FI91863C - Menetelmä valmistaa terapeuttisesti vaikuttavia indolyylipiperidiiniyhdisteitä - Google Patents
Menetelmä valmistaa terapeuttisesti vaikuttavia indolyylipiperidiiniyhdisteitä Download PDFInfo
- Publication number
- FI91863C FI91863C FI890123A FI890123A FI91863C FI 91863 C FI91863 C FI 91863C FI 890123 A FI890123 A FI 890123A FI 890123 A FI890123 A FI 890123A FI 91863 C FI91863 C FI 91863C
- Authority
- FI
- Finland
- Prior art keywords
- piperidine
- salt
- alkoxy
- ethyl
- indolyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 27
- 238000002360 preparation method Methods 0.000 title claims description 20
- HNQZRUDJRPSFAU-UHFFFAOYSA-N 2-piperidin-1-yl-1h-indole Chemical class C1CCCCN1C1=CC2=CC=CC=C2N1 HNQZRUDJRPSFAU-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 84
- -1 4-hydroxy-3,5-dimethoxyphenyl Chemical group 0.000 claims description 82
- 150000003839 salts Chemical class 0.000 claims description 61
- 125000003545 alkoxy group Chemical group 0.000 claims description 34
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000004423 acyloxy group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims description 5
- 125000004450 alkenylene group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- VOXCUZFWWKTYKT-PIHCAMFYSA-N ethyl [4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] carbonate Chemical compound C1=C(OC)C(OC(=O)OCC)=C(OC)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 VOXCUZFWWKTYKT-PIHCAMFYSA-N 0.000 claims description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 57
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 54
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- 238000006243 chemical reaction Methods 0.000 description 40
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 34
- 239000000203 mixture Substances 0.000 description 30
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 27
- 239000002904 solvent Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- 238000000921 elemental analysis Methods 0.000 description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 10
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000003379 elimination reaction Methods 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 230000002411 adverse Effects 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- GOYMYMMZRLPMPO-ASVGJQBISA-N (2e,4e)-5-(4-hydroxy-3,5-dimethoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound COC1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 GOYMYMMZRLPMPO-ASVGJQBISA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 150000007529 inorganic bases Chemical class 0.000 description 4
- 229940098779 methanesulfonic acid Drugs 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- YXNKWHZCUWBSEN-UHFFFAOYSA-N 2-[4-(1h-indol-3-yl)piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1C1=CNC2=CC=CC=C12 YXNKWHZCUWBSEN-UHFFFAOYSA-N 0.000 description 3
- QCVGEOXPDFCNHA-UHFFFAOYSA-N 5,5-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound CC1(C)OC(=O)N(C(N)=O)C1=O QCVGEOXPDFCNHA-UHFFFAOYSA-N 0.000 description 3
- 102000009027 Albumins Human genes 0.000 description 3
- 108010088751 Albumins Proteins 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- 241000700198 Cavia Species 0.000 description 3
- 102000002322 Egg Proteins Human genes 0.000 description 3
- 108010000912 Egg Proteins Proteins 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 238000007239 Wittig reaction Methods 0.000 description 3
- KMRFTKHVDLAEEW-RIALUSDFSA-N [4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] acetate Chemical compound COC1=C(OC(C)=O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 KMRFTKHVDLAEEW-RIALUSDFSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 235000014103 egg white Nutrition 0.000 description 3
- 210000000969 egg white Anatomy 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- QVRMIFPCQGQMKB-LZSLGQGWSA-N (2e,4e)-5-(3,4-dihydroxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(O)C(O)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 QVRMIFPCQGQMKB-LZSLGQGWSA-N 0.000 description 2
- SHCAYSHXUORXNO-LZSLGQGWSA-N (2e,4e)-5-(3,5-dichloro-4-hydroxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(Cl)C(O)=C(Cl)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 SHCAYSHXUORXNO-LZSLGQGWSA-N 0.000 description 2
- FVACAXIERVZNMB-MYUCQOFCSA-N (2e,4e)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 FVACAXIERVZNMB-MYUCQOFCSA-N 0.000 description 2
- QNZXAHIHUWGUCW-XCCLWPCOSA-N (2e,4e)-5-(4-hydroxy-3,5-dimethoxyphenyl)-n-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butyl]penta-2,4-dienamide Chemical compound COC1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 QNZXAHIHUWGUCW-XCCLWPCOSA-N 0.000 description 2
- JMVWLNPNNFQQIF-ASVGJQBISA-N (2e,4e)-5-(4-hydroxy-3,5-dimethylphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound CC1=C(O)C(C)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 JMVWLNPNNFQQIF-ASVGJQBISA-N 0.000 description 2
- RPAKPIHLJIEODQ-VDESZNBCSA-N (2e,4e)-5-(4-hydroxy-3-methoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 RPAKPIHLJIEODQ-VDESZNBCSA-N 0.000 description 2
- GOSUUJBBQTWXPJ-VNQMDCGWSA-N (2e,4e)-5-(4-hydroxy-3-methoxyphenyl)-n-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butyl]penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 GOSUUJBBQTWXPJ-VNQMDCGWSA-N 0.000 description 2
- UIHVYTVOUXWFBI-VDESZNBCSA-N (2e,4e)-5-(4-hydroxy-3-methylphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(O)C(C)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 UIHVYTVOUXWFBI-VDESZNBCSA-N 0.000 description 2
- ZWUFEOKUAIWQNG-PIHCAMFYSA-N (2e,4e)-5-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound CC(C)C1=C(O)C(C(C)C)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 ZWUFEOKUAIWQNG-PIHCAMFYSA-N 0.000 description 2
- YXCKSLDHVQYICC-CSKARUKUSA-N (e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enamide Chemical compound C1=C(OC)C(OCOCCOC)=CC=C1\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 YXCKSLDHVQYICC-CSKARUKUSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- VIGMLAAKWQNCMP-UHFFFAOYSA-N 2-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 VIGMLAAKWQNCMP-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- KAIRZPVWWIMPFT-UHFFFAOYSA-N 3-piperidin-4-yl-1h-indole Chemical compound C1CNCCC1C1=CNC2=CC=CC=C12 KAIRZPVWWIMPFT-UHFFFAOYSA-N 0.000 description 2
- MPSPDUBVKSZXLF-UHFFFAOYSA-N 4-(2-methoxyethoxymethoxy)-3,5-dimethylbenzaldehyde Chemical compound COCCOCOC1=C(C)C=C(C=O)C=C1C MPSPDUBVKSZXLF-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- UYGBSRJODQHNLQ-UHFFFAOYSA-N 4-hydroxy-3,5-dimethylbenzaldehyde Chemical compound CC1=CC(C=O)=CC(C)=C1O UYGBSRJODQHNLQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 206010002198 Anaphylactic reaction Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 108010076876 Keratins Proteins 0.000 description 2
- 102000011782 Keratins Human genes 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- YOFZCLRRRXBCME-PIHCAMFYSA-N [2-ethoxycarbonyloxy-4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]phenyl] ethyl carbonate Chemical compound C1=C(OC(=O)OCC)C(OC(=O)OCC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 YOFZCLRRRXBCME-PIHCAMFYSA-N 0.000 description 2
- XTENRICKNGIPEB-ASVGJQBISA-N [4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]-2-methoxyphenyl] acetate Chemical compound C1=C(OC(C)=O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 XTENRICKNGIPEB-ASVGJQBISA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 230000002009 allergenic effect Effects 0.000 description 2
- 230000036783 anaphylactic response Effects 0.000 description 2
- 208000003455 anaphylaxis Diseases 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000003266 anti-allergic effect Effects 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- XGRJZXREYAXTGV-UHFFFAOYSA-N chlorodiphenylphosphine Chemical compound C=1C=CC=CC=1P(Cl)C1=CC=CC=C1 XGRJZXREYAXTGV-UHFFFAOYSA-N 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- QKLIKSYCQCEPQU-CDJQDVQCSA-N ethyl (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3,5-dimethylphenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC(C)=C(OCOCCOC)C(C)=C1 QKLIKSYCQCEPQU-CDJQDVQCSA-N 0.000 description 2
- UIKBOJQCBFQWBO-XMGZOKRTSA-N ethyl [4-[(1e,3e)-5-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] carbonate Chemical compound C1=C(OC)C(OC(=O)OCC)=C(OC)C=C1\C=C\C=C\C(=O)NCCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 UIKBOJQCBFQWBO-XMGZOKRTSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- RMXCTOJWDUCDBG-FCFGPSFYSA-N (2e,4e)-5-(2-hydroxy-3-methoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound COC1=CC=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1O RMXCTOJWDUCDBG-FCFGPSFYSA-N 0.000 description 1
- HTKTXNNPGRFLBL-ASVGJQBISA-N (2e,4e)-5-(3,4-dimethoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 HTKTXNNPGRFLBL-ASVGJQBISA-N 0.000 description 1
- IIJQQTQIYYXRDB-LZSLGQGWSA-N (2e,4e)-5-(3-chloro-4-hydroxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(Cl)C(O)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 IIJQQTQIYYXRDB-LZSLGQGWSA-N 0.000 description 1
- WBZRSNJBDLZGAV-VDESZNBCSA-N (2e,4e)-5-(3-hydroxy-4-methoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 WBZRSNJBDLZGAV-VDESZNBCSA-N 0.000 description 1
- ZFNUHPLDGRGPCX-LAKPREEESA-N (2e,4e)-5-(4-hydroxy-3,5-dimethoxyphenyl)-n-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]penta-2,4-dienamide Chemical compound COC1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 ZFNUHPLDGRGPCX-LAKPREEESA-N 0.000 description 1
- OFLUWAKDJKAKKU-QVUAPDQZSA-N (2e,4e)-5-(4-hydroxy-3-methoxyphenyl)-n-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 OFLUWAKDJKAKKU-QVUAPDQZSA-N 0.000 description 1
- LRHGZUHQMOAPAC-ZUVMSYQZSA-N (2e,4e)-5-[3,5-dichloro-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(Cl)C=C(\C=C\C=C\C(O)=O)C=C1Cl LRHGZUHQMOAPAC-ZUVMSYQZSA-N 0.000 description 1
- AVPJHQMJTAPAJL-RIALUSDFSA-N (2e,4e)-5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=C(OC)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 AVPJHQMJTAPAJL-RIALUSDFSA-N 0.000 description 1
- WYWAOVONCHAHDE-WGBQWRKPSA-N (2e,4e)-5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-n-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=C(OC)C=C1\C=C\C=C\C(=O)NCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 WYWAOVONCHAHDE-WGBQWRKPSA-N 0.000 description 1
- NVAUSNYOICRQPY-YDFGWWAZSA-N (2e,4e)-5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(OC)C=C(\C=C\C=C\C(O)=O)C=C1OC NVAUSNYOICRQPY-YDFGWWAZSA-N 0.000 description 1
- PQVBJPJDAWWYOM-GFULKKFKSA-N (2e,4e)-5-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(C(C)(C)C)C=C(\C=C\C=C\C(O)=O)C=C1C(C)(C)C PQVBJPJDAWWYOM-GFULKKFKSA-N 0.000 description 1
- HRAHDYQQPPDTRI-VDESZNBCSA-N (2e,4e)-5-[3-chloro-4-(2-methoxyethoxymethoxy)phenyl]-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide Chemical compound C1=C(Cl)C(OCOCCOC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 HRAHDYQQPPDTRI-VDESZNBCSA-N 0.000 description 1
- UABMPNAUYQXVOQ-ZUVMSYQZSA-N (2e,4e)-5-[3-chloro-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=CC=C(\C=C\C=C\C(O)=O)C=C1Cl UABMPNAUYQXVOQ-ZUVMSYQZSA-N 0.000 description 1
- IMVFSLPDWZSWLA-PLPQCDBPSA-N (2e,4e)-5-[3-methoxy-2-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(OC)C=CC=C1\C=C\C=C\C(O)=O IMVFSLPDWZSWLA-PLPQCDBPSA-N 0.000 description 1
- PMPCRCWXJJHVKI-CDJQDVQCSA-N (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3,5-di(propan-2-yl)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(C(C)C)C=C(\C=C\C=C\C(O)=O)C=C1C(C)C PMPCRCWXJJHVKI-CDJQDVQCSA-N 0.000 description 1
- XBQRYIOHRRHUGO-YDFGWWAZSA-N (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3,5-dimethylphenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=C(C)C=C(\C=C\C=C\C(O)=O)C=C1C XBQRYIOHRRHUGO-YDFGWWAZSA-N 0.000 description 1
- VUEKURPWEQMKMU-GGWOSOGESA-N (2e,4e)-5-[4-methoxy-3-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid Chemical compound COCCOCOC1=CC(\C=C\C=C\C(O)=O)=CC=C1OC VUEKURPWEQMKMU-GGWOSOGESA-N 0.000 description 1
- JQBGXQUXDFQQNI-BPNXTJCCSA-N (2e,4e)-n-[2-(4-benzhydryloxypiperidin-1-yl)ethyl]-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)OC(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 JQBGXQUXDFQQNI-BPNXTJCCSA-N 0.000 description 1
- PILNHTKERYLKKC-ASVGJQBISA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 PILNHTKERYLKKC-ASVGJQBISA-N 0.000 description 1
- ALCPLYSPYYNRIQ-LMZONGNASA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-[4-(2-methoxyethoxymethoxy)-3,5-di(propan-2-yl)phenyl]penta-2,4-dienamide Chemical compound C1=C(C(C)C)C(OCOCCOC)=C(C(C)C)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 ALCPLYSPYYNRIQ-LMZONGNASA-N 0.000 description 1
- SHBRHLWQMMNPCD-RIALUSDFSA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-[4-(2-methoxyethoxymethoxy)-3,5-dimethylphenyl]penta-2,4-dienamide Chemical compound C1=C(C)C(OCOCCOC)=C(C)C=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 SHBRHLWQMMNPCD-RIALUSDFSA-N 0.000 description 1
- LBABYBJOJBEXIU-ASVGJQBISA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienamide Chemical compound C1=C(C)C(OCOCCOC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 LBABYBJOJBEXIU-ASVGJQBISA-N 0.000 description 1
- JQXUOOAMYNHJGZ-ASVGJQBISA-N (2e,4e)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-5-[4-methoxy-3-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=CC(\C=C\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 JQXUOOAMYNHJGZ-ASVGJQBISA-N 0.000 description 1
- QZSOXMDRRNPQJV-LAKPREEESA-N (2e,4e)-n-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=CC=C1\C=C\C=C\C(=O)NCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 QZSOXMDRRNPQJV-LAKPREEESA-N 0.000 description 1
- FILKQJVWGDWRSU-XCCLWPCOSA-N (2e,4e)-n-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butyl]-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienamide Chemical compound C1=C(OC)C(OCOCCOC)=CC=C1\C=C\C=C\C(=O)NCCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 FILKQJVWGDWRSU-XCCLWPCOSA-N 0.000 description 1
- KPJZHOPZRAFDTN-ZRGWGRIASA-N (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@H](CO)CC)C2)=C3C2=CN(C)C3=C1 KPJZHOPZRAFDTN-ZRGWGRIASA-N 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- QEPIYJYWBSRCCP-VQHVLOKHSA-N (e)-3-(4-hydroxy-3-methoxyphenyl)-n-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]prop-2-enamide Chemical compound C1=C(O)C(OC)=CC(\C=C\C(=O)NCCN2CCC(CC2)C=2C3=CC=CC=C3NC=2)=C1 QEPIYJYWBSRCCP-VQHVLOKHSA-N 0.000 description 1
- DOYQIFNDQMFQSA-GQCTYLIASA-N (e)-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enoic acid Chemical compound COCCOCOC1=CC=C(\C=C\C(O)=O)C=C1OC DOYQIFNDQMFQSA-GQCTYLIASA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- MASDFXZJIDNRTR-UHFFFAOYSA-N 1,3-bis(trimethylsilyl)urea Chemical compound C[Si](C)(C)NC(=O)N[Si](C)(C)C MASDFXZJIDNRTR-UHFFFAOYSA-N 0.000 description 1
- BIAAQBNMRITRDV-UHFFFAOYSA-N 1-(chloromethoxy)-2-methoxyethane Chemical compound COCCOCCl BIAAQBNMRITRDV-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- CHZXTOCAICMPQR-UHFFFAOYSA-N 2-(2-bromoethyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCBr)C(=O)C2=C1 CHZXTOCAICMPQR-UHFFFAOYSA-N 0.000 description 1
- VKJCJJYNVIYVQR-UHFFFAOYSA-N 2-(3-bromopropyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCBr)C(=O)C2=C1 VKJCJJYNVIYVQR-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UZPJXXDTHSFGPR-UHFFFAOYSA-N 2-[3-[4-(1h-indol-3-yl)piperidin-1-yl]propyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 UZPJXXDTHSFGPR-UHFFFAOYSA-N 0.000 description 1
- ZQKOGGITTXFXDU-UHFFFAOYSA-N 2-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 ZQKOGGITTXFXDU-UHFFFAOYSA-N 0.000 description 1
- AVZBOAGCVKEESJ-UHFFFAOYSA-O 2-ethyl-1,2-benzoxazol-2-ium-7-ol Chemical class C1=CC(O)=C2O[N+](CC)=CC2=C1 AVZBOAGCVKEESJ-UHFFFAOYSA-O 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- OCMQWPUBOZJTLP-UHFFFAOYSA-N 3,5-dichloro-4-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=C(Cl)C=C(C=O)C=C1Cl OCMQWPUBOZJTLP-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- DFRLERNBAUTIOZ-UHFFFAOYSA-N 3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=C(C(C)(C)C)C=C(C=O)C=C1C(C)(C)C DFRLERNBAUTIOZ-UHFFFAOYSA-N 0.000 description 1
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 1
- HXPAVOPKYPZNSP-UHFFFAOYSA-N 3-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-1h-benzimidazol-2-one Chemical compound C1=CC=C2C(C3CCN(CC3)CCN3C4=CC=CC=C4NC3=O)=CNC2=C1 HXPAVOPKYPZNSP-UHFFFAOYSA-N 0.000 description 1
- XTSWIXOWDXKQBT-UHFFFAOYSA-N 3-[4-(1h-indol-3-yl)piperidin-1-yl]propan-1-amine Chemical compound C1CN(CCCN)CCC1C1=CNC2=CC=CC=C12 XTSWIXOWDXKQBT-UHFFFAOYSA-N 0.000 description 1
- XILHFEVVZIZSNP-UHFFFAOYSA-N 3-chloro-4-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=CC=C(C=O)C=C1Cl XILHFEVVZIZSNP-UHFFFAOYSA-N 0.000 description 1
- VWCIFOMVYQSZBO-UHFFFAOYSA-N 3-methoxy-2-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=C(OC)C=CC=C1C=O VWCIFOMVYQSZBO-UHFFFAOYSA-N 0.000 description 1
- NTFBLWDLEPWZEH-UHFFFAOYSA-N 4-(2-methoxyethoxymethoxy)-3-methylbenzaldehyde Chemical compound COCCOCOC1=CC=C(C=O)C=C1C NTFBLWDLEPWZEH-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- JLQULPQWPLYQSS-UHFFFAOYSA-N 4-[4-(1h-indol-3-yl)piperidin-1-yl]butan-1-amine Chemical compound C1CN(CCCCN)CCC1C1=CNC2=CC=CC=C12 JLQULPQWPLYQSS-UHFFFAOYSA-N 0.000 description 1
- HIYAVKIYRIFSCZ-CYEMHPAKSA-N 5-(methylamino)-2-[[(2S,3R,5R,6S,8R,9R)-3,5,9-trimethyl-2-[(2S)-1-oxo-1-(1H-pyrrol-2-yl)propan-2-yl]-1,7-dioxaspiro[5.5]undecan-8-yl]methyl]-1,3-benzoxazole-4-carboxylic acid Chemical compound O=C([C@@H](C)[C@H]1O[C@@]2([C@@H](C[C@H]1C)C)O[C@@H]([C@@H](CC2)C)CC=1OC2=CC=C(C(=C2N=1)C(O)=O)NC)C1=CC=CN1 HIYAVKIYRIFSCZ-CYEMHPAKSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- IBNKZNJKFXUVMH-UHFFFAOYSA-N CC(C)C1=CC(=C(C=C1C=O)C(C)C)OCOCCOC Chemical compound CC(C)C1=CC(=C(C=C1C=O)C(C)C)OCOCCOC IBNKZNJKFXUVMH-UHFFFAOYSA-N 0.000 description 1
- LVQTVYNTYKZVFG-DCIPZJNNSA-N CCOC(=O)/C=C/C=C/C1=CC(=CC(C1)(C(C)(C)C)OCOCCOC)C(C)(C)C Chemical compound CCOC(=O)/C=C/C=C/C1=CC(=CC(C1)(C(C)(C)C)OCOCCOC)C(C)(C)C LVQTVYNTYKZVFG-DCIPZJNNSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 206010010744 Conjunctivitis allergic Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- CKLJMWTZIZZHCS-UWTATZPHSA-N D-aspartic acid Chemical class OC(=O)[C@H](N)CC(O)=O CKLJMWTZIZZHCS-UWTATZPHSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920002527 Glycogen Polymers 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical class OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001214257 Mene Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 206010052568 Urticaria chronic Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LYBZFIUEFPLKHW-RIALUSDFSA-N [4-[(1e,3e)-5-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]-2-methoxyphenyl] propanoate Chemical compound C1=C(OC)C(OC(=O)CC)=CC=C1\C=C\C=C\C(=O)NCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 LYBZFIUEFPLKHW-RIALUSDFSA-N 0.000 description 1
- LVNGLDSNRYEGSR-HCCCJCESSA-N [4-[(1e,3e)-5-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butylamino]-5-oxopenta-1,3-dienyl]-2,6-dimethoxyphenyl] propanoate;hydrochloride Chemical compound Cl.C1=C(OC)C(OC(=O)CC)=C(OC)C=C1\C=C\C=C\C(=O)NCCCCN1CCC(C=2C3=CC=CC=C3NC=2)CC1 LVNGLDSNRYEGSR-HCCCJCESSA-N 0.000 description 1
- QPQGTZMAQRXCJW-UHFFFAOYSA-N [chloro(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(Cl)C1=CC=CC=C1 QPQGTZMAQRXCJW-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- 208000002205 allergic conjunctivitis Diseases 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000002052 anaphylactic effect Effects 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 208000024998 atopic conjunctivitis Diseases 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 208000024376 chronic urticaria Diseases 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- GXGAKHNRMVGRPK-UHFFFAOYSA-N dimagnesium;dioxido-bis[[oxido(oxo)silyl]oxy]silane Chemical compound [Mg+2].[Mg+2].[O-][Si](=O)O[Si]([O-])([O-])O[Si]([O-])=O GXGAKHNRMVGRPK-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- KJXYSJQEAKWUCZ-YDFGWWAZSA-N ethyl (2e,4e)-5-[3,5-dichloro-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC(Cl)=C(OCOCCOC)C(Cl)=C1 KJXYSJQEAKWUCZ-YDFGWWAZSA-N 0.000 description 1
- PSCQKIYIHVNMOY-YDFGWWAZSA-N ethyl (2e,4e)-5-[3-chloro-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC=C(OCOCCOC)C(Cl)=C1 PSCQKIYIHVNMOY-YDFGWWAZSA-N 0.000 description 1
- WCAFCCGSNVLMJV-XSIURBDDSA-N ethyl (2e,4e)-5-[3-methoxy-2-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC=CC(OC)=C1OCOCCOC WCAFCCGSNVLMJV-XSIURBDDSA-N 0.000 description 1
- MIHUTPSXHLWIBL-KQQUZDAGSA-N ethyl (2e,4e)-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC=C(OCOCCOC)C(C)=C1 MIHUTPSXHLWIBL-KQQUZDAGSA-N 0.000 description 1
- XYOKDXPWZKFBSN-KQQUZDAGSA-N ethyl (2e,4e)-5-[4-methoxy-3-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoate Chemical compound CCOC(=O)\C=C\C=C\C1=CC=C(OC)C(OCOCCOC)=C1 XYOKDXPWZKFBSN-KQQUZDAGSA-N 0.000 description 1
- LXLODBXSCRTXFG-BQYQJAHWSA-N ethyl (e)-4-diethoxyphosphorylbut-2-enoate Chemical compound CCOC(=O)\C=C\CP(=O)(OCC)OCC LXLODBXSCRTXFG-BQYQJAHWSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 210000000416 exudates and transudate Anatomy 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229940096919 glycogen Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 210000003405 ileum Anatomy 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000002555 ionophore Substances 0.000 description 1
- 230000000236 ionophoric effect Effects 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229940099273 magnesium trisilicate Drugs 0.000 description 1
- 229910000386 magnesium trisilicate Inorganic materials 0.000 description 1
- 235000019793 magnesium trisilicate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 1
- 229960000582 mepyramine Drugs 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960001186 methysergide Drugs 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- JVHPKYBRJQNPAT-UHFFFAOYSA-N n-cyclohexyl-2,2-diphenylethenimine Chemical compound C1CCCCC1N=C=C(C=1C=CC=CC=1)C1=CC=CC=C1 JVHPKYBRJQNPAT-UHFFFAOYSA-N 0.000 description 1
- KERBAAIBDHEFDD-UHFFFAOYSA-N n-ethylformamide Chemical compound CCNC=O KERBAAIBDHEFDD-UHFFFAOYSA-N 0.000 description 1
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 1
- 125000005933 neopentyloxycarbonyl group Chemical group 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- BITYAPCSNKJESK-UHFFFAOYSA-N potassiosodium Chemical compound [Na].[K] BITYAPCSNKJESK-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 125000005930 sec-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- TXEYQDLBPFQVAA-UHFFFAOYSA-N tetrafluoromethane Chemical compound FC(F)(F)F TXEYQDLBPFQVAA-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB888800795A GB8800795D0 (en) | 1988-01-14 | 1988-01-14 | New indolylpiperidine compounds processes for preparations thereof & pharmaceutical composition comprising same |
| GB8800795 | 1988-01-14 | ||
| GB8818260 | 1988-08-01 | ||
| GB888818260A GB8818260D0 (en) | 1988-08-01 | 1988-08-01 | New indolylpiperidine compounds processes for preparation thereof & pharmaceutical composition comprising same |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI890123A0 FI890123A0 (fi) | 1989-01-11 |
| FI890123L FI890123L (fi) | 1989-07-15 |
| FI91863B FI91863B (fi) | 1994-05-13 |
| FI91863C true FI91863C (fi) | 1994-08-25 |
Family
ID=26293316
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI890123A FI91863C (fi) | 1988-01-14 | 1989-01-11 | Menetelmä valmistaa terapeuttisesti vaikuttavia indolyylipiperidiiniyhdisteitä |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US4935432A (enExample) |
| EP (1) | EP0324431B1 (enExample) |
| JP (1) | JPH0759577B2 (enExample) |
| KR (1) | KR0130899B1 (enExample) |
| CN (1) | CN1021733C (enExample) |
| AU (1) | AU620583B2 (enExample) |
| CA (1) | CA1336605C (enExample) |
| DE (1) | DE68901039D1 (enExample) |
| DK (1) | DK733788A (enExample) |
| ES (1) | ES2032339T3 (enExample) |
| FI (1) | FI91863C (enExample) |
| GR (1) | GR3004987T3 (enExample) |
| HU (2) | HU202224B (enExample) |
| IE (1) | IE63476B1 (enExample) |
| IL (1) | IL88903A (enExample) |
| NO (1) | NO172539C (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK733788A (da) * | 1988-01-14 | 1989-07-15 | Fujisawa Pharmaceutical Co | Indolylpiperidinderivater og fremgangsmaade til fremstilling deraf |
| US5521196A (en) * | 1994-10-05 | 1996-05-28 | Eli Lilly And Company | 5-HT1F agonists for the treatment of migraine |
| US5521197A (en) * | 1994-12-01 | 1996-05-28 | Eli Lilly And Company | 3-<1-alkylenearyl>-4-<1,2,3,6-tetrahydropyridinyl>-and 3-<1-alkylenearyl>-4-piperidinyl-1h-indoles: new 5-HT1F agonists |
| DE19500689A1 (de) * | 1995-01-12 | 1996-07-18 | Merck Patent Gmbh | Indolpiperidin-Derivate |
| CZ288897A3 (cs) * | 1995-03-20 | 1998-02-18 | Eli Lilly And Company | V poloze 5-substituovaný 3-(1,2,3,6-tetrahydropyridin-4-yl)indol a 3-(piperidin-4-yl)indol a farmaceutický prostředek, který je obsahuje |
| US6458806B1 (en) * | 1996-08-15 | 2002-10-01 | Millennium Pharmaceuticals, Inc. | Aryl alkenamides derivatives as MCP-1 antagonists |
| ES2165274B1 (es) * | 1999-06-04 | 2003-04-01 | Almirall Prodesfarma Sa | Nuevos derivados de indolilpiperidina como agentes antihistaminicos y antialergicos. |
| AU5567000A (en) * | 1999-06-24 | 2001-01-09 | Toray Industries, Inc. | Alpha1b-adrenergic receptor antagonists |
| US6376514B1 (en) * | 2000-10-17 | 2002-04-23 | The Procter & Gamble Co. | Substituted six-membered heterocyclic compounds useful for treating multidrug resistance and compositions and methods thereof |
| US6693099B2 (en) * | 2000-10-17 | 2004-02-17 | The Procter & Gamble Company | Substituted piperazine compounds optionally containing a quinolyl moiety for treating multidrug resistance |
| ES2172436B1 (es) | 2000-10-31 | 2004-01-16 | Almirall Prodesfarma Sa | Derivados de indolilpiperidina como agentes antihistaminicos y antialergicos. |
| AU2002336273A1 (en) | 2001-03-09 | 2002-09-24 | Ortho-Mcneil Pharmaceutical, Inc. | Heterocyclic compounds and their use as histamine h4 ligands. |
| ES2201907B1 (es) | 2002-05-29 | 2005-06-01 | Almirall Prodesfarma, S.A. | Nuevos derivados de indolilpiperidina como potentes agentes antihistaminicos y antialergicos. |
| PL375964A1 (en) * | 2002-09-06 | 2005-12-12 | Janssen Pharmaceutica, N.V. | Use of indolyl derivatives for the manufacture of a medicament for the treatment allergic rhinitis |
| NZ538401A (en) | 2002-09-06 | 2008-03-28 | Janssen Pharmaceutica Nv | (1H-benzoimidazol-2-yl)-(piperazinyl)-methanone derivatives and related compounds as histamine H4-receptor antagonists for the treatment of inflammatory and allergic disorders |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2193584B1 (enExample) * | 1972-07-28 | 1975-08-08 | Roussel Uclaf | |
| GB1425354A (en) * | 1973-10-10 | 1976-02-18 | Wyeth John & Brother Ltd | Indole derivatives |
| FR2258843B1 (enExample) * | 1974-01-30 | 1977-09-09 | Roussel Uclaf | |
| IL48508A (en) * | 1974-12-09 | 1979-10-31 | Roussel Uclaf | Pharmaceutical compositions comprising piperidylindole derivatives |
| FR2349331A1 (fr) * | 1976-04-30 | 1977-11-25 | Roussel Uclaf | Nouveaux derives de 2,3 dihydro a/4-(3-indolyl) 1-piperidinyl/methyl 1,4-benzodioxin-2-methanol, un procede pour leur preparation et leur application comme medicaments |
| US4359468A (en) * | 1981-02-25 | 1982-11-16 | Boehringer Ingelheim Ltd. | Antiallergic N-[4-(indolyl)-piperidino-alkyl]-benzimidazolones |
| JPS57188567A (en) * | 1981-05-13 | 1982-11-19 | Fujimoto Seiyaku Kk | Novel preparation of etomidoline |
| US4443461A (en) * | 1981-09-10 | 1984-04-17 | John Wyeth & Brother Limited | N-[2-[[1-[1H-Indolylalkyl- or oxoalkyl]-4-piperidinyl]-amino]-2-oxoethyl]-arylcarboxamide derivatives |
| FR2533924A1 (fr) * | 1982-10-05 | 1984-04-06 | Roussel Uclaf | Nouveaux derives du 4-(1h-indol-3-yl)a-methyl piperidine-1-ethanol, leurs sels, le procede de preparation, l'application a titre de medicaments et les compositions les renfermant |
| JPS60142981A (ja) * | 1983-12-28 | 1985-07-29 | Yoshitomi Pharmaceut Ind Ltd | 3−インド−ルカルボキサミド誘導体 |
| US4673684A (en) * | 1984-04-04 | 1987-06-16 | Terumo Corporation | Amide derivatives and 5-lipoxygenase inhibitors containing the same as an active ingredient |
| US4548939A (en) * | 1984-10-01 | 1985-10-22 | Janssen Pharmaceutica N. V. | 1H-Indol-3-yl containing 1,3-dimethyl-1H-purine-2,6-diones |
| IE58370B1 (en) * | 1985-04-10 | 1993-09-08 | Lundbeck & Co As H | Indole derivatives |
| US4742057A (en) * | 1985-12-05 | 1988-05-03 | Fujisawa Pharmaceutical Co., Ltd. | Antiallergic thiazole compounds |
| DK733788A (da) * | 1988-01-14 | 1989-07-15 | Fujisawa Pharmaceutical Co | Indolylpiperidinderivater og fremgangsmaade til fremstilling deraf |
| GB8819024D0 (en) * | 1988-08-10 | 1988-09-14 | Glaxo Group Ltd | Chemical compounds |
| GB8903036D0 (en) * | 1989-02-10 | 1989-03-30 | Glaxo Group Ltd | Chemical compounds |
-
1988
- 1988-12-30 DK DK733788A patent/DK733788A/da not_active Application Discontinuation
-
1989
- 1989-01-06 IL IL88903A patent/IL88903A/xx not_active IP Right Cessation
- 1989-01-09 IE IE4889A patent/IE63476B1/en not_active IP Right Cessation
- 1989-01-10 DE DE8989100332T patent/DE68901039D1/de not_active Expired - Fee Related
- 1989-01-10 ES ES198989100332T patent/ES2032339T3/es not_active Expired - Lifetime
- 1989-01-10 EP EP89100332A patent/EP0324431B1/en not_active Expired - Lifetime
- 1989-01-11 AU AU28370/89A patent/AU620583B2/en not_active Ceased
- 1989-01-11 US US07/295,569 patent/US4935432A/en not_active Expired - Fee Related
- 1989-01-11 FI FI890123A patent/FI91863C/fi not_active IP Right Cessation
- 1989-01-13 HU HU89132A patent/HU202224B/hu not_active IP Right Cessation
- 1989-01-13 KR KR1019890000297A patent/KR0130899B1/ko not_active Expired - Fee Related
- 1989-01-13 NO NO890155A patent/NO172539C/no unknown
- 1989-01-13 JP JP1007272A patent/JPH0759577B2/ja not_active Expired - Lifetime
- 1989-01-13 CN CN89100182A patent/CN1021733C/zh not_active Expired - Fee Related
- 1989-01-13 CA CA000588224A patent/CA1336605C/en not_active Expired - Fee Related
- 1989-09-28 US US07/414,022 patent/US5017703A/en not_active Expired - Fee Related
-
1992
- 1992-06-19 GR GR910402226T patent/GR3004987T3/el unknown
-
1995
- 1995-06-22 HU HU95P/P00342P patent/HU211485A9/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE890048L (en) | 1989-07-14 |
| IE63476B1 (en) | 1995-04-19 |
| EP0324431B1 (en) | 1992-03-25 |
| US5017703A (en) | 1991-05-21 |
| ES2032339T3 (es) | 1993-02-01 |
| IL88903A0 (en) | 1989-08-15 |
| NO172539B (no) | 1993-04-26 |
| DE68901039D1 (de) | 1992-04-30 |
| NO890155D0 (no) | 1989-01-13 |
| IL88903A (en) | 1993-03-15 |
| GR3004987T3 (enExample) | 1993-04-28 |
| HUT49871A (en) | 1989-11-28 |
| KR890011872A (ko) | 1989-08-23 |
| FI890123A0 (fi) | 1989-01-11 |
| AU2837089A (en) | 1989-07-20 |
| CN1021733C (zh) | 1993-08-04 |
| HU202224B (en) | 1991-02-28 |
| AU620583B2 (en) | 1992-02-20 |
| EP0324431A1 (en) | 1989-07-19 |
| JPH0759577B2 (ja) | 1995-06-28 |
| FI91863B (fi) | 1994-05-13 |
| US4935432A (en) | 1990-06-19 |
| KR0130899B1 (ko) | 1998-04-23 |
| HU211485A9 (en) | 1995-11-28 |
| JPH01221377A (ja) | 1989-09-04 |
| CA1336605C (en) | 1995-08-08 |
| FI890123L (fi) | 1989-07-15 |
| CN1035112A (zh) | 1989-08-30 |
| DK733788A (da) | 1989-07-15 |
| DK733788D0 (da) | 1988-12-30 |
| NO890155L (no) | 1989-07-17 |
| NO172539C (no) | 1993-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI91863C (fi) | Menetelmä valmistaa terapeuttisesti vaikuttavia indolyylipiperidiiniyhdisteitä | |
| FI96202B (fi) | Menetelmä valmistaa farmakologisesti arvokasta substituoitua aminokarbonyylioksipropionyyli-histidyyliaminoalkoholiyhdistettä | |
| JP2000502354A (ja) | ビトロネクチン受容体アンタゴニスト | |
| JP2000511173A (ja) | 一酸化窒素産生阻害剤としての新規なインドリルおよびベンゾフラニルカルボキサミド | |
| US4224445A (en) | Thienothiazine derivatives | |
| US4591590A (en) | Benzhydrylpiperazine derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| US6140341A (en) | Aminoalkyl and acylaminoalkyl ethers, process for their preparation, and their use as bradykinin receptor antagonists | |
| US4801598A (en) | Dihydropyridine anti-allergic and anti-inflammatory agents | |
| US5523410A (en) | Intermediate for synthesis and production of amino acid derivative | |
| JP2671059B2 (ja) | ナフトエ酸誘導体 | |
| JP2531329B2 (ja) | 新規化合物 | |
| KR100248643B1 (ko) | 아릴 및 헤테로아릴 알콕시나프탈렌 유도체 | |
| US4460777A (en) | N-Substituted-2-pyridylindoles | |
| JP4125803B2 (ja) | イオウを含有する複素環式ブラジキニンアンタゴニスト、それらの製造法およびそれらの使用 | |
| RU2124514C1 (ru) | Пролекарства 3-ацил-2-оксиндол-1-карбоксамидов, фармацевтическая композиция | |
| US4096263A (en) | 1,2,3,4-Tetrahydroisoquinolines and the preparation thereof | |
| US4958023A (en) | 2-pyridinecarbothioamides, processes for preparation thereof and pharmaceutical compositions comprising the same | |
| US4873238A (en) | 2-Pyridinecarbothioamides and pharmaceutical compositions comprising the same | |
| JPH04244073A (ja) | チアゾール化合物 | |
| PH26557A (en) | Indolylpiperidine compounds | |
| PH27110A (en) | New indolypiperidine compounds processes for the preparation thereof and pharmaceutical composition comprising the same | |
| RU2070195C1 (ru) | Аминокислотные производные или их фармацевтически приемлемые соли и фармацевтическая композиция на их основе | |
| HU206703B (en) | Process for producing indolyl-piperidine derivatives and pharmaceutical compositions containing them | |
| JPH10158241A (ja) | 尿素誘導体 | |
| JPH06172318A (ja) | 新規合成中間体およびアミノ酸誘導体の製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB | Publication of examined application | ||
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: FUJISAWA PHARMACEUTICAL CO., LTD. |