HU202224B - Process for producing indolylpiperidine derivatives and pharmaceutical compositions comprising same - Google Patents
Process for producing indolylpiperidine derivatives and pharmaceutical compositions comprising same Download PDFInfo
- Publication number
- HU202224B HU202224B HU89132A HU13289A HU202224B HU 202224 B HU202224 B HU 202224B HU 89132 A HU89132 A HU 89132A HU 13289 A HU13289 A HU 13289A HU 202224 B HU202224 B HU 202224B
- Authority
- HU
- Hungary
- Prior art keywords
- alkoxy
- phenyl
- methoxy
- formula
- indolyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 26
- HNQZRUDJRPSFAU-UHFFFAOYSA-N 2-piperidin-1-yl-1h-indole Chemical class C1CCCCN1C1=CC2=CC=CC=C2N1 HNQZRUDJRPSFAU-UHFFFAOYSA-N 0.000 title description 9
- 239000008194 pharmaceutical composition Substances 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 96
- 150000003839 salts Chemical class 0.000 claims description 63
- 238000002360 preparation method Methods 0.000 claims description 29
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 16
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 9
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 208000026935 allergic disease Diseases 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 4
- 125000004450 alkenylene group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims 1
- -1 formyloxy, acetyl Chemical group 0.000 description 209
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 84
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 69
- 238000005481 NMR spectroscopy Methods 0.000 description 58
- 238000001819 mass spectrum Methods 0.000 description 52
- 239000002585 base Substances 0.000 description 44
- 238000006243 chemical reaction Methods 0.000 description 43
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- 239000000243 solution Substances 0.000 description 30
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- 239000000203 mixture Substances 0.000 description 27
- 239000002904 solvent Substances 0.000 description 27
- 238000002329 infrared spectrum Methods 0.000 description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 23
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 17
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 16
- 238000003756 stirring Methods 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- 238000006722 reduction reaction Methods 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 238000003379 elimination reaction Methods 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 230000002411 adverse Effects 0.000 description 5
- 230000003266 anti-allergic effect Effects 0.000 description 5
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000004949 mass spectrometry Methods 0.000 description 5
- 150000007530 organic bases Chemical class 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- RPAKPIHLJIEODQ-VDESZNBCSA-N (2e,4e)-5-(4-hydroxy-3-methoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 RPAKPIHLJIEODQ-VDESZNBCSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 150000007529 inorganic bases Chemical class 0.000 description 4
- 229940098779 methanesulfonic acid Drugs 0.000 description 4
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000017550 sodium carbonate Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- YXNKWHZCUWBSEN-UHFFFAOYSA-N 2-[4-(1h-indol-3-yl)piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1C1=CNC2=CC=CC=C12 YXNKWHZCUWBSEN-UHFFFAOYSA-N 0.000 description 3
- QCVGEOXPDFCNHA-UHFFFAOYSA-N 5,5-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound CC1(C)OC(=O)N(C(N)=O)C1=O QCVGEOXPDFCNHA-UHFFFAOYSA-N 0.000 description 3
- 102000009027 Albumins Human genes 0.000 description 3
- 108010088751 Albumins Proteins 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- 241000700198 Cavia Species 0.000 description 3
- 102000002322 Egg Proteins Human genes 0.000 description 3
- 108010000912 Egg Proteins Proteins 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- XGRJZXREYAXTGV-UHFFFAOYSA-N chlorodiphenylphosphine Chemical compound C=1C=CC=CC=1P(Cl)C1=CC=CC=C1 XGRJZXREYAXTGV-UHFFFAOYSA-N 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 235000014103 egg white Nutrition 0.000 description 3
- 210000000969 egg white Anatomy 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- QVRMIFPCQGQMKB-LZSLGQGWSA-N (2e,4e)-5-(3,4-dihydroxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(O)C(O)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 QVRMIFPCQGQMKB-LZSLGQGWSA-N 0.000 description 2
- GOYMYMMZRLPMPO-ASVGJQBISA-N (2e,4e)-5-(4-hydroxy-3,5-dimethoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound COC1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 GOYMYMMZRLPMPO-ASVGJQBISA-N 0.000 description 2
- QEPIYJYWBSRCCP-VQHVLOKHSA-N (e)-3-(4-hydroxy-3-methoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]prop-2-enamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 QEPIYJYWBSRCCP-VQHVLOKHSA-N 0.000 description 2
- UTTFITRHZWYNIZ-VPXADRJXSA-N 2,3-dihydroxybutanedioic acid (2E,4E)-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound OC(=O)C(O)C(O)C(O)=O.COC1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 UTTFITRHZWYNIZ-VPXADRJXSA-N 0.000 description 2
- VIGMLAAKWQNCMP-UHFFFAOYSA-N 2-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 VIGMLAAKWQNCMP-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- KAIRZPVWWIMPFT-UHFFFAOYSA-N 3-piperidin-4-yl-1h-indole Chemical compound C1CNCCC1C1=CNC2=CC=CC=C12 KAIRZPVWWIMPFT-UHFFFAOYSA-N 0.000 description 2
- UYGBSRJODQHNLQ-UHFFFAOYSA-N 4-hydroxy-3,5-dimethylbenzaldehyde Chemical compound CC1=CC(C=O)=CC(C)=C1O UYGBSRJODQHNLQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 206010002198 Anaphylactic reaction Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 206010010744 Conjunctivitis allergic Diseases 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 206010039085 Rhinitis allergic Diseases 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 206010052568 Urticaria chronic Diseases 0.000 description 2
- 238000007239 Wittig reaction Methods 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 201000009961 allergic asthma Diseases 0.000 description 2
- 208000002205 allergic conjunctivitis Diseases 0.000 description 2
- 201000010105 allergic rhinitis Diseases 0.000 description 2
- 208000003455 anaphylaxis Diseases 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 208000024998 atopic conjunctivitis Diseases 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000006285 cell suspension Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 208000024376 chronic urticaria Diseases 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- UIKBOJQCBFQWBO-XMGZOKRTSA-N ethyl [4-[(1e,3e)-5-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] carbonate Chemical compound C1=C(OC)C(OC(=O)OCC)=C(OC)C=C1\C=C\C=C\C(=O)NCCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 UIKBOJQCBFQWBO-XMGZOKRTSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 210000000416 exudates and transudate Anatomy 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229960003975 potassium Drugs 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- HTKTXNNPGRFLBL-ASVGJQBISA-N (2e,4e)-5-(3,4-dimethoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 HTKTXNNPGRFLBL-ASVGJQBISA-N 0.000 description 1
- IIJQQTQIYYXRDB-LZSLGQGWSA-N (2e,4e)-5-(3-chloro-4-hydroxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(Cl)C(O)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 IIJQQTQIYYXRDB-LZSLGQGWSA-N 0.000 description 1
- ZFNUHPLDGRGPCX-LAKPREEESA-N (2e,4e)-5-(4-hydroxy-3,5-dimethoxyphenyl)-n-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]penta-2,4-dienamide Chemical compound COC1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 ZFNUHPLDGRGPCX-LAKPREEESA-N 0.000 description 1
- GOSUUJBBQTWXPJ-VNQMDCGWSA-N (2e,4e)-5-(4-hydroxy-3-methoxyphenyl)-n-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butyl]penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 GOSUUJBBQTWXPJ-VNQMDCGWSA-N 0.000 description 1
- AVPJHQMJTAPAJL-RIALUSDFSA-N (2e,4e)-5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=C(OC)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 AVPJHQMJTAPAJL-RIALUSDFSA-N 0.000 description 1
- WYWAOVONCHAHDE-WGBQWRKPSA-N (2e,4e)-5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-n-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=C(OC)C=C1\C=C\C=C\C(=O)NCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 WYWAOVONCHAHDE-WGBQWRKPSA-N 0.000 description 1
- NVAUSNYOICRQPY-YDFGWWAZSA-N (2e,4e)-5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(OC)C=C(\C=C\C=C\C(O)=O)C=C1OC NVAUSNYOICRQPY-YDFGWWAZSA-N 0.000 description 1
- DWJXMXOVVOMIKP-HRVWGNOLSA-N (2e,4e)-5-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(C(C)(C)C)C(OCOCCOC)=C(C(C)(C)C)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 DWJXMXOVVOMIKP-HRVWGNOLSA-N 0.000 description 1
- UABMPNAUYQXVOQ-ZUVMSYQZSA-N (2e,4e)-5-[3-chloro-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=CC=C(\C=C\C=C\C(O)=O)C=C1Cl UABMPNAUYQXVOQ-ZUVMSYQZSA-N 0.000 description 1
- XBQRYIOHRRHUGO-YDFGWWAZSA-N (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3,5-dimethylphenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(C)C=C(\C=C\C=C\C(O)=O)C=C1C XBQRYIOHRRHUGO-YDFGWWAZSA-N 0.000 description 1
- VUEKURPWEQMKMU-GGWOSOGESA-N (2e,4e)-5-[4-methoxy-3-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=CC(\C=C\C=C\C(O)=O)=CC=C1OC VUEKURPWEQMKMU-GGWOSOGESA-N 0.000 description 1
- JQBGXQUXDFQQNI-BPNXTJCCSA-N (2e,4e)-n-[2-(4-benzhydryloxypiperidin-1-yl)ethyl]-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)OC(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 JQBGXQUXDFQQNI-BPNXTJCCSA-N 0.000 description 1
- SRJGZDANSKZOLR-RIALUSDFSA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide Chemical compound COC1=C(OC)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 SRJGZDANSKZOLR-RIALUSDFSA-N 0.000 description 1
- PILNHTKERYLKKC-ASVGJQBISA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 PILNHTKERYLKKC-ASVGJQBISA-N 0.000 description 1
- LBABYBJOJBEXIU-ASVGJQBISA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienamide Chemical compound C1=C(C)C(OCOCCOC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 LBABYBJOJBEXIU-ASVGJQBISA-N 0.000 description 1
- KPJZHOPZRAFDTN-ZRGWGRIASA-N (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@H](CO)CC)C2)=C3C2=CN(C)C3=C1 KPJZHOPZRAFDTN-ZRGWGRIASA-N 0.000 description 1
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 1
- VFHPKRBLCTUMIO-IHWYPQMZSA-N (Z)-3-phosphonobut-2-enoic acid Chemical compound OP(=O)(O)C(/C)=C\C(O)=O VFHPKRBLCTUMIO-IHWYPQMZSA-N 0.000 description 1
- DOYQIFNDQMFQSA-GQCTYLIASA-N (e)-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enoic acid Chemical compound COCCOCOC1=CC=C(\C=C\C(O)=O)C=C1OC DOYQIFNDQMFQSA-GQCTYLIASA-N 0.000 description 1
- VPSPZJRWTCSRGA-OFZQCTFJSA-N (e)-but-2-enedioic acid;(2e,4e)-5-(4-hydroxy-3,5-dimethoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound OC(=O)\C=C\C(O)=O.COC1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 VPSPZJRWTCSRGA-OFZQCTFJSA-N 0.000 description 1
- YXCKSLDHVQYICC-CSKARUKUSA-N (e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enamide Chemical compound C1=C(OC)C(OCOCCOC)=CC=C1\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 YXCKSLDHVQYICC-CSKARUKUSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- MASDFXZJIDNRTR-UHFFFAOYSA-N 1,3-bis(trimethylsilyl)urea Chemical compound C[Si](C)(C)NC(=O)N[Si](C)(C)C MASDFXZJIDNRTR-UHFFFAOYSA-N 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- BIAAQBNMRITRDV-UHFFFAOYSA-N 1-(chloromethoxy)-2-methoxyethane Chemical compound COCCOCCl BIAAQBNMRITRDV-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- CHZXTOCAICMPQR-UHFFFAOYSA-N 2-(2-bromoethyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCBr)C(=O)C2=C1 CHZXTOCAICMPQR-UHFFFAOYSA-N 0.000 description 1
- VKJCJJYNVIYVQR-UHFFFAOYSA-N 2-(3-bromopropyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCBr)C(=O)C2=C1 VKJCJJYNVIYVQR-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 1
- UZPJXXDTHSFGPR-UHFFFAOYSA-N 2-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 UZPJXXDTHSFGPR-UHFFFAOYSA-N 0.000 description 1
- ZQKOGGITTXFXDU-UHFFFAOYSA-N 2-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 ZQKOGGITTXFXDU-UHFFFAOYSA-N 0.000 description 1
- AVZBOAGCVKEESJ-UHFFFAOYSA-O 2-ethyl-1,2-benzoxazol-2-ium-7-ol Chemical class C1=CC(O)=C2O[N+](CC)=CC2=C1 AVZBOAGCVKEESJ-UHFFFAOYSA-O 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- OCMQWPUBOZJTLP-UHFFFAOYSA-N 3,5-dichloro-4-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=C(Cl)C=C(C=O)C=C1Cl OCMQWPUBOZJTLP-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- HXPAVOPKYPZNSP-UHFFFAOYSA-N 3-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-1h-benzimidazol-2-one Chemical compound C1=CC=C2C(C3CCN(CC3)CCN3C4=CC=CC=C4NC3=O)=CNC2=C1 HXPAVOPKYPZNSP-UHFFFAOYSA-N 0.000 description 1
- XTSWIXOWDXKQBT-UHFFFAOYSA-N 3-[4-(1h-indol-3-yl)piperidin-1-yl]propan-1-amine Chemical compound C1CN(CCCN)CCC1C1=CNC2=CC=CC=C12 XTSWIXOWDXKQBT-UHFFFAOYSA-N 0.000 description 1
- VWCIFOMVYQSZBO-UHFFFAOYSA-N 3-methoxy-2-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=C(OC)C=CC=C1C=O VWCIFOMVYQSZBO-UHFFFAOYSA-N 0.000 description 1
- QJRXOHILAQUDNO-UHFFFAOYSA-N 4-(2-methoxyethoxymethoxy)-3,5-di(propan-2-yl)benzaldehyde Chemical compound COCCOCOC1=C(C(C)C)C=C(C=O)C=C1C(C)C QJRXOHILAQUDNO-UHFFFAOYSA-N 0.000 description 1
- MPSPDUBVKSZXLF-UHFFFAOYSA-N 4-(2-methoxyethoxymethoxy)-3,5-dimethylbenzaldehyde Chemical compound COCCOCOC1=C(C)C=C(C=O)C=C1C MPSPDUBVKSZXLF-UHFFFAOYSA-N 0.000 description 1
- NTFBLWDLEPWZEH-UHFFFAOYSA-N 4-(2-methoxyethoxymethoxy)-3-methylbenzaldehyde Chemical compound COCCOCOC1=CC=C(C=O)C=C1C NTFBLWDLEPWZEH-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- JLQULPQWPLYQSS-UHFFFAOYSA-N 4-[4-(1h-indol-3-yl)piperidin-1-yl]butan-1-amine Chemical compound C1CN(CCCCN)CCC1C1=CNC2=CC=CC=C12 JLQULPQWPLYQSS-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- MIUJMGOCVMQIOM-GFULKKFKSA-N C(C)(C)(C)C1(CC=C(C=C1C(C)(C)C)/C=C/C=C/C(=O)O)OCOCCOC Chemical compound C(C)(C)(C)C1(CC=C(C=C1C(C)(C)C)/C=C/C=C/C(=O)O)OCOCCOC MIUJMGOCVMQIOM-GFULKKFKSA-N 0.000 description 1
- HIYAVKIYRIFSCZ-CVXKHCKVSA-N Calcimycin Chemical compound CC([C@H]1OC2([C@@H](C[C@H]1C)C)O[C@H]([C@H](CC2)C)CC=1OC2=CC=C(C(=C2N=1)C(O)=O)NC)C(=O)C1=CC=CN1 HIYAVKIYRIFSCZ-CVXKHCKVSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 1
- VPNRQRCYDDIEJE-JRXQYWPASA-N ClC=1C=C(C=C(C1O)Cl)/C=C/C=C/C(=O)NCCN1CC(CCC1)C1=CNC2=CC=CC=C12 Chemical compound ClC=1C=C(C=C(C1O)Cl)/C=C/C=C/C(=O)NCCN1CC(CCC1)C1=CNC2=CC=CC=C12 VPNRQRCYDDIEJE-JRXQYWPASA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229920002527 Glycogen Polymers 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- 108010076876 Keratins Proteins 0.000 description 1
- 102000011782 Keratins Human genes 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- KMRFTKHVDLAEEW-RIALUSDFSA-N [4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] acetate Chemical compound COC1=C(OC(C)=O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 KMRFTKHVDLAEEW-RIALUSDFSA-N 0.000 description 1
- LYBZFIUEFPLKHW-RIALUSDFSA-N [4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]-2-methoxyphenyl] propanoate Chemical compound C1=C(OC)C(OC(=O)CC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 LYBZFIUEFPLKHW-RIALUSDFSA-N 0.000 description 1
- LVNGLDSNRYEGSR-HCCCJCESSA-N [4-[(1e,3e)-5-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] propanoate;hydrochloride Chemical compound Cl.C1=C(OC)C(OC(=O)CC)=C(OC)C=C1\C=C\C=C\C(=O)NCCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 LVNGLDSNRYEGSR-HCCCJCESSA-N 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000002052 anaphylactic effect Effects 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000004657 aryl sulfonyl amino group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- HKNWKTRXBJXGMT-UHFFFAOYSA-N barium palladium Chemical compound [Pd].[Ba] HKNWKTRXBJXGMT-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N beta-methyl-butyric acid Natural products CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- HIYAVKIYRIFSCZ-UHFFFAOYSA-N calcium ionophore A23187 Natural products N=1C2=C(C(O)=O)C(NC)=CC=C2OC=1CC(C(CC1)C)OC1(C(CC1C)C)OC1C(C)C(=O)C1=CC=CN1 HIYAVKIYRIFSCZ-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- GXGAKHNRMVGRPK-UHFFFAOYSA-N dimagnesium;dioxido-bis[[oxido(oxo)silyl]oxy]silane Chemical compound [Mg+2].[Mg+2].[O-][Si](=O)O[Si]([O-])([O-])O[Si]([O-])=O GXGAKHNRMVGRPK-UHFFFAOYSA-N 0.000 description 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- KJXYSJQEAKWUCZ-YDFGWWAZSA-N ethyl (2e,4e)-5-[3,5-dichloro-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC(Cl)=C(OCOCCOC)C(Cl)=C1 KJXYSJQEAKWUCZ-YDFGWWAZSA-N 0.000 description 1
- WCAFCCGSNVLMJV-XSIURBDDSA-N ethyl (2e,4e)-5-[3-methoxy-2-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC=CC(OC)=C1OCOCCOC WCAFCCGSNVLMJV-XSIURBDDSA-N 0.000 description 1
- HMXINTVTGJNVIQ-GFULKKFKSA-N ethyl (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3,5-di(propan-2-yl)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC(C(C)C)=C(OCOCCOC)C(C(C)C)=C1 HMXINTVTGJNVIQ-GFULKKFKSA-N 0.000 description 1
- QKLIKSYCQCEPQU-CDJQDVQCSA-N ethyl (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3,5-dimethylphenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC(C)=C(OCOCCOC)C(C)=C1 QKLIKSYCQCEPQU-CDJQDVQCSA-N 0.000 description 1
- MIHUTPSXHLWIBL-KQQUZDAGSA-N ethyl (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC=C(OCOCCOC)C(C)=C1 MIHUTPSXHLWIBL-KQQUZDAGSA-N 0.000 description 1
- XYOKDXPWZKFBSN-KQQUZDAGSA-N ethyl (2e,4e)-5-[4-methoxy-3-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC=C(OC)C(OCOCCOC)=C1 XYOKDXPWZKFBSN-KQQUZDAGSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- VOXCUZFWWKTYKT-PIHCAMFYSA-N ethyl [4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] carbonate Chemical compound C1=C(OC)C(OC(=O)OCC)=C(OC)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 VOXCUZFWWKTYKT-PIHCAMFYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 229940096919 glycogen Drugs 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229940099273 magnesium trisilicate Drugs 0.000 description 1
- 229910000386 magnesium trisilicate Inorganic materials 0.000 description 1
- 235000019793 magnesium trisilicate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229960001186 methysergide Drugs 0.000 description 1
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 1
- 125000005933 neopentyloxycarbonyl group Chemical group 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- CGACFPIPJPCEQI-UHFFFAOYSA-N thiochloric s-acid Chemical compound SCl(=O)=O CGACFPIPJPCEQI-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000004360 trifluorophenyl group Chemical group 0.000 description 1
- 125000001680 trimethoxyphenyl group Chemical group 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU905861A HU206703B (en) | 1988-01-14 | 1989-01-13 | Process for producing indolyl-piperidine derivatives and pharmaceutical compositions containing them |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB888800795A GB8800795D0 (en) | 1988-01-14 | 1988-01-14 | New indolylpiperidine compounds processes for preparations thereof & pharmaceutical composition comprising same |
| GB888818260A GB8818260D0 (en) | 1988-08-01 | 1988-08-01 | New indolylpiperidine compounds processes for preparation thereof & pharmaceutical composition comprising same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT49871A HUT49871A (en) | 1989-11-28 |
| HU202224B true HU202224B (en) | 1991-02-28 |
Family
ID=26293316
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU89132A HU202224B (en) | 1988-01-14 | 1989-01-13 | Process for producing indolylpiperidine derivatives and pharmaceutical compositions comprising same |
| HU95P/P00342P HU211485A9 (en) | 1988-01-14 | 1995-06-22 | Indolylpiperidine compounds, processes for the preparation thereof and pharmaceutical composition comprising the same |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU95P/P00342P HU211485A9 (en) | 1988-01-14 | 1995-06-22 | Indolylpiperidine compounds, processes for the preparation thereof and pharmaceutical composition comprising the same |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US4935432A (enExample) |
| EP (1) | EP0324431B1 (enExample) |
| JP (1) | JPH0759577B2 (enExample) |
| KR (1) | KR0130899B1 (enExample) |
| CN (1) | CN1021733C (enExample) |
| AU (1) | AU620583B2 (enExample) |
| CA (1) | CA1336605C (enExample) |
| DE (1) | DE68901039D1 (enExample) |
| DK (1) | DK733788A (enExample) |
| ES (1) | ES2032339T3 (enExample) |
| FI (1) | FI91863C (enExample) |
| GR (1) | GR3004987T3 (enExample) |
| HU (2) | HU202224B (enExample) |
| IE (1) | IE63476B1 (enExample) |
| IL (1) | IL88903A (enExample) |
| NO (1) | NO172539C (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK733788A (da) * | 1988-01-14 | 1989-07-15 | Fujisawa Pharmaceutical Co | Indolylpiperidinderivater og fremgangsmaade til fremstilling deraf |
| US5521196A (en) * | 1994-10-05 | 1996-05-28 | Eli Lilly And Company | 5-HT1F agonists for the treatment of migraine |
| US5521197A (en) * | 1994-12-01 | 1996-05-28 | Eli Lilly And Company | 3-<1-alkylenearyl>-4-<1,2,3,6-tetrahydropyridinyl>-and 3-<1-alkylenearyl>-4-piperidinyl-1h-indoles: new 5-HT1F agonists |
| DE19500689A1 (de) * | 1995-01-12 | 1996-07-18 | Merck Patent Gmbh | Indolpiperidin-Derivate |
| CZ288897A3 (cs) * | 1995-03-20 | 1998-02-18 | Eli Lilly And Company | V poloze 5-substituovaný 3-(1,2,3,6-tetrahydropyridin-4-yl)indol a 3-(piperidin-4-yl)indol a farmaceutický prostředek, který je obsahuje |
| US6458806B1 (en) * | 1996-08-15 | 2002-10-01 | Millennium Pharmaceuticals, Inc. | Aryl alkenamides derivatives as MCP-1 antagonists |
| ES2165274B1 (es) * | 1999-06-04 | 2003-04-01 | Almirall Prodesfarma Sa | Nuevos derivados de indolilpiperidina como agentes antihistaminicos y antialergicos. |
| AU5567000A (en) * | 1999-06-24 | 2001-01-09 | Toray Industries, Inc. | Alpha1b-adrenergic receptor antagonists |
| US6376514B1 (en) * | 2000-10-17 | 2002-04-23 | The Procter & Gamble Co. | Substituted six-membered heterocyclic compounds useful for treating multidrug resistance and compositions and methods thereof |
| US6693099B2 (en) * | 2000-10-17 | 2004-02-17 | The Procter & Gamble Company | Substituted piperazine compounds optionally containing a quinolyl moiety for treating multidrug resistance |
| ES2172436B1 (es) | 2000-10-31 | 2004-01-16 | Almirall Prodesfarma Sa | Derivados de indolilpiperidina como agentes antihistaminicos y antialergicos. |
| AU2002336273A1 (en) | 2001-03-09 | 2002-09-24 | Ortho-Mcneil Pharmaceutical, Inc. | Heterocyclic compounds and their use as histamine h4 ligands. |
| ES2201907B1 (es) | 2002-05-29 | 2005-06-01 | Almirall Prodesfarma, S.A. | Nuevos derivados de indolilpiperidina como potentes agentes antihistaminicos y antialergicos. |
| PL375964A1 (en) * | 2002-09-06 | 2005-12-12 | Janssen Pharmaceutica, N.V. | Use of indolyl derivatives for the manufacture of a medicament for the treatment allergic rhinitis |
| NZ538401A (en) | 2002-09-06 | 2008-03-28 | Janssen Pharmaceutica Nv | (1H-benzoimidazol-2-yl)-(piperazinyl)-methanone derivatives and related compounds as histamine H4-receptor antagonists for the treatment of inflammatory and allergic disorders |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2193584B1 (enExample) * | 1972-07-28 | 1975-08-08 | Roussel Uclaf | |
| GB1425354A (en) * | 1973-10-10 | 1976-02-18 | Wyeth John & Brother Ltd | Indole derivatives |
| FR2258843B1 (enExample) * | 1974-01-30 | 1977-09-09 | Roussel Uclaf | |
| IL48508A (en) * | 1974-12-09 | 1979-10-31 | Roussel Uclaf | Pharmaceutical compositions comprising piperidylindole derivatives |
| FR2349331A1 (fr) * | 1976-04-30 | 1977-11-25 | Roussel Uclaf | Nouveaux derives de 2,3 dihydro a/4-(3-indolyl) 1-piperidinyl/methyl 1,4-benzodioxin-2-methanol, un procede pour leur preparation et leur application comme medicaments |
| US4359468A (en) * | 1981-02-25 | 1982-11-16 | Boehringer Ingelheim Ltd. | Antiallergic N-[4-(indolyl)-piperidino-alkyl]-benzimidazolones |
| JPS57188567A (en) * | 1981-05-13 | 1982-11-19 | Fujimoto Seiyaku Kk | Novel preparation of etomidoline |
| US4443461A (en) * | 1981-09-10 | 1984-04-17 | John Wyeth & Brother Limited | N-[2-[[1-[1H-Indolylalkyl- or oxoalkyl]-4-piperidinyl]-amino]-2-oxoethyl]-arylcarboxamide derivatives |
| FR2533924A1 (fr) * | 1982-10-05 | 1984-04-06 | Roussel Uclaf | Nouveaux derives du 4-(1h-indol-3-yl)a-methyl piperidine-1-ethanol, leurs sels, le procede de preparation, l'application a titre de medicaments et les compositions les renfermant |
| JPS60142981A (ja) * | 1983-12-28 | 1985-07-29 | Yoshitomi Pharmaceut Ind Ltd | 3−インド−ルカルボキサミド誘導体 |
| US4673684A (en) * | 1984-04-04 | 1987-06-16 | Terumo Corporation | Amide derivatives and 5-lipoxygenase inhibitors containing the same as an active ingredient |
| US4548939A (en) * | 1984-10-01 | 1985-10-22 | Janssen Pharmaceutica N. V. | 1H-Indol-3-yl containing 1,3-dimethyl-1H-purine-2,6-diones |
| IE58370B1 (en) * | 1985-04-10 | 1993-09-08 | Lundbeck & Co As H | Indole derivatives |
| US4742057A (en) * | 1985-12-05 | 1988-05-03 | Fujisawa Pharmaceutical Co., Ltd. | Antiallergic thiazole compounds |
| DK733788A (da) * | 1988-01-14 | 1989-07-15 | Fujisawa Pharmaceutical Co | Indolylpiperidinderivater og fremgangsmaade til fremstilling deraf |
| GB8819024D0 (en) * | 1988-08-10 | 1988-09-14 | Glaxo Group Ltd | Chemical compounds |
| GB8903036D0 (en) * | 1989-02-10 | 1989-03-30 | Glaxo Group Ltd | Chemical compounds |
-
1988
- 1988-12-30 DK DK733788A patent/DK733788A/da not_active Application Discontinuation
-
1989
- 1989-01-06 IL IL88903A patent/IL88903A/xx not_active IP Right Cessation
- 1989-01-09 IE IE4889A patent/IE63476B1/en not_active IP Right Cessation
- 1989-01-10 DE DE8989100332T patent/DE68901039D1/de not_active Expired - Fee Related
- 1989-01-10 ES ES198989100332T patent/ES2032339T3/es not_active Expired - Lifetime
- 1989-01-10 EP EP89100332A patent/EP0324431B1/en not_active Expired - Lifetime
- 1989-01-11 AU AU28370/89A patent/AU620583B2/en not_active Ceased
- 1989-01-11 US US07/295,569 patent/US4935432A/en not_active Expired - Fee Related
- 1989-01-11 FI FI890123A patent/FI91863C/fi not_active IP Right Cessation
- 1989-01-13 HU HU89132A patent/HU202224B/hu not_active IP Right Cessation
- 1989-01-13 KR KR1019890000297A patent/KR0130899B1/ko not_active Expired - Fee Related
- 1989-01-13 NO NO890155A patent/NO172539C/no unknown
- 1989-01-13 JP JP1007272A patent/JPH0759577B2/ja not_active Expired - Lifetime
- 1989-01-13 CN CN89100182A patent/CN1021733C/zh not_active Expired - Fee Related
- 1989-01-13 CA CA000588224A patent/CA1336605C/en not_active Expired - Fee Related
- 1989-09-28 US US07/414,022 patent/US5017703A/en not_active Expired - Fee Related
-
1992
- 1992-06-19 GR GR910402226T patent/GR3004987T3/el unknown
-
1995
- 1995-06-22 HU HU95P/P00342P patent/HU211485A9/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE890048L (en) | 1989-07-14 |
| IE63476B1 (en) | 1995-04-19 |
| EP0324431B1 (en) | 1992-03-25 |
| US5017703A (en) | 1991-05-21 |
| ES2032339T3 (es) | 1993-02-01 |
| IL88903A0 (en) | 1989-08-15 |
| NO172539B (no) | 1993-04-26 |
| DE68901039D1 (de) | 1992-04-30 |
| NO890155D0 (no) | 1989-01-13 |
| IL88903A (en) | 1993-03-15 |
| GR3004987T3 (enExample) | 1993-04-28 |
| HUT49871A (en) | 1989-11-28 |
| KR890011872A (ko) | 1989-08-23 |
| FI890123A0 (fi) | 1989-01-11 |
| AU2837089A (en) | 1989-07-20 |
| CN1021733C (zh) | 1993-08-04 |
| AU620583B2 (en) | 1992-02-20 |
| EP0324431A1 (en) | 1989-07-19 |
| JPH0759577B2 (ja) | 1995-06-28 |
| FI91863B (fi) | 1994-05-13 |
| US4935432A (en) | 1990-06-19 |
| KR0130899B1 (ko) | 1998-04-23 |
| HU211485A9 (en) | 1995-11-28 |
| JPH01221377A (ja) | 1989-09-04 |
| FI91863C (fi) | 1994-08-25 |
| CA1336605C (en) | 1995-08-08 |
| FI890123L (fi) | 1989-07-15 |
| CN1035112A (zh) | 1989-08-30 |
| DK733788A (da) | 1989-07-15 |
| DK733788D0 (da) | 1988-12-30 |
| NO890155L (no) | 1989-07-17 |
| NO172539C (no) | 1993-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU202224B (en) | Process for producing indolylpiperidine derivatives and pharmaceutical compositions comprising same | |
| AU695817B2 (en) | Thiazole derivative as protein kinase C inhibitors | |
| DE69507293T2 (de) | Benzamid-derivate als vasopressin-antagonisten | |
| JP2000502330A (ja) | メタロプロテイナーゼ阻害薬、それらを含有する薬剤組成物および薬剤としてのそれらの使用、ならびにそれらの製造に有用な方法および中間体 | |
| JP2599665B2 (ja) | ピラジン誘導体 | |
| HUT73526A (en) | Benzazepine derivative, pharmaceutical composition containing the same, and intermediate for the same | |
| US4591590A (en) | Benzhydrylpiperazine derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| KR19990063850A (ko) | Nmda 길항제로서의 테트라히드로퀴놀린 | |
| JP2002542228A (ja) | Mmp阻害剤 | |
| JPH06321921A (ja) | 新規化合物 | |
| IE912670A1 (en) | Pharmaceutical compounds | |
| JPH09328469A (ja) | 新規置換アセトアミド化合物 | |
| JP3077295B2 (ja) | チアゾール化合物 | |
| JP2008517907A (ja) | 新規な使用 | |
| HU199813B (en) | Process for producing new benzothiazinone derivatives and pharmaceutical compositions comprising such active ingredient | |
| PH26557A (en) | Indolylpiperidine compounds | |
| HU206703B (en) | Process for producing indolyl-piperidine derivatives and pharmaceutical compositions containing them | |
| PH27110A (en) | New indolypiperidine compounds processes for the preparation thereof and pharmaceutical composition comprising the same | |
| JPH0258278B2 (enExample) | ||
| JPH1045751A (ja) | 新規ピペラジン化合物 | |
| JPH1095777A (ja) | チアゾール誘導体 | |
| MXPA98002534A (en) | Thiazole derivative as protein kinase c inhibitors | |
| JPH05202061A (ja) | 新規セフェム化合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |