FI87776C - Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider - Google Patents
Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider Download PDFInfo
- Publication number
- FI87776C FI87776C FI871828A FI871828A FI87776C FI 87776 C FI87776 C FI 87776C FI 871828 A FI871828 A FI 871828A FI 871828 A FI871828 A FI 871828A FI 87776 C FI87776 C FI 87776C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- amino
- compound
- formula
- hydrogen
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 71
- 238000000034 method Methods 0.000 title claims description 41
- 230000008569 process Effects 0.000 title claims description 19
- 150000003936 benzamides Chemical class 0.000 title claims description 10
- 229940054066 benzamide antipsychotics Drugs 0.000 title claims 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 205
- 150000001875 compounds Chemical class 0.000 claims description 195
- -1 1,2-benzisoxazolyl Chemical group 0.000 claims description 106
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 42
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 38
- 239000002253 acid Substances 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 33
- 229910052736 halogen Inorganic materials 0.000 claims description 25
- 150000002367 halogens Chemical class 0.000 claims description 25
- 150000002431 hydrogen Chemical group 0.000 claims description 21
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 20
- 150000001204 N-oxides Chemical class 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims description 9
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical group CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 150000001721 carbon Chemical group 0.000 claims description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 7
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000004803 chlorobenzyl group Chemical group 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000004175 fluorobenzyl group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 3
- IRFRTRMQNPJOAG-UHFFFAOYSA-N 4-amino-n-[(4-benzylmorpholin-2-yl)methyl]-2-butoxy-5-chlorobenzamide Chemical group CCCCOC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC=CC=2)C1 IRFRTRMQNPJOAG-UHFFFAOYSA-N 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000006012 2-chloroethoxy group Chemical group 0.000 claims description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Chemical group 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 2
- 125000002946 cyanobenzyl group Chemical group 0.000 claims description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000005921 isopentoxy group Chemical group 0.000 claims description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 claims description 2
- 125000005544 phthalimido group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000006493 trifluoromethyl benzyl group Chemical group 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 115
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 84
- 239000000203 mixture Substances 0.000 description 74
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 71
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 70
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 68
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 65
- 239000002904 solvent Substances 0.000 description 60
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 57
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 51
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- 239000011541 reaction mixture Substances 0.000 description 45
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 42
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 39
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- 239000003921 oil Substances 0.000 description 35
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 34
- 235000019341 magnesium sulphate Nutrition 0.000 description 34
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- 229920006395 saturated elastomer Polymers 0.000 description 33
- 239000011780 sodium chloride Substances 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- 239000012044 organic layer Substances 0.000 description 27
- 230000000694 effects Effects 0.000 description 23
- 239000002244 precipitate Substances 0.000 description 23
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 22
- 239000012458 free base Substances 0.000 description 22
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000007858 starting material Substances 0.000 description 19
- 238000003756 stirring Methods 0.000 description 19
- RKQQPHIGNSVEOH-UHFFFAOYSA-N 4-amino-5-chloro-2-hexoxybenzoic acid Chemical compound CCCCCCOC1=CC(N)=C(Cl)C=C1C(O)=O RKQQPHIGNSVEOH-UHFFFAOYSA-N 0.000 description 17
- 239000000706 filtrate Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 15
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 239000002585 base Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 210000003169 central nervous system Anatomy 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 7
- 125000002947 alkylene group Chemical group 0.000 description 7
- 238000007796 conventional method Methods 0.000 description 7
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 6
- RVEATKYEARPWRE-UHFFFAOYSA-N 4-amino-5-chloro-2-methoxybenzoic acid Chemical compound COC1=CC(N)=C(Cl)C=C1C(O)=O RVEATKYEARPWRE-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 150000008065 acid anhydrides Chemical class 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 230000002496 gastric effect Effects 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- CKZVBXBEDDAEFE-UHFFFAOYSA-N (4-benzylmorpholin-2-yl)methanamine Chemical compound C1COC(CN)CN1CC1=CC=CC=C1 CKZVBXBEDDAEFE-UHFFFAOYSA-N 0.000 description 5
- YPELFRMCRYSPKZ-UHFFFAOYSA-N 4-amino-5-chloro-2-ethoxy-N-({4-[(4-fluorophenyl)methyl]morpholin-2-yl}methyl)benzamide Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC(F)=CC=2)C1 YPELFRMCRYSPKZ-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- JHSPPBBJOLKJDH-UHFFFAOYSA-N [4-[(4-fluorophenyl)methyl]morpholin-2-yl]methanamine Chemical compound C1COC(CN)CN1CC1=CC=C(F)C=C1 JHSPPBBJOLKJDH-UHFFFAOYSA-N 0.000 description 5
- 230000030136 gastric emptying Effects 0.000 description 5
- 230000005176 gastrointestinal motility Effects 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000008194 pharmaceutical composition Substances 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 229960000581 salicylamide Drugs 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
- XWGYOMHQGQZRLC-UHFFFAOYSA-N 4-amino-5-chloro-2-ethoxybenzoic acid Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(O)=O XWGYOMHQGQZRLC-UHFFFAOYSA-N 0.000 description 4
- GVWRZZNYCOTWNN-UHFFFAOYSA-N 4-benzyl-2-(chloromethyl)morpholine Chemical compound C1COC(CCl)CN1CC1=CC=CC=C1 GVWRZZNYCOTWNN-UHFFFAOYSA-N 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 239000012320 chlorinating reagent Substances 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 150000008282 halocarbons Chemical class 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 4
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 230000002123 temporal effect Effects 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- ZWNMRNMIZKFLBZ-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)ethanamine Chemical compound C1COC(CCN)CN1CC1=CC=CC=C1 ZWNMRNMIZKFLBZ-UHFFFAOYSA-N 0.000 description 3
- LRZSAGKIMYFLHY-UHFFFAOYSA-N 2-hydroxypropane-1,2,3-tricarboxylic acid;dihydrate Chemical compound O.O.OC(=O)CC(O)(C(O)=O)CC(O)=O LRZSAGKIMYFLHY-UHFFFAOYSA-N 0.000 description 3
- ODYRBQWYNNOGQN-UHFFFAOYSA-N 4-[[2-(aminomethyl)morpholin-4-yl]methyl]benzonitrile Chemical compound C1COC(CN)CN1CC1=CC=C(C#N)C=C1 ODYRBQWYNNOGQN-UHFFFAOYSA-N 0.000 description 3
- JCHJDTYDCITBBN-UHFFFAOYSA-N 4-acetamido-2-acetyloxy-5-chlorobenzoic acid Chemical compound CC(=O)NC1=CC(OC(C)=O)=C(C(O)=O)C=C1Cl JCHJDTYDCITBBN-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 241000416162 Astragalus gummifer Species 0.000 description 3
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920001615 Tragacanth Polymers 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 3
- 229960004106 citric acid Drugs 0.000 description 3
- 229960002303 citric acid monohydrate Drugs 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 239000003623 enhancer Substances 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 229960004503 metoclopramide Drugs 0.000 description 3
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 3
- IYDYAXXGLUZOJN-UHFFFAOYSA-N n-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]acetamide Chemical compound C1COC(CNC(=O)C)CN1CC1=CC=C(F)C=C1 IYDYAXXGLUZOJN-UHFFFAOYSA-N 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 3
- 238000011321 prophylaxis Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 210000002784 stomach Anatomy 0.000 description 3
- 239000000196 tragacanth Substances 0.000 description 3
- 235000010487 tragacanth Nutrition 0.000 description 3
- 229940116362 tragacanth Drugs 0.000 description 3
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- XUZFLQOWHVNBQZ-UHFFFAOYSA-N (4-benzyl-1,4-oxazepan-2-yl)methanamine Chemical compound C1CCOC(CN)CN1CC1=CC=CC=C1 XUZFLQOWHVNBQZ-UHFFFAOYSA-N 0.000 description 2
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 2
- XNTCJVGYFWBECT-UHFFFAOYSA-N 1-[(2-chlorophenyl)methylamino]propan-2-ol Chemical compound CC(O)CNCC1=CC=CC=C1Cl XNTCJVGYFWBECT-UHFFFAOYSA-N 0.000 description 2
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 2
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 2
- YVENDIOSKPJMLX-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)ethanol Chemical compound C1COC(CCO)CN1CC1=CC=CC=C1 YVENDIOSKPJMLX-UHFFFAOYSA-N 0.000 description 2
- AVKUQDNGOBWLKN-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)ethyl acetate Chemical compound C1COC(CCOC(=O)C)CN1CC1=CC=CC=C1 AVKUQDNGOBWLKN-UHFFFAOYSA-N 0.000 description 2
- YAQSVEHQDFSDCR-UHFFFAOYSA-N 2-[(4-benzylmorpholin-2-yl)methyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CC(OCC1)CN1CC1=CC=CC=C1 YAQSVEHQDFSDCR-UHFFFAOYSA-N 0.000 description 2
- UFUUZLWIJHVFJZ-UHFFFAOYSA-N 2-acetamido-4-(dimethylamino)-5-nitrobenzoic acid Chemical compound CN(C)C1=CC(NC(C)=O)=C(C(O)=O)C=C1[N+]([O-])=O UFUUZLWIJHVFJZ-UHFFFAOYSA-N 0.000 description 2
- GSZUVVWNNPZIGN-UHFFFAOYSA-N 2-acetamido-4-chloro-5-nitrobenzoic acid Chemical compound CC(=O)NC1=CC(Cl)=C([N+]([O-])=O)C=C1C(O)=O GSZUVVWNNPZIGN-UHFFFAOYSA-N 0.000 description 2
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 2
- MNNOFRJMHLQDOE-UHFFFAOYSA-N 2-fluoro-5-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC=C(F)C(C(O)=O)=C1 MNNOFRJMHLQDOE-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- FDAXHDFKDZSHQV-UHFFFAOYSA-N 3-(4-benzylmorpholin-2-yl)propan-1-amine Chemical compound C1COC(CCCN)CN1CC1=CC=CC=C1 FDAXHDFKDZSHQV-UHFFFAOYSA-N 0.000 description 2
- SVSQYRJKZKOKCP-UHFFFAOYSA-N 3-(4-benzylmorpholin-2-yl)propanenitrile Chemical compound C1COC(CCC#N)CN1CC1=CC=CC=C1 SVSQYRJKZKOKCP-UHFFFAOYSA-N 0.000 description 2
- MBXYDAFAUGAUJB-UHFFFAOYSA-N 3-morpholin-2-ylpropanenitrile Chemical compound N#CCCC1CNCCO1 MBXYDAFAUGAUJB-UHFFFAOYSA-N 0.000 description 2
- HFOOMTWBZCIGSL-UHFFFAOYSA-N 4-acetamido-2-ethoxy-n-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]benzamide Chemical compound CCOC1=CC(NC(C)=O)=CC=C1C(=O)NCC1OCCN(CC=2C=CC(F)=CC=2)C1 HFOOMTWBZCIGSL-UHFFFAOYSA-N 0.000 description 2
- ZSFLDBIRNKAYSV-UHFFFAOYSA-N 4-acetamido-5-chloro-2-ethoxy-n-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]benzamide Chemical compound CCOC1=CC(NC(C)=O)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC(F)=CC=2)C1 ZSFLDBIRNKAYSV-UHFFFAOYSA-N 0.000 description 2
- HLPODFYVEMCHBL-UHFFFAOYSA-N 4-amino-n-[(4-benzylmorpholin-2-yl)methyl]-5-chloro-2-methoxybenzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC=CC=2)C1 HLPODFYVEMCHBL-UHFFFAOYSA-N 0.000 description 2
- KZKOWXZFTMYRSE-UHFFFAOYSA-N 5-chloro-4-(dimethylamino)-2-methoxybenzoic acid Chemical compound COC1=CC(N(C)C)=C(Cl)C=C1C(O)=O KZKOWXZFTMYRSE-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 208000007882 Gastritis Diseases 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 206010047700 Vomiting Diseases 0.000 description 2
- DWXFDGVDGNNQBO-UHFFFAOYSA-N [4-[3-(4-chlorophenoxy)propyl]morpholin-2-yl]methanamine Chemical compound C1COC(CN)CN1CCCOC1=CC=C(Cl)C=C1 DWXFDGVDGNNQBO-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- FPZOUXYSPHCLRV-UHFFFAOYSA-N benzyl 2-(2-acetyloxyethyl)morpholine-4-carboxylate Chemical compound C1COC(CCOC(=O)C)CN1C(=O)OCC1=CC=CC=C1 FPZOUXYSPHCLRV-UHFFFAOYSA-N 0.000 description 2
- MLXBQSCAFOXTSR-UHFFFAOYSA-N benzyl 2-(2-chloroethyl)morpholine-4-carboxylate Chemical compound C1COC(CCCl)CN1C(=O)OCC1=CC=CC=C1 MLXBQSCAFOXTSR-UHFFFAOYSA-N 0.000 description 2
- YLOMZAUJLNQHRO-UHFFFAOYSA-N benzyl 2-(2-cyanoethyl)morpholine-4-carboxylate Chemical compound C1COC(CCC#N)CN1C(=O)OCC1=CC=CC=C1 YLOMZAUJLNQHRO-UHFFFAOYSA-N 0.000 description 2
- JLXGHWHTUOCXQX-UHFFFAOYSA-N benzyl 2-(2-hydroxyethyl)morpholine-4-carboxylate Chemical compound C1COC(CCO)CN1C(=O)OCC1=CC=CC=C1 JLXGHWHTUOCXQX-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- WZFOBUJYPANZMG-UHFFFAOYSA-N ethyl 2-(4-benzylmorpholin-2-yl)acetate Chemical compound C1COC(CC(=O)OCC)CN1CC1=CC=CC=C1 WZFOBUJYPANZMG-UHFFFAOYSA-N 0.000 description 2
- YOWFFMYWBHTEJD-UHFFFAOYSA-N ethyl 2-[(1,3-dioxoisoindol-2-yl)methyl]morpholine-4-carboxylate Chemical compound C1N(C(=O)OCC)CCOC1CN1C(=O)C2=CC=CC=C2C1=O YOWFFMYWBHTEJD-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- QAYQKAPOTVSWLS-UHFFFAOYSA-N methyl 2-ethoxybenzoate Chemical compound CCOC1=CC=CC=C1C(=O)OC QAYQKAPOTVSWLS-UHFFFAOYSA-N 0.000 description 2
- VEXJDAUJQLLGAZ-UHFFFAOYSA-N methyl 4-acetamido-5-chloro-2-hexoxybenzoate Chemical compound CCCCCCOC1=CC(NC(C)=O)=C(Cl)C=C1C(=O)OC VEXJDAUJQLLGAZ-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- KJBLQGHJOCAOJP-UHFFFAOYSA-N metoclopramide hydrochloride Chemical compound O.Cl.CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC KJBLQGHJOCAOJP-UHFFFAOYSA-N 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- UGPSGKBXOZVVCV-UHFFFAOYSA-N n-(morpholin-2-ylmethyl)acetamide Chemical compound CC(=O)NCC1CNCCO1 UGPSGKBXOZVVCV-UHFFFAOYSA-N 0.000 description 2
- JARCELFZNGRBJT-UHFFFAOYSA-N n-[(4-benzylmorpholin-2-yl)methyl]acetamide Chemical compound C1COC(CNC(=O)C)CN1CC1=CC=CC=C1 JARCELFZNGRBJT-UHFFFAOYSA-N 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- VDVJGIYXDVPQLP-UHFFFAOYSA-N piperonylic acid Chemical compound OC(=O)C1=CC=C2OCOC2=C1 VDVJGIYXDVPQLP-UHFFFAOYSA-N 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000001226 reprecipitation Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- YAKKATWFMLCGMI-UHFFFAOYSA-N (4-phenylmorpholin-2-yl)methanamine Chemical compound C1COC(CN)CN1C1=CC=CC=C1 YAKKATWFMLCGMI-UHFFFAOYSA-N 0.000 description 1
- NMCDGBASPMWQJD-WLHGVMLRSA-N (e)-but-2-enedioic acid;n-[(4-ethylmorpholin-2-yl)methyl]-2-methoxybenzamide Chemical compound OC(=O)\C=C\C(O)=O.C1N(CC)CCOC1CNC(=O)C1=CC=CC=C1OC NMCDGBASPMWQJD-WLHGVMLRSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- DBUAYOWCIUQXQW-UHFFFAOYSA-N 1,3-benzodioxole-4-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=C1OCO2 DBUAYOWCIUQXQW-UHFFFAOYSA-N 0.000 description 1
- ZNGWEEUXTBNKFR-UHFFFAOYSA-N 1,4-oxazepane Chemical group C1CNCCOC1 ZNGWEEUXTBNKFR-UHFFFAOYSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- PAJODHVUXYNOJU-UHFFFAOYSA-N 1-amino-3-(2-chlorophenyl)-2,2-dimethylpropan-1-ol Chemical compound ClC1=C(CC(C(O)N)(C)C)C=CC=C1 PAJODHVUXYNOJU-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- AEHKBYHYSYENDS-UHFFFAOYSA-N 1-ethoxy-2h-quinoline Chemical compound C1=CC=C2N(OCC)CC=CC2=C1 AEHKBYHYSYENDS-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- IMCDTSZTCIFXNN-UHFFFAOYSA-N 2-(4-benzylmorpholin-2-yl)acetonitrile Chemical compound C1COC(CC#N)CN1CC1=CC=CC=C1 IMCDTSZTCIFXNN-UHFFFAOYSA-N 0.000 description 1
- CQCIVIABGBSMEI-UHFFFAOYSA-N 2-(azidomethyl)-4-benzylmorpholine Chemical compound C1COC(CN=[N+]=[N-])CN1CC1=CC=CC=C1 CQCIVIABGBSMEI-UHFFFAOYSA-N 0.000 description 1
- YVJGCQAEHPDHCM-UHFFFAOYSA-N 2-(benzylamino)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1NCC1=CC=CC=C1 YVJGCQAEHPDHCM-UHFFFAOYSA-N 0.000 description 1
- YFTKHVYQEPCOPM-UHFFFAOYSA-N 2-(chloromethyl)-4-[(2-chlorophenyl)methyl]-6-methylmorpholine Chemical compound C1C(CCl)OC(C)CN1CC1=CC=CC=C1Cl YFTKHVYQEPCOPM-UHFFFAOYSA-N 0.000 description 1
- RUKGENFOLCBVLY-UHFFFAOYSA-N 2-(chloromethyl)-4-phenylmorpholine Chemical compound C1COC(CCl)CN1C1=CC=CC=C1 RUKGENFOLCBVLY-UHFFFAOYSA-N 0.000 description 1
- KPVWVXISFIMMAB-UHFFFAOYSA-N 2-(cyclopropylamino)-5-sulfamoylbenzoic acid Chemical compound OC(=O)C1=CC(S(=O)(=O)N)=CC=C1NC1CC1 KPVWVXISFIMMAB-UHFFFAOYSA-N 0.000 description 1
- FPCAJFZDQXKYRW-UHFFFAOYSA-N 2-(hexylamino)-5-nitrobenzoic acid Chemical compound CCCCCCNC1=CC=C([N+]([O-])=O)C=C1C(O)=O FPCAJFZDQXKYRW-UHFFFAOYSA-N 0.000 description 1
- DUILGEYLVHGSEE-UHFFFAOYSA-N 2-(oxiran-2-ylmethyl)isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CC1CO1 DUILGEYLVHGSEE-UHFFFAOYSA-N 0.000 description 1
- KWEPMOQQKUYWIN-UHFFFAOYSA-N 2-[(4-fluorophenyl)methylamino]ethanol Chemical compound OCCNCC1=CC=C(F)C=C1 KWEPMOQQKUYWIN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- BTDSTEXXTSDBLO-UHFFFAOYSA-N 2-[4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-3-yl]ethanamine Chemical compound NCCC1N(C(COC1)(C)C)CC1=C(C=CC=C1)Cl BTDSTEXXTSDBLO-UHFFFAOYSA-N 0.000 description 1
- SONOHJNKSOBNKY-UHFFFAOYSA-N 2-acetamido-4-chlorobenzoic acid Chemical compound CC(=O)NC1=CC(Cl)=CC=C1C(O)=O SONOHJNKSOBNKY-UHFFFAOYSA-N 0.000 description 1
- JQRZFRQCKBWJNP-UHFFFAOYSA-N 2-amino-4-(dimethylamino)-5-nitrobenzoic acid Chemical compound CN(C)C1=CC(N)=C(C(O)=O)C=C1[N+]([O-])=O JQRZFRQCKBWJNP-UHFFFAOYSA-N 0.000 description 1
- JQSBIZXYGOCDSY-UHFFFAOYSA-N 2-amino-4-(methylamino)-5-nitrobenzoic acid Chemical compound CNC1=CC(N)=C(C(O)=O)C=C1[N+]([O-])=O JQSBIZXYGOCDSY-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical group CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- XDZMPRGFOOFSBL-UHFFFAOYSA-N 2-ethoxybenzoic acid Chemical compound CCOC1=CC=CC=C1C(O)=O XDZMPRGFOOFSBL-UHFFFAOYSA-N 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N 2-hydroxy-pyridine Natural products OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- QUEKGYQTRJVEQC-UHFFFAOYSA-N 2516-96-3 Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1Cl QUEKGYQTRJVEQC-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- ZQJXSIOFSZYGMH-UHFFFAOYSA-N 3-(benzylamino)propan-1-ol Chemical compound OCCCNCC1=CC=CC=C1 ZQJXSIOFSZYGMH-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- JESNSNMMTLYFGV-UHFFFAOYSA-N 3-chloro-2-methoxybenzamide Chemical compound COC1=C(Cl)C=CC=C1C(N)=O JESNSNMMTLYFGV-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- FXAHCXPEXLCFFY-UHFFFAOYSA-N 4-(chloromethyl)morpholine Chemical compound ClCN1CCOCC1 FXAHCXPEXLCFFY-UHFFFAOYSA-N 0.000 description 1
- BCZLYNFDOJXWGN-UHFFFAOYSA-N 4-(morpholin-4-ylmethyl)benzonitrile Chemical compound C1=CC(C#N)=CC=C1CN1CCOCC1 BCZLYNFDOJXWGN-UHFFFAOYSA-N 0.000 description 1
- OTJMOIFNCHDSAG-UHFFFAOYSA-N 4-[(2-chlorophenyl)methyl]-2-methylmorpholine Chemical compound ClC1=C(CN2CCOC(C2)C)C=CC=C1 OTJMOIFNCHDSAG-UHFFFAOYSA-N 0.000 description 1
- ICNWZXFWTBMBKT-UHFFFAOYSA-N 4-acetamido-5-chloro-2-ethoxybenzoic acid Chemical compound CCOC1=CC(NC(C)=O)=C(Cl)C=C1C(O)=O ICNWZXFWTBMBKT-UHFFFAOYSA-N 0.000 description 1
- XVVYSVVBPMJRAB-UHFFFAOYSA-N 4-acetamidobenzamide Chemical class CC(=O)NC1=CC=C(C(N)=O)C=C1 XVVYSVVBPMJRAB-UHFFFAOYSA-N 0.000 description 1
- IMGMDZSNZZJYQC-UHFFFAOYSA-N 4-amino-5-chloro-2-methoxy-n-(morpholin-2-ylmethyl)benzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCNC1 IMGMDZSNZZJYQC-UHFFFAOYSA-N 0.000 description 1
- SGEPBJGKGOHLHC-UHFFFAOYSA-N 4-amino-5-chloro-n-[[4-[(2-chlorophenyl)methyl]morpholin-2-yl]methyl]-2-ethoxybenzamide Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C(=CC=CC=2)Cl)C1 SGEPBJGKGOHLHC-UHFFFAOYSA-N 0.000 description 1
- KCOZHDFHIVRDPG-UHFFFAOYSA-N 4-amino-5-chloro-n-[[4-[(2-fluorophenyl)methyl]morpholin-2-yl]methyl]-2-hydroxybenzamide Chemical compound C1=C(Cl)C(N)=CC(O)=C1C(=O)NCC1OCCN(CC=2C(=CC=CC=2)F)C1 KCOZHDFHIVRDPG-UHFFFAOYSA-N 0.000 description 1
- OWIUGUVNWRNUID-UHFFFAOYSA-N 4-amino-5-chloro-n-[[4-[(3-chlorophenyl)methyl]morpholin-2-yl]methyl]-2-hydroxybenzamide Chemical compound C1=C(Cl)C(N)=CC(O)=C1C(=O)NCC1OCCN(CC=2C=C(Cl)C=CC=2)C1 OWIUGUVNWRNUID-UHFFFAOYSA-N 0.000 description 1
- RDUJCVYCCPKYSR-UHFFFAOYSA-N 4-amino-n-[2-(4-benzylmorpholin-2-yl)ethyl]-5-chloro-2-ethoxybenzamide Chemical compound CCOC1=CC(N)=C(Cl)C=C1C(=O)NCCC1OCCN(CC=2C=CC=CC=2)C1 RDUJCVYCCPKYSR-UHFFFAOYSA-N 0.000 description 1
- QJNVJWLJAYAWEI-UHFFFAOYSA-N 4-amino-n-[2-(4-benzylmorpholin-2-yl)ethyl]-5-chloro-2-methoxybenzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCCC1OCCN(CC=2C=CC=CC=2)C1 QJNVJWLJAYAWEI-UHFFFAOYSA-N 0.000 description 1
- UVTNCRCSZDFKQV-UHFFFAOYSA-N 4-amino-n-[3-(4-benzylmorpholin-2-yl)propyl]-5-chloro-2-methoxybenzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NCCCC1OCCN(CC=2C=CC=CC=2)C1 UVTNCRCSZDFKQV-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- AZEIRPAUJXANCS-UHFFFAOYSA-N 4-ethoxybenzamide Chemical compound CCOC1=CC=C(C(N)=O)C=C1 AZEIRPAUJXANCS-UHFFFAOYSA-N 0.000 description 1
- PDKBNJFZYQVYKF-UHFFFAOYSA-N 5-(dimethylsulfamoyl)-2-(methylamino)benzoic acid Chemical compound CNC1=CC=C(S(=O)(=O)N(C)C)C=C1C(O)=O PDKBNJFZYQVYKF-UHFFFAOYSA-N 0.000 description 1
- SPLPERBFJNXJRZ-UHFFFAOYSA-N 5-(dimethylsulfamoyl)-2-fluorobenzoic acid Chemical compound CN(C)S(=O)(=O)C1=CC=C(F)C(C(O)=O)=C1 SPLPERBFJNXJRZ-UHFFFAOYSA-N 0.000 description 1
- SZGVEGLNNJFISE-UHFFFAOYSA-N 5-chloro-2-ethoxy-4-nitrobenzoic acid Chemical compound CCOC1=CC([N+]([O-])=O)=C(Cl)C=C1C(O)=O SZGVEGLNNJFISE-UHFFFAOYSA-N 0.000 description 1
- CDUYYXSMTAZNGT-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methylbenzamide Chemical compound CC1=CC(Cl)=CC(C(N)=O)=C1O CDUYYXSMTAZNGT-UHFFFAOYSA-N 0.000 description 1
- HAKXXXVBNLKWAU-UHFFFAOYSA-N 5-chloro-2-methoxy-3-methylbenzamide Chemical compound COC1=C(C)C=C(Cl)C=C1C(N)=O HAKXXXVBNLKWAU-UHFFFAOYSA-N 0.000 description 1
- ZNWIZSBLPIUGJI-UHFFFAOYSA-N 5-chloro-n-[[4-[(4-cyanophenyl)methyl]morpholin-2-yl]methyl]-4-(dimethylamino)-2-methoxybenzamide Chemical compound COC1=CC(N(C)C)=C(Cl)C=C1C(=O)NCC1OCCN(CC=2C=CC(=CC=2)C#N)C1 ZNWIZSBLPIUGJI-UHFFFAOYSA-N 0.000 description 1
- CISMZCVQNVNWJW-UHFFFAOYSA-N 5-chlorosulfonyl-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC(S(Cl)(=O)=O)=CC=C1F CISMZCVQNVNWJW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 208000015163 Biliary Tract disease Diseases 0.000 description 1
- POMLYIFGGFZGMM-WLHGVMLRSA-N C(\C=C\C(=O)O)(=O)O.NC1=CC(=C(C(=O)NCC2CN(CCO2)CC2=CC=CC=C2)C=C1Cl)OCCCC Chemical compound C(\C=C\C(=O)O)(=O)O.NC1=CC(=C(C(=O)NCC2CN(CCO2)CC2=CC=CC=C2)C=C1Cl)OCCCC POMLYIFGGFZGMM-WLHGVMLRSA-N 0.000 description 1
- BHDUWLKBHFLMPE-UHFFFAOYSA-N CC1CN(C(CO1)CCCl)CC2=CC=CC=C2Cl Chemical compound CC1CN(C(CO1)CCCl)CC2=CC=CC=C2Cl BHDUWLKBHFLMPE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 208000009132 Catalepsy Diseases 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 206010010774 Constipation Diseases 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PLUBXMRUUVWRLT-UHFFFAOYSA-N Ethyl methanesulfonate Chemical compound CCOS(C)(=O)=O PLUBXMRUUVWRLT-UHFFFAOYSA-N 0.000 description 1
- 206010015995 Eyelid ptosis Diseases 0.000 description 1
- 206010059024 Gastrointestinal toxicity Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 101100450563 Mus musculus Serpind1 gene Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 206010028813 Nausea Diseases 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 206010029333 Neurosis Diseases 0.000 description 1
- 206010061876 Obstruction Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 239000004373 Pullulan Substances 0.000 description 1
- 229920001218 Pullulan Polymers 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical compound NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 206010047853 Waxy flexibility Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- VIAYODHUVXCRFB-UHFFFAOYSA-N [4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-2-yl]methanamine Chemical compound CC1(C)COC(CN)CN1CC1=CC=CC=C1Cl VIAYODHUVXCRFB-UHFFFAOYSA-N 0.000 description 1
- HSPSHZXMUKHKPV-UHFFFAOYSA-N [4-[(2-chlorophenyl)methyl]-6-methylmorpholin-2-yl]methanamine Chemical compound C1C(CN)OC(C)CN1CC1=CC=CC=C1Cl HSPSHZXMUKHKPV-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- INNSZZHSFSFSGS-UHFFFAOYSA-N acetic acid;titanium Chemical compound [Ti].CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O INNSZZHSFSFSGS-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000005530 alkylenedioxy group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 229940031955 anhydrous lanolin Drugs 0.000 description 1
- 208000022531 anorexia Diseases 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000000891 anti-reserpine Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- FKPSBYZGRQJIMO-UHFFFAOYSA-M benzyl(triethyl)azanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC1=CC=CC=C1 FKPSBYZGRQJIMO-UHFFFAOYSA-M 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N beta-methyl-butyric acid Natural products CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000001465 calcium Nutrition 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- CSTBBLHIGMTEAZ-UHFFFAOYSA-N chloroform;ethyl acetate;hexane Chemical compound ClC(Cl)Cl.CCCCCC.CCOC(C)=O CSTBBLHIGMTEAZ-UHFFFAOYSA-N 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 208000023652 chronic gastritis Diseases 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 206010061428 decreased appetite Diseases 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000001335 demethylating effect Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- YDVNLQGCLLPHAH-UHFFFAOYSA-N dichloromethane;hydrate Chemical compound O.ClCCl YDVNLQGCLLPHAH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 201000006549 dyspepsia Diseases 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000000095 emetic effect Effects 0.000 description 1
- 208000028299 esophageal disease Diseases 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- PUEKXXRSLTWHEW-UHFFFAOYSA-N ethyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholine-4-carboxylate Chemical compound C1N(C(=O)OCC)CCOC1CNC(=O)C1=CC(Cl)=C(N)C=C1OC PUEKXXRSLTWHEW-UHFFFAOYSA-N 0.000 description 1
- IJNIKEUNRANIBE-UHFFFAOYSA-N ethyl 3-(aminomethyl)morpholine-4-carboxylate Chemical compound CCOC(=O)N1CCOCC1CN IJNIKEUNRANIBE-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 208000021302 gastroesophageal reflux disease Diseases 0.000 description 1
- 231100000414 gastrointestinal toxicity Toxicity 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- MOTRZVVGCFFABN-UHFFFAOYSA-N hexane;2-propan-2-yloxypropane Chemical compound CCCCCC.CC(C)OC(C)C MOTRZVVGCFFABN-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- DCPMPXBYPZGNDC-UHFFFAOYSA-N hydron;methanediimine;chloride Chemical compound Cl.N=C=N DCPMPXBYPZGNDC-UHFFFAOYSA-N 0.000 description 1
- 239000001341 hydroxy propyl starch Substances 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 235000013828 hydroxypropyl starch Nutrition 0.000 description 1
- 230000001965 increasing effect Effects 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940031703 low substituted hydroxypropyl cellulose Drugs 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229960003511 macrogol Drugs 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VBBPDQQIZOEHIR-UHFFFAOYSA-N methyl 4-acetamido-2-hexoxybenzoate Chemical compound CCCCCCOC1=CC(NC(C)=O)=CC=C1C(=O)OC VBBPDQQIZOEHIR-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- QGEUDBIRXMKEKB-UHFFFAOYSA-N methyl 5-chloro-2-ethoxybenzoate Chemical compound CCOC1=CC=C(Cl)C=C1C(=O)OC QGEUDBIRXMKEKB-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- HKVOVSYVRRXILB-UHFFFAOYSA-N n-[(4-benzylmorpholin-2-yl)methyl]-1,3-benzodioxole-4-carboxamide Chemical compound C=1C=CC=2OCOC=2C=1C(=O)NCC(OCC1)CN1CC1=CC=CC=C1 HKVOVSYVRRXILB-UHFFFAOYSA-N 0.000 description 1
- VDBITLPJLASHCL-UHFFFAOYSA-N n-[[4-[(2-chlorophenyl)methyl]-6-methylmorpholin-2-yl]methyl]acetamide Chemical compound C1C(CNC(C)=O)OC(C)CN1CC1=CC=CC=C1Cl VDBITLPJLASHCL-UHFFFAOYSA-N 0.000 description 1
- WIIQTHTVTPDPQV-UHFFFAOYSA-N n-[[4-[3-(4-chlorophenoxy)propyl]morpholin-2-yl]methyl]acetamide Chemical compound C1COC(CNC(=O)C)CN1CCCOC1=CC=C(Cl)C=C1 WIIQTHTVTPDPQV-UHFFFAOYSA-N 0.000 description 1
- 230000008693 nausea Effects 0.000 description 1
- 208000015238 neurotic disease Diseases 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- MQAYFGXOFCEZRW-UHFFFAOYSA-N oxane-2-carboxylic acid Chemical compound OC(=O)C1CCCCO1 MQAYFGXOFCEZRW-UHFFFAOYSA-N 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229950008882 polysorbate Drugs 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- SAALQYKUFCIMHR-UHFFFAOYSA-N propan-2-ol;2-propan-2-yloxypropane Chemical compound CC(C)O.CC(C)OC(C)C SAALQYKUFCIMHR-UHFFFAOYSA-N 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 201000003004 ptosis Diseases 0.000 description 1
- 235000019423 pullulan Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 235000021195 test diet Nutrition 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000008673 vomiting Effects 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D267/02—Seven-membered rings
- C07D267/08—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D267/10—Seven-membered rings having the hetero atoms in positions 1 and 4 not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10155286 | 1986-04-30 | ||
| JP10155286 | 1986-04-30 | ||
| JP31509086 | 1986-12-31 | ||
| JP31509086 | 1986-12-31 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI871828A0 FI871828A0 (fi) | 1987-04-27 |
| FI871828A7 FI871828A7 (fi) | 1987-10-31 |
| FI87776B FI87776B (fi) | 1992-11-13 |
| FI87776C true FI87776C (fi) | 1993-02-25 |
Family
ID=26442419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI871828A FI87776C (fi) | 1986-04-30 | 1987-04-27 | Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4870074A (enExample) |
| EP (1) | EP0243959B1 (enExample) |
| KR (1) | KR870010030A (enExample) |
| AR (1) | AR242953A1 (enExample) |
| AU (1) | AU592177B2 (enExample) |
| CA (1) | CA1291135C (enExample) |
| CZ (1) | CZ284687B6 (enExample) |
| DE (1) | DE3781195T2 (enExample) |
| DK (1) | DK175281B1 (enExample) |
| ES (1) | ES2043617T3 (enExample) |
| FI (1) | FI87776C (enExample) |
| GR (1) | GR3005934T3 (enExample) |
| HK (1) | HK18194A (enExample) |
| HU (1) | HU198193B (enExample) |
| NZ (1) | NZ220120A (enExample) |
| PH (1) | PH24049A (enExample) |
| SK (1) | SK289787A3 (enExample) |
| SU (1) | SU1597101A3 (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2640139A1 (fr) * | 1988-12-14 | 1990-06-15 | Delagrange Laboratoires | Application de benzamides substitues comme gastromoteurs |
| US5395832A (en) * | 1991-02-15 | 1995-03-07 | Hokuriku Seiyaku Co., Ltd. | Benzamide derivatives |
| TW213460B (enExample) * | 1991-02-15 | 1993-09-21 | Hokuriku Pharmaceutical | |
| US5864039A (en) * | 1994-03-30 | 1999-01-26 | Yoshitomi Pharmaceutical Industries, Ltd. | Benzoic acid compounds and use thereof as medicaments |
| KR970702247A (ko) * | 1994-03-30 | 1997-05-13 | 고야 마사시 | 벤조산 화합물 및 이들의 약제로서의 용도(benzoic acid compound and use thereof as medicine) |
| KR100446099B1 (ko) * | 1995-05-23 | 2004-11-10 | 얀센 파마슈티카 엔.브이. | (2-모르폴리닐메틸)벤즈아미드유도체 |
| JP2001064177A (ja) * | 1999-08-16 | 2001-03-13 | Schering Ag | ベンズアミド誘導体を有効成分とする製剤 |
| KR20030031198A (ko) | 2000-09-29 | 2003-04-18 | 글락소 그룹 리미티드 | 염증 질환 치료용 모르폴린-아세트아미드 유도체 |
| ATE286897T1 (de) * | 2000-11-28 | 2005-01-15 | Smithkline Beecham Plc | Morpholinderivate als antagonisten an orexinrezeptoren |
| JP4829417B2 (ja) * | 2001-03-26 | 2011-12-07 | 明夫 乾 | インスリン抵抗性改善薬 |
| AU2002356418A1 (en) * | 2001-10-08 | 2003-04-22 | Sun Pharmaceutical Industries Limited | An antispasmodic agent spaced drug delivery system |
| GB0208158D0 (en) * | 2002-03-28 | 2002-05-22 | Glaxo Group Ltd | Novel compounds |
| GB0207447D0 (en) * | 2002-03-28 | 2002-05-08 | Glaxo Group Ltd | Novel compounds |
| GB0207449D0 (en) * | 2002-03-28 | 2002-05-08 | Glaxo Group Ltd | Novel compounds |
| HUP0201980A3 (en) * | 2002-06-13 | 2008-06-30 | Richter Gedeon Nyrt | Process for preparing a benzamide derivative and intermediates thereof |
| JP4740740B2 (ja) * | 2003-12-09 | 2011-08-03 | 大日本住友製薬株式会社 | 薬物含有粒子および該粒子を含む固形製剤 |
| US8138204B2 (en) * | 2004-01-07 | 2012-03-20 | Aryx Therapeutics, Inc. | Stereoisomeric compounds and methods for the treatment of gastrointestinal and central nervous system disorders |
| EP1704146B1 (en) | 2004-01-07 | 2010-04-14 | Aryx Therapeutics | Stereoisomeric compounds and methods for the treatment of gastrointestinal and central nervous system disorders |
| US8524736B2 (en) | 2004-01-07 | 2013-09-03 | Armetheon, Inc. | Stereoisomeric compounds and methods for the treatment of gastrointestinal and central nervous system disorders |
| EP1801108B9 (en) * | 2004-09-08 | 2013-11-20 | Mitsubishi Tanabe Pharma Corporation | Morpholine compounds for the treatment of inflammations |
| TWI391380B (zh) * | 2005-06-23 | 2013-04-01 | Array Biopharma Inc | 製備苯并咪唑化合物之方法 |
| ES2436100T3 (es) * | 2005-08-31 | 2013-12-27 | Armetheon, Inc. | Métodos sintéticos y productos intermedios para compuestos estereoisoméricos útiles para el tratamiento de trastornos del sistema nervioso central y gastrointestinal |
| US20090042926A1 (en) * | 2005-12-20 | 2009-02-12 | Jason Imbriglio | Niacin Receptor Agonists, Compositions Containing Such Compounds and Methods of Treatment |
| KR100750593B1 (ko) * | 2006-03-16 | 2007-08-20 | 동우신테크 주식회사 | 치환된 벤즈아미드 유도체의 제조방법 |
| US20080085915A1 (en) * | 2006-06-23 | 2008-04-10 | Cyrus Becker | Compounds and methods for the treatment of gastrointestinal and central nervous system disorders |
| WO2008131259A1 (en) | 2007-04-19 | 2008-10-30 | Concert Pharmaceuticals Inc. | Deuterated morpholinyl compounds |
| CN101402633A (zh) * | 2007-09-11 | 2009-04-08 | 上海恒瑞医药有限公司 | 苯甲酰胺类衍生物、其制备方法及其在医药上的用途 |
| KR101612137B1 (ko) | 2008-02-13 | 2016-04-12 | 다이닛본 스미토모 세이야꾸 가부시끼가이샤 | 구강 내 붕괴정 |
| TWI423967B (zh) * | 2008-02-21 | 2014-01-21 | Dainippon Sumitomo Pharma Co | 醯胺衍生物及含有其之醫藥組合物 |
| EP2465495A4 (en) | 2009-08-11 | 2013-01-23 | Dainippon Sumitomo Pharma Co | TABLET WITH FAST DECOMPOSITION IN THE MOUTH AND TWO OR MORE TYPES OF PARTICLES |
| WO2011107903A1 (en) | 2010-03-04 | 2011-09-09 | Ranbaxy Laboratories Limited | Highly pure mosapride citrate dihydrate and processes for its preparation |
| BR112013019942B1 (pt) | 2011-02-25 | 2022-01-11 | Yuhan Corporation | Uso de composto ou de seu sal farmaceuticamente aceitável, composição farmacêutica, compostos ou seus sais farmaceuticamente aceitáveis e respectivos processos de preparação |
| KR101657616B1 (ko) | 2013-05-24 | 2016-09-19 | 주식회사유한양행 | 피리미딘 고리를 포함하는 바이사이클릭 유도체 및 그의 제조방법 |
| TWI794171B (zh) | 2016-05-11 | 2023-03-01 | 美商滬亞生物國際有限公司 | Hdac抑制劑與pd-l1抑制劑之組合治療 |
| TWI808055B (zh) | 2016-05-11 | 2023-07-11 | 美商滬亞生物國際有限公司 | Hdac 抑制劑與 pd-1 抑制劑之組合治療 |
| CN111349052B (zh) * | 2020-04-07 | 2021-02-12 | 福建海西新药创制有限公司 | 一种枸橼酸莫沙必利的合成方法 |
| CN114560822B (zh) * | 2020-11-27 | 2024-05-28 | 鲁南制药集团股份有限公司 | 一种莫沙必利的二羧酸晶体 |
| CN114591260B (zh) * | 2020-12-05 | 2025-07-11 | 鲁南制药集团股份有限公司 | 一种莫沙必利有机酸盐 |
| CN119241463A (zh) * | 2024-10-22 | 2025-01-03 | 吉林修正药业新药开发有限公司 | 一种枸橼酸莫沙必利杂质化合物及其制备方法 |
| CN119241464A (zh) * | 2024-10-22 | 2025-01-03 | 吉林修正药业新药开发有限公司 | 一种枸橼酸莫沙必利杂质化合物及其制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH451142A (de) * | 1965-01-19 | 1968-05-15 | Sandoz Ag | Verfahren zur Herstellung neuer basisch substituierter Benzoesäureamide |
| US4029786A (en) * | 1972-08-11 | 1977-06-14 | Imperial Chemical Industries Limited | Morpholine derivatives for treating depression |
| US4323503A (en) * | 1976-08-04 | 1982-04-06 | Societe D'etudes Scientifiques Et Industrielles De L'ile-De-France | Substituted 2,3-alkylene di (oxy) benzamides and derivatives |
| US4210754A (en) * | 1977-02-01 | 1980-07-01 | Hoffmann-La Roche Inc. | Morpholino containing benzamides |
| US4692445A (en) * | 1983-04-29 | 1987-09-08 | Rorer Pharmaceutical Corporation | Bicyclic benzenoid aminoalkylene ethers and thioethers, pharmaceutical compositions and use |
| FR2575158B1 (fr) * | 1984-12-20 | 1987-10-02 | Pf Medicament | Arylalcoyloxymethyl-2 morpholines, leur preparation et leur application en tant que medicaments utiles dans le traitement des troubles du systeme nerveux central |
| JPH0390274A (ja) * | 1989-08-28 | 1991-04-16 | Furukawa Alum Co Ltd | Al又はAl合金の気相ろう付法 |
-
1987
- 1987-04-24 CZ CS872897A patent/CZ284687B6/cs not_active IP Right Cessation
- 1987-04-24 US US07/042,474 patent/US4870074A/en not_active Expired - Lifetime
- 1987-04-24 SK SK2897-87A patent/SK289787A3/sk unknown
- 1987-04-27 FI FI871828A patent/FI87776C/fi not_active IP Right Cessation
- 1987-04-28 CA CA000535794A patent/CA1291135C/en not_active Expired - Lifetime
- 1987-04-28 NZ NZ220120A patent/NZ220120A/xx unknown
- 1987-04-29 ES ES87106266T patent/ES2043617T3/es not_active Expired - Lifetime
- 1987-04-29 HU HU871946A patent/HU198193B/hu unknown
- 1987-04-29 SU SU874202484A patent/SU1597101A3/ru active
- 1987-04-29 PH PH35203A patent/PH24049A/en unknown
- 1987-04-29 DK DK198702187A patent/DK175281B1/da not_active IP Right Cessation
- 1987-04-29 EP EP87106266A patent/EP0243959B1/en not_active Expired - Lifetime
- 1987-04-29 DE DE8787106266T patent/DE3781195T2/de not_active Expired - Lifetime
- 1987-04-30 AR AR87307449A patent/AR242953A1/es active
- 1987-04-30 KR KR870004220A patent/KR870010030A/ko not_active Withdrawn
- 1987-04-30 AU AU72275/87A patent/AU592177B2/en not_active Expired
-
1992
- 1992-10-12 GR GR920402254T patent/GR3005934T3/el unknown
-
1994
- 1994-03-03 HK HK181/94A patent/HK18194A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU7227587A (en) | 1987-11-05 |
| FI87776B (fi) | 1992-11-13 |
| FI871828A7 (fi) | 1987-10-31 |
| CZ284687B6 (cs) | 1999-02-17 |
| ES2043617T3 (es) | 1994-01-01 |
| NZ220120A (en) | 1989-06-28 |
| CZ289787A3 (cs) | 1998-11-11 |
| SU1597101A3 (ru) | 1990-09-30 |
| HUT45514A (en) | 1988-07-28 |
| AR242953A1 (es) | 1993-06-30 |
| EP0243959A1 (en) | 1987-11-04 |
| AU592177B2 (en) | 1990-01-04 |
| DK175281B1 (da) | 2004-08-09 |
| SK279058B6 (sk) | 1998-06-03 |
| GR3005934T3 (enExample) | 1993-06-07 |
| HU198193B (en) | 1989-08-28 |
| DK218787D0 (da) | 1987-04-29 |
| US4870074A (en) | 1989-09-26 |
| DE3781195T2 (de) | 1993-02-18 |
| FI871828A0 (fi) | 1987-04-27 |
| DE3781195D1 (de) | 1992-09-24 |
| HK18194A (en) | 1994-03-11 |
| EP0243959B1 (en) | 1992-08-19 |
| SK289787A3 (en) | 1998-06-03 |
| DK218787A (da) | 1987-10-31 |
| PH24049A (en) | 1990-03-05 |
| KR870010030A (ko) | 1987-11-30 |
| CA1291135C (en) | 1991-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI87776C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva substituerade benzamider | |
| ES2279009T3 (es) | Derivados de lactama como antagonistas de receptores 11cby humanos. | |
| US6294555B1 (en) | 1-[(1-Substituted-4-piperidinyl)methyl]-4-piperidine derivative, process for producing the same, medicinal compositions containing the same and intermediates of these compounds | |
| US5281590A (en) | 2-H and 3-alkoxy or hydroxy-8-substituted-dibenz[b,f]-[1,4]oxazepine-10(11)-carboxylic acid, substituted hydrazides for the treatment of osteoporosis | |
| SK154196A3 (en) | Piperazine derivatives, preparation method thereof and their use as 5ht1a antagonists | |
| EP1131321B1 (en) | Indole derivatives and their use as serotonin receptor ligands | |
| NO301586B1 (no) | Dibenz£b,f|£1,4|oksazepin-11(10H)oner, fremgangsmåte til fremstilling derav og farmasöytisk preparat inneholdende dem | |
| WO1991010650A1 (en) | Piperidine and pyrrolidine derivatives | |
| JPH0977742A (ja) | 新規なベンズアミド誘導体 | |
| US4749703A (en) | Calcium antagonist piperazine derivatives, and compositions therefor | |
| US7220777B2 (en) | Lactam derivatives as antagonists for human 11cby receptors | |
| US6528504B2 (en) | Oxazepine derivatives and medicine containing the same | |
| JPH0357903B2 (enExample) | ||
| US7320973B2 (en) | Dihydrodiaryloxazepine derivative and pharmaceutical composition containing the same | |
| SK137597A3 (en) | 1-£'omega'-(3,4-dihydro-2-naphthalenyl)alkyl| cyclic amine derivatives, process for producing the same, and medicinal composition containing the same | |
| KR950008530B1 (ko) | 치환된 벤즈아미드 유도체, 그 제조방법 및 이를 함유하는 약학적 조성물 | |
| KR20040074102A (ko) | 카르복실산 유도체 | |
| ALAGARSAMY et al. | Sinteza i farmakološko ispitivanje novih 4-(3-etilfenil)-1-supstituiranih 4H-[1, 2, 4] triazolo [4, 3-a] kinazolin-5-ona kao nove klase H1-antihistaminika | |
| JPWO2000040570A1 (ja) | オキサゼピン誘導体及び該誘導体を含有する医薬 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Patent granted |
Owner name: DAINIPPON PHARMACEUTICAL CO., LTD. |
|
| MA | Patent expired |