JPS6231706B2 - - Google Patents
Info
- Publication number
- JPS6231706B2 JPS6231706B2 JP52103127A JP10312777A JPS6231706B2 JP S6231706 B2 JPS6231706 B2 JP S6231706B2 JP 52103127 A JP52103127 A JP 52103127A JP 10312777 A JP10312777 A JP 10312777A JP S6231706 B2 JPS6231706 B2 JP S6231706B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- benzimidazole
- formula
- carbon atoms
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 144
- -1 acetoxymethyl group Chemical group 0.000 claims description 143
- 125000004432 carbon atom Chemical group C* 0.000 claims description 84
- 150000003839 salts Chemical class 0.000 claims description 75
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 68
- 125000000217 alkyl group Chemical group 0.000 claims description 50
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 49
- 238000000034 method Methods 0.000 claims description 48
- 239000002253 acid Substances 0.000 claims description 38
- 125000001424 substituent group Chemical group 0.000 claims description 27
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 26
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 19
- 125000005843 halogen group Chemical group 0.000 claims description 17
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 13
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 8
- 125000005042 acyloxymethyl group Chemical group 0.000 claims description 8
- 150000001721 carbon Chemical group 0.000 claims description 8
- AGZPIOULIKYWNV-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]butan-1-one Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(C)C(CO)=N2 AGZPIOULIKYWNV-UHFFFAOYSA-N 0.000 claims description 7
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical group NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- IMSLKRAVPGHJON-UHFFFAOYSA-N 5-butanoyl-1,6-dimethylbenzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(C)C(C(O)=O)=N2 IMSLKRAVPGHJON-UHFFFAOYSA-N 0.000 claims description 5
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 5
- WFNJKISRXLEQLJ-UHFFFAOYSA-N ethyl 5-butanoyl-1,6-dimethylbenzimidazole-2-carboxylate Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(C)C(C(=O)OCC)=N2 WFNJKISRXLEQLJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 139
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 136
- 239000000203 mixture Substances 0.000 description 127
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 126
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 99
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 95
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 93
- 238000002844 melting Methods 0.000 description 73
- 230000008018 melting Effects 0.000 description 73
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 67
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 57
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 49
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 44
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 43
- 239000000706 filtrate Substances 0.000 description 42
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 41
- 239000007858 starting material Substances 0.000 description 38
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 34
- 238000006243 chemical reaction Methods 0.000 description 34
- 229910052938 sodium sulfate Inorganic materials 0.000 description 34
- 235000011152 sodium sulphate Nutrition 0.000 description 34
- 235000019439 ethyl acetate Nutrition 0.000 description 31
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 25
- 239000000284 extract Substances 0.000 description 25
- 239000002244 precipitate Substances 0.000 description 25
- 238000003756 stirring Methods 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 20
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 239000007868 Raney catalyst Substances 0.000 description 18
- 229910000564 Raney nickel Inorganic materials 0.000 description 18
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 18
- 239000012299 nitrogen atmosphere Substances 0.000 description 18
- 239000012286 potassium permanganate Substances 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- 229910052739 hydrogen Inorganic materials 0.000 description 17
- 239000001257 hydrogen Substances 0.000 description 17
- 239000000725 suspension Substances 0.000 description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 15
- 239000003054 catalyst Substances 0.000 description 15
- 238000001816 cooling Methods 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 14
- 239000003795 chemical substances by application Substances 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000005909 Kieselgur Substances 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 12
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 12
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 125000004093 cyano group Chemical group *C#N 0.000 description 11
- 230000003301 hydrolyzing effect Effects 0.000 description 11
- 239000003208 petroleum Substances 0.000 description 11
- 239000012071 phase Substances 0.000 description 11
- 230000008569 process Effects 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 10
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- 239000002775 capsule Substances 0.000 description 10
- 238000000354 decomposition reaction Methods 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 10
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 229920002472 Starch Polymers 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- PDQHWNXMXSPSPN-UHFFFAOYSA-N 5-butanoyl-6-methyl-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N=C(C(O)=O)N2 PDQHWNXMXSPSPN-UHFFFAOYSA-N 0.000 description 8
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 230000009471 action Effects 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- 239000008101 lactose Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 239000003960 organic solvent Substances 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- 150000001340 alkali metals Chemical class 0.000 description 7
- 229910021529 ammonia Inorganic materials 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 239000003109 Disodium ethylene diamine tetraacetate Substances 0.000 description 6
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 6
- YZGQDNOIGFBYKF-UHFFFAOYSA-N Ethoxyacetic acid Chemical compound CCOCC(O)=O YZGQDNOIGFBYKF-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 125000004423 acyloxy group Chemical group 0.000 description 6
- 229960000686 benzalkonium chloride Drugs 0.000 description 6
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 238000007796 conventional method Methods 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- 235000019301 disodium ethylene diamine tetraacetate Nutrition 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 6
- 230000032050 esterification Effects 0.000 description 6
- 238000005886 esterification reaction Methods 0.000 description 6
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- 239000011707 mineral Substances 0.000 description 6
- 229910017604 nitric acid Inorganic materials 0.000 description 6
- 229920001223 polyethylene glycol Polymers 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- AAPFFANIUXBDKG-UHFFFAOYSA-N 1-[1-butyl-2-(hydroxymethyl)-6-methylbenzimidazol-5-yl]butan-1-one Chemical compound CCCC(=O)C1=C(C)C=C2N(CCCC)C(CO)=NC2=C1 AAPFFANIUXBDKG-UHFFFAOYSA-N 0.000 description 5
- WDTPOCJYJMCQCC-UHFFFAOYSA-N 1-[1-ethyl-2-(hydroxymethyl)-6-methylbenzimidazol-5-yl]butan-1-one Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(CC)C(CO)=N2 WDTPOCJYJMCQCC-UHFFFAOYSA-N 0.000 description 5
- XPHORMZHZGHMTR-UHFFFAOYSA-N 1-[2-(ethoxymethyl)-6-methyl-1h-benzimidazol-5-yl]butan-1-one Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N=C(COCC)N2 XPHORMZHZGHMTR-UHFFFAOYSA-N 0.000 description 5
- IFXWUSRZNMTTRQ-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1-methylbenzimidazol-5-yl]butan-1-one Chemical compound CCCC(=O)C1=CC=C2N(C)C(CO)=NC2=C1 IFXWUSRZNMTTRQ-UHFFFAOYSA-N 0.000 description 5
- CDHIAFMPEFFVPV-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1-methylbenzimidazol-5-yl]ethanone Chemical compound CC(=O)C1=CC=C2N(C)C(CO)=NC2=C1 CDHIAFMPEFFVPV-UHFFFAOYSA-N 0.000 description 5
- CCZYTPDGSKQGJZ-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-6-methyl-1h-benzimidazol-5-yl]butan-1-one Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N=C(CO)N2 CCZYTPDGSKQGJZ-UHFFFAOYSA-N 0.000 description 5
- AGQHHQQMBHLVTR-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-6-methyl-1h-benzimidazol-5-yl]pentan-1-one Chemical compound C1=C(C)C(C(=O)CCCC)=CC2=C1N=C(CO)N2 AGQHHQQMBHLVTR-UHFFFAOYSA-N 0.000 description 5
- 108010010803 Gelatin Proteins 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- OONMKRWGOWNJHC-UHFFFAOYSA-N ethyl 5-butanoyl-6-methyl-1h-benzimidazole-2-carboxylate Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N=C(C(=O)OCC)N2 OONMKRWGOWNJHC-UHFFFAOYSA-N 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 239000008273 gelatin Substances 0.000 description 5
- 229920000159 gelatin Polymers 0.000 description 5
- 235000019322 gelatine Nutrition 0.000 description 5
- 235000011852 gelatine desserts Nutrition 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical group O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 230000001590 oxidative effect Effects 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 235000019698 starch Nutrition 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- IMZHEOIOBUYAKR-UHFFFAOYSA-N (5-butanoyl-1,6-dimethylbenzimidazol-2-yl)methyl acetate Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(C)C(COC(C)=O)=N2 IMZHEOIOBUYAKR-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- XXLJYJANQKYLHY-UHFFFAOYSA-N 1,6-dimethyl-5-pentanoylbenzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CCCC)=CC2=C1N(C)C(C(O)=O)=N2 XXLJYJANQKYLHY-UHFFFAOYSA-N 0.000 description 4
- NFIRTKRVCXLTHP-UHFFFAOYSA-N 1-[1-butyl-2-(hydroxymethyl)benzimidazol-5-yl]ethanone Chemical compound CC(=O)C1=CC=C2N(CCCC)C(CO)=NC2=C1 NFIRTKRVCXLTHP-UHFFFAOYSA-N 0.000 description 4
- QYKRHDMHFWQSMC-UHFFFAOYSA-N 1-[2-(ethoxymethyl)-1,6-dimethylbenzimidazol-5-yl]butan-1-one Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(C)C(COCC)=N2 QYKRHDMHFWQSMC-UHFFFAOYSA-N 0.000 description 4
- HNKMUFMFSIXTAQ-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-6-methoxy-1-methylbenzimidazol-5-yl]butan-1-one Chemical compound C1=C(OC)C(C(=O)CCC)=CC2=C1N(C)C(CO)=N2 HNKMUFMFSIXTAQ-UHFFFAOYSA-N 0.000 description 4
- QRZDNLPRAFTOJI-UHFFFAOYSA-N 1-[6-chloro-2-(hydroxymethyl)-1-methylbenzimidazol-5-yl]butan-1-one Chemical compound C1=C(Cl)C(C(=O)CCC)=CC2=C1N(C)C(CO)=N2 QRZDNLPRAFTOJI-UHFFFAOYSA-N 0.000 description 4
- AXFLCECAQXDCFY-UHFFFAOYSA-N 1-[6-hydroxy-2-(hydroxymethyl)-1-methylbenzimidazol-5-yl]butan-1-one Chemical compound C1=C(O)C(C(=O)CCC)=CC2=C1N(C)C(CO)=N2 AXFLCECAQXDCFY-UHFFFAOYSA-N 0.000 description 4
- YMDVEBHCAVEDJE-UHFFFAOYSA-N 5-acetyl-1-butylbenzimidazole-2-carboxylic acid Chemical compound CC(=O)C1=CC=C2N(CCCC)C(C(O)=O)=NC2=C1 YMDVEBHCAVEDJE-UHFFFAOYSA-N 0.000 description 4
- RARVLJSWAWTBKS-UHFFFAOYSA-N 5-acetyl-1-methylbenzimidazole-2-carboxylic acid Chemical compound CC(=O)C1=CC=C2N(C)C(C(O)=O)=NC2=C1 RARVLJSWAWTBKS-UHFFFAOYSA-N 0.000 description 4
- QMVICRPFLIELLI-UHFFFAOYSA-N 5-butanoyl-1-ethyl-6-methylbenzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(CC)C(C(O)=O)=N2 QMVICRPFLIELLI-UHFFFAOYSA-N 0.000 description 4
- JRSOAKLTEKSJFM-UHFFFAOYSA-N 5-butanoyl-1-methylbenzimidazole-2-carboxylic acid Chemical compound CCCC(=O)C1=CC=C2N(C)C(C(O)=O)=NC2=C1 JRSOAKLTEKSJFM-UHFFFAOYSA-N 0.000 description 4
- RJJQCWQNUPJMOW-UHFFFAOYSA-N 5-butanoyl-6-chloro-1-methylbenzimidazole-2-carboxylic acid Chemical compound C1=C(Cl)C(C(=O)CCC)=CC2=C1N(C)C(C(O)=O)=N2 RJJQCWQNUPJMOW-UHFFFAOYSA-N 0.000 description 4
- JQOMGULPNDLUMY-UHFFFAOYSA-N 6-methyl-5-pentanoyl-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CCCC)=CC2=C1N=C(C(O)=O)N2 JQOMGULPNDLUMY-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 4
- 125000005907 alkyl ester group Chemical group 0.000 description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 4
- 125000004414 alkyl thio group Chemical group 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- FFSAXUULYPJSKH-UHFFFAOYSA-N butyrophenone Chemical compound CCCC(=O)C1=CC=CC=C1 FFSAXUULYPJSKH-UHFFFAOYSA-N 0.000 description 4
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 4
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- IODPUBGVJXJAAN-UHFFFAOYSA-N cyclopropyl-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]methanone Chemical compound CC1=CC=2N(C)C(CO)=NC=2C=C1C(=O)C1CC1 IODPUBGVJXJAAN-UHFFFAOYSA-N 0.000 description 4
- FFYPMLJYZAEMQB-UHFFFAOYSA-N diethyl pyrocarbonate Chemical compound CCOC(=O)OC(=O)OCC FFYPMLJYZAEMQB-UHFFFAOYSA-N 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 238000006266 etherification reaction Methods 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 229910052748 manganese Inorganic materials 0.000 description 4
- 239000011572 manganese Substances 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- 235000000346 sugar Nutrition 0.000 description 4
- 230000000699 topical effect Effects 0.000 description 4
- 229940100445 wheat starch Drugs 0.000 description 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 3
- CMNAZHJTWNZKGB-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]pentan-1-one Chemical compound C1=C(C)C(C(=O)CCCC)=CC2=C1N(C)C(CO)=N2 CMNAZHJTWNZKGB-UHFFFAOYSA-N 0.000 description 3
- JHBNAMDGOYKRLD-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]pentane-1-thione Chemical compound C1=C(C)C(C(=S)CCCC)=CC2=C1N(C)C(CO)=N2 JHBNAMDGOYKRLD-UHFFFAOYSA-N 0.000 description 3
- GHOVEVDMOMCZPF-UHFFFAOYSA-N 1-[2-[2-(dimethylamino)ethoxymethyl]-1,6-dimethylbenzimidazol-5-yl]butan-1-one Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(C)C(COCCN(C)C)=N2 GHOVEVDMOMCZPF-UHFFFAOYSA-N 0.000 description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 3
- MWFJMXGEHRFRLN-UHFFFAOYSA-N 4-chloro-2-methyl-2-nitro-1-phenylbutan-1-one Chemical compound ClCCC(C)([N+]([O-])=O)C(=O)C1=CC=CC=C1 MWFJMXGEHRFRLN-UHFFFAOYSA-N 0.000 description 3
- JPPIGIXNTLLSID-UHFFFAOYSA-N 5-(cyclopropanecarbonyl)-1,6-dimethylbenzimidazole-2-carboxylic acid Chemical compound CC1=CC=2N(C)C(C(O)=O)=NC=2C=C1C(=O)C1CC1 JPPIGIXNTLLSID-UHFFFAOYSA-N 0.000 description 3
- GUKRJGCKQBHQQB-UHFFFAOYSA-N 5-(cyclopropanecarbonyl)-6-methyl-1h-benzimidazole-2-carboxylic acid Chemical compound CC1=CC=2N=C(C(O)=O)NC=2C=C1C(=O)C1CC1 GUKRJGCKQBHQQB-UHFFFAOYSA-N 0.000 description 3
- DDTHFBOSMDXPHY-UHFFFAOYSA-N 5-[4-(benzenesulfinyl)butanoyl]-6-methyl-1h-benzimidazole-2-carboxylic acid Chemical compound CC1=CC=2N=C(C(O)=O)NC=2C=C1C(=O)CCCS(=O)C1=CC=CC=C1 DDTHFBOSMDXPHY-UHFFFAOYSA-N 0.000 description 3
- UZSGSGBNMHCDAF-UHFFFAOYSA-N 5-acetyl-6-methyl-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)C)=CC2=C1N=C(C(O)=O)N2 UZSGSGBNMHCDAF-UHFFFAOYSA-N 0.000 description 3
- RESKQVBHGBIQFO-UHFFFAOYSA-N 5-butanoyl-1-butylbenzimidazole-2-carboxylic acid Chemical compound CCCC(=O)C1=CC=C2N(CCCC)C(C(O)=O)=NC2=C1 RESKQVBHGBIQFO-UHFFFAOYSA-N 0.000 description 3
- YOXFOFOOPGNOAT-UHFFFAOYSA-N 5-butanoyl-6-chloro-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(Cl)C(C(=O)CCC)=CC2=C1N=C(C(O)=O)N2 YOXFOFOOPGNOAT-UHFFFAOYSA-N 0.000 description 3
- FEDDXAWBWDVIOL-UHFFFAOYSA-N 5-butanoyl-6-hydroxy-1-methylbenzimidazole-2-carboxylic acid Chemical compound C1=C(O)C(C(=O)CCC)=CC2=C1N(C)C(C(O)=O)=N2 FEDDXAWBWDVIOL-UHFFFAOYSA-N 0.000 description 3
- GKZGNFSJGQOBSI-UHFFFAOYSA-N 6-butanoyl-5-methoxy-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(OC)C(C(=O)CCC)=CC2=C1N=C(C(O)=O)N2 GKZGNFSJGQOBSI-UHFFFAOYSA-N 0.000 description 3
- QUPONANMOFTOPJ-UHFFFAOYSA-N 6-methyl-5-(4-methylsulfinylbutanoyl)-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(C(=O)CCCS(C)=O)C(C)=CC2=C1NC(C(O)=O)=N2 QUPONANMOFTOPJ-UHFFFAOYSA-N 0.000 description 3
- BOVPEPACCLBXFU-UHFFFAOYSA-N 6-methyl-5-(4-phenylbutanethioyl)-1h-benzimidazole-2-carboxylic acid Chemical compound CC1=CC=2N=C(C(O)=O)NC=2C=C1C(=S)CCCC1=CC=CC=C1 BOVPEPACCLBXFU-UHFFFAOYSA-N 0.000 description 3
- IKNFQVQQHAGYBL-UHFFFAOYSA-N 6-methyl-5-pentanethioyl-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=S)CCCC)=CC2=C1N=C(C(O)=O)N2 IKNFQVQQHAGYBL-UHFFFAOYSA-N 0.000 description 3
- JDVKKNOYEGFCJX-UHFFFAOYSA-N 6-methyl-5-propanoyl-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CC)=CC2=C1N=C(C(O)=O)N2 JDVKKNOYEGFCJX-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- 244000215068 Acacia senegal Species 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 101100294102 Caenorhabditis elegans nhr-2 gene Proteins 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- 229920000084 Gum arabic Polymers 0.000 description 3
- 206010020751 Hypersensitivity Diseases 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- FGDQGDKNTTYGQH-UHFFFAOYSA-N [2-(hydroxymethyl)-1-methylbenzimidazol-5-yl]-phenylmethanone Chemical compound C=1C=C2N(C)C(CO)=NC2=CC=1C(=O)C1=CC=CC=C1 FGDQGDKNTTYGQH-UHFFFAOYSA-N 0.000 description 3
- 235000010489 acacia gum Nutrition 0.000 description 3
- 239000000205 acacia gum Substances 0.000 description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 3
- 208000026935 allergic disease Diseases 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- 239000006196 drop Substances 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 3
- GEXKZWSEGAYLRI-UHFFFAOYSA-N ethyl 5-butanoyl-1-methylbenzimidazole-2-carboxylate Chemical compound CCCC(=O)C1=CC=C2N(C)C(C(=O)OCC)=NC2=C1 GEXKZWSEGAYLRI-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 229910001385 heavy metal Inorganic materials 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 125000003884 phenylalkyl group Chemical group 0.000 description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 230000002335 preservative effect Effects 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 150000003460 sulfonic acids Chemical class 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 150000003626 triacylglycerols Chemical class 0.000 description 3
- BEXNUSWSAKHHAK-UHFFFAOYSA-N (3-chlorophenyl)-(2-methylcyclopropyl)methanone Chemical compound CC1CC1C(=O)C1=CC=CC(Cl)=C1 BEXNUSWSAKHHAK-UHFFFAOYSA-N 0.000 description 2
- YBDBYPQFIMSFJW-UHFFFAOYSA-N (4-chloro-3-nitrophenyl)-phenylmethanone Chemical compound C1=C(Cl)C([N+](=O)[O-])=CC(C(=O)C=2C=CC=CC=2)=C1 YBDBYPQFIMSFJW-UHFFFAOYSA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- BWKAYBPLDRWMCJ-UHFFFAOYSA-N 1,1-diethoxy-n,n-dimethylmethanamine Chemical compound CCOC(N(C)C)OCC BWKAYBPLDRWMCJ-UHFFFAOYSA-N 0.000 description 2
- FXCJYMLJTUZGDU-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)butan-1-one Chemical compound CCCC(=O)C1=CC=C(Cl)C=C1Cl FXCJYMLJTUZGDU-UHFFFAOYSA-N 0.000 description 2
- FUOFMMGRWPPDQX-UHFFFAOYSA-N 1-(2-chloro-1,1,2-trifluoroethyl)benzimidazole Chemical class C1=CC=C2N(C(F)(F)C(Cl)F)C=NC2=C1 FUOFMMGRWPPDQX-UHFFFAOYSA-N 0.000 description 2
- YEVPHFIFGUWSMG-UHFFFAOYSA-N 1-(4-chloro-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 YEVPHFIFGUWSMG-UHFFFAOYSA-N 0.000 description 2
- OSOUNOBYRMOXQQ-UHFFFAOYSA-N 1-chloro-3-methylbenzene Chemical compound CC1=CC=CC(Cl)=C1 OSOUNOBYRMOXQQ-UHFFFAOYSA-N 0.000 description 2
- RHXSYTACTOMVLJ-UHFFFAOYSA-N 1H-benzimidazole-2-carboxylic acid Chemical class C1=CC=C2NC(C(=O)O)=NC2=C1 RHXSYTACTOMVLJ-UHFFFAOYSA-N 0.000 description 2
- LXFQSRIDYRFTJW-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C(C)=C1 LXFQSRIDYRFTJW-UHFFFAOYSA-N 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- RXTITFHNXYHRGA-UHFFFAOYSA-N 2-nitro-1-phenylpentan-1-one Chemical compound CCCC([N+]([O-])=O)C(=O)C1=CC=CC=C1 RXTITFHNXYHRGA-UHFFFAOYSA-N 0.000 description 2
- UVLYAAGVAKIMDT-UHFFFAOYSA-N 3,4-diamino-1-phenylpentan-1-one Chemical compound CC(N)C(N)CC(=O)C1=CC=CC=C1 UVLYAAGVAKIMDT-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- QOHPAHPPMQUNGP-UHFFFAOYSA-N 3-chloro-2-methyl-2-nitro-1-phenylbutan-1-one Chemical compound CC(Cl)C(C)([N+]([O-])=O)C(=O)C1=CC=CC=C1 QOHPAHPPMQUNGP-UHFFFAOYSA-N 0.000 description 2
- YBPZIBAPHZOXQQ-UHFFFAOYSA-N 4-amino-3-nitro-1-phenylbutan-1-one Chemical compound NCC([N+]([O-])=O)CC(=O)C1=CC=CC=C1 YBPZIBAPHZOXQQ-UHFFFAOYSA-N 0.000 description 2
- IDVRANFLJHDQIH-UHFFFAOYSA-N 4-chloro-1-phenylpentan-1-one Chemical compound CC(Cl)CCC(=O)C1=CC=CC=C1 IDVRANFLJHDQIH-UHFFFAOYSA-N 0.000 description 2
- VBPIQNBMJNSMPK-UHFFFAOYSA-N 4-chloro-2-methyl-1-phenylheptan-1-one Chemical compound CCCC(Cl)CC(C)C(=O)C1=CC=CC=C1 VBPIQNBMJNSMPK-UHFFFAOYSA-N 0.000 description 2
- FICVTFVMCXTAOK-UHFFFAOYSA-N 4-chloro-2-methyl-1-phenylpentan-1-one Chemical compound CC(Cl)CC(C)C(=O)C1=CC=CC=C1 FICVTFVMCXTAOK-UHFFFAOYSA-N 0.000 description 2
- ZDGXAZCSSHIPLR-UHFFFAOYSA-N 4-chloro-2-methyl-5-nitro-1-phenylheptan-1-one Chemical compound CCC([N+]([O-])=O)C(Cl)CC(C)C(=O)C1=CC=CC=C1 ZDGXAZCSSHIPLR-UHFFFAOYSA-N 0.000 description 2
- NSGPCFAOXGNZOI-UHFFFAOYSA-N 4-chloro-2-methyl-5-nitro-1-phenylpentan-1-one Chemical compound [O-][N+](=O)CC(Cl)CC(C)C(=O)C1=CC=CC=C1 NSGPCFAOXGNZOI-UHFFFAOYSA-N 0.000 description 2
- HLYZRIRSOMBXAN-UHFFFAOYSA-N 4-chloro-3-nitro-1-phenylpentan-1-one Chemical compound CC(Cl)C([N+]([O-])=O)CC(=O)C1=CC=CC=C1 HLYZRIRSOMBXAN-UHFFFAOYSA-N 0.000 description 2
- UNOMDUDPBICQQK-UHFFFAOYSA-N 5-(4-methoxybutanoyl)-6-methyl-1h-benzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CCCOC)=CC2=C1N=C(C(O)=O)N2 UNOMDUDPBICQQK-UHFFFAOYSA-N 0.000 description 2
- LKWXLIXKZRYWND-UHFFFAOYSA-N 5-(cyclohexanecarbonyl)-6-methyl-1h-benzimidazole-2-carboxylic acid Chemical compound CC1=CC=2N=C(C(O)=O)NC=2C=C1C(=O)C1CCCCC1 LKWXLIXKZRYWND-UHFFFAOYSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- ZLNANJQCJANXGQ-UHFFFAOYSA-N [2-(hydroxymethyl)-3h-benzimidazol-5-yl]-phenylmethanone Chemical compound C=1C=C2NC(CO)=NC2=CC=1C(=O)C1=CC=CC=C1 ZLNANJQCJANXGQ-UHFFFAOYSA-N 0.000 description 2
- KFACFOHGKLDYOR-UHFFFAOYSA-N [3-amino-4-(methylamino)phenyl]-(2-methylcyclopropyl)methanone Chemical compound NC=1C(=CC=C(C=1)C(=O)C1C(C1)C)NC KFACFOHGKLDYOR-UHFFFAOYSA-N 0.000 description 2
- MBIKSTPZGCWPLJ-UHFFFAOYSA-N [4-(methylamino)-3-nitrophenyl]-(2-methylcyclopropyl)methanone Chemical compound CC1C(C1)C(=O)C1=CC=C(C(=C1)[N+](=O)[O-])NC MBIKSTPZGCWPLJ-UHFFFAOYSA-N 0.000 description 2
- FFJICZMWZQXOLC-UHFFFAOYSA-N [4-(methylamino)-3-nitrophenyl]-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1C(=O)C1=CC=CC=C1 FFJICZMWZQXOLC-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 230000003266 anti-allergic effect Effects 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical compound [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 125000004984 dialkylaminoalkoxy group Chemical group 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- 239000010685 fatty oil Substances 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 210000004051 gastric juice Anatomy 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 2
- 230000009610 hypersensitivity Effects 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229940041682 inhalant solution Drugs 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- CELWCAITJAEQNL-UHFFFAOYSA-N oxan-2-ol Chemical compound OC1CCCCO1 CELWCAITJAEQNL-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 210000002345 respiratory system Anatomy 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003797 solvolysis reaction Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000002511 suppository base Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- LYNLMSYCBSCQEF-UHFFFAOYSA-N thian-2-ol Chemical compound OC1CCCCS1 LYNLMSYCBSCQEF-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- YJGRCQPSXYULTO-UHFFFAOYSA-N thiolan-2-ol Chemical compound OC1CCCS1 YJGRCQPSXYULTO-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- BDOKVSSACRXBAL-UHFFFAOYSA-N (2-chlorocyclopropyl)-(4-methyl-3-nitrophenyl)methanone Chemical compound ClC1C(C1)C(=O)C1=CC=C(C(=C1)[N+](=O)[O-])C BDOKVSSACRXBAL-UHFFFAOYSA-N 0.000 description 1
- NCOOMUPYVHBELO-UHFFFAOYSA-N (2-chlorocyclopropyl)-(4-methylphenyl)methanone Chemical compound C1=CC(C)=CC=C1C(=O)C1C(Cl)C1 NCOOMUPYVHBELO-UHFFFAOYSA-N 0.000 description 1
- UJHSIDUUJPTLDY-UHFFFAOYSA-N (2-nitrophenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 UJHSIDUUJPTLDY-UHFFFAOYSA-N 0.000 description 1
- RXCOGDYOZQGGMK-UHFFFAOYSA-N (3,4-diaminophenyl)-phenylmethanone Chemical compound C1=C(N)C(N)=CC=C1C(=O)C1=CC=CC=C1 RXCOGDYOZQGGMK-UHFFFAOYSA-N 0.000 description 1
- CQJSHKQCFNJVJV-UHFFFAOYSA-N (4-chloro-2-methylphenyl)-cyclopropylmethanone Chemical compound CC1=CC(Cl)=CC=C1C(=O)C1CC1 CQJSHKQCFNJVJV-UHFFFAOYSA-N 0.000 description 1
- HCBZGUQHXPLIKD-UHFFFAOYSA-N (4-chloro-3-nitrophenyl)-(2-methylcyclopropyl)methanone Chemical compound ClC1=CC=C(C=C1[N+](=O)[O-])C(=O)C1C(C1)C HCBZGUQHXPLIKD-UHFFFAOYSA-N 0.000 description 1
- 150000000180 1,2-diols Chemical class 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- WDCYWAQPCXBPJA-UHFFFAOYSA-N 1,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1 WDCYWAQPCXBPJA-UHFFFAOYSA-N 0.000 description 1
- VKGPFQJSMSDNPS-UHFFFAOYSA-N 1,6-dimethyl-5-(2-methylpropanoyl)benzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)C(C)C)=CC2=C1N(C)C(C(O)=O)=N2 VKGPFQJSMSDNPS-UHFFFAOYSA-N 0.000 description 1
- SVSVRCSFZBAGQJ-UHFFFAOYSA-N 1,6-dimethyl-5-propanoylbenzimidazole-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)CC)=CC2=C1N(C)C(C(O)=O)=N2 SVSVRCSFZBAGQJ-UHFFFAOYSA-N 0.000 description 1
- SZTMZXIKPMNFEU-UHFFFAOYSA-N 1-(3,4-diamino-2-methylphenyl)pentan-1-one Chemical compound CCCCC(=O)C1=CC=C(N)C(N)=C1C SZTMZXIKPMNFEU-UHFFFAOYSA-N 0.000 description 1
- HJLRYDBRORTQIU-UHFFFAOYSA-N 1-(3-nitrophenyl)butan-1-one Chemical compound CCCC(=O)C1=CC=CC([N+]([O-])=O)=C1 HJLRYDBRORTQIU-UHFFFAOYSA-N 0.000 description 1
- BUZYGTVTZYSBCU-UHFFFAOYSA-N 1-(4-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C=C1 BUZYGTVTZYSBCU-UHFFFAOYSA-N 0.000 description 1
- QUIAPSGBAXIITH-UHFFFAOYSA-N 1-[2-(ethoxymethyl)-1,6-dimethylbenzimidazol-5-yl]butan-1-ol Chemical compound C1=C(C)C(C(O)CCC)=CC2=C1N(C)C(COCC)=N2 QUIAPSGBAXIITH-UHFFFAOYSA-N 0.000 description 1
- OYAREECSDULSQY-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]-2-methylbutan-1-one Chemical compound C1=C(C)C(C(=O)C(C)CC)=CC2=C1N(C)C(CO)=N2 OYAREECSDULSQY-UHFFFAOYSA-N 0.000 description 1
- LXCIDNKNFXOVRN-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]-2-methylpropan-1-one Chemical compound C1=C(C)C(C(=O)C(C)C)=CC2=C1N(C)C(CO)=N2 LXCIDNKNFXOVRN-UHFFFAOYSA-N 0.000 description 1
- NLVTWCWFZXYHLK-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]-3-methylbutan-1-one Chemical compound C1=C(C)C(C(=O)CC(C)C)=CC2=C1N(C)C(CO)=N2 NLVTWCWFZXYHLK-UHFFFAOYSA-N 0.000 description 1
- WSYBQVHZJANIRI-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1,6-dimethylbenzimidazol-5-yl]propan-1-one Chemical compound C1=C(C)C(C(=O)CC)=CC2=C1N(C)C(CO)=N2 WSYBQVHZJANIRI-UHFFFAOYSA-N 0.000 description 1
- RLTMSDVXYNAINF-UHFFFAOYSA-N 1-[3-amino-6-methyl-2-(methylamino)phenyl]butan-1-ol Chemical compound CCCC(O)C1=C(C)C=CC(N)=C1NC RLTMSDVXYNAINF-UHFFFAOYSA-N 0.000 description 1
- AYRBHTOSHJHALD-UHFFFAOYSA-N 1-amino-2-methylpropan-1-ol Chemical compound CC(C)C(N)O AYRBHTOSHJHALD-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- LDKSCZJUIURGMW-UHFFFAOYSA-N 1-isothiocyanato-3-methylsulfanylpropane Chemical group CSCCCN=C=S LDKSCZJUIURGMW-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- IAJLTMBBAVVMQO-UHFFFAOYSA-N 1h-benzimidazol-2-ylmethanol Chemical compound C1=CC=C2NC(CO)=NC2=C1 IAJLTMBBAVVMQO-UHFFFAOYSA-N 0.000 description 1
- FGRJGEWVJCCOJJ-UHFFFAOYSA-N 2,2-dimethylaziridine Chemical compound CC1(C)CN1 FGRJGEWVJCCOJJ-UHFFFAOYSA-N 0.000 description 1
- OXBLVCZKDOZZOJ-UHFFFAOYSA-N 2,3-Dihydrothiophene Chemical compound C1CC=CS1 OXBLVCZKDOZZOJ-UHFFFAOYSA-N 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- HZLCGUXUOFWCCN-UHFFFAOYSA-N 2-hydroxynonadecane-1,2,3-tricarboxylic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C(O)(C(O)=O)CC(O)=O HZLCGUXUOFWCCN-UHFFFAOYSA-N 0.000 description 1
- RJQVOSLUITZNKS-UHFFFAOYSA-N 2-methyl-4-(methylamino)-5-nitro-1-phenylpentan-1-one Chemical compound [O-][N+](=O)CC(NC)CC(C)C(=O)C1=CC=CC=C1 RJQVOSLUITZNKS-UHFFFAOYSA-N 0.000 description 1
- GENIBHVFBNANQD-UHFFFAOYSA-N 2-nitro-1-phenylbutan-1-one Chemical compound CCC([N+]([O-])=O)C(=O)C1=CC=CC=C1 GENIBHVFBNANQD-UHFFFAOYSA-N 0.000 description 1
- JTWHVBNYYWFXSI-UHFFFAOYSA-N 2-nitro-1-phenylethanone Chemical compound [O-][N+](=O)CC(=O)C1=CC=CC=C1 JTWHVBNYYWFXSI-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- ATVJJNGVPSKBGO-UHFFFAOYSA-N 3,4-dihydro-2h-thiopyran Chemical compound C1CSC=CC1 ATVJJNGVPSKBGO-UHFFFAOYSA-N 0.000 description 1
- FGMRHNYMZYMARX-UHFFFAOYSA-N 3-amino-2-nitrobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1[N+]([O-])=O FGMRHNYMZYMARX-UHFFFAOYSA-N 0.000 description 1
- CCWHCCHRNBYJRZ-UHFFFAOYSA-N 4,5-dimethyl-1h-benzimidazole-2-carboxylic acid Chemical compound CC1=CC=C2NC(C(O)=O)=NC2=C1C CCWHCCHRNBYJRZ-UHFFFAOYSA-N 0.000 description 1
- BAZZFNRUYYSKQQ-UHFFFAOYSA-N 4-amino-2-methyl-5-nitro-1-phenylpentan-1-one Chemical compound [O-][N+](=O)CC(N)CC(C)C(=O)C1=CC=CC=C1 BAZZFNRUYYSKQQ-UHFFFAOYSA-N 0.000 description 1
- LYLPRVUTJGLNPP-UHFFFAOYSA-N 4-amino-2-methylpentan-2-ol Chemical compound CC(N)CC(C)(C)O LYLPRVUTJGLNPP-UHFFFAOYSA-N 0.000 description 1
- XSBBIIJOHBNDGV-UHFFFAOYSA-N 4-amino-3-nitro-1-phenylpentan-1-one Chemical compound CC(N)C([N+]([O-])=O)CC(=O)C1=CC=CC=C1 XSBBIIJOHBNDGV-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- LVUZJZOTQYETIW-UHFFFAOYSA-N 4-butanoyl-1,6-dimethylbenzimidazole-2-carboxylic acid Chemical compound CCCC(=O)C1=CC(C)=CC2=C1N=C(C(O)=O)N2C LVUZJZOTQYETIW-UHFFFAOYSA-N 0.000 description 1
- GHEFQKHLHFXSBR-UHFFFAOYSA-N 4-chloro-1-phenylbutan-1-one Chemical compound ClCCCC(=O)C1=CC=CC=C1 GHEFQKHLHFXSBR-UHFFFAOYSA-N 0.000 description 1
- GRNUQNSPBUFODU-UHFFFAOYSA-N 4-chloro-3-nitro-1-phenylbutan-1-one Chemical compound [O-][N+](=O)C(CCl)CC(=O)C1=CC=CC=C1 GRNUQNSPBUFODU-UHFFFAOYSA-N 0.000 description 1
- YQYCDPZKAOARRI-UHFFFAOYSA-N 4-methoxythian-4-ol Chemical compound COC1(O)CCSCC1 YQYCDPZKAOARRI-UHFFFAOYSA-N 0.000 description 1
- DLGUWNCNEGCFAV-UHFFFAOYSA-N 4-methoxythiane Chemical compound COC1CCSCC1 DLGUWNCNEGCFAV-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- ZBJICUWWYTVRHV-UHFFFAOYSA-N 5-benzoyl-1-methylbenzimidazole-2-carboxylic acid Chemical compound C=1C=C2N(C)C(C(O)=O)=NC2=CC=1C(=O)C1=CC=CC=C1 ZBJICUWWYTVRHV-UHFFFAOYSA-N 0.000 description 1
- LAALFDPCHOQGFZ-UHFFFAOYSA-N 5-butanoyl-6-methoxy-1-methylbenzimidazole-2-carboxylic acid Chemical compound C1=C(OC)C(C(=O)CCC)=CC2=C1N(C)C(C(O)=O)=N2 LAALFDPCHOQGFZ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241001465677 Ancylostomatoidea Species 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000005973 Carvone Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 206010010741 Conjunctivitis Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 241001126259 Nippostrongylus brasiliensis Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- SFVWUAIFCISEEK-UHFFFAOYSA-N [3-amino-4-(methylamino)phenyl]-phenylmethanone Chemical compound C1=C(N)C(NC)=CC=C1C(=O)C1=CC=CC=C1 SFVWUAIFCISEEK-UHFFFAOYSA-N 0.000 description 1
- DGYIJVNZSDYBOE-UHFFFAOYSA-N [CH2]C1=CC=NC=C1 Chemical group [CH2]C1=CC=NC=C1 DGYIJVNZSDYBOE-UHFFFAOYSA-N 0.000 description 1
- UQRKYTFOFYASRJ-UHFFFAOYSA-N [Mg].BrBr Chemical compound [Mg].BrBr UQRKYTFOFYASRJ-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000012445 acidic reagent Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 238000005273 aeration Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229940040563 agaric acid Drugs 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 description 1
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- CDSGJHCARATGKG-UHFFFAOYSA-N bis(3-methylbutyl)borane Chemical compound CC(C)CCBCCC(C)C CDSGJHCARATGKG-UHFFFAOYSA-N 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 229910010277 boron hydride Inorganic materials 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical class [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940065285 cadmium compound Drugs 0.000 description 1
- 150000001662 cadmium compounds Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- UUAGAQFQZIEFAH-UHFFFAOYSA-N chlorotrifluoroethylene Chemical compound FC(F)=C(F)Cl UUAGAQFQZIEFAH-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000003426 co-catalyst Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000012045 crude solution Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical class OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 125000002474 dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 238000007323 disproportionation reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- UESSEMPSSAXQJC-UHFFFAOYSA-N ethanol;methanamine Chemical compound NC.CCO UESSEMPSSAXQJC-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- OKOVEHLSBNFOHB-UHFFFAOYSA-N ethyl 2-bromo-2-oxoacetate Chemical compound CCOC(=O)C(Br)=O OKOVEHLSBNFOHB-UHFFFAOYSA-N 0.000 description 1
- OWZFULPEVHKEKS-UHFFFAOYSA-N ethyl 2-chloro-2-oxoacetate Chemical compound CCOC(=O)C(Cl)=O OWZFULPEVHKEKS-UHFFFAOYSA-N 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 208000024711 extrinsic asthma Diseases 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000010855 food raising agent Nutrition 0.000 description 1
- ULITUPMHIDVLLV-UHFFFAOYSA-N formonitrile;sodium Chemical compound [Na].N#C ULITUPMHIDVLLV-UHFFFAOYSA-N 0.000 description 1
- 125000002425 furfuryl group Chemical group C(C1=CC=CO1)* 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 230000003862 health status Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 201000010659 intrinsic asthma Diseases 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002497 iodine compounds Chemical class 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- GCICAPWZNUIIDV-UHFFFAOYSA-N lithium magnesium Chemical compound [Li].[Mg] GCICAPWZNUIIDV-UHFFFAOYSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- LZFCBBSYZJPPIV-UHFFFAOYSA-M magnesium;hexane;bromide Chemical compound [Mg+2].[Br-].CCCCC[CH2-] LZFCBBSYZJPPIV-UHFFFAOYSA-M 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- GXYAGIBEGZNHHD-UHFFFAOYSA-N methyl 5-butanoyl-6-methyl-1h-benzimidazole-2-carboxylate Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N=C(C(=O)OC)N2 GXYAGIBEGZNHHD-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 235000010603 pastilles Nutrition 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 210000004303 peritoneum Anatomy 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- AFDMODCXODAXLC-UHFFFAOYSA-N phenylmethanimine Chemical compound N=CC1=CC=CC=C1 AFDMODCXODAXLC-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- FVMYAKCVQFMFRV-UHFFFAOYSA-N propan-2-yl 5-butanoyl-1,6-dimethylbenzimidazole-2-carboxylate Chemical compound C1=C(C)C(C(=O)CCC)=CC2=C1N(C)C(C(=O)OC(C)C)=N2 FVMYAKCVQFMFRV-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 1
- 150000004819 silanols Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000012439 solid excipient Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229940032330 sulfuric acid Drugs 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- AAPLIUHOKVUFCC-UHFFFAOYSA-N trimethylsilanol Chemical compound C[Si](C)(C)O AAPLIUHOKVUFCC-UHFFFAOYSA-N 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- XKGLSKVNOSHTAD-UHFFFAOYSA-N valerophenone Chemical class CCCCC(=O)C1=CC=CC=C1 XKGLSKVNOSHTAD-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/12—Radicals substituted by oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/26—Psychostimulants, e.g. nicotine, cocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/14—Decongestants or antiallergics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/16—Otologicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/807—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen all halogen atoms bound to the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/813—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen polycyclic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Pulmonology (AREA)
- Neurology (AREA)
- Ophthalmology & Optometry (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Immunology (AREA)
- Psychiatry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU75684A LU75684A1 (enPDFPhase) | 1976-08-27 | 1976-08-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5328172A JPS5328172A (en) | 1978-03-16 |
| JPS6231706B2 true JPS6231706B2 (enPDFPhase) | 1987-07-09 |
Family
ID=19728336
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP10312777A Granted JPS5328172A (en) | 1976-08-27 | 1977-08-27 | Preparation of acylated heterocyclic carboxylic acid |
Country Status (32)
| Country | Link |
|---|---|
| US (3) | US4141982A (enPDFPhase) |
| JP (1) | JPS5328172A (enPDFPhase) |
| AR (6) | AR224610A1 (enPDFPhase) |
| AT (1) | AT359060B (enPDFPhase) |
| AU (1) | AU517209B2 (enPDFPhase) |
| BE (1) | BE858157A (enPDFPhase) |
| CA (1) | CA1098526A (enPDFPhase) |
| CH (8) | CH631973A5 (enPDFPhase) |
| DD (1) | DD132735A5 (enPDFPhase) |
| DE (1) | DE2737462A1 (enPDFPhase) |
| DK (1) | DK381277A (enPDFPhase) |
| ES (7) | ES461906A1 (enPDFPhase) |
| FI (1) | FI68230C (enPDFPhase) |
| FR (1) | FR2362841A1 (enPDFPhase) |
| GB (2) | GB1595913A (enPDFPhase) |
| GR (1) | GR72908B (enPDFPhase) |
| HK (1) | HK93784A (enPDFPhase) |
| HU (2) | HU186765B (enPDFPhase) |
| IE (1) | IE45665B1 (enPDFPhase) |
| IL (1) | IL52820A (enPDFPhase) |
| LU (1) | LU75684A1 (enPDFPhase) |
| MY (1) | MY8500936A (enPDFPhase) |
| NL (1) | NL7709471A (enPDFPhase) |
| NO (1) | NO148488C (enPDFPhase) |
| NZ (1) | NZ185035A (enPDFPhase) |
| OA (1) | OA05753A (enPDFPhase) |
| PL (4) | PL112665B1 (enPDFPhase) |
| PT (1) | PT66947B (enPDFPhase) |
| SE (1) | SE434397B (enPDFPhase) |
| SG (1) | SG70784G (enPDFPhase) |
| SU (7) | SU882410A3 (enPDFPhase) |
| ZA (1) | ZA775182B (enPDFPhase) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4312873A (en) * | 1978-09-29 | 1982-01-26 | Syntex (U.S.A.) Inc. | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
| US4322431A (en) * | 1979-02-09 | 1982-03-30 | Ciba-Geigy Corporation | Pharmaceutical preparations containing benzimidazole 2-derivatives |
| US4492708A (en) * | 1982-09-27 | 1985-01-08 | Eli Lilly And Company | Antiviral benzimidazoles |
| EP0277402B1 (en) * | 1987-02-03 | 1991-09-11 | W.R. Grace & Co.-Conn. | Biocide |
| JPH04197628A (ja) * | 1990-11-28 | 1992-07-17 | Sekisui Chem Co Ltd | 壁パネルの製造方法 |
| US5216003A (en) * | 1992-01-02 | 1993-06-01 | G. D. Searle & Co. | Diacid-containing benzimidazole compounds for treatment of neurotoxic injury |
| FR2751649B1 (fr) * | 1996-07-26 | 1998-08-28 | Adir | Nouveaux derives de benzimidazole, de benzoxazole et de benzothiazole, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| RU2430091C1 (ru) * | 2010-03-15 | 2011-09-27 | Учреждение Российской академии наук Институт химии и химической технологии Сибирского отделения РАН (ИХХТ СО РАН) | Способ получения 2,2-дизамещенных-4,5-бензо-циклопентадииминов-1,3 |
| US9663703B2 (en) | 2014-04-25 | 2017-05-30 | James George Clements | Method and compositions for enhanced oil recovery |
| CN109467512B (zh) * | 2018-12-18 | 2021-06-08 | 苏州开元民生科技股份有限公司 | 一种3,4-二氨基-二苯甲酮的合成方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB766749A (en) | 1954-01-11 | 1957-01-23 | Aschaffenburger Zellstoffwerke | Benzimidazole cobalamines and process for their preparation and separation |
| US3318889A (en) * | 1963-10-14 | 1967-05-09 | S B Penick & Company | 2-benzimidazole carbamates |
| DE1923481A1 (de) * | 1969-05-08 | 1970-11-12 | Hoechst Ag | Verfahren zur Herstellung von Amiden und Estern der 1-Hydroxy-benzimidazol-2-carbonsaeure |
| NL7013343A (enPDFPhase) * | 1969-09-26 | 1971-03-30 | ||
| BE759237A (fr) * | 1969-11-21 | 1971-05-01 | Montedison Spa | Procede de preparation d'amides a partir de composes heterocycliques azotes |
| BE792402A (fr) * | 1971-12-07 | 1973-06-07 | Ciba Geigy | Composes heterocycliques azotes et medicaments anthelminthiqueset antimicrobiens qui en contiennent |
| US4026936A (en) * | 1975-08-07 | 1977-05-31 | Hoffmann-La Roche Inc. | Anthelmintic pyridine and thiazole substituted benzimidazole carbamates |
-
1976
- 1976-08-27 LU LU75684A patent/LU75684A1/xx unknown
-
1977
- 1977-08-01 HU HU811133A patent/HU186765B/hu unknown
- 1977-08-01 HU HU77CI1761A patent/HU180700B/hu unknown
- 1977-08-18 US US05/825,630 patent/US4141982A/en not_active Expired - Lifetime
- 1977-08-19 DE DE19772737462 patent/DE2737462A1/de not_active Ceased
- 1977-08-22 PT PT66947A patent/PT66947B/pt unknown
- 1977-08-23 DD DD7700200697A patent/DD132735A5/xx unknown
- 1977-08-24 OA OA56266A patent/OA05753A/xx unknown
- 1977-08-25 FI FI772521A patent/FI68230C/fi not_active IP Right Cessation
- 1977-08-25 PL PL1977213906A patent/PL112665B1/pl unknown
- 1977-08-25 IL IL52820A patent/IL52820A/xx unknown
- 1977-08-25 GB GB35710/77A patent/GB1595913A/en not_active Expired
- 1977-08-25 CH CH1040177A patent/CH631973A5/de not_active IP Right Cessation
- 1977-08-25 PL PL1977206452A patent/PL108853B1/pl unknown
- 1977-08-25 PL PL1977200449A patent/PL105527B1/pl not_active IP Right Cessation
- 1977-08-25 GB GB17219/80A patent/GB1595914A/en not_active Expired
- 1977-08-25 PL PL1977211468A patent/PL110215B1/pl unknown
- 1977-08-25 FR FR7725938A patent/FR2362841A1/fr active Granted
- 1977-08-25 CA CA285,456A patent/CA1098526A/en not_active Expired
- 1977-08-26 GR GR54237A patent/GR72908B/el unknown
- 1977-08-26 NO NO772962A patent/NO148488C/no unknown
- 1977-08-26 NZ NZ185035A patent/NZ185035A/xx unknown
- 1977-08-26 SE SE7709615A patent/SE434397B/xx not_active IP Right Cessation
- 1977-08-26 DK DK381277A patent/DK381277A/da not_active Application Discontinuation
- 1977-08-26 ZA ZA00775182A patent/ZA775182B/xx unknown
- 1977-08-26 AU AU28255/77A patent/AU517209B2/en not_active Expired
- 1977-08-26 SU SU772513755A patent/SU882410A3/ru active
- 1977-08-26 BE BE180470A patent/BE858157A/xx not_active IP Right Cessation
- 1977-08-26 NL NL7709471A patent/NL7709471A/xx not_active Application Discontinuation
- 1977-08-26 AT AT620677A patent/AT359060B/de not_active IP Right Cessation
- 1977-08-26 ES ES461906A patent/ES461906A1/es not_active Expired
- 1977-08-26 IE IE1779/77A patent/IE45665B1/en unknown
- 1977-08-27 JP JP10312777A patent/JPS5328172A/ja active Granted
- 1977-08-29 AR AR268986A patent/AR224610A1/es active
-
1978
- 1978-06-26 SU SU782627856A patent/SU745365A3/ru active
- 1978-07-13 ES ES471690A patent/ES471690A1/es not_active Expired
- 1978-07-13 ES ES471687A patent/ES471687A1/es not_active Expired
- 1978-07-13 ES ES471689A patent/ES471689A1/es not_active Expired
- 1978-07-13 ES ES471686A patent/ES471686A1/es not_active Expired
- 1978-07-13 ES ES471688A patent/ES471688A1/es not_active Expired
- 1978-11-16 SU SU782685605A patent/SU843744A3/ru active
- 1978-11-16 SU SU782685606A patent/SU831074A3/ru active
- 1978-11-16 SU SU782685604A patent/SU923368A3/ru active
- 1978-11-20 US US05/962,426 patent/US4213993A/en not_active Expired - Lifetime
-
1979
- 1979-01-15 SU SU792708672A patent/SU888819A3/ru active
- 1979-01-15 SU SU792707652A patent/SU784766A3/ru active
- 1979-01-18 AR AR275219A patent/AR222318A1/es active
- 1979-01-18 AR AR275220A patent/AR231536A1/es active
- 1979-01-18 AR AR275222A patent/AR227621A1/es active
- 1979-01-18 AR AR275218A patent/AR230990A1/es active
- 1979-01-18 AR AR275221A patent/AR225889A1/es active
- 1979-04-02 ES ES79479189A patent/ES8106706A1/es not_active Expired
- 1979-12-28 US US06/107,980 patent/US4344957A/en not_active Expired - Lifetime
-
1981
- 1981-09-30 CH CH630581A patent/CH631974A5/de not_active IP Right Cessation
- 1981-10-01 CH CH630481A patent/CH632749A5/de not_active IP Right Cessation
- 1981-10-13 CH CH653881A patent/CH631975A5/de not_active IP Right Cessation
- 1981-10-13 CH CH653681A patent/CH632253A5/de not_active IP Right Cessation
-
1982
- 1982-03-23 CH CH177582A patent/CH634305A5/de not_active IP Right Cessation
- 1982-07-27 CH CH455682A patent/CH637121A5/de not_active IP Right Cessation
- 1982-07-27 CH CH455582A patent/CH637120A5/de not_active IP Right Cessation
-
1984
- 1984-10-05 SG SG707/84A patent/SG70784G/en unknown
- 1984-11-29 HK HK937/84A patent/HK93784A/xx unknown
-
1985
- 1985-12-30 MY MY936/85A patent/MY8500936A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3094452B2 (ja) | 7−(2−アミノエチル)−ベンゾチアゾロン | |
| AU756221B2 (en) | 2-aminopyridine derivatives, their use as medicines and pharmaceutical compositions containing them | |
| EP0658559A1 (de) | Thienothiazinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als 5-dipoxygenase und Cyclooxygenaseinhibitoren | |
| JPH0236163A (ja) | 新規なヒドロキサメート誘導体 | |
| JP2004509855A (ja) | TNFαインヒビターとして有用なクマリン誘導体 | |
| EP0266558A2 (de) | 5-Alkylbenzimidazole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| US4535092A (en) | Acylanilides having antiandrogenic activity | |
| DE69430752T2 (de) | Tetracyclische verbindungen | |
| JPS6231706B2 (enPDFPhase) | ||
| EP0181136B1 (en) | Oxindole antiinflammatory agents | |
| JPS6216949B2 (enPDFPhase) | ||
| JPH07107047B2 (ja) | 新規ヘテロ環式化合物及びその製法 | |
| HU203350B (en) | Process for producing antiinflammatory tricyclic oxindole derivatives | |
| CA1244436A (en) | 4-quinolone derivatives | |
| JPH05221991A (ja) | ベンゼンスルホンアミド誘導体 | |
| EP0398413A1 (en) | "3,4-dehydropiperidine derivatives having psychotropic activity | |
| JP2009509996A (ja) | Cb2受容体および/または5−ht6受容体との結合能を有するキノリン化合物 | |
| JPH07505394A (ja) | 橋渡しビスアリールカルビノール誘導体,組成物および使用法 | |
| JPH05262761A (ja) | アリールアルキルアミン誘導体 | |
| EP0657459A1 (de) | Neue Thienothiazinderivate, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Antiinflammatorikum und Analgeticum | |
| JP2002544270A (ja) | ベンゾフラニルスルホネート類 | |
| US20080070946A1 (en) | Hydroxymethylbenzothiazoles Amides | |
| EP0072961A1 (de) | 1-Phenylindazol-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0000574B1 (de) | Benzimidazol-2-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Arzneimitteln | |
| KR20040062663A (ko) | Ccr-3 수용체 길항제 ⅶ |