HU198010B - Process for producing new pyridazin-amines and pharmaceutical compositions containing them as active components - Google Patents
Process for producing new pyridazin-amines and pharmaceutical compositions containing them as active components Download PDFInfo
- Publication number
- HU198010B HU198010B HU851127A HU112785A HU198010B HU 198010 B HU198010 B HU 198010B HU 851127 A HU851127 A HU 851127A HU 112785 A HU112785 A HU 112785A HU 198010 B HU198010 B HU 198010B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- group
- alkyl
- compound
- phenyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 23
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 14
- LETVJWLLIMJADE-UHFFFAOYSA-N pyridazin-3-amine Chemical class NC1=CC=CN=N1 LETVJWLLIMJADE-UHFFFAOYSA-N 0.000 title claims abstract 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 190
- 150000003839 salts Chemical class 0.000 claims abstract description 31
- 239000002253 acid Substances 0.000 claims abstract description 24
- 239000004480 active ingredient Substances 0.000 claims abstract description 19
- 239000003814 drug Substances 0.000 claims abstract description 4
- 239000002585 base Substances 0.000 claims description 159
- -1 phenylthio, hydroxy, mercapto, amino Chemical group 0.000 claims description 119
- 229910052739 hydrogen Inorganic materials 0.000 claims description 69
- 239000001257 hydrogen Substances 0.000 claims description 67
- 125000000217 alkyl group Chemical group 0.000 claims description 61
- 239000000460 chlorine Substances 0.000 claims description 41
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 40
- 150000002431 hydrogen Chemical class 0.000 claims description 39
- 229910052736 halogen Inorganic materials 0.000 claims description 36
- 150000002367 halogens Chemical class 0.000 claims description 36
- 125000003545 alkoxy group Chemical group 0.000 claims description 33
- 238000002360 preparation method Methods 0.000 claims description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 25
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 21
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 20
- 125000005843 halogen group Chemical group 0.000 claims description 19
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 10
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 9
- 125000001624 naphthyl group Chemical group 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 239000000376 reactant Substances 0.000 claims description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 7
- 239000012442 inert solvent Substances 0.000 claims description 7
- 125000004076 pyridyl group Chemical group 0.000 claims description 7
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 6
- 239000012458 free base Substances 0.000 claims description 6
- 125000005059 halophenyl group Chemical group 0.000 claims description 6
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 5
- 239000000969 carrier Substances 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 239000004305 biphenyl Substances 0.000 claims description 3
- 235000010290 biphenyl Nutrition 0.000 claims description 3
- 125000006267 biphenyl group Chemical group 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 230000029936 alkylation Effects 0.000 claims description 2
- 238000005804 alkylation reaction Methods 0.000 claims description 2
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 238000010306 acid treatment Methods 0.000 claims 1
- 125000000033 alkoxyamino group Chemical group 0.000 claims 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 103
- 239000003443 antiviral agent Substances 0.000 abstract description 2
- 229940079593 drug Drugs 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 108
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 102
- 239000000543 intermediate Substances 0.000 description 85
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 65
- 239000000047 product Substances 0.000 description 56
- 239000000243 solution Substances 0.000 description 53
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 45
- 229960001701 chloroform Drugs 0.000 description 43
- 239000011541 reaction mixture Substances 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 33
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 26
- 238000010992 reflux Methods 0.000 description 23
- 239000000284 extract Substances 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 18
- 125000001309 chloro group Chemical group Cl* 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000003054 catalyst Substances 0.000 description 14
- 239000003480 eluent Substances 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 13
- 229910000029 sodium carbonate Inorganic materials 0.000 description 13
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 11
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 230000000840 anti-viral effect Effects 0.000 description 10
- 239000012074 organic phase Substances 0.000 description 10
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000908 ammonium hydroxide Substances 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 description 8
- 238000004440 column chromatography Methods 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 5
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 230000000120 cytopathologic effect Effects 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- 125000004193 piperazinyl group Chemical group 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- JIWHIRLNKIUYSM-UHFFFAOYSA-N 1-(3-methylphenyl)piperazine Chemical compound CC1=CC=CC(N2CCNCC2)=C1 JIWHIRLNKIUYSM-UHFFFAOYSA-N 0.000 description 4
- UZNICTGTVMYVEC-UHFFFAOYSA-N 3-chloro-6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(Cl)=CC=2)=C1 UZNICTGTVMYVEC-UHFFFAOYSA-N 0.000 description 4
- 241000709661 Enterovirus Species 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- 238000007126 N-alkylation reaction Methods 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- 239000003929 acidic solution Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- KKIMDKMETPPURN-UHFFFAOYSA-N 1-(3-(trifluoromethyl)phenyl)piperazine Chemical compound FC(F)(F)C1=CC=CC(N2CCNCC2)=C1 KKIMDKMETPPURN-UHFFFAOYSA-N 0.000 description 3
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 208000036142 Viral infection Diseases 0.000 description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000004682 monohydrates Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- 230000009385 viral infection Effects 0.000 description 3
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 2
- BKWQKVJYXODDAC-UHFFFAOYSA-N 1,2-dihydropyridazine Chemical compound N1NC=CC=C1 BKWQKVJYXODDAC-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- JGBQQUPVGSNEPI-UHFFFAOYSA-N 1-(2,4,6-trimethylphenyl)piperazine Chemical compound CC1=CC(C)=CC(C)=C1N1CCNCC1 JGBQQUPVGSNEPI-UHFFFAOYSA-N 0.000 description 2
- FNWWTNNFZGBMEM-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-oxocyclohexane-1-carbonitrile Chemical compound C1=CC(F)=CC=C1C1(C#N)CCC(=O)CC1 FNWWTNNFZGBMEM-UHFFFAOYSA-N 0.000 description 2
- QYVKPFCWDRNFQE-UHFFFAOYSA-N 1-benzyl-3-(2,3-dimethylphenyl)piperidin-3-ol;hydrochloride Chemical compound Cl.CC1=CC=CC(C2(O)CN(CC=3C=CC=CC=3)CCC2)=C1C QYVKPFCWDRNFQE-UHFFFAOYSA-N 0.000 description 2
- VPQDANQXTDUFFC-UHFFFAOYSA-N 1-benzyl-3-(3-methylphenyl)pyrrolidin-3-ol;hydrochloride Chemical compound Cl.CC1=CC=CC(C2(O)CN(CC=3C=CC=CC=3)CC2)=C1 VPQDANQXTDUFFC-UHFFFAOYSA-N 0.000 description 2
- MWWYSYLPYMJRLD-UHFFFAOYSA-N 1-benzyl-5-(3-fluorophenyl)-3,6-dihydro-2h-pyridine;hydrochloride Chemical compound Cl.FC1=CC=CC(C=2CN(CC=3C=CC=CC=3)CCC=2)=C1 MWWYSYLPYMJRLD-UHFFFAOYSA-N 0.000 description 2
- ONOBXDPYDHTSBQ-UHFFFAOYSA-N 2,3,4,7-tetrahydro-1h-diazepine Chemical compound C1CC=CCNN1 ONOBXDPYDHTSBQ-UHFFFAOYSA-N 0.000 description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 2
- TUAMRELNJMMDMT-UHFFFAOYSA-N 3,5-xylenol Chemical compound CC1=CC(C)=CC(O)=C1 TUAMRELNJMMDMT-UHFFFAOYSA-N 0.000 description 2
- UGCAPSLJXXAAKL-UHFFFAOYSA-N 3-[4-(3-methylphenyl)piperazin-1-yl]-6-phenylmethoxypyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(OCC=3C=CC=CC=3)=CC=2)=C1 UGCAPSLJXXAAKL-UHFFFAOYSA-N 0.000 description 2
- UKVWKJFQNQXUCK-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-3-ol Chemical compound C=1C=C(Cl)C(C(F)(F)F)=CC=1C1(O)CCCNC1 UKVWKJFQNQXUCK-UHFFFAOYSA-N 0.000 description 2
- YYAXVBUGXIIBPY-UHFFFAOYSA-N 3-[4-hydroxy-4-(3-methylphenyl)piperidin-1-yl]-1h-pyridazin-6-one Chemical compound CC1=CC=CC(C2(O)CCN(CC2)C=2N=NC(O)=CC=2)=C1 YYAXVBUGXIIBPY-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- CSBLMONHKZJULU-UHFFFAOYSA-N 3-chloro-6-(4-pyridin-2-ylpiperazin-1-yl)pyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCN(C=2N=CC=CC=2)CC1 CSBLMONHKZJULU-UHFFFAOYSA-N 0.000 description 2
- DDOAUTHWSCUHQA-UHFFFAOYSA-N 3-methoxy-6-[4-(3-methylphenyl)-1-piperazinyl]pyridazine Chemical compound N1=NC(OC)=CC=C1N1CCN(C=2C=C(C)C=CC=2)CC1 DDOAUTHWSCUHQA-UHFFFAOYSA-N 0.000 description 2
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 206010022998 Irritability Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000012894 fetal calf serum Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229940100688 oral solution Drugs 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- DTUQWGWMVIHBKE-UHFFFAOYSA-N phenylacetaldehyde Chemical compound O=CCC1=CC=CC=C1 DTUQWGWMVIHBKE-UHFFFAOYSA-N 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridine hydrochloride Substances [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- YUWJDPNQDRSTQJ-UHFFFAOYSA-N (1-benzylpiperidin-4-yl) benzoate;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(=O)OC(CC1)CCN1CC1=CC=CC=C1 YUWJDPNQDRSTQJ-UHFFFAOYSA-N 0.000 description 1
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- OIIOPWHTJZYKIL-PMACEKPBSA-N (5S)-5-[[[5-[2-chloro-3-[2-chloro-3-[6-methoxy-5-[[[(2S)-5-oxopyrrolidin-2-yl]methylamino]methyl]pyrazin-2-yl]phenyl]phenyl]-3-methoxypyrazin-2-yl]methylamino]methyl]pyrrolidin-2-one Chemical compound C1(=C(N=C(C2=C(C(C3=CC=CC(=C3Cl)C3=NC(OC)=C(N=C3)CNC[C@H]3NC(=O)CC3)=CC=C2)Cl)C=N1)OC)CNC[C@H]1NC(=O)CC1 OIIOPWHTJZYKIL-PMACEKPBSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000006531 (C2-C5) alkyl group Chemical group 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- MECORNNOSYQMOX-UHFFFAOYSA-N 1,2-dimethylpiperidin-4-ol Chemical compound CC1CC(O)CCN1C MECORNNOSYQMOX-UHFFFAOYSA-N 0.000 description 1
- AMNUAPBXFXNMAV-UHFFFAOYSA-N 1-(1-benzylpiperidin-4-yl)-2-phenylethanone Chemical compound C1CN(CC=2C=CC=CC=2)CCC1C(=O)CC1=CC=CC=C1 AMNUAPBXFXNMAV-UHFFFAOYSA-N 0.000 description 1
- LIKXJDINUMWKQA-UHFFFAOYSA-N 1-(2,3-dimethylphenyl)piperazine Chemical compound CC1=CC=CC(N2CCNCC2)=C1C LIKXJDINUMWKQA-UHFFFAOYSA-N 0.000 description 1
- IVTZRJKKXSKXKO-UHFFFAOYSA-N 1-(2-fluorophenyl)piperazine Chemical compound FC1=CC=CC=C1N1CCNCC1 IVTZRJKKXSKXKO-UHFFFAOYSA-N 0.000 description 1
- BCAXXHXWUVAOCS-UHFFFAOYSA-N 1-(2-methoxyphenyl)-1,4-diazepane;hydrochloride Chemical compound Cl.COC1=CC=CC=C1N1CCNCCC1 BCAXXHXWUVAOCS-UHFFFAOYSA-N 0.000 description 1
- YPSJXNJVWQTPQR-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-(4-pyridazin-3-ylpiperazin-1-yl)cyclohex-3-ene-1-carbonitrile Chemical compound C1=CC(F)=CC=C1C1(C#N)CC=C(N2CCN(CC2)C=2N=NC=CC=2)CC1 YPSJXNJVWQTPQR-UHFFFAOYSA-N 0.000 description 1
- DRPALKDBYYDKLF-UHFFFAOYSA-N 1-(6-chloropyridazin-3-yl)-4-(3-methoxyphenyl)piperidin-4-ol Chemical compound COC1=CC=CC(C2(O)CCN(CC2)C=2N=NC(Cl)=CC=2)=C1 DRPALKDBYYDKLF-UHFFFAOYSA-N 0.000 description 1
- CEWINTJYCMXUFE-UHFFFAOYSA-N 1-(6-chloropyridazin-3-yl)-n-[3-(trifluoromethyl)phenyl]piperidin-4-amine Chemical compound FC(F)(F)C1=CC=CC(NC2CCN(CC2)C=2N=NC(Cl)=CC=2)=C1 CEWINTJYCMXUFE-UHFFFAOYSA-N 0.000 description 1
- GKPCMZDULZMSTC-UHFFFAOYSA-N 1-(6-chloropyridazin-3-yl)piperidin-4-amine Chemical compound C1CC(N)CCN1C1=CC=C(Cl)N=N1 GKPCMZDULZMSTC-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- JEZVJEGZZUZQAP-UHFFFAOYSA-N 1-[2-methoxy-5-(trifluoromethyl)phenyl]piperazine;hydrochloride Chemical compound Cl.COC1=CC=C(C(F)(F)F)C=C1N1CCNCC1 JEZVJEGZZUZQAP-UHFFFAOYSA-N 0.000 description 1
- SLBZOBMDVNPVDX-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]-1,4-diazepane;hydrochloride Chemical compound Cl.FC(F)(F)C1=CC=CC(N2CCNCCC2)=C1 SLBZOBMDVNPVDX-UHFFFAOYSA-N 0.000 description 1
- UPOQTGGAWSMKFF-UHFFFAOYSA-N 1-benzyl-3-(3-fluorophenyl)piperidin-3-ol;hydrochloride Chemical compound Cl.C1C(O)(C=2C=C(F)C=CC=2)CCCN1CC1=CC=CC=C1 UPOQTGGAWSMKFF-UHFFFAOYSA-N 0.000 description 1
- FEIPAYSBTLMYMA-UHFFFAOYSA-N 1-benzyl-3-(3-fluorophenyl)pyrrolidin-3-ol;hydrochloride Chemical compound Cl.C1C(O)(C=2C=C(F)C=CC=2)CCN1CC1=CC=CC=C1 FEIPAYSBTLMYMA-UHFFFAOYSA-N 0.000 description 1
- IRHWLXLKGIBTSE-UHFFFAOYSA-N 1-benzyl-3-(3-methoxyphenyl)pyrrolidin-3-ol;hydrochloride Chemical compound Cl.COC1=CC=CC(C2(O)CN(CC=3C=CC=CC=3)CC2)=C1 IRHWLXLKGIBTSE-UHFFFAOYSA-N 0.000 description 1
- GURFJIOKYNMDLZ-UHFFFAOYSA-N 1-benzyl-3-(3-methylphenyl)piperidin-3-ol;hydrochloride Chemical compound Cl.CC1=CC=CC(C2(O)CN(CC=3C=CC=CC=3)CCC2)=C1 GURFJIOKYNMDLZ-UHFFFAOYSA-N 0.000 description 1
- OVQAJYCAXPHYNV-UHFFFAOYSA-N 1-benzyl-3-methylpiperidin-4-one Chemical compound C1CC(=O)C(C)CN1CC1=CC=CC=C1 OVQAJYCAXPHYNV-UHFFFAOYSA-N 0.000 description 1
- RESWCEVLMQVZDK-UHFFFAOYSA-N 1-benzyl-4-(3-methylphenyl)-2,3-dihydropyrrole;hydrochloride Chemical compound Cl.CC1=CC=CC(C=2CCN(CC=3C=CC=CC=3)C=2)=C1 RESWCEVLMQVZDK-UHFFFAOYSA-N 0.000 description 1
- IUDQYANXUSEYMF-UHFFFAOYSA-N 1-benzyl-5-(2,3-dimethylphenyl)-3,4-dihydro-2h-pyridine Chemical compound CC1=CC=CC(C=2CCCN(CC=3C=CC=CC=3)C=2)=C1C IUDQYANXUSEYMF-UHFFFAOYSA-N 0.000 description 1
- QMTALVXTYDWHRJ-UHFFFAOYSA-N 1-benzyl-5-(2,3-dimethylphenyl)-3,6-dihydro-2h-pyridine Chemical compound CC1=CC=CC(C=2CN(CC=3C=CC=CC=3)CCC=2)=C1C QMTALVXTYDWHRJ-UHFFFAOYSA-N 0.000 description 1
- MLJABRLIHSWNLH-UHFFFAOYSA-N 1-benzyl-n-(2,3-dimethylphenyl)piperidin-3-amine Chemical compound CC1=CC=CC(NC2CN(CC=3C=CC=CC=3)CCC2)=C1C MLJABRLIHSWNLH-UHFFFAOYSA-N 0.000 description 1
- PHNHPMBJCVJOKD-UHFFFAOYSA-N 1-benzyl-n-methyl-n-(3-methylphenyl)piperidin-4-amine Chemical compound C=1C=CC(C)=CC=1N(C)C(CC1)CCN1CC1=CC=CC=C1 PHNHPMBJCVJOKD-UHFFFAOYSA-N 0.000 description 1
- PWWUYRHNABQJKW-UHFFFAOYSA-N 1-benzyl-n-phenylpiperidin-3-amine Chemical compound C=1C=CC=CC=1CN(C1)CCCC1NC1=CC=CC=C1 PWWUYRHNABQJKW-UHFFFAOYSA-N 0.000 description 1
- JRGGUPZKKTVKOV-UHFFFAOYSA-N 1-bromo-3-chlorobenzene Chemical compound ClC1=CC=CC(Br)=C1 JRGGUPZKKTVKOV-UHFFFAOYSA-N 0.000 description 1
- CJIRWMAWYOWROD-UHFFFAOYSA-N 1-chloro-3-prop-1-enylbenzene Chemical compound CC=CC1=CC=CC(Cl)=C1 CJIRWMAWYOWROD-UHFFFAOYSA-N 0.000 description 1
- VVAKEQGKZNKUSU-UHFFFAOYSA-N 2,3-dimethylaniline Chemical compound CC1=CC=CC(N)=C1C VVAKEQGKZNKUSU-UHFFFAOYSA-N 0.000 description 1
- JHQBLYITVCBGTO-UHFFFAOYSA-N 2-(4-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(CC#N)C=C1 JHQBLYITVCBGTO-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- NYWJONVMRVOPNN-UHFFFAOYSA-N 2-phenyl-1-piperidin-4-ylethanone;hydrochloride Chemical compound Cl.C1CNCCC1C(=O)CC1=CC=CC=C1 NYWJONVMRVOPNN-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- YEYKMVJDLWJFOA-UHFFFAOYSA-N 2-propoxyethanol Chemical compound CCCOCCO YEYKMVJDLWJFOA-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- VQAFMTSSCUETHA-UHFFFAOYSA-N 3,6-dibromopyridazine Chemical compound BrC1=CC=C(Br)N=N1 VQAFMTSSCUETHA-UHFFFAOYSA-N 0.000 description 1
- RUVVGCRPPJVNMC-UHFFFAOYSA-N 3,6-dichloro-4,5-dimethylpyridazine Chemical compound CC1=C(C)C(Cl)=NN=C1Cl RUVVGCRPPJVNMC-UHFFFAOYSA-N 0.000 description 1
- RVECZHFENFMRHJ-UHFFFAOYSA-N 3,6-difluoropyridazine Chemical compound FC1=CC=C(F)N=N1 RVECZHFENFMRHJ-UHFFFAOYSA-N 0.000 description 1
- GCLHXKPPHRIJOE-UHFFFAOYSA-N 3,6-diiodopyridazine Chemical compound IC1=CC=C(I)N=N1 GCLHXKPPHRIJOE-UHFFFAOYSA-N 0.000 description 1
- HDGPJJLFNJQOLZ-UHFFFAOYSA-N 3-(2,3-dimethylphenyl)piperidin-3-ol;hydrochloride Chemical compound Cl.CC1=CC=CC(C2(O)CNCCC2)=C1C HDGPJJLFNJQOLZ-UHFFFAOYSA-N 0.000 description 1
- TXQGNZXKUWJMKW-UHFFFAOYSA-N 3-(2,3-dimethylphenyl)piperidine Chemical compound CC1=CC=CC(C2CNCCC2)=C1C TXQGNZXKUWJMKW-UHFFFAOYSA-N 0.000 description 1
- KEZSBVDZJLECRK-UHFFFAOYSA-N 3-(3-chlorophenyl)piperidin-3-ol;hydrochloride Chemical compound Cl.C=1C=CC(Cl)=CC=1C1(O)CCCNC1 KEZSBVDZJLECRK-UHFFFAOYSA-N 0.000 description 1
- NWZNRIBKSVTKPI-UHFFFAOYSA-N 3-(3-fluorophenyl)piperidin-3-ol Chemical compound C=1C=CC(F)=CC=1C1(O)CCCNC1 NWZNRIBKSVTKPI-UHFFFAOYSA-N 0.000 description 1
- MXCZNHNUNCBCBD-UHFFFAOYSA-N 3-(3-fluorophenyl)piperidine;hydrochloride Chemical compound Cl.FC1=CC=CC(C2CNCCC2)=C1 MXCZNHNUNCBCBD-UHFFFAOYSA-N 0.000 description 1
- LBULFOYXFMTUOO-UHFFFAOYSA-N 3-(3-fluorophenyl)pyrrolidin-3-ol;hydrochloride Chemical compound Cl.C=1C=CC(F)=CC=1C1(O)CCNC1 LBULFOYXFMTUOO-UHFFFAOYSA-N 0.000 description 1
- JPVZTWCYQYELIB-UHFFFAOYSA-N 3-(3-methoxyphenyl)piperidin-3-ol;hydrochloride Chemical compound Cl.COC1=CC=CC(C2(O)CNCCC2)=C1 JPVZTWCYQYELIB-UHFFFAOYSA-N 0.000 description 1
- UNDDDVVLBSSKMX-UHFFFAOYSA-N 3-(3-methylphenyl)piperidin-3-ol;hydrochloride Chemical compound Cl.CC1=CC=CC(C2(O)CNCCC2)=C1 UNDDDVVLBSSKMX-UHFFFAOYSA-N 0.000 description 1
- OHFNOQQJKQDEOT-UHFFFAOYSA-N 3-(3-methylphenyl)piperidine Chemical compound CC1=CC=CC(C2CNCCC2)=C1 OHFNOQQJKQDEOT-UHFFFAOYSA-N 0.000 description 1
- NELYUTCWSBAKLX-UHFFFAOYSA-N 3-(3-methylphenyl)pyrrolidin-3-ol Chemical compound CC1=CC=CC(C2(O)CNCC2)=C1 NELYUTCWSBAKLX-UHFFFAOYSA-N 0.000 description 1
- CTURYFLLWYPPDA-UHFFFAOYSA-N 3-(4-bromophenoxy)-6-imidazol-1-ylpyridazine Chemical compound C1=CC(Br)=CC=C1OC1=CC=C(N2C=NC=C2)N=N1 CTURYFLLWYPPDA-UHFFFAOYSA-N 0.000 description 1
- PQIHGUIPVSTFNQ-UHFFFAOYSA-N 3-(4-chlorophenoxy)-6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(OC=3C=CC(Cl)=CC=3)=CC=2)=C1 PQIHGUIPVSTFNQ-UHFFFAOYSA-N 0.000 description 1
- HQAUXRYQTBFNPH-UHFFFAOYSA-N 3-(4-chlorophenoxy)-6-imidazol-1-ylpyridazine Chemical compound C1=CC(Cl)=CC=C1OC1=CC=C(N2C=NC=C2)N=N1 HQAUXRYQTBFNPH-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- GIUAVXNJIRGKJH-UHFFFAOYSA-N 3-[4-(2,3-dimethylphenyl)-3,6-dihydro-2h-pyridin-1-yl]-6-methoxypyridazine Chemical compound N1=NC(OC)=CC=C1N1CC=C(C=2C(=C(C)C=CC=2)C)CC1 GIUAVXNJIRGKJH-UHFFFAOYSA-N 0.000 description 1
- WILZGELSNROLDU-UHFFFAOYSA-N 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-fluoropyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(F)=CC=2)=C1C WILZGELSNROLDU-UHFFFAOYSA-N 0.000 description 1
- LSQAGLPLFCJDHY-UHFFFAOYSA-N 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-iodopyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(I)=CC=2)=C1C LSQAGLPLFCJDHY-UHFFFAOYSA-N 0.000 description 1
- JABQJWNMYMFSJJ-UHFFFAOYSA-N 3-[4-(3-chlorophenyl)piperazin-1-yl]-6-iodopyridazine Chemical compound ClC1=CC=CC(N2CCN(CC2)C=2N=NC(I)=CC=2)=C1 JABQJWNMYMFSJJ-UHFFFAOYSA-N 0.000 description 1
- JFQIDXOJRRAJBE-UHFFFAOYSA-N 3-[4-(3-fluorophenyl)-3,4-dihydro-2h-pyridin-1-yl]-6-methoxypyridazine Chemical compound N1=NC(OC)=CC=C1N1C=CC(C=2C=C(F)C=CC=2)CC1 JFQIDXOJRRAJBE-UHFFFAOYSA-N 0.000 description 1
- ORDSWYBPSSTGFZ-UHFFFAOYSA-N 3-[4-(3-phenylpropyl)piperazin-1-yl]pyridazine Chemical compound C=1C=CC=CC=1CCCN(CC1)CCN1C1=CC=CN=N1 ORDSWYBPSSTGFZ-UHFFFAOYSA-N 0.000 description 1
- KYWCPQNVTKPCCY-UHFFFAOYSA-N 3-bromo-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(Br)=CC=2)=C1C KYWCPQNVTKPCCY-UHFFFAOYSA-N 0.000 description 1
- NISFTMVTRMIFGT-UHFFFAOYSA-N 3-bromo-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazine Chemical compound COC1=CC=CC=C1N1CCN(C=2N=NC(Br)=CC=2)CC1 NISFTMVTRMIFGT-UHFFFAOYSA-N 0.000 description 1
- VEEKGKCCJDLMIG-UHFFFAOYSA-N 3-bromo-6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(Br)=CC=2)=C1 VEEKGKCCJDLMIG-UHFFFAOYSA-N 0.000 description 1
- XMZQWZJMTBCUFT-UHFFFAOYSA-N 3-bromopropylbenzene Chemical compound BrCCCC1=CC=CC=C1 XMZQWZJMTBCUFT-UHFFFAOYSA-N 0.000 description 1
- XFNVOYCATFPHCK-UHFFFAOYSA-N 3-butoxy-6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine Chemical compound N1=NC(OCCCC)=CC=C1N1CCN(C=2C=C(C)C=CC=2)CC1 XFNVOYCATFPHCK-UHFFFAOYSA-N 0.000 description 1
- NUVFLHVSVLRUMC-UHFFFAOYSA-N 3-chloro-4,5-dimethyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2C(=C(C)C(Cl)=NN=2)C)=C1 NUVFLHVSVLRUMC-UHFFFAOYSA-N 0.000 description 1
- OIKVRFDPUNLUDG-UHFFFAOYSA-N 3-chloro-6-(4-cyclohexylpiperazin-1-yl)pyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCN(C2CCCCC2)CC1 OIKVRFDPUNLUDG-UHFFFAOYSA-N 0.000 description 1
- SEFIWZVZUMYZHC-UHFFFAOYSA-N 3-chloro-6-(4-ethylphenoxy)pyridazine Chemical compound C1=CC(CC)=CC=C1OC1=CC=C(Cl)N=N1 SEFIWZVZUMYZHC-UHFFFAOYSA-N 0.000 description 1
- LEDGEBFIQLPJST-UHFFFAOYSA-N 3-chloro-6-[3-(3-fluorophenyl)-2,5-dihydropyrrol-1-yl]pyridazine Chemical compound FC1=CC=CC(C=2CN(CC=2)C=2N=NC(Cl)=CC=2)=C1 LEDGEBFIQLPJST-UHFFFAOYSA-N 0.000 description 1
- BNQVCCOHWPIPGE-UHFFFAOYSA-N 3-chloro-6-[3-(3-methylphenyl)-2,5-dihydropyrrol-1-yl]pyridazine Chemical compound CC1=CC=CC(C=2CN(CC=2)C=2N=NC(Cl)=CC=2)=C1 BNQVCCOHWPIPGE-UHFFFAOYSA-N 0.000 description 1
- PHNQFASUADVVBK-UHFFFAOYSA-N 3-chloro-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-4,5-dimethylpyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2C(=C(C)C(Cl)=NN=2)C)=C1C PHNQFASUADVVBK-UHFFFAOYSA-N 0.000 description 1
- WQRBZMFFYNMAQR-UHFFFAOYSA-N 3-chloro-6-[4-(2-phenylethyl)piperazin-1-yl]pyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCN(CCC=2C=CC=CC=2)CC1 WQRBZMFFYNMAQR-UHFFFAOYSA-N 0.000 description 1
- QXKKFBLEBXPECY-UHFFFAOYSA-N 3-chloro-6-[4-(3-fluorophenyl)-3,6-dihydro-2h-pyridin-1-yl]pyridazine Chemical compound FC1=CC=CC(C=2CCN(CC=2)C=2N=NC(Cl)=CC=2)=C1 QXKKFBLEBXPECY-UHFFFAOYSA-N 0.000 description 1
- JPBHYCHTWKTLOI-UHFFFAOYSA-N 3-chloro-6-[4-(3-methoxyphenyl)-3,6-dihydro-2h-pyridin-1-yl]pyridazine Chemical compound COC1=CC=CC(C=2CCN(CC=2)C=2N=NC(Cl)=CC=2)=C1 JPBHYCHTWKTLOI-UHFFFAOYSA-N 0.000 description 1
- KDEYQNFHALQZCT-UHFFFAOYSA-N 3-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyridazine Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2N=NC(Cl)=CC=2)CC1 KDEYQNFHALQZCT-UHFFFAOYSA-N 0.000 description 1
- VAJLJRMHTTUOFQ-UHFFFAOYSA-N 3-chloro-6-imidazol-1-ylpyridazine Chemical compound N1=NC(Cl)=CC=C1N1C=NC=C1 VAJLJRMHTTUOFQ-UHFFFAOYSA-N 0.000 description 1
- CAZDNMWZZXLBSI-UHFFFAOYSA-N 3-chloro-6-methylsulfanylpyridazine Chemical compound CSC1=CC=C(Cl)N=N1 CAZDNMWZZXLBSI-UHFFFAOYSA-N 0.000 description 1
- BUHGCLPAHGFCLE-UHFFFAOYSA-N 3-chloro-6-methylsulfonylpyridazine Chemical compound CS(=O)(=O)C1=CC=C(Cl)N=N1 BUHGCLPAHGFCLE-UHFFFAOYSA-N 0.000 description 1
- DXPPQFXYIZTQCV-UHFFFAOYSA-N 3-chloro-6-piperazin-1-ylpyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCNCC1 DXPPQFXYIZTQCV-UHFFFAOYSA-N 0.000 description 1
- QJFGGQGXUVBIHD-UHFFFAOYSA-N 3-fluoro-6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(F)=CC=2)=C1 QJFGGQGXUVBIHD-UHFFFAOYSA-N 0.000 description 1
- BWGUYOLNDXVMHR-UHFFFAOYSA-N 3-imidazol-1-yl-6-(4-methylphenoxy)pyridazine Chemical compound C1=CC(C)=CC=C1OC1=CC=C(N2C=NC=C2)N=N1 BWGUYOLNDXVMHR-UHFFFAOYSA-N 0.000 description 1
- DGNZNORMLXWZIN-UHFFFAOYSA-N 3-imidazol-1-ylpyridazine Chemical compound C1=NC=CN1C1=CC=CN=N1 DGNZNORMLXWZIN-UHFFFAOYSA-N 0.000 description 1
- MFIVRHVJICOUQR-UHFFFAOYSA-N 3-iodo-6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine Chemical compound CC1=CC=CC(N2CCN(CC2)C=2N=NC(I)=CC=2)=C1 MFIVRHVJICOUQR-UHFFFAOYSA-N 0.000 description 1
- CYPBHLZYIJHHEI-UHFFFAOYSA-N 3-methoxy-6-[4-(3-phenylpropyl)piperazin-1-yl]pyridazine Chemical compound N1=NC(OC)=CC=C1N1CCN(CCCC=2C=CC=CC=2)CC1 CYPBHLZYIJHHEI-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- WITVCECKMPRGSZ-UHFFFAOYSA-N 3-methyl-6-[4-(3-methylphenyl)-3,6-dihydro-2h-pyridin-1-yl]pyridazine Chemical compound CC1=CC=CC(C=2CCN(CC=2)C=2N=NC(C)=CC=2)=C1 WITVCECKMPRGSZ-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- GVCVETMVKFGZJE-UHFFFAOYSA-N 3-thiophen-2-ylpiperidin-3-ol Chemical compound C=1C=CSC=1C1(O)CCCNC1 GVCVETMVKFGZJE-UHFFFAOYSA-N 0.000 description 1
- HSZCTWGOSSILDX-UHFFFAOYSA-N 3-thiophen-2-ylpyrrolidine Chemical compound C1NCCC1C1=CC=CS1 HSZCTWGOSSILDX-UHFFFAOYSA-N 0.000 description 1
- BVUHYTLOOZFDHN-UHFFFAOYSA-N 4-(3-chlorophenyl)-3-methylpiperidin-4-ol Chemical compound CC1CNCCC1(O)C1=CC=CC(Cl)=C1 BVUHYTLOOZFDHN-UHFFFAOYSA-N 0.000 description 1
- JLBCGFFRDPEPAR-UHFFFAOYSA-N 4-(3-methylphenyl)-1-(6-phenylmethoxypyridazin-3-yl)piperidin-4-ol Chemical compound CC1=CC=CC(C2(O)CCN(CC2)C=2N=NC(OCC=3C=CC=CC=3)=CC=2)=C1 JLBCGFFRDPEPAR-UHFFFAOYSA-N 0.000 description 1
- MZOGJWJBDZZPAF-UHFFFAOYSA-N 4-(3-methylphenyl)piperidine-4-carboxamide Chemical compound CC1=CC=CC(C2(CCNCC2)C(N)=O)=C1 MZOGJWJBDZZPAF-UHFFFAOYSA-N 0.000 description 1
- GVCLNACSYKYUHP-UHFFFAOYSA-N 4-amino-7-(2-hydroxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbothioamide Chemical compound C1=NC(N)=C2C(C(=S)N)=CN(COCCO)C2=N1 GVCLNACSYKYUHP-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- UFPWCQRRHUQPFY-UHFFFAOYSA-N 4-naphthalen-1-ylpiperidin-4-ol Chemical compound C=1C=CC2=CC=CC=C2C=1C1(O)CCNCC1 UFPWCQRRHUQPFY-UHFFFAOYSA-N 0.000 description 1
- FYBSDMFIETWQGG-UHFFFAOYSA-N 4-naphthalen-2-ylpiperidin-4-ol Chemical compound C=1C=C2C=CC=CC2=CC=1C1(O)CCNCC1 FYBSDMFIETWQGG-UHFFFAOYSA-N 0.000 description 1
- LDDVKKCDRPPCAN-UHFFFAOYSA-N 4-thiophen-2-ylpiperidine;hydrochloride Chemical compound Cl.C1CNCCC1C1=CC=CS1 LDDVKKCDRPPCAN-UHFFFAOYSA-N 0.000 description 1
- AQVHODQJEQQBHE-UHFFFAOYSA-N 5-(3-fluorophenyl)-1,2,3,6-tetrahydropyridine Chemical compound FC1=CC=CC(C=2CNCCC=2)=C1 AQVHODQJEQQBHE-UHFFFAOYSA-N 0.000 description 1
- IJRKLHTZAIFUTB-UHFFFAOYSA-N 5-nitro-2-(2-phenylethylamino)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1NCCC1=CC=CC=C1 IJRKLHTZAIFUTB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- YNGVIJZIXQLITN-UHFFFAOYSA-N C(C(=O)O)(=O)O.CC=1C=C(C=CC1)NC1CNCC1 Chemical compound C(C(=O)O)(=O)O.CC=1C=C(C=CC1)NC1CNCC1 YNGVIJZIXQLITN-UHFFFAOYSA-N 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- FHCJMYMHNKCMGY-UHFFFAOYSA-N CC1=C(N=NC=C1)S(=O)O Chemical compound CC1=C(N=NC=C1)S(=O)O FHCJMYMHNKCMGY-UHFFFAOYSA-N 0.000 description 1
- SCJNYBYSTCRPAO-LXBQGUBHSA-N CN(C)C\C=C\C(=O)NC1=CC=C(N=C1)C(=O)N[C@@]1(C)CCC[C@H](C1)NC1=NC(C2=CNC3=CC=CC=C23)=C(Cl)C=N1 Chemical compound CN(C)C\C=C\C(=O)NC1=CC=C(N=C1)C(=O)N[C@@]1(C)CCC[C@H](C1)NC1=NC(C2=CNC3=CC=CC=C23)=C(Cl)C=N1 SCJNYBYSTCRPAO-LXBQGUBHSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 241000430519 Human rhinovirus sp. Species 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JPJLOEDCVOCPGZ-UHFFFAOYSA-N OC(=O)C(O)=O.CC1=CC=CC(NC2CN(CC=3C=CC=CC=3)CCC2)=C1C Chemical compound OC(=O)C(O)=O.CC1=CC=CC(NC2CN(CC=3C=CC=CC=3)CCC2)=C1C JPJLOEDCVOCPGZ-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 206010037742 Rabies Diseases 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- DRBWRJPFNOBNIO-KOLCDFICSA-N [(2r)-1-[(2r)-2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid Chemical compound N([C@H](C)C(=O)N1[C@@H](CCC1)B(O)O)C(=O)C1=CC=NC=C1 DRBWRJPFNOBNIO-KOLCDFICSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000002908 adrenolytic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000000954 anitussive effect Effects 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000005101 aryl methoxy carbonyl group Chemical group 0.000 description 1
- 125000005002 aryl methyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- OTKPPUXRIADSGD-PPRNARJGSA-N avoparcina Chemical compound O([C@@H]1C2=CC=C(C(=C2)Cl)OC=2C=C3C=C(C=2O[C@H]2C([C@@H](O)[C@H](O)[C@@H](CO)O2)O[C@@H]2O[C@@H](C)[C@H](O)[C@H](N)C2)OC2=CC=C(C=C2)[C@@H](O)[C@H](C(N[C@H](C(=O)N[C@H]3C(=O)N[C@H]2C(=O)N[C@@H]1C(N[C@@H](C1=CC(O)=CC(O)=C1C=1C(O)=CC=C2C=1)C(O)=O)=O)C=1C=CC(O)=CC=1)=O)NC(=O)[C@H](NC)C=1C=CC(O[C@H]2[C@@H]([C@H](O)[C@@H](O)[C@H](C)O2)O)=CC=1)[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1 OTKPPUXRIADSGD-PPRNARJGSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- MWOBKFYERIDQSZ-UHFFFAOYSA-N benzene;sodium Chemical compound [Na].C1=CC=CC=C1 MWOBKFYERIDQSZ-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000007541 cellular toxicity Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 229940075894 denatured ethanol Drugs 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- 101150007302 dntt gene Proteins 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- DFBKLUNHFCTMDC-GKRDHZSOSA-N endrin Chemical compound C([C@@H]1[C@H]2[C@@]3(Cl)C(Cl)=C([C@]([C@H]22)(Cl)C3(Cl)Cl)Cl)[C@@H]2[C@H]2[C@@H]1O2 DFBKLUNHFCTMDC-GKRDHZSOSA-N 0.000 description 1
- 239000003797 essential amino acid Substances 0.000 description 1
- 235000020776 essential amino acid Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- HVVVROXSCDCBHU-UHFFFAOYSA-N ethyl 3-(2,3-dimethylanilino)pyrrolidine-1-carboxylate Chemical compound C1N(C(=O)OCC)CCC1NC1=CC=CC(C)=C1C HVVVROXSCDCBHU-UHFFFAOYSA-N 0.000 description 1
- JLCCMQJVNQWCLV-UHFFFAOYSA-N ethyl 3-(3-chlorophenyl)-3-hydroxypiperidine-1-carboxylate Chemical compound C1N(C(=O)OCC)CCCC1(O)C1=CC=CC(Cl)=C1 JLCCMQJVNQWCLV-UHFFFAOYSA-N 0.000 description 1
- HWWMKRAIYICWHR-UHFFFAOYSA-N ethyl 3-(3-methylanilino)pyrrolidine-1-carboxylate Chemical compound C1N(C(=O)OCC)CCC1NC1=CC=CC(C)=C1 HWWMKRAIYICWHR-UHFFFAOYSA-N 0.000 description 1
- MZXGXGDCWUBBLY-UHFFFAOYSA-N ethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypyrrolidine-1-carboxylate Chemical compound C1N(C(=O)OCC)CCC1(O)C1=CC=C(Cl)C(C(F)(F)F)=C1 MZXGXGDCWUBBLY-UHFFFAOYSA-N 0.000 description 1
- LGDXPCYVLKJJOJ-UHFFFAOYSA-N ethyl 3-hydroxy-3-thiophen-2-ylpiperidine-1-carboxylate Chemical compound C1N(C(=O)OCC)CCCC1(O)C1=CC=CS1 LGDXPCYVLKJJOJ-UHFFFAOYSA-N 0.000 description 1
- YQONNJPKBHDJJM-UHFFFAOYSA-N ethyl 3-methyl-4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)C(C)C1 YQONNJPKBHDJJM-UHFFFAOYSA-N 0.000 description 1
- DQYGBMLEVQLDQC-UHFFFAOYSA-N ethyl 3-oxopyrrolidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)C1 DQYGBMLEVQLDQC-UHFFFAOYSA-N 0.000 description 1
- AZIZEUXODJXZMN-UHFFFAOYSA-N ethyl 4-[3-(trifluoromethyl)anilino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=CC=CC(C(F)(F)F)=C1 AZIZEUXODJXZMN-UHFFFAOYSA-N 0.000 description 1
- RCZNRTFGSCUKTH-UHFFFAOYSA-N ethyl 4-hydroxy-4-naphthalen-1-ylpiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(O)C1=CC=CC2=CC=CC=C12 RCZNRTFGSCUKTH-UHFFFAOYSA-N 0.000 description 1
- JIKKYEFWHFUSBK-UHFFFAOYSA-N ethyl 4-hydroxy-4-naphthalen-2-ylpiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(O)C1=CC=C(C=CC=C2)C2=C1 JIKKYEFWHFUSBK-UHFFFAOYSA-N 0.000 description 1
- CSERRCZOQYHBCI-UHFFFAOYSA-N ethyl 4-hydroxy-4-thiophen-2-ylpiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(O)C1=CC=CS1 CSERRCZOQYHBCI-UHFFFAOYSA-N 0.000 description 1
- OQEHTFFLOHTFSB-UHFFFAOYSA-N ethyl 4-piperazin-1-ylbenzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1N1CCNCC1 OQEHTFFLOHTFSB-UHFFFAOYSA-N 0.000 description 1
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical group CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LNOQURRKNJKKBU-UHFFFAOYSA-N ethyl piperazine-1-carboxylate Chemical compound CCOC(=O)N1CCNCC1 LNOQURRKNJKKBU-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 208000006454 hepatitis Diseases 0.000 description 1
- 231100000283 hepatitis Toxicity 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- UEXQBEVWFZKHNB-UHFFFAOYSA-N intermediate 29 Natural products C1=CC(N)=CC=C1NC1=NC=CC=N1 UEXQBEVWFZKHNB-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 1
- FINKSGWSBJRISB-UHFFFAOYSA-N methyl 4-hydroxy-2-methylbenzoate Chemical compound COC(=O)C1=CC=C(O)C=C1C FINKSGWSBJRISB-UHFFFAOYSA-N 0.000 description 1
- AQYXXOBARQKFID-UHFFFAOYSA-N methyl 6-[4-(3-methylphenyl)piperazin-1-yl]pyridazine-3-carboxylate Chemical compound N1=NC(C(=O)OC)=CC=C1N1CCN(C=2C=C(C)C=CC=2)CC1 AQYXXOBARQKFID-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- WABNTDGCYZUQBZ-UHFFFAOYSA-N n-(2,3-dimethylphenyl)piperidin-3-amine;oxalic acid Chemical compound OC(=O)C(O)=O.CC1=CC=CC(NC2CNCCC2)=C1C WABNTDGCYZUQBZ-UHFFFAOYSA-N 0.000 description 1
- HRBYJVVENJTBBO-UHFFFAOYSA-N n-(2,3-dimethylphenyl)pyrrolidin-3-amine Chemical compound CC1=CC=CC(NC2CNCC2)=C1C HRBYJVVENJTBBO-UHFFFAOYSA-N 0.000 description 1
- XHEVPNAGGLUWHQ-UHFFFAOYSA-N n-(2-chloroethyl)-n-(3-chloropropyl)-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N(CCCl)CCCCl)C=C1 XHEVPNAGGLUWHQ-UHFFFAOYSA-N 0.000 description 1
- RCQHGXSHYZXFMO-UHFFFAOYSA-N n-(3-methylphenyl)piperidin-3-amine Chemical compound CC1=CC=CC(NC2CNCCC2)=C1 RCQHGXSHYZXFMO-UHFFFAOYSA-N 0.000 description 1
- UNQTYWWIVXWOJT-UHFFFAOYSA-N n-(6-chloropyridazin-3-yl)acetamide Chemical compound CC(=O)NC1=CC=C(Cl)N=N1 UNQTYWWIVXWOJT-UHFFFAOYSA-N 0.000 description 1
- IHCHOVVAJBADAH-UHFFFAOYSA-N n-[2-hydroxy-4-(1h-pyrazol-4-yl)phenyl]-6-methoxy-3,4-dihydro-2h-chromene-3-carboxamide Chemical compound C1C2=CC(OC)=CC=C2OCC1C(=O)NC(C(=C1)O)=CC=C1C=1C=NNC=1 IHCHOVVAJBADAH-UHFFFAOYSA-N 0.000 description 1
- IUHKSSSSKOXADH-UHFFFAOYSA-N n-[3-(trifluoromethyl)phenyl]piperidin-3-amine Chemical compound FC(F)(F)C1=CC=CC(NC2CNCCC2)=C1 IUHKSSSSKOXADH-UHFFFAOYSA-N 0.000 description 1
- YNGLUJKTMXSDOC-UHFFFAOYSA-N n-[3-(trifluoromethyl)phenyl]piperidin-4-amine Chemical compound FC(F)(F)C1=CC=CC(NC2CCNCC2)=C1 YNGLUJKTMXSDOC-UHFFFAOYSA-N 0.000 description 1
- JGXUAQAYDPKTKP-UHFFFAOYSA-N n-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine;dihydrochloride Chemical compound Cl.Cl.FC(F)(F)C1=CC=CC(NC2CNCC2)=C1 JGXUAQAYDPKTKP-UHFFFAOYSA-N 0.000 description 1
- JQDNZFYQBNCCRO-UHFFFAOYSA-N n-phenylpiperidin-3-amine Chemical compound C1CCNCC1NC1=CC=CC=C1 JQDNZFYQBNCCRO-UHFFFAOYSA-N 0.000 description 1
- 201000009240 nasopharyngitis Diseases 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 229940098462 oral drops Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940100595 phenylacetaldehyde Drugs 0.000 description 1
- 125000002071 phenylalkoxy group Chemical group 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- WFJZBOIOPMOUCB-UHFFFAOYSA-N pyridazine;hydrochloride Chemical compound Cl.C1=CC=NN=C1 WFJZBOIOPMOUCB-UHFFFAOYSA-N 0.000 description 1
- GZRKXKUVVPSREJ-UHFFFAOYSA-N pyridinylpiperazine Chemical compound C1CNCCN1C1=CC=CC=N1 GZRKXKUVVPSREJ-UHFFFAOYSA-N 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- ILJOYZVVZZFIKA-UHFFFAOYSA-M sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate Chemical compound O.[Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 ILJOYZVVZZFIKA-UHFFFAOYSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 125000003396 thiol group Chemical class [H]S* 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/22—Nitrogen and oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Virology (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Oncology (AREA)
- Communicable Diseases (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59344484A | 1984-03-26 | 1984-03-26 | |
| US06/702,772 US5001125A (en) | 1984-03-26 | 1985-02-15 | Anti-virally active pyridazinamines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT37614A HUT37614A (en) | 1986-01-23 |
| HU198010B true HU198010B (en) | 1989-07-28 |
Family
ID=27081705
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU851127A HU198010B (en) | 1984-03-26 | 1985-03-25 | Process for producing new pyridazin-amines and pharmaceutical compositions containing them as active components |
Country Status (22)
| Country | Link |
|---|---|
| US (3) | US5001125A (da) |
| EP (1) | EP0156433B1 (da) |
| KR (1) | KR870001158B1 (da) |
| AT (1) | ATE61050T1 (da) |
| AU (1) | AU576563B2 (da) |
| BG (1) | BG43690A3 (da) |
| CA (1) | CA1238321A (da) |
| CZ (1) | CZ277730B6 (da) |
| DE (1) | DE3581819D1 (da) |
| DK (1) | DK166277C (da) |
| ES (1) | ES8606289A1 (da) |
| FI (1) | FI85373C (da) |
| GR (1) | GR850714B (da) |
| HU (1) | HU198010B (da) |
| IL (1) | IL74707A (da) |
| NO (1) | NO161257C (da) |
| NZ (1) | NZ211494A (da) |
| PH (1) | PH22495A (da) |
| PT (1) | PT80157B (da) |
| RO (1) | RO91197B (da) |
| SU (1) | SU1384198A3 (da) |
| ZW (1) | ZW5485A1 (da) |
Families Citing this family (74)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5001125A (en) * | 1984-03-26 | 1991-03-19 | Janssen Pharmaceutica N.V. | Anti-virally active pyridazinamines |
| ES8802151A1 (es) * | 1985-07-31 | 1988-04-01 | Janssen Pharmaceutica Nv | Un procedimiento para la preparacion de nuevos piridazinaminas. |
| NZ225045A (en) * | 1987-07-01 | 1990-06-26 | Janssen Pharmaceutica Nv | Antiviral pharmaceutical compositions containing cyclodextrin and an antiviral agent |
| US4992433A (en) * | 1987-11-23 | 1991-02-12 | Janssen Pharmaceutica N.V. | Novel pyridazinamine derivatives |
| US5106973A (en) * | 1987-11-23 | 1992-04-21 | Janssen Pharmaceutica N.V. | Pyridzainamine derivatives |
| US5231184A (en) * | 1987-11-23 | 1993-07-27 | Janssen Pharmaceutica N.V. | Pridazinamine derivatives |
| JPH01139578A (ja) * | 1987-11-26 | 1989-06-01 | Morishita Seiyaku Kk | 3−(1h−イミダゾール−1−イル)ピリダジン誘導体 |
| GB8911158D0 (en) * | 1989-05-16 | 1989-07-05 | Janssen Pharmaceutica Nv | Antiviral pyridazinamines |
| NZ233526A (en) * | 1989-05-15 | 1991-09-25 | Janssen Pharmaceutica Nv | Pyridazine derivatives and their pharmaceutical compositions |
| US5070090A (en) * | 1989-05-15 | 1991-12-03 | Janssen Pharmaceutica N.V. | Antipicorpaviral herterocyclic-substituted morpholinyl alkylphenol ethers |
| NZ233503A (en) * | 1989-05-15 | 1991-06-25 | Janssen Pharmaceutica Nv | Substituted (thio)morpholinyl and piperazinyl alkylphenol ethers |
| JO1645B1 (en) * | 1989-12-26 | 1991-11-27 | شركة جانسين فارماسوتيكا ان. في | Pyridazine compounds are antibacterial viruses |
| US5100893A (en) * | 1990-04-18 | 1992-03-31 | Janssen Pharmaceutica N.V. | Antipicornaviral pyridazinamines |
| FR2668151A1 (fr) * | 1990-10-23 | 1992-04-24 | Rhone Poulenc Agrochimie | Composes a groupe triazolopyridazine leurs preparations et compositions herbicides les contenant. |
| JPH05117150A (ja) * | 1991-10-25 | 1993-05-14 | Sanwa Kagaku Kenkyusho Co Ltd | 抗ウイルス剤 |
| JPH05255089A (ja) * | 1991-12-18 | 1993-10-05 | Sanwa Kagaku Kenkyusho Co Ltd | 抗ウイルス剤 |
| US5242924A (en) * | 1992-07-02 | 1993-09-07 | Sterling Winthrop Inc. | Tetrazolyl-(phenoxy and phenoxyalkyl)-piperidinylpyridazines as antiviral agents |
| FR2703354B1 (fr) * | 1993-03-31 | 1995-06-30 | Lafon Labor | Derives de 1, 2, 5, 6-tetrahydropyridine, leur procede de preparation et leurs applications en therapeutique. |
| EP0650476B1 (en) * | 1993-04-07 | 2002-06-26 | Otsuka Pharmaceutical Co., Ltd. | Peripheral vasodilating agent containing n-acylated 4-amino piperidine derivatives as active ingredients |
| CA2133855A1 (en) * | 1993-10-11 | 1995-04-12 | Marco Baroni | Heteroarylpiperidines, process for their preparation and pharmaceutical compositions in which they are present |
| FR2721514B1 (fr) * | 1994-06-23 | 1996-09-06 | Lafon Labor | Compositions thérapeutiques comprenant des 3-phényl-3-hydroxypipéridines. |
| FR2721513B1 (fr) * | 1994-06-23 | 1996-09-06 | Lafon Labor | Utilisation de dérivés de 1,2,5,6-tétrahydropyridine pour la fabrication de médicaments à effet sédatif. |
| US5753679A (en) * | 1995-05-10 | 1998-05-19 | Hoffmann-La Roche Inc. | Benzyl-piperidine derivatives |
| SI0876366T1 (en) * | 1996-01-15 | 2001-12-31 | Janssen Pharmaceutica Nv | Angiogenesis inhibiting pyridazinamines |
| FR2745811B1 (fr) * | 1996-03-07 | 1998-05-22 | Sanofi Sa | Glutarimide disubstitue procede pour sa preparation, et son utilisation |
| SK285198B6 (sk) * | 1997-10-27 | 2006-08-03 | Neurosearch A/S | Homopiperazínový derivát, farmaceutická kompozícia obsahujúca tento derivát a jeho použitie |
| US6251919B1 (en) * | 1998-02-27 | 2001-06-26 | Warner-Lambert | Heterocyclic substituted aniline calcium channel blockers |
| NZ514021A (en) * | 1999-04-26 | 2001-09-28 | Neurosearch As | Heteroaryl diazacycloalkanes, their preparation and use |
| US6833370B1 (en) * | 1999-05-21 | 2004-12-21 | Abbott Laboratories | Heterocycle substituted aminoazacycles useful as central nervous system agents |
| AUPQ105499A0 (en) | 1999-06-18 | 1999-07-08 | Biota Scientific Management Pty Ltd | Antiviral agents |
| AU2851701A (en) * | 2000-02-07 | 2001-08-20 | Janssen Pharmaceutica N.V. | Use of thrombin receptor antagonists against gliosis |
| AUPR213700A0 (en) * | 2000-12-18 | 2001-01-25 | Biota Scientific Management Pty Ltd | Antiviral agents |
| US7390813B1 (en) | 2001-12-21 | 2008-06-24 | Xenon Pharmaceuticals Inc. | Pyridylpiperazines and aminonicotinamides and their use as therapeutic agents |
| US20050119251A1 (en) * | 2001-12-21 | 2005-06-02 | Jian-Min Fu | Nicotinamide derivatives and their use as therapeutic agents |
| BR0307429A (pt) * | 2002-02-05 | 2004-12-28 | Novo Nordisk As | Composto, uso do mesmo, composição farmacêutica, e, método para o tratamento de distúrbios ou doenças relacionadas com receptor de histamina h3 |
| US20030236259A1 (en) * | 2002-02-05 | 2003-12-25 | Rolf Hohlweg | Novel aryl- and heteroarylpiperazines |
| US6855709B2 (en) | 2002-02-22 | 2005-02-15 | Pharmacia & Upjohn Company | Pyridyl sulfone derivatives |
| HUP0200849A2 (hu) * | 2002-03-06 | 2004-08-30 | Sanofi-Synthelabo | N-aminoacetil-2-ciano-pirrolidin-származékok, e vegyületeket tartalmazó gyógyszerkészítmények és eljárás előállításukra |
| PT1648874E (pt) | 2003-07-30 | 2011-12-23 | Xenon Pharmaceuticals Inc | Derivados de piperazina e a sua utilização a título de agentes terapêuticos |
| US7754711B2 (en) * | 2003-07-30 | 2010-07-13 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives and their use as therapeutic agents |
| EP2316826A1 (en) | 2003-07-30 | 2011-05-04 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives and their use as therapeutics agents |
| US7759348B2 (en) | 2003-07-30 | 2010-07-20 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives and their use as therapeutic agents |
| CN1882549B (zh) | 2003-11-20 | 2011-02-23 | 詹森药业有限公司 | 用作聚(adp-核糖)聚合酶抑制剂的7-苯基烷基取代的2-喹啉酮和2-喹喔啉酮 |
| SG150533A1 (en) | 2003-11-20 | 2009-03-30 | Janssen Pharmaceutica Nv | 6-alkenyl and 6-phenylalkyl substituted 2-quinolinones and 2- quinoxalinones as poly(adp-ribose) polymerase inhibitors |
| MY142362A (en) | 2004-01-29 | 2010-11-30 | Otsuka Pharma Co Ltd | Pharmaceutical composition for promoting angiogenesis |
| US7485727B2 (en) * | 2004-03-31 | 2009-02-03 | Nippon Soda Co., Ltd. | Cyclic amine compound and pest control agent |
| UA88012C2 (uk) | 2004-06-30 | 2009-09-10 | Янссен Фармацевтика Н.В. | Похідні хіназоліндіону як інгібітори parp |
| JP4969443B2 (ja) | 2004-06-30 | 2012-07-04 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | Parp阻害剤としてのキナゾリノン誘導体 |
| WO2006003147A1 (en) | 2004-06-30 | 2006-01-12 | Janssen Pharmaceutica N.V. | Phthalazine derivatives as parp inhibitors |
| US8071603B2 (en) * | 2004-09-20 | 2011-12-06 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| MX2007003329A (es) * | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y biciclicos y su uso como inhibidores de estearoil-coa-desaturasa (scd). |
| EP1814551A2 (en) | 2004-09-20 | 2007-08-08 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives for inhibiting human stearoyl-coa-desaturase |
| AU2005286728A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as mediators of stearoyl-CoA desaturase |
| US7767677B2 (en) | 2004-09-20 | 2010-08-03 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| AU2005286793A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives for the treatment of diseases mediated by stearoyl-CoA desaturase enzymes |
| CA2580762A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as therapeutic agents |
| CA2580857A1 (en) * | 2004-09-20 | 2006-09-28 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-coa desaturase inhibitors |
| CA2584422A1 (en) * | 2004-10-18 | 2006-04-27 | Eli Lilly And Company | 1-(hetero)aryl-3-amino-pyrollidine derivatives for use as mglur3 receptor antagonists |
| MX2007015216A (es) * | 2005-06-03 | 2008-02-22 | Xenon Pharmaceuticals Inc | Derivados de aminotiazol y sus usos como agentes terapeuticos. |
| CN1887875B (zh) * | 2005-06-30 | 2011-04-06 | 深圳市东阳光实业发展有限公司 | 哒嗪胺衍生物及其用于制备小rna病毒抑制剂的用途 |
| US8501739B2 (en) | 2005-07-04 | 2013-08-06 | High Point Pharmaceuticals, Llc | Medicaments |
| AU2006272334A1 (en) * | 2005-07-20 | 2007-01-25 | Merck Frosst Canada Ltd | Heteroaromatic compounds as inhibitors of stearoyl-coenzyme A delta-9 desaturase |
| EP1932844B1 (en) | 2005-10-06 | 2015-09-02 | Nippon Soda Co., Ltd. | Cross-linked cyclic amine compounds and agents for pest control |
| JP2009531447A (ja) * | 2006-03-29 | 2009-09-03 | メルク エンド カムパニー インコーポレーテッド | ジアゼパンオレキシン受容体アンタゴニスト |
| WO2007122411A1 (en) * | 2006-04-26 | 2007-11-01 | Astrazeneca Ab | Diazepan-1-yl-sulfonyl derivatives for the treatment of metabolic syndrome |
| AU2007267197B2 (en) * | 2006-05-29 | 2011-12-01 | High Point Pharmaceuticals, Llc | 3- (1, 3-Benzodioxol-5-yl) -6- (4-cyclopropylpiperazin-1-yl) -pyridazine, its salts and solvates and its use as histamine H3 receptor antagonist |
| WO2008107478A1 (en) | 2007-03-08 | 2008-09-12 | Janssen Pharmaceutica Nv | Quinolinone derivatives as parp and tank inhibitors |
| EP2014656A3 (en) * | 2007-06-11 | 2011-08-24 | High Point Pharmaceuticals, LLC | New heteocyclic h3 antagonists |
| PL2215075T3 (pl) | 2007-10-26 | 2014-04-30 | Janssen Pharmaceutica Nv | Pochodne chinolinonu jako inhibitory PARP |
| WO2009118382A1 (en) | 2008-03-27 | 2009-10-01 | Janssen Pharmaceutica Nv | Tetrahydrophenanthridinones and tetrahydrocyclopentaquinolinones as parp and tubulin polymerization inhibitors |
| ATE513818T1 (de) | 2008-03-27 | 2011-07-15 | Janssen Pharmaceutica Nv | Chinazolinonderivate als tubulinpolymerisationshemmer |
| US20100041663A1 (en) | 2008-07-18 | 2010-02-18 | Novartis Ag | Organic Compounds as Smo Inhibitors |
| US20160168124A1 (en) | 2013-07-30 | 2016-06-16 | Janssen Sciences Ireland Uc | Substituted pyridine-piperazinyl analogues as rsv antiviral compounds |
| EP3085701B1 (en) * | 2013-12-20 | 2019-02-20 | Institute of Pharmacology and Toxicology Academy of Military Medical Sciences P.L.A. China | N, n' substituted piperidinamine compounds, and preparation method and usage thereof |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL72956C (da) * | 1947-11-12 | |||
| US3014034A (en) * | 1959-01-22 | 1961-12-19 | Ciba Pharm Prod Inc | 1, 3-diaryl, 5-amino-pyridazinones |
| US2985657A (en) * | 1959-10-12 | 1961-05-23 | Paul A J Janssen | 1-(aroylalkyl)-4-heterocyclylpiperazines |
| GB1184714A (en) * | 1965-12-16 | 1970-03-18 | Science Union & Cie | Di- and Tri-Phenylpropyl Piperazine Derivatives |
| GB1293565A (en) * | 1969-05-03 | 1972-10-18 | Aspro Nicholas Ltd | Aminophthalazines and pharmaceutical compositions thereof |
| US4181723A (en) * | 1973-08-02 | 1980-01-01 | Sandoz Ltd. | 3-Hydrazino-5,6,7,8,9,10-hexahydro-cycloocta[c]pyridazines |
| NL171985C (nl) * | 1976-02-10 | 1983-06-16 | Rhone Poulenc Ind | Werkwijze voor het bereiden van preparaten met werking tegen schistosomiasis, de aldus verkregen gevormde preparaten en werkwijze voor het bereiden van 1,2-dithioolverbindingen. |
| US4104385A (en) * | 1976-08-19 | 1978-08-01 | Sterling Drug Inc. | Cyclic alkylidenyl N-[6-(amino)-3-pyridazinyl]aminomethylenemalonates |
| IN148482B (da) * | 1977-06-03 | 1981-03-07 | Pfizer | |
| HU176100B (en) * | 1977-10-25 | 1980-12-28 | Gyogyszerkutato Intezet | Process for preparing new 3-/1-pyrazolyl/-pyridazine derivatives |
| US4370328A (en) * | 1977-11-03 | 1983-01-25 | Pfizer Inc. | Cardiac stimulant 1-(3- or 4-substituted piperidino)phthalazines |
| DE2935359A1 (de) * | 1979-09-01 | 1981-03-26 | Basf Ag, 67063 Ludwigshafen | 6-imidazolyl-3-hydrazino-pyridazine |
| US4304775A (en) * | 1979-12-13 | 1981-12-08 | Sterling Drug Inc. | 3-Hydrazino-6-(pyridinyl) pyridazines and cardiotonic use thereof |
| FI70411C (fi) * | 1980-12-29 | 1986-09-19 | Pfizer | Foerfarande foer framstaellning av nya antihypertensiva 4-amino-6,7-dimetoxi-2-piperazinokinazolin derivat |
| FR2511366A1 (fr) * | 1981-08-11 | 1983-02-18 | Sanofi Sa | Nouveaux derives de la pyridazine, leur procede de preparation et les medicaments, actifs sur le systeme nerveux central, qui en contiennent |
| JPS5877866A (ja) * | 1981-11-04 | 1983-05-11 | Mitsui Toatsu Chem Inc | アミノピリダジン誘導体および除草剤 |
| GB2121140B (en) | 1982-06-03 | 1985-12-04 | Lucas Ind Plc | Disc assemblies for brakes |
| FR2539741A1 (fr) * | 1983-01-21 | 1984-07-27 | Sanofi Sa | Composes a noyau heterocyclique diazote, leur procede de preparation et les medicaments, actifs sur le systeme nerveux central, qui en contiennent |
| US5001125A (en) * | 1984-03-26 | 1991-03-19 | Janssen Pharmaceutica N.V. | Anti-virally active pyridazinamines |
| US4661493A (en) * | 1985-03-29 | 1987-04-28 | Pfizer Inc. | Tioconazole and related compounds for control of Herpes simplex virus |
| NZ225045A (en) * | 1987-07-01 | 1990-06-26 | Janssen Pharmaceutica Nv | Antiviral pharmaceutical compositions containing cyclodextrin and an antiviral agent |
| US4992433A (en) * | 1987-11-23 | 1991-02-12 | Janssen Pharmaceutica N.V. | Novel pyridazinamine derivatives |
| GB8911158D0 (en) * | 1989-05-16 | 1989-07-05 | Janssen Pharmaceutica Nv | Antiviral pyridazinamines |
-
1985
- 1985-02-15 US US06/702,772 patent/US5001125A/en not_active Expired - Fee Related
- 1985-02-28 KR KR1019850001303A patent/KR870001158B1/ko not_active Expired
- 1985-03-15 AT AT85200384T patent/ATE61050T1/de not_active IP Right Cessation
- 1985-03-15 DE DE8585200384T patent/DE3581819D1/de not_active Expired - Fee Related
- 1985-03-15 EP EP85200384A patent/EP0156433B1/en not_active Expired - Lifetime
- 1985-03-18 NZ NZ211494A patent/NZ211494A/en unknown
- 1985-03-20 CZ CS851952A patent/CZ277730B6/cs unknown
- 1985-03-21 GR GR850714A patent/GR850714B/el unknown
- 1985-03-22 ES ES541521A patent/ES8606289A1/es not_active Expired
- 1985-03-22 SU SU853867689A patent/SU1384198A3/ru active
- 1985-03-22 NO NO851167A patent/NO161257C/no unknown
- 1985-03-25 ZW ZW54/85A patent/ZW5485A1/xx unknown
- 1985-03-25 FI FI851177A patent/FI85373C/fi not_active IP Right Cessation
- 1985-03-25 AU AU40348/85A patent/AU576563B2/en not_active Ceased
- 1985-03-25 CA CA000477330A patent/CA1238321A/en not_active Expired
- 1985-03-25 IL IL74707A patent/IL74707A/xx unknown
- 1985-03-25 PT PT80157A patent/PT80157B/pt not_active IP Right Cessation
- 1985-03-25 DK DK134185A patent/DK166277C/da active
- 1985-03-25 HU HU851127A patent/HU198010B/hu not_active IP Right Cessation
- 1985-03-26 RO RO118137A patent/RO91197B/ro unknown
- 1985-03-26 BG BG069434A patent/BG43690A3/xx unknown
- 1985-03-26 PH PH32047A patent/PH22495A/en unknown
-
1991
- 1991-01-03 US US07/637,091 patent/US5157035A/en not_active Expired - Fee Related
-
1992
- 1992-08-13 US US07/929,622 patent/US5292738A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU198010B (en) | Process for producing new pyridazin-amines and pharmaceutical compositions containing them as active components | |
| US7220736B2 (en) | Pyrimidine compounds | |
| AU2005219525B2 (en) | Fused derivatives of pyrazole | |
| CN112533904B (zh) | 黑皮质素亚型-2受体(mc2r)拮抗剂及其用途 | |
| KR101421852B1 (ko) | 카세인 키나제 억제제로서의 이미다졸 유도체 | |
| US20030229095A1 (en) | Aromatic nitrogen-containig 6-membered cyclic compounds | |
| WO2006038734A1 (en) | Pyridazinone derivatives cytokines inhibitors | |
| HU195501B (en) | Process for producing /4-substituted-piperazinyl- and -homopiperazinyl/-pyridazines and pharmaceutical compositions containing them | |
| HU203747B (en) | Process for producing new 2-amino-pyrimidinone derivatives and pharmaceutical compositions containing them | |
| US20040142930A1 (en) | Cyclic compounds | |
| JPWO2000017163A1 (ja) | シアノフェニル誘導体 | |
| CZ9797A3 (en) | Triazole derivative, process of its preparation and pharmaceutical composition containing thereof | |
| US20230303534A1 (en) | Preparation method for novel rho-related protein kinase inhibitor and intermediate in preparation method | |
| JPS60226862A (ja) | 抗ウイルス活性ピリダジンアミン類 | |
| IE61607B1 (en) | Benzimidazole derivatives, the preparation thereof and their application in therapy | |
| EA007501B1 (ru) | Производные пиперазинилацилпиперидина, их получение и их терапевтическое применение | |
| AU2021296163A1 (en) | Quaternary indazole glucocorticoid receptor antagonists | |
| JP3269574B2 (ja) | メタノアントラセン化合物、これを含有する神経精神障害を治療するための調剤学的組成物、およびこの化合物を製造するための方法および中間体 | |
| US6169086B1 (en) | Pyrazole derivatives | |
| US5919788A (en) | 4-(1H-indol-1-yl)-1-piperidinyl derivatives | |
| US20250092023A1 (en) | Piperazine indazole glucocorticoid receptor antagonists | |
| EA019742B1 (ru) | Карбаматные производные алкилгетероциклов, их получение и их применение в терапии | |
| WO1996010024A1 (fr) | Derive pyrimidinylpyrazole | |
| HU201926B (en) | Process for producing new n-(3-hydroxy-4-piperidyl)-benzamide derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
| HUP0401949A2 (hu) | 4-Imidazolin-2-on-származékok |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |