IE38172B1 - Cephalosporin compounds - Google Patents
Cephalosporin compoundsInfo
- Publication number
- IE38172B1 IE38172B1 IE644/72A IE64472A IE38172B1 IE 38172 B1 IE38172 B1 IE 38172B1 IE 644/72 A IE644/72 A IE 644/72A IE 64472 A IE64472 A IE 64472A IE 38172 B1 IE38172 B1 IE 38172B1
- Authority
- IE
- Ireland
- Prior art keywords
- syn
- group
- compounds
- anti isomers
- organic group
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title abstract 2
- -1 Cephalosporin compounds Chemical class 0.000 title abstract 2
- 229940124587 cephalosporin Drugs 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 150000002148 esters Chemical class 0.000 abstract 2
- 125000000962 organic group Chemical group 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 abstract 2
- GSSHOWKSLFTGFK-KGMSYRRLSA-N (6R)-7-isocyanato-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylic acid Chemical compound N(=C=O)C1[C@@H]2N(C=CC(S2)C(=O)O)C1=O GSSHOWKSLFTGFK-KGMSYRRLSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 125000005518 carboxamido group Chemical group 0.000 abstract 1
- 150000001735 carboxylic acids Chemical class 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
- 238000000926 separation method Methods 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/14—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/81—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Oncology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1508271A GB1399086A (en) | 1971-05-14 | 1971-05-14 | Cephalosporin compounds |
| GB4588471 | 1971-10-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE38172L IE38172L (en) | 1972-11-14 |
| IE38172B1 true IE38172B1 (en) | 1978-01-18 |
Family
ID=26251025
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE644/72A IE38172B1 (en) | 1971-05-14 | 1972-05-12 | Cephalosporin compounds |
Country Status (22)
| Country | Link |
|---|---|
| JP (3) | JPS531280B1 (enExample) |
| AT (1) | AT336786B (enExample) |
| BE (1) | BE783449A (enExample) |
| CA (1) | CA1027554A (enExample) |
| CH (1) | CH591497A5 (enExample) |
| CS (2) | CS245753B2 (enExample) |
| CY (1) | CY971A (enExample) |
| DE (2) | DE2223375C2 (enExample) |
| DK (1) | DK155187C (enExample) |
| ES (2) | ES402651A1 (enExample) |
| FR (2) | FR2137900B1 (enExample) |
| GB (1) | GB1399086A (enExample) |
| HK (1) | HK66078A (enExample) |
| IE (1) | IE38172B1 (enExample) |
| IL (1) | IL39429A (enExample) |
| KE (1) | KE2895A (enExample) |
| MY (1) | MY7800466A (enExample) |
| NL (1) | NL166688C (enExample) |
| NO (1) | NO154797C (enExample) |
| PH (1) | PH11205A (enExample) |
| SE (1) | SE457795B (enExample) |
| YU (2) | YU41807B (enExample) |
Families Citing this family (121)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4064346A (en) * | 1971-05-14 | 1977-12-20 | Glaxo Laboratories Limited | 3-Acetoxymethyl-7β-(2-carboxy-methoxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
| GB1445979A (en) * | 1972-10-25 | 1976-08-11 | Glaxo Lab Ltd | Cephalosporin derivatives |
| US4033950A (en) * | 1971-05-14 | 1977-07-05 | Glaxo Laboratories Limited | 3-Hydroxymethyl-7β-(2-alkoxy-or benzyloxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
| US4138555A (en) | 1971-05-14 | 1979-02-06 | Glaxo Laboratories, Limited | (6R,7R)-7-[2-aryl-2-(etherified oximino)acetamido]-3-carbamoyloxymethylceph-3-em-4-carboxylic acid 1-oxides |
| GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
| US4079178A (en) * | 1971-05-14 | 1978-03-14 | Glaxo Laboratories Limited | Cephalosporins having (α-etherified oximino) acylamido groups at the 7-position |
| AR207341A1 (es) * | 1973-03-15 | 1976-09-30 | Fujisawa Pharmaceutical Co | Un procedimiento para la preparacion de derivados de acido 2-alquil-2 o 3-cefem-4-carboxilico |
| US4144392A (en) | 1973-12-21 | 1979-03-13 | Glaxo Laboratories Limited | Cephalosporins having at position-7 a carboxy substituted α-etherified hydroxyimino-arylacetamido group and at position-3 the residue of a sulphur nucleophile |
| US4095021A (en) | 1973-12-21 | 1978-06-13 | Glaxo Laboratories Limited | 3-Carbamoyloxymethyl or N-methyl-carbamoyloxymethyl-7-[2-carboxymethoxyimino-2-(fur-2-yl or thien-2-yl)acetamido]ceph-3-em-4-carboxylic acids and derivatives thereof |
| IL46302A (en) * | 1973-12-21 | 1978-09-29 | Glaxo Lab Ltd | 7 -( -(etherified oxyimino)-acylamido)cephalosporanic acid derivatives |
| GB1512957A (en) * | 1974-08-23 | 1978-06-01 | Glaxo Lab Ltd | Gephalosporin antibiotics |
| DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
| GB1522140A (en) * | 1974-12-20 | 1978-08-23 | Glaxo Lab Ltd | Syn-7-(2-hydroxyiminoacetamido)-3-pyridiniummethyl cephalosporins methods for their preparation and compositions containing them |
| US4200746A (en) | 1974-12-20 | 1980-04-29 | Glaxo Laboratories, Ltd. | Cephalosporins |
| US4143166A (en) * | 1975-02-04 | 1979-03-06 | Fujisawa Pharmaceutical Co., Ltd. | 7[(2-Hydroxyamino-2-disubstituted phenyl-acetamido)-]3-heterocyclicthio-3-cephem-4-carboxylic acids |
| GB1555471A (en) * | 1975-06-19 | 1979-11-14 | Glaxo Lab Ltd | 7 carbamoylalkoxyimino acetamido 3 em 4 carboxylic acidsand derivatives thereof |
| SE440655B (sv) * | 1976-01-23 | 1985-08-12 | Roussel Uclaf | Sett att framstella nya oximderivat av 7-amino-tiazolyl-acetamido-cefalosporansyra |
| IE44888B1 (en) * | 1976-03-09 | 1982-05-05 | Fujisawa Pharmaceutical Co | 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation theroef |
| US4165430A (en) | 1976-03-19 | 1979-08-21 | Glaxo Laboratories Limited | Cephalosporins having a 7-carboxy substituted α-etherified oximinoarylacetamido) group |
| FR2345153A1 (fr) * | 1976-03-25 | 1977-10-21 | Roussel Uclaf | Nouvelles alcoyloximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
| DK162391C (da) * | 1976-04-12 | 1992-03-09 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af syn-isomerer af 3,7-disubstituerede 3-cephem-4-carboxylsyreforbindelser |
| DE2715385A1 (de) * | 1976-04-14 | 1977-11-10 | Takeda Chemical Industries Ltd | Cephalosporinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel |
| US4278670A (en) * | 1976-07-12 | 1981-07-14 | Smithkline Corporation | 7-Alpha-oxyiminoacylcephalosporins |
| US4066762A (en) * | 1976-07-12 | 1978-01-03 | Smithkline Corporation | Derivatives of 7-(2-substituted-2-hydroxyiminoacetamido)-3-(1-substituted tetrazol-5-ylthiomethyl-3-cephem-4-carboxylic acid |
| FR2361895A1 (fr) * | 1976-08-20 | 1978-03-17 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-carbamoyloxymethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| GB1592149A (en) * | 1976-10-08 | 1981-07-01 | Fujisawa Pharmaceutical Co | 3 7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for preparation thereof |
| FR2381053A1 (fr) * | 1977-02-18 | 1978-09-15 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-thiadiazolyl thiomethyl 7-aminothiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| JPS53103493A (en) * | 1977-02-18 | 1978-09-08 | Takeda Chem Ind Ltd | Cephalosporin derivatives and process for their preparation |
| FR2384779A1 (fr) * | 1977-03-25 | 1978-10-20 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-chloro ou 3-methoxy 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| SE439312B (sv) | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| DE2716677C2 (de) * | 1977-04-15 | 1985-10-10 | Hoechst Ag, 6230 Frankfurt | Cephemderivate und Verfahren zu ihrer Herstellung |
| NL7805715A (nl) * | 1977-06-03 | 1978-12-05 | Hoffmann La Roche | Werkwijze voor het bereiden van acylderivaten. |
| IT1192287B (it) * | 1977-11-14 | 1988-03-31 | Fujisawa Pharmaceutical Co | Derivati di acido cefalosporanico ad azione farmaceutica e relativo procedimento di preparazione |
| SE445350B (sv) * | 1978-04-14 | 1986-06-16 | Roussel Uclaf | Oximderivat av 3-azidometyl-7-amino-tiazolyl-acetamido-cefalosporansyra och dess anvendning som antibiotika |
| FR2438051A2 (fr) * | 1978-10-05 | 1980-04-30 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-azidomethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| AR229883A1 (es) | 1978-05-26 | 1983-12-30 | Glaxo Group Ltd | Procedimiento para la preparacion de antibiotico(6r,7r)-7-((z)-2-(2-aminotiazol-4-il)-2-(2-carboxiprop-2-oxiimino)-acetamido)-3-(1-piridinometil)-cef-3-em-4-carboxilato |
| DE2822861A1 (de) * | 1978-05-26 | 1979-11-29 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| DE2822860A1 (de) * | 1978-05-26 | 1979-11-29 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| US4268509A (en) * | 1978-07-10 | 1981-05-19 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds and processes for preparation thereof |
| US4284631A (en) * | 1978-07-31 | 1981-08-18 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted cephem compounds and pharmaceutical antibacterial compositions containing them |
| CA1136616A (en) * | 1978-11-15 | 1982-11-30 | Glaxo Group Limited | Cephalosporin antibiotics |
| DE2914327A1 (de) * | 1979-04-09 | 1980-10-30 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| EP0088454B1 (en) * | 1979-09-03 | 1986-03-05 | Fujisawa Pharmaceutical Co., Ltd. | New starting compounds for preparing cephem compounds and processes for their preparation |
| US4341777A (en) * | 1979-09-10 | 1982-07-27 | Glaxo Group Limited | Cephalosporin antibiotic |
| DE3069364D1 (en) * | 1979-10-12 | 1984-11-08 | Fujisawa Pharmaceutical Co | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them |
| EP0104671B1 (fr) * | 1980-02-18 | 1990-05-23 | Roussel-Uclaf | Nouvelles oximes dérivées de l'acide 3-alkyloxy ou 3-alkylthiométhyl-7 amino thiazolylacétamido céphalosporaniques, leur préparation, leur application comme médicaments et les compositions les renfermant |
| FR2476087A1 (fr) * | 1980-02-18 | 1981-08-21 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-alkyloxy ou 3-alkyl-thiomethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| EP0037797A3 (de) * | 1980-03-11 | 1981-12-16 | Ciba-Geigy Ag | Cephalosporinverbindungen, Verfahren zu ihrer Herstellung, sie enthaltende pharmazeutische Zusammensetzungen und ihre Verwendung |
| GR75644B (enExample) * | 1980-06-18 | 1984-08-02 | Fujisawa Pharmaceutical Co | |
| ZA813787B (en) * | 1980-06-18 | 1982-07-28 | Fujisawa Pharmaceutical Co | New cephem compounds and processes for preparation thereof |
| IL63207A (en) * | 1980-07-24 | 1985-09-29 | Lonza Ag | Process for the preparation of 2-(2-aminothiazole-4-yl)-2-(syn)-methoxyiminoacetic acid esters |
| US4443444A (en) * | 1980-08-11 | 1984-04-17 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| DE3175156D1 (en) * | 1980-08-29 | 1986-09-25 | Fujisawa Pharmaceutical Co | New cephem compounds and processes for preparation thereof |
| US4416879A (en) * | 1980-09-08 | 1983-11-22 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| NZ198350A (en) * | 1980-09-25 | 1985-02-28 | Toyama Chemical Co Ltd | Cephalosporins and intermediates;pharmaceutical compositions |
| US4458072A (en) * | 1980-10-10 | 1984-07-03 | Hoffmann-La Roche Inc. | Acyl derivatives |
| FR2494275A2 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouveaux derives de vinyl-3 cephalosporines et leur preparation |
| FR2494280A1 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouveaux derives de la cephalosporine et leur preparation |
| FR2494274A2 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouvelles thiovinyl-3 cephalosporines, leur preparation et les medicaments qui les contiennent |
| FR2494279A1 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouvelles oxacephalosporines, leur preparation et les medicaments qui les contiennent |
| FR2494276A2 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouvelles vinyl-3 cephalosporines, et leur preparation |
| GR76342B (enExample) * | 1981-02-02 | 1984-08-06 | Fujisawa Pharmaceutical Co | |
| FR2499995A1 (fr) * | 1981-02-13 | 1982-08-20 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-alkyloxy ou 3-alkylthiomethyl 7-amino thiazolylacetamido cephalosporanique, leur preparation, leur application comme medicaments, les compositions les renfermant et les nouveaux intermediaires obtenus. |
| JPS6011917B2 (ja) * | 1981-04-09 | 1985-03-28 | 山之内製薬株式会社 | 新規なセファロスポリン化合物 |
| FR2505338A1 (fr) * | 1981-05-11 | 1982-11-12 | Rhone Poulenc Sante | Nouvelles oxacephalosporines et leur preparation |
| FR2505339A1 (fr) * | 1981-05-11 | 1982-11-12 | Rhone Poulenc Sante | Nouvelles oxacephalosporines et leur preparation |
| EP0070803A3 (de) * | 1981-07-16 | 1984-05-02 | Ciba-Geigy Ag | Antibiotisch wirksame Aminotriazolyl-Cephalosporinderivate und ihre Herstellung |
| GR76701B (enExample) * | 1981-09-08 | 1984-08-29 | Lilly Co Eli | |
| JPS5859992A (ja) * | 1981-09-14 | 1983-04-09 | Fujisawa Pharmaceut Co Ltd | 新規セフエム化合物およびその製造法、並びに細菌感染症予防・治療剤 |
| US4521413A (en) * | 1981-09-14 | 1985-06-04 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| MA19602A1 (fr) * | 1981-09-30 | 1983-04-01 | Ciba Geigy Ag | Composes d'amino-oxazolyle, procede pour leur preparation, preparations pharmaceutiques qui contiennent ces composes, et leur application |
| US4401668A (en) * | 1981-10-02 | 1983-08-30 | Eli Lilly And Company | Pyrazinium substituted cephalosporins |
| US4474954A (en) * | 1981-12-07 | 1984-10-02 | Bristol-Myers Company | Intermediates for cephalosporin derivatives |
| US4394503A (en) | 1981-12-07 | 1983-07-19 | Bristol-Myers Company | Cephalosporin derivatives |
| US4406899A (en) | 1982-03-04 | 1983-09-27 | Bristol-Myers Company | Cephalosporins |
| US4457929A (en) * | 1982-03-29 | 1984-07-03 | Bristol-Myers Company | 3-Quaternary ammonium methyl)-substituted cephalosporin derivatives |
| PH19163A (en) * | 1982-04-06 | 1986-01-16 | Daiichi Seiyaku Co | Cephalosporin derivatives |
| DE3374410D1 (en) | 1982-06-28 | 1987-12-17 | Bristol Myers Co | Cephalosporin derivatives, a process for the manufacture thereof and pharmaceutical compositions containing said derivatives |
| US4500526A (en) * | 1982-06-28 | 1985-02-19 | Bristol-Myers Company | Cephalosporin derivatives |
| GB2125033B (en) * | 1982-07-23 | 1985-08-29 | Servipharm Ltd | Cephalosporins |
| IE55406B1 (en) * | 1982-08-07 | 1990-09-12 | Tanabe Seiyaku Co | Novel cephalosporin compounds and preparation thereof |
| US4546101A (en) * | 1982-09-10 | 1985-10-08 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds useful for treating infectious diseases in human being and animals and processes for preparation thereof |
| FR2533216A1 (fr) * | 1982-09-22 | 1984-03-23 | Toyama Chemical Co Ltd | Nouvelles cephalosporines, et leurs sels |
| JPS5973043A (ja) * | 1982-10-19 | 1984-04-25 | House Food Ind Co Ltd | 易溶性ゲル化剤の製造法 |
| US4486586A (en) * | 1983-02-10 | 1984-12-04 | Bristol-Myers Company | Cephalosporin derivatives |
| US4525473A (en) * | 1983-03-30 | 1985-06-25 | Bristol-Myers Company | Cephalosporins |
| GB2137993A (en) * | 1983-04-12 | 1984-10-17 | Lilly Co Eli | Improvements in or relating to naphthylglycyl cephalosporin derivatives |
| US4482553A (en) * | 1983-04-12 | 1984-11-13 | Eli Lilly And Company | Benzothienylglycyl cephalosporin derivatives |
| US4492694A (en) * | 1983-04-12 | 1985-01-08 | Eli Lilly And Company | Indolylglycyl cephalosporin derivatives |
| US4492693A (en) * | 1983-04-12 | 1985-01-08 | Eli Lilly And Company | Benzothienylglycyl cephalosporin derivatives |
| DE3330605A1 (de) * | 1983-08-25 | 1985-03-14 | Hoechst Ag, 6230 Frankfurt | Cephalosporinderivate und verfahren zu ihrer herstellung |
| JPS60190783A (ja) * | 1983-12-21 | 1985-09-28 | Sumitomo Seiyaku Kk | セフエム系化合物 |
| JPS60132983A (ja) * | 1983-12-21 | 1985-07-16 | Tanabe Seiyaku Co Ltd | チアゾ−ル酢酸誘導体及びその製法 |
| JPS60142987A (ja) * | 1983-12-29 | 1985-07-29 | Mochida Pharmaceut Co Ltd | セフアロスポリン誘導体 |
| EP0150507B1 (en) * | 1983-12-29 | 1992-08-05 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives, processes for producing the same and compositions containing them |
| GB8411954D0 (en) * | 1984-05-10 | 1984-06-13 | Glaxo Group Ltd | Cephalosporin antibiotics |
| FI851934A7 (fi) * | 1984-05-30 | 1985-12-01 | Ici Plc | Kefalosporiinijohdannaisia. |
| IE58487B1 (en) * | 1984-09-07 | 1993-09-22 | Kaisha Maiji Seika | New cephalosporin compounds and the production thereof |
| US4868173A (en) * | 1984-11-20 | 1989-09-19 | Ici Pharma | Cephalosporin derivatives |
| JPS61145186A (ja) * | 1984-12-20 | 1986-07-02 | Meiji Seika Kaisha Ltd | 新規セフエム化合物及びその製造法 |
| DE3587997D1 (de) * | 1984-12-27 | 1995-04-06 | Banyu Pharma Co Ltd | Isoindolinderivate. |
| US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US4708955A (en) * | 1985-06-24 | 1987-11-24 | Bristol-Myers Company | 3-(substituted)propenyl-7-aminothiazol-ylcephalosporanic acids and esters thereof |
| US4874856A (en) * | 1985-06-24 | 1989-10-17 | Bristol-Myers Company | 3-(substituted)propenyl-7-(aminothiazolylacetamido) ceph-3-em-4-carboxylic acids and esters thereof |
| US4814328A (en) * | 1986-03-19 | 1989-03-21 | Banyu Pharmaceutical Co., Ltd. | Cephalosporin derivatives, and antibacterial agents |
| DE3623921A1 (de) * | 1986-07-16 | 1988-01-21 | Basf Ag | Oximether und diese enthaltende fungizide |
| ZA877987B (en) * | 1986-11-12 | 1988-08-31 | Ici Pharma | Antibiotic compounds |
| JPS63132893A (ja) * | 1986-11-25 | 1988-06-04 | Mochida Pharmaceut Co Ltd | 新規セフアロスポリン誘導体、その製法およびそれらを有効成分とする抗菌剤 |
| US4880798A (en) * | 1986-11-25 | 1989-11-14 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| EP0272827A3 (en) * | 1986-12-23 | 1990-02-07 | ZENECA Pharma S.A. | 3-heterocyclicthiomethyl cephalosphorins |
| US5262410A (en) * | 1986-12-23 | 1993-11-16 | Ici Pharma | 3-heterocyclic thiomethyl cephalosporins |
| US5189157A (en) * | 1987-06-16 | 1993-02-23 | Hoffmann La Roche Inc. | Antibacterial cephalosporin compounds |
| ATE130299T1 (de) * | 1987-07-23 | 1995-12-15 | Zeneca Pharma Sa | Cephalosporinverbindungen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische präparate. |
| ATE131824T1 (de) * | 1987-07-23 | 1996-01-15 | Zeneca Pharma Sa | Cephalosporinverbindungen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische präparate |
| KR900006811B1 (ko) * | 1988-05-11 | 1990-09-21 | 주식회사 럭 키 | 신규 세팔로스포린 유도체 및 그의 제조방법 |
| US5202315A (en) * | 1989-05-11 | 1993-04-13 | Lucky, Ltd. | Cephalosporin compounds |
| GB8927871D0 (en) * | 1989-12-08 | 1990-02-14 | Beecham Group Plc | Novel compounds |
| IN189046B (enExample) | 1998-03-30 | 2002-12-14 | Ranbaxy Lab Ltd | |
| AU2820700A (en) * | 1999-03-09 | 2000-09-28 | Ranbaxy Laboratories Limited | Process for the preparation of cefuroxime |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE311519B (enExample) * | 1962-12-14 | 1969-06-16 | Astra Ab | |
| GB1208014A (en) * | 1967-03-23 | 1970-10-07 | Glaxo Lab Ltd | Cephalosporins |
| GB1208015A (en) * | 1967-03-23 | 1970-10-07 | Glaxo Lab Ltd | Cephalosporins |
| GB1241657A (en) * | 1967-08-21 | 1971-08-04 | Glaxo Lab Ltd | Improvements in or relating to cephalosporin compounds |
| GB1279402A (en) * | 1968-06-14 | 1972-06-28 | Glaxo Lab Ltd | Improvements in or relating to cephalosporin derivatives |
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
| ZA72568B (en) * | 1971-01-29 | 1972-10-25 | Glaxo Lab Ltd | Improvements in or relating to antibiotics |
| GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
-
1971
- 1971-05-14 GB GB1508271A patent/GB1399086A/en not_active Expired
-
1972
- 1972-05-12 CS CS723209A patent/CS245753B2/cs unknown
- 1972-05-12 CS CS72839A patent/CS245754B2/cs unknown
- 1972-05-12 CA CA141,965A patent/CA1027554A/en not_active Expired
- 1972-05-12 YU YU1267/72A patent/YU41807B/xx unknown
- 1972-05-12 CH CH705972A patent/CH591497A5/xx not_active IP Right Cessation
- 1972-05-12 DE DE2223375A patent/DE2223375C2/de not_active Expired
- 1972-05-12 SE SE7206296A patent/SE457795B/xx unknown
- 1972-05-12 DE DE2265234A patent/DE2265234C2/de not_active Expired
- 1972-05-12 CY CY971A patent/CY971A/xx unknown
- 1972-05-12 BE BE783449A patent/BE783449A/xx not_active IP Right Cessation
- 1972-05-12 IL IL39429A patent/IL39429A/xx unknown
- 1972-05-12 ES ES402651A patent/ES402651A1/es not_active Expired
- 1972-05-12 NL NLAANVRAGE7206403,A patent/NL166688C/xx not_active IP Right Cessation
- 1972-05-12 IE IE644/72A patent/IE38172B1/xx unknown
- 1972-05-12 NO NO721705A patent/NO154797C/no unknown
- 1972-05-12 JP JP4714872A patent/JPS531280B1/ja active Pending
- 1972-05-12 DK DK237372A patent/DK155187C/da active
- 1972-05-15 FR FR7217284A patent/FR2137900B1/fr not_active Expired
- 1972-05-15 AT AT420872A patent/AT336786B/de not_active IP Right Cessation
- 1972-05-15 FR FR7217283A patent/FR2137899B1/fr not_active Expired
-
1974
- 1974-08-23 PH PH16206A patent/PH11205A/en unknown
- 1974-09-16 ES ES430104A patent/ES430104A1/es not_active Expired
-
1977
- 1977-06-22 JP JP7426977A patent/JPS5328141A/ja active Granted
-
1978
- 1978-10-19 KE KE2895A patent/KE2895A/xx unknown
- 1978-11-16 HK HK660/78A patent/HK66078A/xx unknown
- 1978-12-30 MY MY466/78A patent/MY7800466A/xx unknown
-
1979
- 1979-02-24 JP JP2128779A patent/JPS54135792A/ja active Pending
- 1979-12-28 YU YU03213/79A patent/YU321379A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE38172L (en) | Cephalosporin compounds | |
| IE40695B1 (en) | Process for the manufacture of 7-amino-cephem-3-ol-4 carboxylic acid compounds | |
| GB1377304A (en) | Alkyl esters of pyrrolidone carboxylic acid | |
| GB1448316A (en) | Racemization of optically active 2,2-dimethyl-3,1,-alkenyl- cyclopropane-1-carboxylic acids | |
| GB1318291A (en) | Carboxamide derivatives and fungicidal compositions containing them | |
| GB1399088A (en) | Cephalosporin compounds | |
| GB1419759A (en) | Process for the manufacture of perfluoroalkyl-methylene carbo xylic acids | |
| GB1399089A (en) | Carboxylic acids and derivatives thereof | |
| IE37392B1 (en) | 5-amino-isophthalic acid derivatives | |
| GB1399087A (en) | Penicillin compounds | |
| GB1496491A (en) | Dihydroergopeptine derivatives | |
| ES464122A1 (es) | Un procedimiento para la preparacion de eteres de acido cla-vulanico. | |
| SE7514475L (sv) | Cefalosporiner | |
| GB1396368A (en) | Perfluoroalkyl sulphinic acids and a process for their production | |
| GB1389195A (en) | Antibiotics | |
| GB1298005A (enExample) | ||
| GB1505020A (en) | Substituted 2-phenylimino-thiazolines a process for their preparation and their use as ectoparasiticides | |
| GB1331181A (en) | Phenylacetohydroxamic acids process for their manufacture and preparations containing them | |
| GB1445668A (en) | Process for obtaining the optical isomers of penicillamine | |
| ES385834A1 (es) | Un procedimiento para preparar monoesteres de alfa carboxi-bencilpenicilina. | |
| GB1383522A (en) | 2-methyl-6-chloropyridines and salts thereof | |
| JPS5549384A (en) | Novel antibacterial compound | |
| GB1429697A (en) | Method for producing isonitrosomalonic esters | |
| GB846737A (en) | 3-substituted 4-hydroxybenzoic acids and their preparation | |
| GB1292662A (en) | Bicycloheptaneheptanoic acids and esters thereof |