES ES541662A patent/ES541662A0/es active Granted
- 1985-03-28 ES ES541660A patent/ES541660A0/es active Granted
- 1985-03-28 ES ES541661A patent/ES541661A0/es active Granted
-
1987
- 1987-01-28 US US07/007,530 patent/US4766130A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES8603478A1 (es) | 1985-12-16 |
| PH21496A (en) | 1987-11-10 |
| KR850001208A (ko) | 1985-03-16 |
| DE3324115A1 (de) | 1985-01-17 |
| ES8603480A1 (es) | 1985-12-16 |
| DK326484D0 (da) | 1984-07-03 |
| JPS6036486A (ja) | 1985-02-25 |
| GR82380B (instruction) | 1984-12-13 |
| ZA845103B (en) | 1986-03-26 |
| US4766130A (en) | 1988-08-23 |
| HUT34475A (en) | 1985-03-28 |
| ES541662A0 (es) | 1985-12-16 |
| ES8603479A1 (es) | 1985-12-16 |
| PT78836A (de) | 1984-08-01 |
| DD224851A5 (de) | 1985-07-17 |
| FI842666A7 (fi) | 1985-01-06 |
| US4670438A (en) | 1987-06-02 |
| AU3032384A (en) | 1985-01-10 |
| EP0130461A2 (de) | 1985-01-09 |
| FI842666A0 (fi) | 1984-07-03 |
| ES541661A0 (es) | 1985-12-16 |
| HU194878B (en) | 1988-03-28 |
| IL72298A0 (en) | 1984-11-30 |
| DK326484A (da) | 1985-01-06 |
| ES541660A0 (es) | 1985-12-16 |
| ES533995A0 (es) | 1985-06-16 |
| PT78836B (de) | 1986-10-21 |
| EP0130461A3 (de) | 1987-05-06 |
| ES8506017A1 (es) | 1985-06-16 |
| NZ208779A (en) | 1988-02-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO842684L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater | |
| US4582837A (en) | Imidazo[4,5-b] and [4,5-c]pyridine derivatives having cardiotonic activity | |
| FI92697C (fi) | Menetelmä lääkeaineina käyttökelpoisten imidatso/4,5-b/kinolinyylioksialkaanihappoamidien valmistamiseksi | |
| AU592983B2 (en) | Imidazoquinoline antithrombogenic cardiotonicagents | |
| KR900008567B1 (ko) | 이미다조키놀리닐에테르 유도체의 제조방법 | |
| AU628913B2 (en) | Pyrazolopyridine compound and processes for preparation thereof | |
| EP0370381B1 (en) | 2(1H)-quinolinone compounds, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| US4722929A (en) | Novel 2-phenyl-imidazoles and pharmaceutical compositions containing same | |
| NO862477L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-arylimidazol-derivater. | |
| US5354759A (en) | Angiotenin II antagonizing heterocyclic compounds | |
| IE861104L (en) | Xanthines | |
| WO2006026760A2 (en) | 1-amino imidazo-containing compounds and methods | |
| NO316564B1 (no) | Fremgangsmåte til fremstilling av imidazokinolinaminer | |
| PL171766B1 (pl) | Sposób wytwarzania imidazo-skondensowanych zwiazków izo-i heterocyklicznych PL PL | |
| IE63502B1 (en) | Aminopyrimidine derivatives useful for treating cardiovascular disorders | |
| DE69713255T2 (de) | Pharmazeutische Pyridin-Derivate, ihre Herstellungsverfahren und Zwischenprodukte dafür | |
| NZ233047A (en) | Heterocyclic derivatives of diazepine and pharmaceutical compositions | |
| AU1719901A (en) | Pyrazolo-pyridine derivatives as ligands for gaba receptors | |
| NO855196L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazoderivater. | |
| US4284768A (en) | 1,2-Dihydro-4-amino-2-oxo-3-quinoline-carboxylic acid derivatives | |
| NO152373B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive 8-fenyl-purin-derivater | |
| NO854964L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazoderivater. | |
| NO845169L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzimidazol-derivater | |
| EP0594883A1 (en) | Imidazo(1,2-c) quinazoline derivatives as antihypertensives and anti dysurics | |
| CS220343B2 (en) | Method of producing new imidazoquinazoline derivatives |