GB702834A - Improvements in or relating to a method of electrical arc-extinction in electric circuit-breakers - Google Patents
Improvements in or relating to a method of electrical arc-extinction in electric circuit-breakersInfo
- Publication number
- GB702834A GB702834A GB22508/50A GB2250850A GB702834A GB 702834 A GB702834 A GB 702834A GB 22508/50 A GB22508/50 A GB 22508/50A GB 2250850 A GB2250850 A GB 2250850A GB 702834 A GB702834 A GB 702834A
- Authority
- GB
- United Kingdom
- Prior art keywords
- arc
- breakers
- extinction
- relating
- electric circuit
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 241000272186 Falco columbarius Species 0.000 abstract 1
- GJAARPKBDFKHFS-UHFFFAOYSA-N Gerin Natural products COC(=O)C(=C)C1CC2C(=C)C(=O)C=CC2(C)CC1OC(=O)C GJAARPKBDFKHFS-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H9/00—Details of switching devices, not covered by groups H01H1/00 - H01H7/00
- H01H9/30—Means for extinguishing or preventing arc between current-carrying parts
- H01H9/34—Stationary parts for restricting or subdividing the arc, e.g. barrier plate
- H01H9/341—Barrier plates carrying electrodes
Landscapes
- Arc-Extinguishing Devices That Are Switches (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR291021X | 1949-10-13 | ||
| FR754276X | 1953-06-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB702834A true GB702834A (en) | 1954-01-27 |
Family
ID=31947985
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB22508/50A Expired GB702834A (en) | 1949-10-13 | 1950-09-13 | Improvements in or relating to a method of electrical arc-extinction in electric circuit-breakers |
| GB25562/52A Expired GB723837A (en) | 1949-10-13 | 1952-10-13 | Improvements in or relating to arc-extinction devices for electric circuit-breakers |
| GB14854/54A Expired GB754276A (en) | 1949-10-13 | 1954-05-20 | Improvements in or relating to electrical arc extinction chambers |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB25562/52A Expired GB723837A (en) | 1949-10-13 | 1952-10-13 | Improvements in or relating to arc-extinction devices for electric circuit-breakers |
| GB14854/54A Expired GB754276A (en) | 1949-10-13 | 1954-05-20 | Improvements in or relating to electrical arc extinction chambers |
Country Status (6)
| Country | Link |
|---|---|
| US (4) | US2668890A (enExample) |
| BE (1) | BE498021A (enExample) |
| CH (2) | CH291021A (enExample) |
| DE (3) | DE975815C (enExample) |
| FR (5) | FR1000691A (enExample) |
| GB (3) | GB702834A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1026394B (de) * | 1955-09-22 | 1958-03-20 | Merlin Gerin | Elektrischer Leistungsschalter |
| DE1064589B (de) * | 1955-11-10 | 1959-09-03 | Licentia Gmbh | Elektrischer Schalter mit Lichtbogenloeschkammer und mit magnetischer Blasung |
| DE1100138B (de) * | 1955-10-04 | 1961-02-23 | Merlin Gerin | Vorrichtung zur Loeschung des Unterbrechungsbogens bei Leistungstrennschaltern |
| DE1146159B (de) * | 1959-04-21 | 1963-03-28 | Hugo Miebach G M B H | Lichtbogenkammer fuer elektrische Schaltgeraete mit Permanent-Blasmagneten |
| DE1150132B (de) * | 1955-08-23 | 1963-06-12 | Westinghouse Electric Corp | Mehrpoliges elektrisches Schaltgeraet mit in Luft schaltenden Kontakten |
| DE1068788B (de) * | 1968-02-08 | Calor-Emag Elektrizitäts-Aktiengesellschaft, '4030 Ratingen | Elektrischer Schalter mit Lichtbogenlängung zwischen Isolierwänden |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1010606B (de) * | 1953-09-01 | 1957-06-19 | Calor Emag Elektrizitaets Ag | Magnetfeldschalter fuer Gleich- und Wechselstrom |
| DE1019367B (de) * | 1953-12-23 | 1957-11-14 | Siemens Ag | Schalter mit Lichtbogenloeschkammer |
| US2933574A (en) * | 1954-04-26 | 1960-04-19 | Westinghouse Electric Corp | Circuit interrupters |
| US2816992A (en) * | 1954-11-26 | 1957-12-17 | Westinghouse Electric Corp | Circuit interrupters |
| US2868927A (en) * | 1956-05-03 | 1959-01-13 | Ite Circuit Breaker Ltd | Solenoid interrupter |
| DE1031866B (de) * | 1956-10-20 | 1958-06-12 | Voigt & Haeffner Ag | Lichtbogenloescheinrichtung fuer elektrische Schalter |
| US2967220A (en) * | 1958-11-18 | 1961-01-03 | Westinghouse Electric Corp | Circuit interrupters |
| US3128359A (en) * | 1960-01-06 | 1964-04-07 | Westinghouse Electric Corp | Circuit interrupters having arc extinguishing means |
| US3033961A (en) * | 1960-05-04 | 1962-05-08 | Ite Circuit Breaker Ltd | Serpentine corrugated arc product coolers |
| FR1269359A (fr) * | 1960-07-01 | 1961-08-11 | Merlin Gerin | Perfectionnements à un dispositif d'extinction d'arc |
| FR1269356A (fr) * | 1960-07-01 | 1961-08-11 | Merlin Gerin | Perfectionnements à un dispositif d'extinction d'arc |
| FR1269360A (fr) * | 1960-07-01 | 1961-08-11 | Merlin Gerin | Perfectionnements à un dispositif d'extinction d'arc |
| FR1269358A (fr) * | 1960-07-01 | 1961-08-11 | Merlin Gerin | Procédé et dispositif d'extinction d'arc |
| US3187123A (en) * | 1961-04-03 | 1965-06-01 | Scully Anthony Corp | Binary key identifier for machine tools |
| US3151274A (en) * | 1961-12-27 | 1964-09-29 | Gen Electric | Current limiting lightning arrester using porous material in the gap structure |
| US3151273A (en) * | 1961-12-27 | 1964-09-29 | Gen Electric | Current limiting lightning arrester with porous gap structure |
| CH396181A (de) * | 1962-11-28 | 1965-07-31 | Bbc Brown Boveri & Cie | Funkenstreckenanordnung für Überspannungsableiter |
| US3322995A (en) * | 1965-04-26 | 1967-05-30 | Globe Union Inc | Electronic component and method of manufacture thereof |
| US3403239A (en) * | 1965-05-24 | 1968-09-24 | Square D Co | Electromagnetically-operated air-break, clapper-type high-voltage contactor |
| US3662133A (en) * | 1969-02-18 | 1972-05-09 | Westinghouse Electric Corp | Space-plate arc-chute for an air-break circuit breaker |
| FR2255689B1 (enExample) * | 1973-12-20 | 1976-10-08 | Merlin Gerin | |
| GB2084402B (en) * | 1980-09-17 | 1984-05-02 | Gec Elliott Automation Ltd | Circuit breaker arc chute |
| FR2719152B1 (fr) * | 1994-04-22 | 1996-05-24 | Gec Alsthom T & D Sa | Disjoncteur à moyenne ou haute tension. |
| US6479781B1 (en) * | 2000-06-23 | 2002-11-12 | General Electric Company | Arc chute assembly for circuit breaker mechanisms |
| US9845599B2 (en) | 2014-04-23 | 2017-12-19 | Nucor Corporation | Structural steel decking system and method of securing |
| US9863146B2 (en) | 2015-05-14 | 2018-01-09 | Nucor Corporation | Structural panel systems with a nested sidelap and method of securing |
| MX2018011385A (es) | 2016-03-21 | 2019-06-20 | Nucor Corp | Sistemas estructurales con solapa lateral mejorada y tramos de pandeo. |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR961277A (enExample) * | 1950-05-09 | |||
| DE218829C (enExample) * | 1908-12-01 | |||
| DE444505C (de) * | 1925-07-19 | 1927-05-20 | Voigt & Haeffner Akt Ges | Schalter mit Blasung |
| CH138996A (fr) * | 1928-01-18 | 1930-03-31 | Delle Atel Const Electr | Cheminée de soufflage pour appareils de rupture de circuits électriques. |
| US1888707A (en) * | 1928-07-14 | 1932-11-22 | Westinghouse Electric & Mfg Co | Circuit interrupter |
| DE533471C (de) * | 1930-04-02 | 1931-09-12 | I G Farbenindustrie Akt Ges | Verfahren zur Darstellung von Oxydiphenylindolderivaten |
| US2037418A (en) * | 1931-01-24 | 1936-04-14 | Westinghouse Electric & Mfg Co | Circuit breaker |
| CH165267A (de) * | 1932-07-29 | 1933-11-15 | Oerlikon Maschf | Einrichtung für die Lichtbogenlöschung bei Schaltern mit Hörnerelektroden. |
| US2167499A (en) * | 1937-01-29 | 1939-07-25 | Westinghouse Electric & Mfg Co | Disconnecting switch |
| US2306204A (en) * | 1939-10-11 | 1942-12-22 | Gen Electric | Electric arc extinguishing apparatus |
| DE710229C (de) * | 1940-04-20 | 1941-09-08 | Aeg | Lichtbogenloeschvorrichtung fuer Schalter |
| CH230575A (de) * | 1941-05-21 | 1944-01-15 | Licentia Gmbh | Elektrischer Stromunterbrecher für hochgespannten Gleichstrom. |
| BE495600A (enExample) * | 1944-08-04 | |||
| US2564178A (en) * | 1945-06-08 | 1951-08-14 | Howard M Strobel | Deion circuit breaker |
| US2436189A (en) * | 1945-09-17 | 1948-02-17 | Gen Electric | Arc extinguishing device |
| NL72730C (enExample) * | 1946-07-29 | |||
| US2568377A (en) * | 1947-07-14 | 1951-09-18 | Czechoslovak Metal & Engineeri | Magnetic switch |
-
0
- BE BE498021D patent/BE498021A/fr unknown
-
1949
- 1949-10-13 FR FR1000691D patent/FR1000691A/fr not_active Expired
-
1950
- 1950-06-10 DE DEM3893A patent/DE975815C/de not_active Expired
- 1950-09-06 CH CH291021D patent/CH291021A/fr unknown
- 1950-09-13 GB GB22508/50A patent/GB702834A/en not_active Expired
- 1950-10-03 US US188148A patent/US2668890A/en not_active Expired - Lifetime
-
1951
- 1951-10-15 FR FR61399D patent/FR61399E/fr not_active Expired
-
1952
- 1952-01-18 FR FR62384D patent/FR62384E/fr not_active Expired
- 1952-09-11 DE DEM15486A patent/DE1155840B/de active Pending
- 1952-09-13 CH CH305648D patent/CH305648A/fr unknown
- 1952-10-13 GB GB25562/52A patent/GB723837A/en not_active Expired
-
1953
- 1953-06-08 US US360299A patent/US2750476A/en not_active Expired - Lifetime
- 1953-06-08 US US360300A patent/US2707739A/en not_active Expired - Lifetime
- 1953-06-17 FR FR65047D patent/FR65047E/fr not_active Expired
-
1954
- 1954-05-20 GB GB14854/54A patent/GB754276A/en not_active Expired
- 1954-06-07 US US434801A patent/US2783336A/en not_active Expired - Lifetime
- 1954-06-12 DE DEM23401A patent/DE1014623B/de active Pending
-
1957
- 1957-10-17 FR FR3945A patent/FR72633E/fr not_active Expired
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1068788B (de) * | 1968-02-08 | Calor-Emag Elektrizitäts-Aktiengesellschaft, '4030 Ratingen | Elektrischer Schalter mit Lichtbogenlängung zwischen Isolierwänden | |
| DE1150132B (de) * | 1955-08-23 | 1963-06-12 | Westinghouse Electric Corp | Mehrpoliges elektrisches Schaltgeraet mit in Luft schaltenden Kontakten |
| DE1026394B (de) * | 1955-09-22 | 1958-03-20 | Merlin Gerin | Elektrischer Leistungsschalter |
| DE1100138B (de) * | 1955-10-04 | 1961-02-23 | Merlin Gerin | Vorrichtung zur Loeschung des Unterbrechungsbogens bei Leistungstrennschaltern |
| DE1064589B (de) * | 1955-11-10 | 1959-09-03 | Licentia Gmbh | Elektrischer Schalter mit Lichtbogenloeschkammer und mit magnetischer Blasung |
| DE1146159B (de) * | 1959-04-21 | 1963-03-28 | Hugo Miebach G M B H | Lichtbogenkammer fuer elektrische Schaltgeraete mit Permanent-Blasmagneten |
Also Published As
| Publication number | Publication date |
|---|---|
| FR65047E (fr) | 1956-01-25 |
| US2783336A (en) | 1957-02-26 |
| US2750476A (en) | 1956-06-12 |
| FR1000691A (fr) | 1952-02-14 |
| GB723837A (en) | 1955-02-09 |
| FR72633E (fr) | 1960-04-22 |
| GB754276A (en) | 1956-08-08 |
| CH305648A (fr) | 1955-02-28 |
| DE1155840B (de) | 1963-10-17 |
| FR62384E (fr) | 1955-06-14 |
| DE1014623B (de) | 1957-08-29 |
| DE975815C (de) | 1962-10-04 |
| FR61399E (fr) | 1955-04-26 |
| US2668890A (en) | 1954-02-09 |
| BE498021A (enExample) | |
| CH291021A (fr) | 1953-05-31 |
| US2707739A (en) | 1955-05-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB702834A (en) | Improvements in or relating to a method of electrical arc-extinction in electric circuit-breakers | |
| GB1151572A (en) | Improvements in or relating to Circuit Breaker Apparatus | |
| GB711726A (en) | Improvements in or relating to electric switches having magnetic blowouts | |
| GB1164686A (en) | Vacuum-Type Circuit Breaker | |
| GB714979A (en) | Improvements in or relating to gas break electric circuit interrupters having arc chutes | |
| GB1227729A (enExample) | ||
| GB650039A (en) | Improvements in arc extinguishing horns and chambers for electric switches | |
| GB622381A (en) | Improvements in or relating to electric circuit-breakers having arc-extinguishing means | |
| GB853162A (en) | Improvements in or relating to electric cut-off switches having arc-quenching arrangements | |
| GB832316A (en) | Improved electric circuit breaker of the magnetic blow-out type | |
| GB605124A (en) | Improvements in and relating to electric air circuit breakers | |
| GB1216977A (en) | Improvements in and relating to electric circuit breakers | |
| GB590970A (en) | Improvements in or relating to electric air-break circuit-breakers | |
| GB1023518A (en) | Electrical switching arrangement | |
| GB804660A (en) | Improvements in electric circuit-breakers having magnetic blowouts | |
| GB996015A (en) | Improvements in or relating to electric circuit breakers | |
| GB848177A (en) | Improvements in or relating to electric circuit interrupters | |
| GB840743A (en) | Improvements relating to air-break electric circuit interrupters | |
| GB728638A (en) | Improvements in and relating to arc chutes for electric circuit breakers | |
| GB909057A (en) | A contact arrangement for electric switchgear | |
| GB216474A (en) | Improvements relating to magnetic blow-out devices for electric circuit interruptersand the like | |
| GB851143A (en) | Improvements in or relating to electric circuit interrupters | |
| GB1089971A (en) | Improvements in electric circuit breakers | |
| GB696726A (en) | Improvements relating to gas-blast electric circuit breakers | |
| GB601838A (en) | Improvements in and relating to electric switches having arc-rupturing devices |