JPS6351704B2 - - Google Patents
Info
- Publication number
- JPS6351704B2 JPS6351704B2 JP55077884A JP7788480A JPS6351704B2 JP S6351704 B2 JPS6351704 B2 JP S6351704B2 JP 55077884 A JP55077884 A JP 55077884A JP 7788480 A JP7788480 A JP 7788480A JP S6351704 B2 JPS6351704 B2 JP S6351704B2
- Authority
- JP
- Japan
- Prior art keywords
- soluble
- indicator
- tablet
- elongated core
- binder
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000001954 sterilising effect Effects 0.000 claims description 50
- 238000004659 sterilization and disinfection Methods 0.000 claims description 50
- 239000011230 binding agent Substances 0.000 claims description 39
- 239000011162 core material Substances 0.000 claims description 39
- 239000000126 substance Substances 0.000 claims description 30
- 239000000463 material Substances 0.000 claims description 22
- 239000000853 adhesive Substances 0.000 claims description 17
- 230000001070 adhesive effect Effects 0.000 claims description 17
- 239000002195 soluble material Substances 0.000 claims description 17
- 238000002844 melting Methods 0.000 claims description 13
- 230000008018 melting Effects 0.000 claims description 13
- 230000007423 decrease Effects 0.000 claims description 9
- 229920006316 polyvinylpyrrolidine Polymers 0.000 claims description 9
- 229920006395 saturated elastomer Polymers 0.000 claims description 9
- 239000003522 acrylic cement Substances 0.000 claims description 8
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical group NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 claims description 7
- 229960000581 salicylamide Drugs 0.000 claims description 7
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 5
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003232 water-soluble binding agent Substances 0.000 claims description 3
- 239000000155 melt Substances 0.000 claims 2
- 239000002184 metal Substances 0.000 claims 2
- 239000003826 tablet Substances 0.000 description 22
- 244000005700 microbiome Species 0.000 description 12
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 6
- 230000000813 microbial effect Effects 0.000 description 6
- 239000000975 dye Substances 0.000 description 4
- -1 polypropylene Polymers 0.000 description 4
- 241000193385 Geobacillus stearothermophilus Species 0.000 description 3
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 229920001296 polysiloxane Polymers 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000013464 silicone adhesive Substances 0.000 description 3
- 230000004083 survival effect Effects 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000002147 killing effect Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 235000019890 Amylum Nutrition 0.000 description 1
- 101100313377 Caenorhabditis elegans stip-1 gene Proteins 0.000 description 1
- 231100000681 Certain safety factor Toxicity 0.000 description 1
- 241000193470 Clostridium sporogenes Species 0.000 description 1
- 101100313382 Dictyostelium discoideum stip-2 gene Proteins 0.000 description 1
- 101100516335 Rattus norvegicus Necab1 gene Proteins 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 101150059016 TFIP11 gene Proteins 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003190 augmentative effect Effects 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- SBNKFTQSBPKMBZ-UHFFFAOYSA-N ethenzamide Chemical compound CCOC1=CC=CC=C1C(N)=O SBNKFTQSBPKMBZ-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- DKLYDESVXZKCFI-UHFFFAOYSA-N n,n-diphenylacetamide Chemical compound C=1C=CC=CC=1N(C(=O)C)C1=CC=CC=C1 DKLYDESVXZKCFI-UHFFFAOYSA-N 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007944 soluble tablet Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N31/00—Investigating or analysing non-biological materials by the use of the chemical methods specified in the subgroup; Apparatus specially adapted for such methods
- G01N31/22—Investigating or analysing non-biological materials by the use of the chemical methods specified in the subgroup; Apparatus specially adapted for such methods using chemical indicators
- G01N31/226—Investigating or analysing non-biological materials by the use of the chemical methods specified in the subgroup; Apparatus specially adapted for such methods using chemical indicators for investigating the degree of sterilisation
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61L—METHODS OR APPARATUS FOR STERILISING MATERIALS OR OBJECTS IN GENERAL; DISINFECTION, STERILISATION OR DEODORISATION OF AIR; CHEMICAL ASPECTS OF BANDAGES, DRESSINGS, ABSORBENT PADS OR SURGICAL ARTICLES; MATERIALS FOR BANDAGES, DRESSINGS, ABSORBENT PADS OR SURGICAL ARTICLES
- A61L2/00—Methods or apparatus for disinfecting or sterilising materials or objects other than foodstuffs or contact lenses; Accessories therefor
- A61L2/26—Accessories or devices or components used for biocidal treatment
- A61L2/28—Devices for testing the effectiveness or completeness of sterilisation, e.g. indicators which change colour
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Biophysics (AREA)
- Epidemiology (AREA)
- Physics & Mathematics (AREA)
- Animal Behavior & Ethology (AREA)
- Analytical Chemistry (AREA)
- Biochemistry (AREA)
- General Physics & Mathematics (AREA)
- Immunology (AREA)
- Pathology (AREA)
- Apparatus For Disinfection Or Sterilisation (AREA)
- Measuring Temperature Or Quantity Of Heat (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/047,955 US4448548A (en) | 1979-06-11 | 1979-06-11 | Steam sterilization indicator |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS565660A JPS565660A (en) | 1981-01-21 |
| JPS6351704B2 true JPS6351704B2 (enExample) | 1988-10-14 |
Family
ID=21951945
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP7788480A Granted JPS565660A (en) | 1979-06-11 | 1980-06-11 | Steam sterilizing indicator |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US4448548A (enExample) |
| EP (1) | EP0022284B1 (enExample) |
| JP (1) | JPS565660A (enExample) |
| AR (1) | AR228257A1 (enExample) |
| AT (1) | ATE9763T1 (enExample) |
| AU (1) | AU537239B2 (enExample) |
| BR (1) | BR8003580A (enExample) |
| CA (1) | CA1148416A (enExample) |
| DE (1) | DE3069406D1 (enExample) |
| DK (1) | DK249580A (enExample) |
| ES (1) | ES492283A0 (enExample) |
| NO (1) | NO801728L (enExample) |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4353990A (en) * | 1981-02-09 | 1982-10-12 | Minnesota Mining And Manufacturing Company | Sanitation indicator |
| US4576795A (en) * | 1983-09-28 | 1986-03-18 | Warner-Lambert Company | Disposable sterilizer vacuum test pack |
| US4579715A (en) * | 1983-09-28 | 1986-04-01 | Warner-Lambert Company | Disposable sterilizer vacuum test pack |
| JPS60131463A (ja) * | 1983-12-20 | 1985-07-13 | Showa Yakuhin Kako Kk | 簡易判定具 |
| US4786773A (en) * | 1986-12-18 | 1988-11-22 | Alcan International Limited | Systems and methods for determining doneness of microwave-heated bodies |
| US4850716A (en) * | 1987-11-20 | 1989-07-25 | Minnesota Mining And Manufacturing Company | Remotely detectable sterilization monitor |
| US5252484A (en) * | 1988-11-29 | 1993-10-12 | Minnesota Mining And Manufacturing Company | Rapid read-out biological indicator |
| US5073488A (en) * | 1988-11-29 | 1991-12-17 | Minnesota Mining And Manufacturing Company | Rapid method for determining efficacy of a sterilization cycle and rapid read-out biological indicator |
| US5204062A (en) * | 1989-09-05 | 1993-04-20 | Surgicot Incorporated | Bowie-dick test device |
| JPH0756026Y2 (ja) * | 1989-11-30 | 1995-12-25 | 株式会社寺岡製作所 | 滅菌確認インジケータ付粘着テープ |
| US5486459A (en) * | 1989-12-14 | 1996-01-23 | Medical College Of Ohio | Biologically relevant methods for the rapid determination of sterility |
| US5158363A (en) * | 1991-08-16 | 1992-10-27 | Propper Manufacturing Company, Inc. | Steam sterilization indicator |
| AU687819B2 (en) * | 1993-08-09 | 1998-03-05 | Johnson & Johnson Medical, Inc. | Self-contained biological indicator |
| US5378430A (en) * | 1993-10-07 | 1995-01-03 | Pymah Corporation | Steam sterilization process monitor |
| AU1882795A (en) * | 1994-03-11 | 1995-09-25 | Propper Manufacturing Company, Inc. | Steam sterilization indicator |
| US5476792A (en) * | 1994-04-05 | 1995-12-19 | Temple Division, Air Liquide America Corporation | Time-temperature indicator devices |
| US5487352A (en) | 1994-09-21 | 1996-01-30 | John R. Williams | Temperature indicator for cooked meats |
| US5990199A (en) * | 1995-04-19 | 1999-11-23 | North American Science Associates, Inc. | Indicator ink compositions |
| US6042264A (en) * | 1995-10-23 | 2000-03-28 | Lifelines Technology, Inc. | Time-temperature indicator device and method of manufacture |
| US5709472A (en) * | 1995-10-23 | 1998-01-20 | Lifelines Technology, Inc. | Time-temperature indicator device and method of manufacture |
| FR2740974B1 (fr) * | 1995-11-09 | 1999-06-04 | Mercey Gilles | Procede et dispositif de verification de bon fonctionnement d'un sterilisateur |
| US5830683A (en) * | 1996-01-22 | 1998-11-03 | North American Science Associates, Inc. | Indicator systems for determination of sterilization |
| DE19616930C1 (de) * | 1996-04-27 | 1997-07-24 | Aesculap Ag | Sterilisierbehälter für ärztliche Instrumente sowie wiederverwendbares Filter für Sterilisierbehälter |
| US5745039A (en) * | 1997-02-21 | 1998-04-28 | Minnesota Mining And Manufacturing Company | Remote sterilization monitor |
| US6063631A (en) * | 1997-05-21 | 2000-05-16 | 3M Innovative Properties Company | Sterilization indicator |
| US6238623B1 (en) | 1997-05-21 | 2001-05-29 | 3M Innovative Properties Company | Labels and tracking systems for sterilization procedures |
| US6287518B1 (en) | 1997-06-25 | 2001-09-11 | 3M Innovative Properties Company | Sterilization monitors |
| US5942438A (en) | 1997-11-07 | 1999-08-24 | Johnson & Johnson Medical, Inc. | Chemical indicator for oxidation-type sterilization processes using bleachable dyes |
| US6352837B1 (en) | 1999-02-22 | 2002-03-05 | 3M Innovative Properties Company | Rapid readout sterilization indicator for liquid peracetic acid sterilization procedures |
| US6488890B1 (en) | 1999-08-05 | 2002-12-03 | 3M Innovative Properties Company | Machine readable sterilization indicator for monitoring articles to be sterilized |
| US6485978B1 (en) | 1999-08-05 | 2002-11-26 | 3M Innovative Properties Company | Method of using a chemical indicator |
| US6485979B1 (en) | 1999-08-05 | 2002-11-26 | 3M Innovative Properties Company | Electronic system for tracking and monitoring articles to be sterilized and associated method |
| USD439344S1 (en) | 1999-10-06 | 2001-03-20 | 3M Innovative Properties Company | Sterilization indicator for sterilization process |
| JP2001221718A (ja) * | 2000-02-08 | 2001-08-17 | Canon Inc | 再利用可能なユニットを含む装置およびその管理システム |
| CA2478308A1 (en) | 2002-03-07 | 2003-09-18 | Avery International Corporation | Color changing device for time indicating label and methods of making and using the same |
| US7105350B2 (en) | 2002-08-30 | 2006-09-12 | Tropicana Products, Inc. | Closure integrity test method for hot-fill bottling operation |
| US6737645B2 (en) | 2002-08-30 | 2004-05-18 | Tropicana Products, Inc. | Method for qualifying bottle rinser |
| US7074280B2 (en) * | 2003-07-03 | 2006-07-11 | Healthmark Industries Co. | Method and system to represent a temperature experienced by a medical device in a medical washing machine |
| US20050079093A1 (en) | 2003-10-14 | 2005-04-14 | Allegiance Corporation | Sterilization wraps and methods for sterilizing articles |
| US8267576B2 (en) | 2004-11-08 | 2012-09-18 | Freshpoint Holdings Sa | Time-temperature indicating device |
| RU2284520C1 (ru) * | 2005-09-15 | 2006-09-27 | Федеральное государственное унитарное предприятие "25 Государственный научно-исследовательский институт Министерства обороны Российской Федерации" (по применению топлив, масел, смазок и специальных жидкостей-ГосНИИ по химмотологии) (ФГУП "25 ГосНИИ Минобороны России") | Реагентная индикаторная бумага для определения алюминия |
| US8043845B2 (en) * | 2006-09-20 | 2011-10-25 | American Sterilizer Company | Sterilization indicator |
| US8895239B2 (en) * | 2006-09-20 | 2014-11-25 | American Sterilizer Company | Genetically engineered biological indicator |
| US20080184927A1 (en) * | 2007-02-02 | 2008-08-07 | Paul Phong Anh Pham | Container cap for assuring quality |
| US7718125B2 (en) * | 2007-07-25 | 2010-05-18 | Dana Products Inc. | Sterilization challenge specimen holder |
| US7790105B2 (en) * | 2007-07-25 | 2010-09-07 | Dana Prodicts, Inc. | Sterilization challenge specimen holder |
| WO2009036303A1 (en) | 2007-09-12 | 2009-03-19 | David Spenciner | Finite and multiple sterilization indication method for devices |
| US8343437B2 (en) | 2008-06-04 | 2013-01-01 | Jp Laboratories, Inc. | Monitoring system based on etching of metals |
| JP5833920B2 (ja) | 2008-06-04 | 2015-12-16 | パテル,ジー | 金属のエッチングに基づくモニタリングシステム |
| US20100043694A1 (en) * | 2008-08-20 | 2010-02-25 | Patel Gordhanbhai N | Tamper evident indicating devices |
| US8173388B2 (en) * | 2008-09-30 | 2012-05-08 | American Sterilizer Company | Self-contained biological indicator |
| USD608455S1 (en) | 2008-09-30 | 2010-01-19 | American Sterilizer Company | Self-contained biological indicator |
| US8765398B2 (en) * | 2010-05-12 | 2014-07-01 | Mesa Laboratories, Inc. | Biological indicator with integral package |
| WO2012068240A2 (en) * | 2010-11-16 | 2012-05-24 | Symmetry Medical Manufacturing, Inc. | Apparatus and method for indicating biological content within a container |
| US9623134B1 (en) * | 2011-02-21 | 2017-04-18 | American Sterilizer Company | Sterilization test strip |
| US9265846B2 (en) * | 2012-11-28 | 2016-02-23 | American Sterilizer Company | Air removal test strip |
| US20140154150A1 (en) * | 2012-11-28 | 2014-06-05 | Dana Products, Inc. | Air removal test strip |
| KR20140126552A (ko) * | 2013-04-23 | 2014-10-31 | 인텔렉추얼디스커버리 주식회사 | 동결 표시기 |
| DE102013208332A1 (de) * | 2013-05-07 | 2014-11-13 | Aesculap Ag | Sterilanzeige durch Phasenwechsel |
| TWI624890B (zh) | 2013-08-22 | 2018-05-21 | Sakura Color Prod Corp | Indicator for electronic component manufacturing apparatus, and design and/or management method of the same |
| US9739757B2 (en) * | 2013-12-04 | 2017-08-22 | Temptime Corporation | Condition change labels |
| EP3100031A4 (en) | 2014-01-27 | 2017-09-20 | Jp Laboratories, Inc. | Indicating devices based on lateral diffusion of a mobile phase through a non-porous stationary phase |
| KR102342177B1 (ko) * | 2014-02-14 | 2021-12-21 | 사쿠라 컬러 프로덕츠 코포레이션 | 플라즈마 처리 감지 표시기 |
| US9360464B2 (en) * | 2014-03-05 | 2016-06-07 | American Sterilizer Company | Dual migrating indicator |
| US9354227B2 (en) * | 2014-03-05 | 2016-05-31 | American Sterilizer Company | Dual migrating indicator |
| JP6474390B2 (ja) | 2014-05-09 | 2019-02-27 | 株式会社サクラクレパス | 変色層として無機物質を使用したプラズマ処理検知インジケータ |
| CA2950094C (en) * | 2014-05-30 | 2021-11-09 | American Sterilizer Company | Air removal test strip |
| CA2998327A1 (en) | 2015-09-11 | 2017-03-16 | Stryker Corporation | Sterilization enclosure for surgical instruments |
| US10119946B2 (en) | 2016-04-22 | 2018-11-06 | American Sterilizer Company | Sterilization test strip |
| US10704077B2 (en) | 2017-07-24 | 2020-07-07 | American Sterilizer Company | Sterilization indicator with temperature indicator |
| CN107823684A (zh) * | 2017-11-17 | 2018-03-23 | 南京巨鲨显示科技有限公司 | 一种压力蒸汽灭菌化学指示片 |
| US11244439B2 (en) | 2018-03-20 | 2022-02-08 | 3M Innovative Properties Company | Vision system for status detection of wrapped packages |
| US10874759B2 (en) | 2018-03-20 | 2020-12-29 | 3M Innovative Properties Company | Sterilization process management |
| US11462319B2 (en) | 2018-03-20 | 2022-10-04 | 3M Innovative Properties Company | Sterilization process management |
| CN109395133A (zh) * | 2018-09-20 | 2019-03-01 | 南京巨鲨显示科技有限公司 | 一种压力蒸汽灭菌指示物及其制备方法 |
| WO2021053430A1 (en) | 2019-09-20 | 2021-03-25 | 3M Innovative Properties Company | High temperature sterilizable adhesive articles |
| US11951226B2 (en) | 2019-11-25 | 2024-04-09 | 3M Innovative Properties Company | Ethylene oxide sterilization sensor including acid-functional sorbent and method of use |
| MX2023013829A (es) * | 2021-05-27 | 2023-12-08 | Steris Corp | Indicador y lector del proceso de identificacion por radiofrecuencia. |
Family Cites Families (141)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1917048A (en) * | 1933-07-04 | Thomas midgufiy | ||
| US3018611A (en) * | 1962-01-30 | Timer device and method for determination | ||
| US161118A (en) * | 1875-03-23 | Improvement in lamp-wicks | ||
| US1703880A (en) * | 1929-03-05 | Thermoscope | ||
| CA917548A (en) | 1972-12-26 | C. Bhiwandker Nutan | Sterilization indicator material and tape containing the same | |
| US197902A (en) * | 1877-12-04 | Improvement in lamp-wicks | ||
| CA823264A (en) | 1969-09-16 | I. Edenbaum Martin | Steam induced color changing vinyl resin markings | |
| CA498481A (en) | 1953-12-15 | George E. Underwood, Jr. | Fusible thermometer | |
| US1000673A (en) * | 1911-01-20 | 1911-08-15 | Archibald W Diack | Pyrometer. |
| US1238123A (en) * | 1915-12-09 | 1917-08-28 | Allan A Freeman | Acid and alkali testing and indicating device. |
| US1191572A (en) * | 1916-05-24 | 1916-07-18 | Charles T Davis | Surgical package and method for indicating sterilization thereof. |
| US1441307A (en) * | 1919-12-18 | 1923-01-09 | Swanberg Julius | Temperature indicator |
| US1426569A (en) * | 1921-02-26 | 1922-08-22 | Alonzo P Ingram | Gummed tape |
| US1558153A (en) * | 1924-01-04 | 1925-10-20 | Karl A Ferkel | Temperature-indicating means |
| US1535536A (en) * | 1924-01-29 | 1925-04-28 | Macdonald Donald | Thermic telltale |
| US1676536A (en) * | 1925-08-26 | 1928-07-10 | Karl A Ferkel | Temperature-indicating means |
| US1788104A (en) * | 1930-05-31 | 1931-01-06 | Hargreaves Wilfrid | Sterilizing test device |
| US1843234A (en) * | 1931-03-24 | 1932-02-02 | James C Karnes | Testing sealed containers and method of testing containers |
| US1894015A (en) * | 1931-12-15 | 1933-01-10 | Wilburn F Bernstein | Septic indicator |
| US2118144A (en) * | 1932-08-05 | 1938-05-24 | Berman Phoebus | Sterilizing indicator and ink |
| US1951650A (en) * | 1932-10-19 | 1934-03-20 | Archibald W Diack | Pyrometer and casing therefor |
| US2046863A (en) * | 1934-03-19 | 1936-07-07 | Macgregor Instr Company | Means for indicating sterilizing temperatures |
| US2049867A (en) * | 1935-06-07 | 1936-08-04 | Rca Corp | Radio tube label |
| US2195395A (en) * | 1938-10-21 | 1940-04-02 | Chapman Arthur William | Means for indicating the extent of a thermal treatment |
| US2277278A (en) * | 1939-01-24 | 1942-03-24 | Stanley F Triplett | Indicator for frozen canned goods |
| US2278749A (en) * | 1939-02-09 | 1942-04-07 | American Seating Co | Chair arm |
| US2222067A (en) * | 1939-04-22 | 1940-11-19 | Phoebus Berman | Sterilizing indicator |
| US2308087A (en) * | 1940-03-06 | 1943-01-12 | Hansens Lab Inc | Temperature indicator |
| US2269038A (en) * | 1940-07-25 | 1942-01-06 | Nashua Gummed & Coated Paper | Temperature-indicating instrumentality |
| US2337534A (en) * | 1941-06-14 | 1943-12-28 | Alfred W Barber | Device for indicating exposure time of printed pages |
| US2335999A (en) * | 1941-07-31 | 1943-12-07 | Archibald W Diack | Pyrometer |
| GB551783A (en) | 1942-03-21 | 1943-03-09 | Dunlop Rubber Co | Improvements in indicating or recording temperature changes applicable to vulcanised or other heated articles |
| US2490933A (en) * | 1943-07-19 | 1949-12-13 | Earl L Tornquist | Temperature indicator |
| US2379459A (en) * | 1944-02-02 | 1945-07-03 | Schreiber Raymond Paul | Temperature indicator |
| US2606654A (en) * | 1945-04-19 | 1952-08-12 | American Viscose Corp | Package combined with sterilization indicator |
| GB602753A (en) | 1945-08-30 | 1948-06-02 | Republic Flow Meters Co | Improvements in or relating to temperature indicators |
| US2552477A (en) * | 1946-06-05 | 1951-05-08 | Cole James Webb | Temperature time integrator |
| US2460215A (en) * | 1946-07-08 | 1949-01-25 | Kenneth J Chase | Telltale for frozen food packages |
| US2567445A (en) * | 1946-08-21 | 1951-09-11 | Elizabeth W Parker | Method of measuring the ph of aqueous liquids, moist foodstuffs, and the like |
| GB647379A (en) | 1948-03-27 | 1950-12-13 | Gade Lab Ltd | Improvements in devices for indicating completion of sterilization |
| US2579738A (en) * | 1948-04-02 | 1951-12-25 | Hargreaves Wilfrid | Sterilizer test device |
| US2560537A (en) * | 1949-07-08 | 1951-07-17 | Ariel A Andersen | Defrosting indicator |
| US2614430A (en) * | 1950-02-01 | 1952-10-21 | Eastman Kodak Co | Temperature indicating device |
| US2677278A (en) * | 1950-03-21 | 1954-05-04 | Smith & Underwood | Fusible thermometer |
| US2716065A (en) * | 1951-06-04 | 1955-08-23 | Aseptic Thermo Indicator Compa | Telltale for frozen food packages |
| US2928791A (en) * | 1953-02-12 | 1960-03-15 | Joseph D Loconti | Temperature indicators |
| US2799167A (en) * | 1953-02-12 | 1957-07-16 | Joseph D Loconti | Temperature indicators |
| US2798856A (en) * | 1954-03-19 | 1957-07-09 | Baxter Don Inc | Steam sterilization indicator |
| US2798855A (en) * | 1954-03-19 | 1957-07-09 | Baxter Don Inc | Sterilization indicator |
| US2708896A (en) * | 1954-05-12 | 1955-05-24 | Millard F Smith | Indicating protective covers for pipe flanges and valves |
| US2889799A (en) * | 1955-01-20 | 1959-06-09 | Korpman Ralf | Temperature indicator |
| US2847067A (en) * | 1955-09-01 | 1958-08-12 | Hynson Westcott & Dunning Inc | Sterilization indicator |
| US2918893A (en) * | 1955-11-17 | 1959-12-29 | Clyde A Norton | Leakage indicator for liquid fuel systems |
| US2826073A (en) * | 1956-02-20 | 1958-03-11 | Aseptic Thermo Indicator Compa | Sterilization indicator |
| US2971852A (en) * | 1956-07-23 | 1961-02-14 | Schulein Joseph | Temperature telltale |
| US2850393A (en) * | 1956-07-23 | 1958-09-02 | Aseptic Thermo Indicator Compa | Frozen food telltale |
| US2854384A (en) * | 1956-09-17 | 1958-09-30 | John W Beakley | Method and apparatus for sterilizer tests and control |
| US2951764A (en) * | 1957-01-25 | 1960-09-06 | Kenneth J Chase | Signal device for food package |
| US2932971A (en) * | 1957-02-11 | 1960-04-19 | Gen Dynamics Corp | Temperature indicator |
| US3065083A (en) * | 1958-01-02 | 1962-11-20 | Albert E Gessler | Time-delay temperature indicator |
| US2915405A (en) * | 1958-03-17 | 1959-12-01 | Hammond Jr | Frozen food indicator |
| US3046786A (en) * | 1958-08-12 | 1962-07-31 | Honeywell Regulator Co | Condition responsive device |
| US3055759A (en) * | 1959-04-13 | 1962-09-25 | John C Busby | Temperature indicators |
| US3059474A (en) * | 1959-09-24 | 1962-10-23 | Gen Dynamics Corp | Temperature indicating device |
| GB889573A (en) | 1959-12-09 | 1962-02-21 | Macarthys Ltd | Improvements in or relating to indicating devices for heat treatment |
| US3047405A (en) * | 1960-01-25 | 1962-07-31 | William M Lauier | Indicators |
| US3067015A (en) * | 1960-01-29 | 1962-12-04 | Ray F Lawdermilt | Spoilage indicator for food containers |
| US3002385A (en) * | 1960-02-12 | 1961-10-03 | Pyrodyne Inc | Temperature indicator |
| US2998306A (en) * | 1960-04-15 | 1961-08-29 | Aseptic Thermo Indicator Compa | Telltale for ethylene oxide sterilization |
| US3114349A (en) * | 1960-04-25 | 1963-12-17 | Propper Mfg Company Inc | Sterilization indicators |
| GB910520A (en) | 1960-07-15 | 1962-11-14 | Ca Nat Research Council | Temperature responsive elements |
| US3098751A (en) * | 1960-07-18 | 1963-07-23 | Aseptic Thermo Indicator Compa | Printing ink composition for ethylene oxide sterilization indicators |
| US3465590A (en) * | 1960-08-22 | 1969-09-09 | Sybron Corp | Thermometer |
| US3118774A (en) * | 1960-09-01 | 1964-01-21 | Ca Nat Research Council | Detection of spoilage |
| US3078182A (en) * | 1960-09-09 | 1963-02-19 | Shuford Mills Inc | Color-changing pressure-sensitive adhesive indicator tapes |
| US3471422A (en) * | 1961-05-22 | 1969-10-07 | Tempil Corp | Time-temperature responsive color changing typographic printing ink composition |
| US3093242A (en) * | 1961-07-10 | 1963-06-11 | Aseptic Thermo Indicator Compa | Packaged article for ethylene oxide sterilization and subsequent storage |
| US3082624A (en) * | 1961-09-11 | 1963-03-26 | Honeywell Regulator Co | Condition responsive devices |
| NL286850A (enExample) * | 1961-12-18 | 1900-01-01 | ||
| US3243303A (en) * | 1962-06-27 | 1966-03-29 | Leighton C Johnson | Temperature monitor employing a flowable aqueous composition containing dispersed polyvinyl acetate as a flow retardant |
| US3205158A (en) * | 1962-10-04 | 1965-09-07 | Honeywell Inc | Condition responsive devices |
| US3242733A (en) * | 1963-07-02 | 1966-03-29 | Atlantic Res Corp | Indicator device |
| US3288718A (en) * | 1963-11-26 | 1966-11-29 | Us Envelope Co | Sterilization indicator coating |
| GB1027417A (en) * | 1964-03-09 | 1966-04-27 | Macarthys Ltd | Improvements in or relating to indicating devices for heat treatment |
| US3352794A (en) * | 1964-07-07 | 1967-11-14 | Boeing Co | Process for making a temperature sensitive color reversible pigment and resulting product |
| US3460964A (en) * | 1964-11-19 | 1969-08-12 | Eastman Kodak Co | Heat-sensitive recording element and composition |
| FR1461252A (fr) | 1964-12-24 | 1966-12-10 | Johnson & Johnson | Objet contenant un produit qui change de couleur par stérilisation à la vapeur d'eau et son procédé de fabrication |
| US3386807A (en) * | 1964-12-24 | 1968-06-04 | Johnson & Johnson | Indicator tape |
| US3311084A (en) * | 1964-12-24 | 1967-03-28 | Johnson & Johnson | Indicator tape |
| US3360338A (en) * | 1964-12-24 | 1967-12-26 | Johnson & Johnson | Indicator tape |
| US3360337A (en) * | 1964-12-24 | 1967-12-26 | Johnson & Johnson | Indicator tape |
| US3360339A (en) * | 1964-12-28 | 1967-12-26 | Johnson & Johnson | Indicator tape |
| GB1132334A (en) | 1964-12-28 | 1968-10-30 | E S & A Robinson Holdings Ltd | Steam autoclaving indicator ink |
| US3344670A (en) * | 1964-12-31 | 1967-10-03 | Ashland Oil Inc | Time/temperature integrators |
| US3440144A (en) * | 1965-05-21 | 1969-04-22 | Andersen Prod H W | Method and apparatus for checking and testing the effectiveness of sterilization |
| US3313266A (en) * | 1965-08-30 | 1967-04-11 | Propper Mfg Company Inc | Fusible pellet tube control |
| US3414415A (en) * | 1965-10-22 | 1968-12-03 | Robert L. Broad Jr. | Thaw indicator |
| US3437070A (en) * | 1966-01-28 | 1969-04-08 | Lloyd B Campbell | Temperature indicator |
| US3420205A (en) * | 1966-03-23 | 1969-01-07 | Miles Lab | Indicating device |
| DE1573279C3 (de) | 1966-12-19 | 1975-08-14 | Michel-Werke Kg, 8900 Augsburg | Vorrichtung zum Anzeigen einer kritischen Temperaturerhöhung |
| US3430491A (en) * | 1966-12-27 | 1969-03-04 | Leigh R Gignilliat | Disposable clinical thermometer |
| US3341238A (en) * | 1967-01-27 | 1967-09-12 | Propper Mfg Company Inc | Sterilization indicating devices and method of securing leader string thereto |
| US3846242A (en) | 1967-07-14 | 1974-11-05 | Sybron Corp | Biological sterility indicator and method for using same |
| GB1215891A (en) * | 1968-03-22 | 1970-12-16 | Roy Henry Maxwell | Indicators for steam sterilisation |
| US3523011A (en) * | 1968-05-07 | 1970-08-04 | Canadian Technical Tape Ltd | Sterilization indicator material and tape containing the same |
| US3479877A (en) * | 1968-08-28 | 1969-11-25 | Minnesota Mining & Mfg | Time-temperature indicator |
| US3580079A (en) * | 1969-03-06 | 1971-05-25 | Abbott Lab | Thermometer indicator |
| US3545400A (en) * | 1969-03-25 | 1970-12-08 | Von L Smith | Freeze and thaw indicator |
| US3597976A (en) * | 1969-07-03 | 1971-08-10 | Paul J Fryar | Clinical temperature bandage |
| US3684737A (en) | 1969-08-25 | 1972-08-15 | Mask Off Co | Coating composition for indicating sterilization |
| US3652249A (en) | 1969-08-26 | 1972-03-28 | Propper Mfg Co Inc | Apparatus for manufacutring assemblies of closed glass tubes each with a pellet therein |
| US3616898A (en) * | 1969-09-08 | 1971-11-02 | Abbott Lab | Peelable seal package |
| US3627469A (en) * | 1970-04-27 | 1971-12-14 | Kendall & Co | Exposure and sterilization indicators comprising substituted pyridines quinolines and/or isoquinolines |
| US3695903A (en) | 1970-05-04 | 1972-10-03 | American Standard Inc | Time/temperature indicators |
| US3661717A (en) | 1970-05-08 | 1972-05-09 | Minnesota Mining & Mfg | Unitary sterility indicator and method |
| US3665770A (en) | 1970-07-24 | 1972-05-30 | Bio Medical Sciences Inc | Temperature indicator |
| DE2134314C3 (de) | 1970-07-24 | 1978-08-31 | Bio-Medical Sciences, Inc., Fairfield, N.J. (V.St.A.) | Temperaturanzeiger |
| US3667916A (en) | 1970-11-17 | 1972-06-06 | Johnson & Johnson | Sterilization indicator |
| US3704985A (en) | 1971-03-04 | 1972-12-05 | Bio Medical Sciences Inc | Temperature indicator |
| US3718815A (en) | 1971-03-09 | 1973-02-27 | Gte Sylvania Inc | Photographic flashlamp unit with flashed lamp indicator and method of making same |
| US3768976A (en) | 1971-05-20 | 1973-10-30 | Us Army | Temperature-time integrating indicator |
| GB1367703A (en) * | 1971-08-22 | 1974-09-18 | Spezialfolien Leipzig Veb | Temperature indicating articles |
| US3843452A (en) | 1972-04-26 | 1974-10-22 | Miles Lab | Microbiological test article |
| GB1415782A (en) | 1973-02-10 | 1975-11-26 | Chapman A W | Means for indicating completion of sterilisation processes |
| US3954011A (en) | 1973-09-24 | 1976-05-04 | Minnesota Mining And Manufacturing Company | Selected time interval indicating device |
| DE2350441A1 (de) | 1973-10-08 | 1975-04-17 | Bernhard Nollen | Thermometer |
| US3962920A (en) | 1973-10-10 | 1976-06-15 | Minnesota Mining And Manufacturing Company | Reservoir pad for time indicator |
| US3942467A (en) | 1974-01-21 | 1976-03-09 | Bio-Medical Sciences, Inc. | Time temperature indicator |
| US3932134A (en) | 1974-10-16 | 1976-01-13 | Bio-Medical Sciences, Inc. | Time-temperature integrating indicator device |
| US3946611A (en) | 1974-05-14 | 1976-03-30 | Bio-Medical Sciences, Inc. | Time-temperature integrating indicator |
| US4042336A (en) * | 1974-05-14 | 1977-08-16 | Bio-Medical Sciences Inc. | Time temperature integrating indicator |
| US3862824A (en) | 1974-05-30 | 1975-01-28 | Arthur William Chapman | Means for indicating completion of sterilisation processes |
| US3935743A (en) | 1974-07-15 | 1976-02-03 | Brodie Donald E | Temperature indicators |
| US3981683A (en) * | 1975-04-14 | 1976-09-21 | Bio-Medical Sciences, Inc. | Temperature responsive sterility indicator |
| US4038873A (en) * | 1975-06-18 | 1977-08-02 | Big Three Industries, Inc. (Tempil Div.) | Temperature monitor and indicator |
| US4145186A (en) | 1976-10-04 | 1979-03-20 | H. W. Andersen Products Inc. | Sterilization detection device and method |
| US4179397A (en) | 1978-05-22 | 1979-12-18 | American Can Company | Indicator ink |
| US4195186A (en) | 1978-07-12 | 1980-03-25 | Gulf Research And Development Company | Process for preparing organic acids |
| US4382063A (en) | 1979-09-10 | 1983-05-03 | Parke-Davis Company | Sterile indicator device |
| US4333339A (en) | 1980-03-21 | 1982-06-08 | Akzona Incorporated | Steam trap monitor |
| US4410493A (en) | 1981-05-11 | 1983-10-18 | Sybron Corporation | Indicator device for use in steam sterilization |
-
1979
- 1979-06-11 US US06/047,955 patent/US4448548A/en not_active Ceased
-
1980
- 1980-01-28 CA CA000344525A patent/CA1148416A/en not_active Expired
- 1980-06-10 AT AT80200537T patent/ATE9763T1/de not_active IP Right Cessation
- 1980-06-10 DE DE8080200537T patent/DE3069406D1/de not_active Expired
- 1980-06-10 BR BR8003580A patent/BR8003580A/pt unknown
- 1980-06-10 AU AU59167/80A patent/AU537239B2/en not_active Ceased
- 1980-06-10 EP EP80200537A patent/EP0022284B1/en not_active Expired
- 1980-06-10 NO NO801728A patent/NO801728L/no unknown
- 1980-06-10 ES ES492283A patent/ES492283A0/es active Granted
- 1980-06-10 AR AR281367A patent/AR228257A1/es active
- 1980-06-10 DK DK249580A patent/DK249580A/da not_active Application Discontinuation
- 1980-06-11 JP JP7788480A patent/JPS565660A/ja active Granted
-
1991
- 1991-12-24 US US07/813,371 patent/USRE34515E/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS565660A (en) | 1981-01-21 |
| EP0022284B1 (en) | 1984-10-10 |
| BR8003580A (pt) | 1981-01-05 |
| ES8105571A1 (es) | 1981-06-16 |
| ATE9763T1 (de) | 1984-10-15 |
| CA1148416A (en) | 1983-06-21 |
| DE3069406D1 (en) | 1984-11-15 |
| AU5916780A (en) | 1980-12-18 |
| ES492283A0 (es) | 1981-06-16 |
| USRE34515E (en) | 1994-01-18 |
| NO801728L (no) | 1980-12-12 |
| DK249580A (da) | 1980-12-12 |
| AU537239B2 (en) | 1984-06-14 |
| US4448548A (en) | 1984-05-15 |
| AR228257A1 (es) | 1983-02-15 |
| EP0022284A1 (en) | 1981-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6351704B2 (enExample) | ||
| US3981683A (en) | Temperature responsive sterility indicator | |
| US5378430A (en) | Steam sterilization process monitor | |
| KR101190526B1 (ko) | 살균 처리 효과를 신속하게 측정하기 위한 통합기 시스템 및 방법 | |
| US4514361A (en) | Steam sterilization indicator | |
| CA3070180C (en) | Sterilization indicator with temperature indicator | |
| CA3021782C (en) | Compact sterilization indicator with multiple width wicking zones | |
| CA2940630C (en) | Dual migrating indicator | |
| CA1073327A (en) | Ethylene oxide indicator | |
| US9623134B1 (en) | Sterilization test strip | |
| CA1165188A (en) | Steam sterilization indicator | |
| US9360464B2 (en) | Dual migrating indicator | |
| Beck | A new instrument for measuring and for monitoring the time and temperature of steam sterilizers |