HU196959B - Process for producing merkapto-acyl-proline derivatives - Google Patents
Process for producing merkapto-acyl-proline derivatives Download PDFInfo
- Publication number
- HU196959B HU196959B HU862689A HU268986A HU196959B HU 196959 B HU196959 B HU 196959B HU 862689 A HU862689 A HU 862689A HU 268986 A HU268986 A HU 268986A HU 196959 B HU196959 B HU 196959B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- thiourea
- proline
- solvent
- iii
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 10
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 41
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 16
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 238000002955 isolation Methods 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 4
- 239000000010 aprotic solvent Substances 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000001475 halogen functional group Chemical group 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 3
- 230000003301 hydrolyzing effect Effects 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 14
- 229960000830 captopril Drugs 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 8
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 5
- -1 alkyl (C1-C4) -alkyl Chemical group 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- GBRDFWFRKGIRTC-SSDOTTSWSA-N BrC[C@H](C(=O)N1CCCC1)C Chemical compound BrC[C@H](C(=O)N1CCCC1)C GBRDFWFRKGIRTC-SSDOTTSWSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- WMXCDAVJEZZYLT-UHFFFAOYSA-N tert-butylthiol Chemical compound CC(C)(C)S WMXCDAVJEZZYLT-UHFFFAOYSA-N 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- JQZIKLPHXXBMCA-UHFFFAOYSA-N triphenylmethanethiol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(S)C1=CC=CC=C1 JQZIKLPHXXBMCA-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- SJYSAVFKJLHJHP-RQJHMYQMSA-N (2s)-1-[(2s)-3-bromo-2-methylpropanoyl]pyrrolidine-2-carboxylic acid Chemical compound BrC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O SJYSAVFKJLHJHP-RQJHMYQMSA-N 0.000 description 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 1
- YHUMTHWQGWPJOQ-UHFFFAOYSA-N 2,6-dichloro-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Cl)C(=O)C(Cl)=C1 YHUMTHWQGWPJOQ-UHFFFAOYSA-N 0.000 description 1
- BUPXDXGYFXDDAA-UHFFFAOYSA-N 3-bromo-2-methylpropanoic acid Chemical compound BrCC(C)C(O)=O BUPXDXGYFXDDAA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- IQFHBMLABCGDMQ-HHQFNNIRSA-N O.BrC[C@H](C(=O)N1[C@@H](CCC1)C(=O)O)C Chemical compound O.BrC[C@H](C(=O)N1[C@@H](CCC1)C(=O)O)C IQFHBMLABCGDMQ-HHQFNNIRSA-N 0.000 description 1
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- HIVLDXAAFGCOFU-UHFFFAOYSA-N ammonium hydrosulfide Chemical compound [NH4+].[SH-] HIVLDXAAFGCOFU-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000001284 azanium sulfanide Substances 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- NEDMOHHWRPHBAL-MERQFXBCSA-N benzyl (2s)-pyrrolidin-1-ium-2-carboxylate;chloride Chemical compound Cl.O=C([C@H]1NCCC1)OCC1=CC=CC=C1 NEDMOHHWRPHBAL-MERQFXBCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- RUZLIIJDZBWWSA-INIZCTEOSA-N methyl 2-[[(1s)-1-(7-methyl-2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-9-yl)ethyl]amino]benzoate Chemical group COC(=O)C1=CC=CC=C1N[C@@H](C)C1=CC(C)=CN2C(=O)C=C(N3CCOCC3)N=C12 RUZLIIJDZBWWSA-INIZCTEOSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical group CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Peptides Or Proteins (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT0091186A AT395012B (de) | 1986-06-27 | 1986-04-07 | Verfahren zur herstellung von n-(1(s)|thoxycarbonyl-3-phenyl-propyl)-(s)-alanyl-(s)prolin und von dessen saeureadditionssalzen |
| HU862689A HU196959B (en) | 1986-06-27 | 1986-06-27 | Process for producing merkapto-acyl-proline derivatives |
| CH2372/87A CH673279A5 (enExample) | 1986-06-27 | 1987-06-24 | |
| CN198787104388A CN87104388A (zh) | 1986-06-27 | 1987-06-24 | 制备硫基酰基脯氨酸的方法 |
| YU118187A YU46319B (sh) | 1986-06-27 | 1987-06-24 | Postupak za dobijanje 1-/3-merkapto-/2s/-metilpropionil/-pirolidin-/2s/-karboksilne kiseline |
| SE8702654A SE462751B (sv) | 1986-06-27 | 1987-06-26 | Saett foer framstaellning av en merkaptoacylprolin |
| DK329787A DK329787A (da) | 1986-06-27 | 1987-06-26 | Fremgangsmaade til fremstilling af mercaptoacylprolinderivater |
| KR1019870006546A KR900007217B1 (ko) | 1986-06-27 | 1987-06-26 | 메르캅토아실프롤린의 제조방법 |
| PT85190A PT85190B (pt) | 1986-06-27 | 1987-06-26 | Processo para a preparacao de uma mercaptoacilprolina |
| JP62159491A JPS6327475A (ja) | 1986-06-27 | 1987-06-26 | メルカプトアシルプロリンの製造法 |
| IT8721085A IT1206792B (it) | 1986-06-27 | 1987-06-26 | Procedimento per preparare una mercaptoacilprolina. |
| AT0162087A AT387381B (de) | 1986-06-27 | 1987-06-26 | Verfahren zur herstellung von einem mercapto-acylprolin |
| AR87307987A AR243159A1 (es) | 1986-06-27 | 1987-06-26 | Procedimiento de preparacion de acido 1-(3-mercapto-(2s)-metilpropionil)-pirrolidin-(2s)-carboxilico o sus sales farmaceuticamente aceptables. |
| CS874794A CS276394B6 (en) | 1986-06-27 | 1987-06-26 | Process for preparing 1-/3-mercapto-(2s)-methylpropionyl/-pyrrolidine-(2s)-carboxylic acid |
| NO872690A NO168941C (no) | 1986-06-27 | 1987-06-26 | Fremgangsmaate for fremstilling av mercaptoacylprolin. |
| DD87304203A DD263757A5 (de) | 1986-06-27 | 1987-06-26 | Verfahren zur herstellung von 1-[3-mercapto-(2s)-methyl-propionyl]-pyrrolidin-(2s)-carbonsaeure |
| GR871012A GR871012B (en) | 1986-06-27 | 1987-06-26 | Process for preparing a mercaptoacylproline |
| ES8702024A ES2004451A6 (es) | 1986-06-27 | 1987-06-26 | Procedimiento de preparacion de acido 1-(3-mercapto-(2s)-metilpropionil-pirrolidin-(2s)-carboxilico |
| PL1987266478A PL153449B1 (en) | 1986-06-27 | 1987-06-26 | Procedure for the production of mercaptoacyloproline |
| SU874202836A SU1650007A3 (ru) | 1986-06-27 | 1987-06-26 | Способ получени 1-[3-меркапто-(2S)-метилпропионил]-пирролидин-(2S)-карбоновой кислоты |
| FI872859A FI87770C (fi) | 1986-06-27 | 1987-06-26 | Foerfarande foer framstaellning av merkaptoacylprolin |
| DE19873721430 DE3721430A1 (de) | 1986-06-27 | 1987-06-29 | Verfahren zur herstellung von 1-(3'-(mercapto)-(2's)-(methyl)-propionyl)-pyrrolidin-(2s)-carbonsaeure oder ihren salzen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU862689A HU196959B (en) | 1986-06-27 | 1986-06-27 | Process for producing merkapto-acyl-proline derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT44490A HUT44490A (en) | 1988-03-28 |
| HU196959B true HU196959B (en) | 1989-02-28 |
Family
ID=10960651
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU862689A HU196959B (en) | 1986-06-27 | 1986-06-27 | Process for producing merkapto-acyl-proline derivatives |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS6327475A (enExample) |
| KR (1) | KR900007217B1 (enExample) |
| CN (1) | CN87104388A (enExample) |
| AR (1) | AR243159A1 (enExample) |
| AT (2) | AT395012B (enExample) |
| CH (1) | CH673279A5 (enExample) |
| CS (1) | CS276394B6 (enExample) |
| DD (1) | DD263757A5 (enExample) |
| DE (1) | DE3721430A1 (enExample) |
| DK (1) | DK329787A (enExample) |
| ES (1) | ES2004451A6 (enExample) |
| FI (1) | FI87770C (enExample) |
| GR (1) | GR871012B (enExample) |
| HU (1) | HU196959B (enExample) |
| IT (1) | IT1206792B (enExample) |
| NO (1) | NO168941C (enExample) |
| PL (1) | PL153449B1 (enExample) |
| PT (1) | PT85190B (enExample) |
| SE (1) | SE462751B (enExample) |
| SU (1) | SU1650007A3 (enExample) |
| YU (1) | YU46319B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE421551B (sv) * | 1980-03-26 | 1982-01-04 | Sandvik Ab | Borrverktyg for rotations- och/eller slagborrning |
| HU208954B (en) * | 1990-09-21 | 1994-02-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing 1-(3-mercapto-(2s)-methyl-1-oxo-propyl)-l-prolyn |
| JPS62125081A (ja) * | 1985-11-21 | 1987-06-06 | キングプリンテイング株式会社 | 捺染方法 |
| EP0928191B1 (en) * | 1996-09-26 | 2002-08-28 | Meditor Pharmaceuticals Ltd. | Pharmaceutical compositions comprising s-alkylisothiouronium derivatives |
| CN103086939A (zh) * | 2011-10-28 | 2013-05-08 | 华中药业股份有限公司 | 1-(3-溴-2-d-甲基丙酰基)吡咯烷-2-羧酸的重结晶方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU509899B2 (en) * | 1976-02-13 | 1980-05-29 | E.R. Squibb & Sons, Inc. | Proline derivatives and related compounds |
| IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
| GB2065643B (en) * | 1979-12-13 | 1983-08-24 | Kanegafuchi Chemical Ind | Optically active n-mercaptoalkanoylamino acids |
| IE54551B1 (en) * | 1982-01-22 | 1989-11-22 | Ici Plc | Amide derivatives |
| KR860001391B1 (ko) * | 1984-07-23 | 1986-09-22 | 보령제약 주식회사 | 피롤리딘 유도체의 제조방법 |
-
1986
- 1986-04-07 AT AT0091186A patent/AT395012B/de not_active IP Right Cessation
- 1986-06-27 HU HU862689A patent/HU196959B/hu unknown
-
1987
- 1987-06-24 CH CH2372/87A patent/CH673279A5/de not_active IP Right Cessation
- 1987-06-24 YU YU118187A patent/YU46319B/sh unknown
- 1987-06-24 CN CN198787104388A patent/CN87104388A/zh active Pending
- 1987-06-26 NO NO872690A patent/NO168941C/no unknown
- 1987-06-26 GR GR871012A patent/GR871012B/el unknown
- 1987-06-26 DK DK329787A patent/DK329787A/da not_active Application Discontinuation
- 1987-06-26 ES ES8702024A patent/ES2004451A6/es not_active Expired
- 1987-06-26 FI FI872859A patent/FI87770C/fi not_active IP Right Cessation
- 1987-06-26 DD DD87304203A patent/DD263757A5/de not_active IP Right Cessation
- 1987-06-26 SU SU874202836A patent/SU1650007A3/ru active
- 1987-06-26 SE SE8702654A patent/SE462751B/sv not_active IP Right Cessation
- 1987-06-26 KR KR1019870006546A patent/KR900007217B1/ko not_active Expired
- 1987-06-26 AR AR87307987A patent/AR243159A1/es active
- 1987-06-26 CS CS874794A patent/CS276394B6/cs unknown
- 1987-06-26 PL PL1987266478A patent/PL153449B1/pl unknown
- 1987-06-26 JP JP62159491A patent/JPS6327475A/ja active Pending
- 1987-06-26 IT IT8721085A patent/IT1206792B/it active
- 1987-06-26 PT PT85190A patent/PT85190B/pt not_active IP Right Cessation
- 1987-06-26 AT AT0162087A patent/AT387381B/de not_active IP Right Cessation
- 1987-06-29 DE DE19873721430 patent/DE3721430A1/de not_active Withdrawn
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU747422A3 (ru) | Способ получени производных пролина | |
| IE852296L (en) | Oxiranes and 2-acylamido-2-fluoro-1-arylpropanols. | |
| US4154934A (en) | Mercaptoacylamino derivatives of heterocyclic carboxylic acids | |
| US4332725A (en) | Process for the preparation of 1-[3-mercapto-(2S)-methylpropionyl]-pyrrolidine-(2S)-carboxylic acid | |
| HU196959B (en) | Process for producing merkapto-acyl-proline derivatives | |
| EP0018546B1 (en) | Process for the production of phenylglycyl chloride hydrochlorides | |
| AU745355B2 (en) | Process for producing substituted alkylamines or salts thereof | |
| US3983162A (en) | Optical resolution of alkyl esters of DL-phenylalanine | |
| US5473081A (en) | Process for the preparation of l-proline derivatives | |
| EP0967204A1 (en) | Process for producing benzylsuccinic acid derivatives | |
| KR100317425B1 (ko) | 할로겐화제 및 수산기의 할로겐화 방법 | |
| PT863874E (pt) | Processo para a preparacao de dioxoazabiciclo-hexanos | |
| ITMI981478A1 (it) | Procedimento per la preparazione di (s)-n-terbutil-1,2,3,4- tetraidroisochinolin-3-carbossiammide | |
| HU211101B (en) | Process for preparing 1-[/2s/-methyl-3-mercapto-propionyl]-pyrrolidine-/2s/-carboxylic acid | |
| PT99022A (pt) | Processo para a preparacao de 1-{(2s)-3-mercapto-metil-1-oxopropil}-l-prolina e de um intermediario | |
| JPH05221966A (ja) | L−プロリン誘導体の製造方法 | |
| US4477677A (en) | Process for the preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetoxyacetic acid | |
| IE903146A1 (en) | Asymmetric chemical synthesis and intermediates for making¹antifungal compounds | |
| JP3942674B2 (ja) | 7位水酸基が選択的に保護されたエスクレチン誘導体の製造方法 | |
| KR0139260B1 (ko) | 고리화된 이미다졸을 가지는 벤즈이미다졸 유도체 | |
| HU182778B (en) | Process for preparing 4-/n-alkyl-carbamoyloxy/-l-proline | |
| KR860000850B1 (ko) | 인돌초산 유도체의 제조방법 | |
| JPS61178947A (ja) | アリ−ルアルキルケトンの製造方法 | |
| PL79142B1 (en) | Novel cephalosporin derivatives, and processes for their preparation [gb1271013a] | |
| JPS61158962A (ja) | 1,4−ジヒドロピリジン誘導体の製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HC9A | Change of name, address |
Owner name: EGIS GYOGYSZERGYAR NYRT., HU Free format text: FORMER OWNER(S): EGIS GYOGYSZERGYAR, HU |