HUT66655A - Process for preparing substituted diamino-phthalimides and analogues and pharmaceutical compositions containing them - Google Patents
Process for preparing substituted diamino-phthalimides and analogues and pharmaceutical compositions containing them Download PDFInfo
- Publication number
- HUT66655A HUT66655A HU9201789A HU9201789A HUT66655A HU T66655 A HUT66655 A HU T66655A HU 9201789 A HU9201789 A HU 9201789A HU 9201789 A HU9201789 A HU 9201789A HU T66655 A HUT66655 A HU T66655A
- Authority
- HU
- Hungary
- Prior art keywords
- group
- phenyl
- alkyl
- lower alkyl
- hydroxy
- Prior art date
Links
- YTJWBAMDRDWGEG-UHFFFAOYSA-N 4,5-diaminoisoindole-1,3-dione Chemical class NC1=CC=C2C(=O)NC(=O)C2=C1N YTJWBAMDRDWGEG-UHFFFAOYSA-N 0.000 title claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 title description 9
- 238000004519 manufacturing process Methods 0.000 title description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 118
- -1 commodity Chemical group 0.000 claims description 104
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 104
- 150000001875 compounds Chemical class 0.000 claims description 99
- 125000003545 alkoxy group Chemical group 0.000 claims description 60
- 229910052739 hydrogen Inorganic materials 0.000 claims description 51
- 239000001257 hydrogen Substances 0.000 claims description 47
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 45
- 150000003839 salts Chemical class 0.000 claims description 38
- 229910052736 halogen Inorganic materials 0.000 claims description 34
- 150000002367 halogens Chemical class 0.000 claims description 33
- 125000002252 acyl group Chemical group 0.000 claims description 26
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 25
- 125000003118 aryl group Chemical group 0.000 claims description 24
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 24
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 22
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- 125000003282 alkyl amino group Chemical group 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 15
- 125000002947 alkylene group Chemical group 0.000 claims description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000004423 acyloxy group Chemical group 0.000 claims description 14
- 125000001624 naphthyl group Chemical group 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 13
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 13
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 10
- 125000005153 alkyl sulfamoyl group Chemical group 0.000 claims description 10
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 10
- 125000000304 alkynyl group Chemical group 0.000 claims description 10
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000005237 alkyleneamino group Chemical group 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 8
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 8
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 7
- 125000004414 alkyl thio group Chemical group 0.000 claims description 7
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 7
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 7
- 229910052786 argon Inorganic materials 0.000 claims description 6
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 6
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 5
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 5
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims description 4
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims 8
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims 2
- LRYZJEXQHWCLJY-UHFFFAOYSA-N 1-phenyl-2-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC=CC=C1C1=CC=CC=C1 LRYZJEXQHWCLJY-UHFFFAOYSA-N 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 claims 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 claims 1
- 235000010290 biphenyl Nutrition 0.000 claims 1
- 239000004305 biphenyl Substances 0.000 claims 1
- 125000006448 cycloalkyl cycloalkyl group Chemical group 0.000 claims 1
- 230000003442 weekly effect Effects 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 119
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 62
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 60
- 239000000243 solution Substances 0.000 description 39
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 37
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 27
- 239000000047 product Substances 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- 239000013078 crystal Substances 0.000 description 23
- 239000002904 solvent Substances 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 150000002431 hydrogen Chemical group 0.000 description 17
- 239000004480 active ingredient Substances 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 12
- 229910052938 sodium sulfate Inorganic materials 0.000 description 12
- 235000011152 sodium sulphate Nutrition 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- 239000012267 brine Substances 0.000 description 9
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 210000004027 cell Anatomy 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- XTRGYRNLGRNSAF-UHFFFAOYSA-N dimethyl 4,5-bis(trimethylsilyloxy)cyclohexa-1,4-diene-1,2-dicarboxylate Chemical compound COC(=O)C1=C(C(=O)OC)CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C1 XTRGYRNLGRNSAF-UHFFFAOYSA-N 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- WJWUNGQMBUGZHX-UHFFFAOYSA-N dimethyl 4,5-dianilinobenzene-1,2-dicarboxylate Chemical compound C=1C=CC=CC=1NC=1C=C(C(=O)OC)C(C(=O)OC)=CC=1NC1=CC=CC=C1 WJWUNGQMBUGZHX-UHFFFAOYSA-N 0.000 description 5
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 238000007911 parenteral administration Methods 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 230000035755 proliferation Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000005160 1H NMR spectroscopy Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- 108091000080 Phosphotransferase Proteins 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- 102000001253 Protein Kinase Human genes 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 125000001072 heteroaryl group Chemical group 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 102000020233 phosphotransferase Human genes 0.000 description 3
- 108060006633 protein kinase Proteins 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 description 3
- AAALVYBICLMAMA-UHFFFAOYSA-N 4,5-dianilinophthalimide Chemical compound C=1C=CC=CC=1NC=1C=C2C(=O)NC(=O)C2=CC=1NC1=CC=CC=C1 AAALVYBICLMAMA-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- WXAFLLJZQFPBSQ-UHFFFAOYSA-N 5,6-bis(2-nitroanilino)isoindole-1,3-dione Chemical compound [O-][N+](=O)C1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)[N+]([O-])=O)=CC2=C1C(=O)NC2=O WXAFLLJZQFPBSQ-UHFFFAOYSA-N 0.000 description 2
- HZUNYDVOCZBNFE-UHFFFAOYSA-N 5,6-dianilino-3-sulfanylideneisoindol-1-one Chemical compound C=1C=CC=CC=1NC=1C=C2C(=O)NC(=S)C2=CC=1NC1=CC=CC=C1 HZUNYDVOCZBNFE-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 240000003291 Armoracia rusticana Species 0.000 description 2
- 235000011330 Armoracia rusticana Nutrition 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical group CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 102000001301 EGF receptor Human genes 0.000 description 2
- 108060006698 EGF receptor Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000009024 Epidermal Growth Factor Human genes 0.000 description 2
- 101800003838 Epidermal growth factor Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical group Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 206010029897 Obsessive thoughts Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 2
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000005133 alkynyloxy group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- AEFCNKNEDYCBEM-UHFFFAOYSA-N dimethyl 4,5-bis(cyclohexylamino)benzene-1,2-dicarboxylate Chemical compound C1CCCCC1NC=1C=C(C(=O)OC)C(C(=O)OC)=CC=1NC1CCCCC1 AEFCNKNEDYCBEM-UHFFFAOYSA-N 0.000 description 2
- XJFKXZWUQHFQJH-UHFFFAOYSA-N dimethyl 4-anilino-5-(n-methylanilino)benzene-1,2-dicarboxylate Chemical compound C=1C=CC=CC=1N(C)C=1C=C(C(=O)OC)C(C(=O)OC)=CC=1NC1=CC=CC=C1 XJFKXZWUQHFQJH-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940116977 epidermal growth factor Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 210000005260 human cell Anatomy 0.000 description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 210000002510 keratinocyte Anatomy 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 210000004962 mammalian cell Anatomy 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 239000002511 suppository base Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 2
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 2
- 229940100445 wheat starch Drugs 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- 125000001359 1,2,3-triazol-4-yl group Chemical group [H]N1N=NC([*])=C1[H] 0.000 description 1
- LGBZKMKARLGUFK-UHFFFAOYSA-N 1,4-diphenyl-2,3-dihydroquinoxaline-6,7-dicarboxylic acid Chemical compound C1=2C=C(C(O)=O)C(C(=O)O)=CC=2N(C=2C=CC=CC=2)CCN1C1=CC=CC=C1 LGBZKMKARLGUFK-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical group COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- JVVSPDVWQZZDRF-UHFFFAOYSA-N 2-[(6-anilino-1,3-dioxoisoindol-5-yl)amino]benzonitrile Chemical compound C=1C=CC=CC=1NC=1C=C2C(=O)NC(=O)C2=CC=1NC1=CC=CC=C1C#N JVVSPDVWQZZDRF-UHFFFAOYSA-N 0.000 description 1
- PBXGATFFHXGXEQ-UHFFFAOYSA-N 2-[[6-(2-carboxyanilino)-1,3-dioxoisoindol-5-yl]amino]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)C(O)=O)=CC2=C1C(=O)NC2=O PBXGATFFHXGXEQ-UHFFFAOYSA-N 0.000 description 1
- DCZHQBARKJVGSU-UHFFFAOYSA-N 2-amino-5,6-dianilinoisoindole-1,3-dione Chemical compound C=1C=CC=CC=1NC=1C=C2C(=O)N(N)C(=O)C2=CC=1NC1=CC=CC=C1 DCZHQBARKJVGSU-UHFFFAOYSA-N 0.000 description 1
- UBPDKIDWEADHPP-UHFFFAOYSA-N 2-iodoaniline Chemical compound NC1=CC=CC=C1I UBPDKIDWEADHPP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- KSKFACJRXWQBQH-UHFFFAOYSA-N 3-[[6-(3-carboxyanilino)-1,3-dioxoisoindol-5-yl]amino]benzoic acid Chemical compound OC(=O)C1=CC=CC(NC=2C(=CC=3C(=O)NC(=O)C=3C=2)NC=2C=C(C=CC=2)C(O)=O)=C1 KSKFACJRXWQBQH-UHFFFAOYSA-N 0.000 description 1
- XJOPNVHCWLFRES-UHFFFAOYSA-N 4-(cyclohexylamino)isoindole-1,3-dione Chemical compound O=C1NC(=O)C2=C1C=CC=C2NC1CCCCC1 XJOPNVHCWLFRES-UHFFFAOYSA-N 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 1
- FIIDVVUUWRJXLF-UHFFFAOYSA-N 4-phenylmethoxyaniline Chemical compound C1=CC(N)=CC=C1OCC1=CC=CC=C1 FIIDVVUUWRJXLF-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- JUXFEWPDVNQORW-UHFFFAOYSA-N 5,6-bis(2,3,4,5,6-pentafluoroanilino)isoindole-1,3-dione Chemical compound FC1=C(F)C(F)=C(F)C(F)=C1NC(C(=C1)NC=2C(=C(F)C(F)=C(F)C=2F)F)=CC2=C1C(=O)NC2=O JUXFEWPDVNQORW-UHFFFAOYSA-N 0.000 description 1
- GNFDNSRMCKGVPW-UHFFFAOYSA-N 5,6-bis(2-hydroxyanilino)isoindole-1,3-dione Chemical compound OC1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)O)=CC2=C1C(=O)NC2=O GNFDNSRMCKGVPW-UHFFFAOYSA-N 0.000 description 1
- XRGIILFXTQOTHN-UHFFFAOYSA-N 5,6-bis(2-iodoanilino)isoindole-1,3-dione Chemical compound IC1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)I)=CC2=C1C(=O)NC2=O XRGIILFXTQOTHN-UHFFFAOYSA-N 0.000 description 1
- RELMFJNFSUREHD-UHFFFAOYSA-N 5,6-bis(2-methoxyanilino)isoindole-1,3-dione Chemical compound COC1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)OC)=CC2=C1C(=O)NC2=O RELMFJNFSUREHD-UHFFFAOYSA-N 0.000 description 1
- ZUYKLOJBZUJKFE-UHFFFAOYSA-N 5,6-bis(2-phenylanilino)isoindole-1,3-dione Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1NC=1C=C2C(=O)NC(=O)C2=CC=1NC1=CC=CC=C1C1=CC=CC=C1 ZUYKLOJBZUJKFE-UHFFFAOYSA-N 0.000 description 1
- PNHFJHCSISNJJT-UHFFFAOYSA-N 5,6-bis(3-ethylanilino)isoindole-1,3-dione Chemical compound CCC1=CC=CC(NC=2C(=CC=3C(=O)NC(=O)C=3C=2)NC=2C=C(CC)C=CC=2)=C1 PNHFJHCSISNJJT-UHFFFAOYSA-N 0.000 description 1
- VBXMMKOVEQTSID-UHFFFAOYSA-N 5,6-bis(3-hydroxyanilino)isoindole-1,3-dione Chemical compound OC1=CC=CC(NC=2C(=CC=3C(=O)NC(=O)C=3C=2)NC=2C=C(O)C=CC=2)=C1 VBXMMKOVEQTSID-UHFFFAOYSA-N 0.000 description 1
- HCVZDPSRXWGXLO-UHFFFAOYSA-N 5,6-bis(3-methylanilino)isoindole-1,3-dione Chemical compound CC1=CC=CC(NC=2C(=CC=3C(=O)NC(=O)C=3C=2)NC=2C=C(C)C=CC=2)=C1 HCVZDPSRXWGXLO-UHFFFAOYSA-N 0.000 description 1
- OOIVHIRMFWOFOX-UHFFFAOYSA-N 5,6-bis(4-ethylanilino)isoindole-1,3-dione Chemical compound C1=CC(CC)=CC=C1NC(C(=C1)NC=2C=CC(CC)=CC=2)=CC2=C1C(=O)NC2=O OOIVHIRMFWOFOX-UHFFFAOYSA-N 0.000 description 1
- TYLKNORJFZPIPX-UHFFFAOYSA-N 5,6-bis(4-hydroxyanilino)isoindole-1,3-dione Chemical compound C1=CC(O)=CC=C1NC(C(=C1)NC=2C=CC(O)=CC=2)=CC2=C1C(=O)NC2=O TYLKNORJFZPIPX-UHFFFAOYSA-N 0.000 description 1
- VAMLWUCMJGIKEA-UHFFFAOYSA-N 5,6-bis(4-phenylmethoxyanilino)isoindole-1,3-dione Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1NC=1C=C2C(=O)NC(=O)C2=CC=1NC(C=C1)=CC=C1OCC1=CC=CC=C1 VAMLWUCMJGIKEA-UHFFFAOYSA-N 0.000 description 1
- PIULJDLFTHDBDQ-UHFFFAOYSA-N 5,6-bis(naphthalen-1-ylamino)isoindole-1,3-dione Chemical compound C1=CC=C2C(NC3=C(NC=4C5=CC=CC=C5C=CC=4)C=C4C(=O)NC(C4=C3)=O)=CC=CC2=C1 PIULJDLFTHDBDQ-UHFFFAOYSA-N 0.000 description 1
- SBMCNTIAXQFOMN-UHFFFAOYSA-N 5,6-bis(naphthalen-2-ylamino)isoindole-1,3-dione Chemical compound C1=CC=CC2=CC(NC3=C(NC=4C=C5C=CC=CC5=CC=4)C=C4C(=O)NC(C4=C3)=O)=CC=C21 SBMCNTIAXQFOMN-UHFFFAOYSA-N 0.000 description 1
- PALHPUMGGVZDEX-UHFFFAOYSA-N 5,6-bis[2-(trifluoromethyl)anilino]isoindole-1,3-dione Chemical compound FC(F)(F)C1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)C(F)(F)F)=CC2=C1C(=O)NC2=O PALHPUMGGVZDEX-UHFFFAOYSA-N 0.000 description 1
- WIVVAJYCKXUPQA-UHFFFAOYSA-N 5,6-dianilino-2-benzylisoindole-1,3-dione Chemical compound O=C1C2=CC(NC=3C=CC=CC=3)=C(NC=3C=CC=CC=3)C=C2C(=O)N1CC1=CC=CC=C1 WIVVAJYCKXUPQA-UHFFFAOYSA-N 0.000 description 1
- COUTZDPHOXUIHW-UHFFFAOYSA-N 5,6-dianilino-2-hydroxyisoindole-1,3-dione Chemical compound C=1C=CC=CC=1NC=1C=C2C(=O)N(O)C(=O)C2=CC=1NC1=CC=CC=C1 COUTZDPHOXUIHW-UHFFFAOYSA-N 0.000 description 1
- IIKZZRHBCAUVEL-UHFFFAOYSA-N 5-(2,4-dinitroanilino)-6-(4-nitroanilino)isoindole-1,3-dione Chemical compound C1=CC([N+](=O)[O-])=CC=C1NC(C(=C1)NC=2C(=CC(=CC=2)[N+]([O-])=O)[N+]([O-])=O)=CC2=C1C(=O)NC2=O IIKZZRHBCAUVEL-UHFFFAOYSA-N 0.000 description 1
- TUVATDKGRAZRRI-UHFFFAOYSA-N 5-(cyclohexylamino)isoindole-1,3-dione Chemical compound C=1C=C2C(=O)NC(=O)C2=CC=1NC1CCCCC1 TUVATDKGRAZRRI-UHFFFAOYSA-N 0.000 description 1
- AGGVZVIQMNSAPN-UHFFFAOYSA-N 5-anilino-6-(4-hydroxyanilino)isoindole-1,3-dione Chemical compound C1=CC(O)=CC=C1NC(C(=C1)NC=2C=CC=CC=2)=CC2=C1C(=O)NC2=O AGGVZVIQMNSAPN-UHFFFAOYSA-N 0.000 description 1
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000219495 Betulaceae Species 0.000 description 1
- NLHHDSLRTQOVMK-UHFFFAOYSA-N C(#N)C1=C(NC2=C3C(C(=O)NC3=O)=CC=C2)C=CC=C1 Chemical compound C(#N)C1=C(NC2=C3C(C(=O)NC3=O)=CC=C2)C=CC=C1 NLHHDSLRTQOVMK-UHFFFAOYSA-N 0.000 description 1
- LMSDXBLHIOTFKH-UHFFFAOYSA-N C1CCCC2=C(C=CC=C12)NC1=C2C(C(=O)NC2=O)=CC=C1 Chemical compound C1CCCC2=C(C=CC=C12)NC1=C2C(C(=O)NC2=O)=CC=C1 LMSDXBLHIOTFKH-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- PTYWPNBYDYGDOZ-UHFFFAOYSA-N FC=1C=C(NC2=C3C(C(=O)NC3=O)=CC=C2)C=CC1 Chemical compound FC=1C=C(NC2=C3C(C(=O)NC3=O)=CC=C2)C=CC1 PTYWPNBYDYGDOZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 description 1
- 101000873645 Homo sapiens Secretory carrier-associated membrane protein 3 Proteins 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 101000668058 Infectious salmon anemia virus (isolate Atlantic salmon/Norway/810/9/99) RNA-directed RNA polymerase catalytic subunit Proteins 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 208000003788 Neoplasm Micrometastasis Diseases 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 description 1
- 102100035895 Secretory carrier-associated membrane protein 3 Human genes 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- XQAXGZLFSSPBMK-UHFFFAOYSA-M [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;trihydrate Chemical compound O.O.O.[Cl-].C1=CC(=[N+](C)C)C=C2SC3=CC(N(C)C)=CC=C3N=C21 XQAXGZLFSSPBMK-UHFFFAOYSA-M 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000001785 acacia senegal l. willd gum Substances 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005138 alkoxysulfonyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 230000022131 cell cycle Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- FVAMEILVGOUEFP-UHFFFAOYSA-N dimethyl 1,4-diphenyl-2,3-dihydroquinoxaline-6,7-dicarboxylate Chemical compound C1=2C=C(C(=O)OC)C(C(=O)OC)=CC=2N(C=2C=CC=CC=2)CCN1C1=CC=CC=C1 FVAMEILVGOUEFP-UHFFFAOYSA-N 0.000 description 1
- PRNFORNTJCKVHE-UHFFFAOYSA-N dimethyl 3-(4-methoxyanilino)benzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(NC=2C=CC(OC)=CC=2)=C1C(=O)OC PRNFORNTJCKVHE-UHFFFAOYSA-N 0.000 description 1
- MKIZEPYHEZSZSD-UHFFFAOYSA-N dimethyl 3-anilinobenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(NC=2C=CC=CC=2)=C1C(=O)OC MKIZEPYHEZSZSD-UHFFFAOYSA-N 0.000 description 1
- PRAKUYLJFUQFBZ-UHFFFAOYSA-N dimethyl 4,5-bis(4-fluoroanilino)benzene-1,2-dicarboxylate Chemical compound C=1C=C(F)C=CC=1NC=1C=C(C(=O)OC)C(C(=O)OC)=CC=1NC1=CC=C(F)C=C1 PRAKUYLJFUQFBZ-UHFFFAOYSA-N 0.000 description 1
- CBOAGOLUKVWDLV-UHFFFAOYSA-N dimethyl 4,5-bis(4-phenylmethoxyanilino)benzene-1,2-dicarboxylate Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1NC=1C=C(C(=O)OC)C(C(=O)OC)=CC=1NC(C=C1)=CC=C1OCC1=CC=CC=C1 CBOAGOLUKVWDLV-UHFFFAOYSA-N 0.000 description 1
- KAMMTQKKMPZSSH-UHFFFAOYSA-N dimethyl 4,5-bis(n-methylanilino)benzene-1,2-dicarboxylate Chemical compound C=1C=CC=CC=1N(C)C=1C=C(C(=O)OC)C(C(=O)OC)=CC=1N(C)C1=CC=CC=C1 KAMMTQKKMPZSSH-UHFFFAOYSA-N 0.000 description 1
- FCYCDJNFASPSAU-UHFFFAOYSA-N dimethyl 4-(cyclohexylamino)benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1NC1CCCCC1 FCYCDJNFASPSAU-UHFFFAOYSA-N 0.000 description 1
- XXFZQMIWILHHTH-UHFFFAOYSA-N dimethyl 4-anilino-5-(4-methoxyanilino)benzene-1,2-dicarboxylate Chemical compound C=1C=C(OC)C=CC=1NC=1C=C(C(=O)OC)C(C(=O)OC)=CC=1NC1=CC=CC=C1 XXFZQMIWILHHTH-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000036566 epidermal hyperplasia Effects 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- ZQPDYICOPRCWEV-UHFFFAOYSA-N ethyl 2-[[6-(2-ethoxycarbonylanilino)-1,3-dioxoisoindol-5-yl]amino]benzoate Chemical compound CCOC(=O)C1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)C(=O)OCC)=CC2=C1C(=O)NC2=O ZQPDYICOPRCWEV-UHFFFAOYSA-N 0.000 description 1
- AQQPIFDOBPJHEG-UHFFFAOYSA-N ethyl 3-[[6-(3-ethoxycarbonylanilino)-1,3-dioxoisoindol-5-yl]amino]benzoate Chemical compound CCOC(=O)C1=CC=CC(NC=2C(=CC=3C(=O)NC(=O)C=3C=2)NC=2C=C(C=CC=2)C(=O)OCC)=C1 AQQPIFDOBPJHEG-UHFFFAOYSA-N 0.000 description 1
- YYZSKNSWBMHANU-UHFFFAOYSA-N ethyl 4-[[6-(4-ethoxycarbonylanilino)-1,3-dioxoisoindol-5-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC(C(=C1)NC=2C=CC(=CC=2)C(=O)OCC)=CC2=C1C(=O)NC2=O YYZSKNSWBMHANU-UHFFFAOYSA-N 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- NEXSMEBSBIABKL-UHFFFAOYSA-N hexamethyldisilane Chemical compound C[Si](C)(C)[Si](C)(C)C NEXSMEBSBIABKL-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- GBYBTARUOWDPLJ-UHFFFAOYSA-N methyl 2-[[6-(2-methoxycarbonylanilino)-1,3-dioxoisoindol-5-yl]amino]benzoate Chemical compound COC(=O)C1=CC=CC=C1NC(C(=C1)NC=2C(=CC=CC=2)C(=O)OC)=CC2=C1C(=O)NC2=O GBYBTARUOWDPLJ-UHFFFAOYSA-N 0.000 description 1
- CHPATHCWFOUXPX-UHFFFAOYSA-N methyl 3-[[6-(3-methoxycarbonylanilino)-1,3-dioxoisoindol-5-yl]amino]benzoate Chemical compound COC(=O)C1=CC=CC(NC=2C(=CC=3C(=O)NC(=O)C=3C=2)NC=2C=C(C=CC=2)C(=O)OC)=C1 CHPATHCWFOUXPX-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PADPKJACPLYMPK-UHFFFAOYSA-N n',n'-diphenylethane-1,2-diamine Chemical compound C=1C=CC=CC=1N(CCN)C1=CC=CC=C1 PADPKJACPLYMPK-UHFFFAOYSA-N 0.000 description 1
- ZYZHMSJNPCYUTB-UHFFFAOYSA-N n-benzyl-1-phenylethanamine Chemical compound C=1C=CC=CC=1C(C)NCC1=CC=CC=C1 ZYZHMSJNPCYUTB-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000017095 negative regulation of cell growth Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 210000001428 peripheral nervous system Anatomy 0.000 description 1
- 208000027232 peripheral nervous system disease Diseases 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical class C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 1
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 1
- 230000026267 regulation of growth Effects 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000010408 sweeping Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- BEIXTGGJVNHLEO-UHFFFAOYSA-N trimethyl(3-trimethylsilyloxybuta-1,3-dien-2-yloxy)silane Chemical compound C[Si](C)(C)OC(=C)C(=C)O[Si](C)(C)C BEIXTGGJVNHLEO-UHFFFAOYSA-N 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/46—Iso-indoles; Hydrogenated iso-indoles with an oxygen atom in position 1
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Luminescent Compositions (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Enzymes And Modification Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Pyridine Compounds (AREA)
- Breeding Of Plants And Reproduction By Means Of Culturing (AREA)
- Electrophonic Musical Instruments (AREA)
- Stringed Musical Instruments (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH160191 | 1991-05-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HU9201789D0 HU9201789D0 (en) | 1992-08-28 |
| HUT66655A true HUT66655A (en) | 1994-12-28 |
Family
ID=4214234
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9201789A HUT66655A (en) | 1991-05-30 | 1992-05-28 | Process for preparing substituted diamino-phthalimides and analogues and pharmaceutical compositions containing them |
Country Status (25)
| Country | Link |
|---|---|
| EP (1) | EP0516588B1 (enExample) |
| JP (1) | JP2593273B2 (enExample) |
| KR (1) | KR920021508A (enExample) |
| CN (1) | CN1067052A (enExample) |
| AT (1) | ATE108437T1 (enExample) |
| AU (1) | AU653024B2 (enExample) |
| CA (1) | CA2069857A1 (enExample) |
| CS (1) | CS156792A3 (enExample) |
| CY (1) | CY1979A (enExample) |
| DE (1) | DE59200277D1 (enExample) |
| DK (1) | DK0516588T3 (enExample) |
| ES (1) | ES2056699T3 (enExample) |
| FI (1) | FI100530B (enExample) |
| HK (1) | HK214896A (enExample) |
| HU (1) | HUT66655A (enExample) |
| IE (1) | IE65772B1 (enExample) |
| IL (1) | IL102038A0 (enExample) |
| MA (1) | MA22540A1 (enExample) |
| MX (1) | MX9202544A (enExample) |
| NO (1) | NO178261C (enExample) |
| NZ (1) | NZ242941A (enExample) |
| PL (1) | PL170909B1 (enExample) |
| RU (1) | RU2095349C1 (enExample) |
| TW (1) | TW204341B (enExample) |
| ZA (1) | ZA923940B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5491144A (en) * | 1991-05-30 | 1996-02-13 | Ciba-Geigy Corporation | Substituted diaminophthalimides and analogues |
| EP0600831A1 (de) * | 1992-11-27 | 1994-06-08 | Ciba-Geigy Ag | Phthalazinonderivate |
| EP0600830A1 (de) * | 1992-11-27 | 1994-06-08 | Ciba-Geigy Ag | Substituierte Derivate von Diaminophthalimid als Protein-Tyrosin-Kinase-Hemmer |
| ZA944568B (en) * | 1993-06-25 | 1995-03-20 | Mobius Consultancy Pty Ltd | Therapeutic agent |
| AU691815B2 (en) * | 1993-06-25 | 1998-05-28 | Main Camp Marketing Pty. Ltd. | Therapeutic agent |
| GB9314893D0 (en) * | 1993-07-19 | 1993-09-01 | Zeneca Ltd | Quinazoline derivatives |
| GB9325217D0 (en) * | 1993-12-09 | 1994-02-09 | Zeneca Ltd | Pyrimidine derivatives |
| WO1995024190A2 (en) | 1994-03-07 | 1995-09-14 | Sugen, Inc. | Receptor tyrosine kinase inhibitors for inhibiting cell proliferative disorders and compositions thereof |
| GB9600545D0 (en) | 1996-01-11 | 1996-03-13 | Ciba Geigy Ag | Compositions |
| EP1661566A3 (en) * | 1996-08-05 | 2008-04-16 | Myriad Genetics, Inc. | Use of beta-sheet mimetics as protease and kinase inhibitors and as inhibitors of transcription factors |
| ATE320811T1 (de) * | 1996-08-05 | 2006-04-15 | Myriad Genetics Inc | Verwendung von beta-blatt mimetika als protease und kinase hemmer und alshemmer eines transkriptionsfaktors |
| US7374857B2 (en) * | 2001-11-30 | 2008-05-20 | Wako Pure Chemical Industries Ltd. | Bismide compound, acid generator and resist composition each containing the same, and method of forming pattern from the composition |
| WO2005039564A1 (en) * | 2003-10-02 | 2005-05-06 | Vertex Pharmaceuticals Incorporated | Phthalimide compounds useful as protein kinase inhibitors |
| WO2006047514A2 (en) * | 2004-10-25 | 2006-05-04 | Whitehead Institute For Biomedical Research | Daph analogs and inhibition of protein aggregation |
| US7745641B2 (en) | 2005-04-19 | 2010-06-29 | Kyowa Hakko Kirin Co., Ltd. | Nitrogen-containing heterocyclic compound |
| DE102009031058A1 (de) * | 2009-06-30 | 2011-01-27 | Clariant International Ltd. | Kontinuierliches Verfahren zur Herstellung von Amiden aromatischer Carbonsäuren |
| JP5934559B2 (ja) * | 2012-04-05 | 2016-06-15 | 国立大学法人京都工芸繊維大学 | 発光材料および有機el素子 |
| CN105434432B (zh) * | 2015-12-04 | 2018-11-13 | 中国科学院昆明植物研究所 | N-羟基邻苯二甲酰亚胺类化合物在制备抗肿瘤药物中的应用 |
| WO2023283425A1 (en) | 2021-07-09 | 2023-01-12 | Plexium, Inc. | Aryl compounds and pharmaceutical compositions that modulate ikzf2 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3857947A (en) * | 1972-08-14 | 1974-12-31 | Stauffer Chemical Co | Fungicidal active phthalimides |
| GB1581073A (en) * | 1976-09-08 | 1980-12-10 | Campbell Chain Co | Locking assembly |
| JPS60161968A (ja) * | 1984-01-31 | 1985-08-23 | Sankyo Co Ltd | フタ−ルイミド誘導体及び農業用殺菌剤 |
-
1992
- 1992-05-20 AU AU17053/92A patent/AU653024B2/en not_active Ceased
- 1992-05-21 ES ES92810385T patent/ES2056699T3/es not_active Expired - Lifetime
- 1992-05-21 DE DE59200277T patent/DE59200277D1/de not_active Expired - Fee Related
- 1992-05-21 AT AT92810385T patent/ATE108437T1/de not_active IP Right Cessation
- 1992-05-21 DK DK92810385.2T patent/DK0516588T3/da active
- 1992-05-21 EP EP92810385A patent/EP0516588B1/de not_active Expired - Lifetime
- 1992-05-25 CS CS921567A patent/CS156792A3/cs unknown
- 1992-05-26 TW TW081104093A patent/TW204341B/zh active
- 1992-05-27 PL PL92294701A patent/PL170909B1/pl unknown
- 1992-05-27 FI FI922459A patent/FI100530B/fi not_active IP Right Cessation
- 1992-05-28 MX MX9202544A patent/MX9202544A/es not_active IP Right Cessation
- 1992-05-28 NZ NZ242941A patent/NZ242941A/en unknown
- 1992-05-28 IL IL102038A patent/IL102038A0/xx unknown
- 1992-05-28 CA CA002069857A patent/CA2069857A1/en not_active Abandoned
- 1992-05-28 HU HU9201789A patent/HUT66655A/hu unknown
- 1992-05-29 RU SU925011857A patent/RU2095349C1/ru active
- 1992-05-29 JP JP4138985A patent/JP2593273B2/ja not_active Expired - Lifetime
- 1992-05-29 MA MA22828A patent/MA22540A1/fr unknown
- 1992-05-29 KR KR1019920009286A patent/KR920021508A/ko not_active Abandoned
- 1992-05-29 ZA ZA923940A patent/ZA923940B/xx unknown
- 1992-05-29 NO NO922133A patent/NO178261C/no unknown
- 1992-05-29 CN CN92104118A patent/CN1067052A/zh active Pending
- 1992-07-01 IE IE921770A patent/IE65772B1/en not_active IP Right Cessation
-
1996
- 1996-12-12 HK HK214896A patent/HK214896A/xx not_active IP Right Cessation
-
1997
- 1997-09-05 CY CY197997A patent/CY1979A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATE108437T1 (de) | 1994-07-15 |
| JP2593273B2 (ja) | 1997-03-26 |
| NZ242941A (en) | 1994-10-26 |
| EP0516588A1 (de) | 1992-12-02 |
| HK214896A (en) | 1996-12-13 |
| IE65772B1 (en) | 1995-11-15 |
| KR920021508A (ko) | 1992-12-18 |
| PL170909B1 (pl) | 1997-02-28 |
| PL294701A1 (enExample) | 1993-02-08 |
| FI922459L (fi) | 1992-12-01 |
| AU653024B2 (en) | 1994-09-15 |
| CS156792A3 (en) | 1992-12-16 |
| JPH05163240A (ja) | 1993-06-29 |
| EP0516588B1 (de) | 1994-07-13 |
| IE921770A1 (en) | 1992-12-02 |
| ZA923940B (en) | 1993-11-15 |
| NO922133D0 (no) | 1992-05-29 |
| NO178261B (no) | 1995-11-13 |
| HU9201789D0 (en) | 1992-08-28 |
| MA22540A1 (fr) | 1992-12-31 |
| AU1705392A (en) | 1992-12-03 |
| FI100530B (fi) | 1997-12-31 |
| FI922459A0 (fi) | 1992-05-27 |
| CN1067052A (zh) | 1992-12-16 |
| CA2069857A1 (en) | 1992-12-01 |
| IL102038A0 (en) | 1992-12-30 |
| TW204341B (enExample) | 1993-04-21 |
| NO178261C (no) | 1996-02-21 |
| MX9202544A (es) | 1992-11-01 |
| ES2056699T3 (es) | 1994-10-01 |
| DE59200277D1 (de) | 1994-08-18 |
| RU2095349C1 (ru) | 1997-11-10 |
| CY1979A (en) | 1997-09-05 |
| DK0516588T3 (da) | 1994-08-15 |
| NO922133L (no) | 1992-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HUT66655A (en) | Process for preparing substituted diamino-phthalimides and analogues and pharmaceutical compositions containing them | |
| CA2330756C (en) | Indole derivatives and their use for the treatment of malignant and other diseases based on pathological cell proliferation | |
| KR20160103986A (ko) | N-벤질 트립탄트린 유도체, 및 이의 제조 방법 및 적용 | |
| CZ302359B6 (cs) | Triazolové slouceniny a jejich použití | |
| EP0619813A1 (en) | Linked cyclic polyamines with activity against hiv | |
| de Andrade et al. | 1, 2, 3-Triazole-based analogue of benznidazole displays remarkable activity against Trypanosoma cruzi | |
| KR910006637B1 (ko) | 트립타민 유도체의 제조방법 | |
| JPH10279477A (ja) | ベンジリデン−およびシンナミリデン−マロンニトリル誘導体を有効成分として含有する哺乳類細胞での増殖工程の抑制のためのタンパク質チロシンキナーゼ阻害剤 | |
| Slater et al. | Indolocarbazoles: potent, selective inhibitors of human cytomegalovirus replication | |
| EA012295B1 (ru) | Конденсированные пирролокарбазолы | |
| DE69528229T2 (de) | N-substituierte beta-aryl und beta-heteroaryl-alpha-cyamoacrylamidderivate als tyrosine kinase inhibitoren | |
| JPH07107066B2 (ja) | 置換インドキノキサリン類 | |
| DE69217308T2 (de) | Dihydropyridine zur Anwendung in der Antitumor-Therapie | |
| US5663336A (en) | Substituted diaminophthalimides and analogues | |
| US20040248922A1 (en) | Lavendamycin analogs, quinoline-5,8-diones and methods of using them | |
| CZ14995A3 (en) | Tetracyclin compounds, process of their preparation, intermediates for their preparation and their use as antitumor preparations | |
| GB2120670A (en) | Piperazine derivatives | |
| JPH05507072A (ja) | Egfレセプタチロシンキナーゼを阻害する複素環式エテンジイル化合物 | |
| EP0536208B1 (en) | 1,2-dihydro-3h-dibenzisoquinoline-1,3-dione anticancer agents | |
| JPH05117273A (ja) | 医薬化合物 | |
| CN107652218A (zh) | 一种二氢吡咯酮衍生物及其在制备抗肿瘤药物中的应用 | |
| US5229395A (en) | Potential anticancer agents derived from acridine | |
| JPH0222252A (ja) | 5―ヒドロキシトリプタミン―1a―受容体結合化合物 | |
| CA2389766C (fr) | Nouveaux derives d'indenoindolones, leur procede de preparation et les compositions pharmaceutiques qui les contiennent | |
| Nagy et al. | Synthesis of new tetrazolyldienylphenothiazines as potential multidrug resistance inhibitory compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| DGB9 | Succession in title of applicant |
Owner name: NOVARTIS AG., CH |
|
| DFD9 | Temporary protection cancelled due to non-payment of fee |