FI70216C - Foerfarande foer framstaellning av nya 1-etyl-6-fluor-7-(3-substituerad-1-pyrrolidinyl)-1,8-naftyridin-3-karboxylsyraderivat anvaendbara som antibakteriella medel - Google Patents
Foerfarande foer framstaellning av nya 1-etyl-6-fluor-7-(3-substituerad-1-pyrrolidinyl)-1,8-naftyridin-3-karboxylsyraderivat anvaendbara som antibakteriella medel Download PDFInfo
- Publication number
- FI70216C FI70216C FI803042A FI803042A FI70216C FI 70216 C FI70216 C FI 70216C FI 803042 A FI803042 A FI 803042A FI 803042 A FI803042 A FI 803042A FI 70216 C FI70216 C FI 70216C
- Authority
- FI
- Finland
- Prior art keywords
- ethyl
- compound
- formula
- naphthyridine
- fluoro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 109
- -1 1-ethyl-6-fluoro-7- (3-substituted-1-pyrrolidinyl) -1,8-naphthyridine-3-carboxylic acid Chemical class 0.000 claims description 41
- 239000002253 acid Substances 0.000 claims description 36
- 125000006239 protecting group Chemical group 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 230000000844 anti-bacterial effect Effects 0.000 claims description 9
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 8
- 150000001450 anions Chemical class 0.000 claims description 8
- 229910052731 fluorine Inorganic materials 0.000 claims description 8
- 239000011737 fluorine Substances 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000003242 anti bacterial agent Substances 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims 1
- 241000277284 Salvelinus fontinalis Species 0.000 claims 1
- 230000002110 toxicologic effect Effects 0.000 claims 1
- 231100000027 toxicology Toxicity 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 52
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 45
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 34
- 239000000203 mixture Substances 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- 239000002585 base Substances 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 25
- 239000000243 solution Substances 0.000 description 22
- 239000002244 precipitate Substances 0.000 description 20
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 18
- 238000003756 stirring Methods 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 15
- 239000012954 diazonium Substances 0.000 description 15
- 229960000443 hydrochloric acid Drugs 0.000 description 15
- 238000010992 reflux Methods 0.000 description 14
- 150000001989 diazonium salts Chemical class 0.000 description 13
- 208000015181 infectious disease Diseases 0.000 description 11
- 239000007795 chemical reaction product Substances 0.000 description 10
- 230000002829 reductive effect Effects 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 238000006467 substitution reaction Methods 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 7
- LJYJAEQCLXAHFQ-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(Cl)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 LJYJAEQCLXAHFQ-UHFFFAOYSA-N 0.000 description 6
- 241000894006 Bacteria Species 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 150000005058 1,8-naphthyridines Chemical class 0.000 description 5
- BQDVLIDLHOSQHC-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(N)C1 BQDVLIDLHOSQHC-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 5
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000006894 reductive elimination reaction Methods 0.000 description 5
- 230000009885 systemic effect Effects 0.000 description 5
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 241000699666 Mus <mouse, genus> Species 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 229940125904 compound 1 Drugs 0.000 description 4
- 229940125782 compound 2 Drugs 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-dimethylbenzene Natural products CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- VMQOKIGGJZABQQ-UHFFFAOYSA-N 7-(3-acetamidopyrrolidin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(NC(C)=O)C1 VMQOKIGGJZABQQ-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 229940126062 Compound A Drugs 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 231100000460 acute oral toxicity Toxicity 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 238000007912 intraperitoneal administration Methods 0.000 description 3
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- DQEZUPBIKTXOSW-UHFFFAOYSA-N 1-(pyrrolidin-3-ylamino)propan-2-one Chemical compound CC(=O)CNC1CCNC1 DQEZUPBIKTXOSW-UHFFFAOYSA-N 0.000 description 2
- PAIPBNLRLDPMJO-UHFFFAOYSA-N 1-ethyl-6-fluoro-4-oxo-7-[3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N(C1)CCC1NC(=O)OCC1=CC=CC=C1 PAIPBNLRLDPMJO-UHFFFAOYSA-N 0.000 description 2
- HSGYLDBZTRHBCR-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-[3-(methylamino)pyrrolidin-1-yl]-1,8-naphthyridin-4-one Chemical compound C(C)N1C=CC(C2=CC(=C(N=C12)N1CC(CC1)NC)F)=O HSGYLDBZTRHBCR-UHFFFAOYSA-N 0.000 description 2
- SDUXFWBQJKQSLT-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-[3-(methylamino)pyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(NC)C1 SDUXFWBQJKQSLT-UHFFFAOYSA-N 0.000 description 2
- UOQHWNPVNXSDDO-UHFFFAOYSA-N 3-bromoimidazo[1,2-a]pyridine-6-carbonitrile Chemical compound C1=CC(C#N)=CN2C(Br)=CN=C21 UOQHWNPVNXSDDO-UHFFFAOYSA-N 0.000 description 2
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 2
- ZLUCAEFRANXBKF-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride Chemical compound Cl.N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(N)C1 ZLUCAEFRANXBKF-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 241000193996 Streptococcus pyogenes Species 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000005103 alkyl silyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013256 coordination polymer Substances 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- FTVDNLKUHAZFLG-UHFFFAOYSA-N ethyl 1-ethyl-6-fluoro-7-methoxy-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound COC1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=N1 FTVDNLKUHAZFLG-UHFFFAOYSA-N 0.000 description 2
- BOCOIWFIRVIXEQ-UHFFFAOYSA-N ethyl 1-ethyl-7-methoxy-6-nitro-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound COC1=C([N+]([O-])=O)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=N1 BOCOIWFIRVIXEQ-UHFFFAOYSA-N 0.000 description 2
- OZHNZTJHNKQKDL-UHFFFAOYSA-N ethyl 6-amino-1-ethyl-7-methoxy-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound COC1=C(N)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=N1 OZHNZTJHNKQKDL-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000001678 irradiating effect Effects 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 229960000448 lactic acid Drugs 0.000 description 2
- 229940099563 lactobionic acid Drugs 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- HDCCJUCOIKLZNM-UHFFFAOYSA-N n-pyrrolidin-3-ylacetamide Chemical compound CC(=O)NC1CCNC1 HDCCJUCOIKLZNM-UHFFFAOYSA-N 0.000 description 2
- MHWLWQUZZRMNGJ-UHFFFAOYSA-N nalidixic acid Chemical compound C1=C(C)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHWLWQUZZRMNGJ-UHFFFAOYSA-N 0.000 description 2
- 150000005054 naphthyridines Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 238000005979 thermal decomposition reaction Methods 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical group N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- KONLZZQLTABAAC-UHFFFAOYSA-N 1-ethyl-4-oxo-7-pyrrolidin-1-yl-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC=C1N1CCCC1 KONLZZQLTABAAC-UHFFFAOYSA-N 0.000 description 1
- XYGUDUHZSJWYPM-UHFFFAOYSA-N 1-ethyl-6-fluoro-4,7-dioxo-8h-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(O)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 XYGUDUHZSJWYPM-UHFFFAOYSA-N 0.000 description 1
- OVLFKCPTCUOZMO-UHFFFAOYSA-N 1-ethyl-6-fluoro-4-oxo-7-[3-(2-oxopropylamino)pyrrolidin-1-yl]-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(NCC(C)=O)C1 OVLFKCPTCUOZMO-UHFFFAOYSA-N 0.000 description 1
- SLCJJDUWIODLSK-UHFFFAOYSA-N 1-ethyl-6-fluoro-4-oxo-7-[3-(propan-2-ylamino)pyrrolidin-1-yl]-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(NC(C)C)C1 SLCJJDUWIODLSK-UHFFFAOYSA-N 0.000 description 1
- DVGQZGSRNOYAGE-UHFFFAOYSA-N 1-ethyl-6-fluoro-4-oxo-7-pyrrolidin-1-yl-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCCC1 DVGQZGSRNOYAGE-UHFFFAOYSA-N 0.000 description 1
- UMDSGHDGURILEZ-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-[3-(methylamino)pyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride Chemical compound Cl.N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(NC)C1 UMDSGHDGURILEZ-UHFFFAOYSA-N 0.000 description 1
- VUQUWJWPLQKIBG-UHFFFAOYSA-N 1-ethyl-7-[3-(ethylamino)pyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C(NCC)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(O)=O)=CN2CC VUQUWJWPLQKIBG-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- JMXCJYDVRCEOMI-UHFFFAOYSA-N 3-chloro-1,8-naphthyridine Chemical class N1=CC=CC2=CC(Cl)=CN=C21 JMXCJYDVRCEOMI-UHFFFAOYSA-N 0.000 description 1
- QILHGSSOWXKYFZ-UHFFFAOYSA-N 3-fluoro-1,8-naphthyridine Chemical class N1=CC=CC2=CC(F)=CN=C21 QILHGSSOWXKYFZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- LVZSNQPBPUONNY-UHFFFAOYSA-N 6-chloro-1-ethyl-4-oxo-7-pyrrolidin-1-yl-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(Cl)=C1N1CCCC1 LVZSNQPBPUONNY-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- VTNOCMJGRXLPGM-UHFFFAOYSA-N C(C)C=1N(C2=NC(=C(C=C2C(C1)=O)F)N1CC(CC1)NC(C)=O)CC Chemical compound C(C)C=1N(C2=NC(=C(C=C2C(C1)=O)F)N1CC(CC1)NC(C)=O)CC VTNOCMJGRXLPGM-UHFFFAOYSA-N 0.000 description 1
- 241001478240 Coccus Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- BAJHNJXAMHNSDN-UHFFFAOYSA-N NC1CN(CC1)C1(CN(C2=NC=C(C=C2C1=O)F)CC)C(=O)O Chemical compound NC1CN(CC1)C1(CN(C2=NC=C(C=C2C1=O)F)CC)C(=O)O BAJHNJXAMHNSDN-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 description 1
- UIQWBVPFHHQZHH-UHFFFAOYSA-N OOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOO UIQWBVPFHHQZHH-UHFFFAOYSA-N 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- 238000006350 Schiemann fluorination reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000002924 anti-infective effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005101 aryl methoxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- HMWIMQPWNDDSFE-UHFFFAOYSA-N benzyl pyrrolidine-3-carboxylate Chemical compound C1CNCC1C(=O)OCC1=CC=CC=C1 HMWIMQPWNDDSFE-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- SKCNIGRBPJIUBQ-UHFFFAOYSA-N chloroform;ethyl acetate Chemical compound ClC(Cl)Cl.CCOC(C)=O SKCNIGRBPJIUBQ-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- ZZOOBDLMUUWALZ-UHFFFAOYSA-N ethyl 1-ethyl-6-fluoro-4-oxo-7-[3-(2-oxopropylamino)pyrrolidin-1-yl]-1,8-naphthyridine-3-carboxylate Chemical compound FC=1C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=NC=1N1CCC(NCC(C)=O)C1 ZZOOBDLMUUWALZ-UHFFFAOYSA-N 0.000 description 1
- NDESOPVYUOKSCO-UHFFFAOYSA-N ethyl 1-ethyl-7-ethylsulfonyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound CCS(=O)(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=N1 NDESOPVYUOKSCO-UHFFFAOYSA-N 0.000 description 1
- QVRCBTFBMRMXHO-UHFFFAOYSA-N ethyl 1-ethyl-7-methoxy-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound COC1=CC=C2C(=O)C(C(=O)OCC)=CN(CC)C2=N1 QVRCBTFBMRMXHO-UHFFFAOYSA-N 0.000 description 1
- MBZJZMDWZDAYQD-UHFFFAOYSA-N ethyl 6-amino-7-chloro-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound ClC1=C(N)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=N1 MBZJZMDWZDAYQD-UHFFFAOYSA-N 0.000 description 1
- JYCMNNYCLUCNRH-UHFFFAOYSA-N ethyl 7-(3-acetamidopyrrolidin-1-yl)-6-amino-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound NC=1C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=NC=1N1CCC(NC(C)=O)C1 JYCMNNYCLUCNRH-UHFFFAOYSA-N 0.000 description 1
- VQRGWMZCXPPTBE-UHFFFAOYSA-N ethyl 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound ClC1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=N1 VQRGWMZCXPPTBE-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- QAXZWHGWYSJAEI-UHFFFAOYSA-N n,n-dimethylformamide;ethanol Chemical compound CCO.CN(C)C=O QAXZWHGWYSJAEI-UHFFFAOYSA-N 0.000 description 1
- NBKSUJZHTCAECY-UHFFFAOYSA-N n-propyl-n-pyrrolidin-3-ylacetamide Chemical compound CCCN(C(C)=O)C1CCNC1 NBKSUJZHTCAECY-UHFFFAOYSA-N 0.000 description 1
- 229960000210 nalidixic acid Drugs 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 229940126701 oral medication Drugs 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- RCIMBBZXSXFZBV-UHFFFAOYSA-N piromidic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CN=C1N1CCCC1 RCIMBBZXSXFZBV-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- NGXSWUFDCSEIOO-UHFFFAOYSA-N pyrrolidin-3-amine Chemical compound NC1CCNC1 NGXSWUFDCSEIOO-UHFFFAOYSA-N 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- PNGLEYLFMHGIQO-UHFFFAOYSA-M sodium;3-(n-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate;dihydrate Chemical compound O.O.[Na+].[O-]S(=O)(=O)CC(O)CN(CC)C1=CC=CC(OC)=C1 PNGLEYLFMHGIQO-UHFFFAOYSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 239000012137 tryptone Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12622379A JPS5649382A (en) | 1979-09-28 | 1979-09-28 | 6-fluoro-7-cyclic amino-1,8-naphthylidine derivative and its salt |
| JP12622379 | 1979-09-28 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI803042A7 FI803042A7 (fi) | 1981-03-29 |
| FI70216B FI70216B (fi) | 1986-02-28 |
| FI70216C true FI70216C (fi) | 1986-09-15 |
Family
ID=14929790
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI803042A FI70216C (fi) | 1979-09-28 | 1980-09-26 | Foerfarande foer framstaellning av nya 1-etyl-6-fluor-7-(3-substituerad-1-pyrrolidinyl)-1,8-naftyridin-3-karboxylsyraderivat anvaendbara som antibakteriella medel |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4341784A (enExample) |
| EP (1) | EP0027752B1 (enExample) |
| JP (1) | JPS5649382A (enExample) |
| AR (1) | AR226320A1 (enExample) |
| AU (1) | AU534288B2 (enExample) |
| CA (1) | CA1147731A (enExample) |
| CS (1) | CS215139B2 (enExample) |
| DD (1) | DD155990A5 (enExample) |
| DE (1) | DE3065949D1 (enExample) |
| DK (1) | DK155048C (enExample) |
| ES (1) | ES8107217A1 (enExample) |
| FI (1) | FI70216C (enExample) |
| HU (1) | HU183218B (enExample) |
| PH (1) | PH15907A (enExample) |
| PL (1) | PL127762B1 (enExample) |
| SU (1) | SU1060112A3 (enExample) |
| YU (1) | YU42983B (enExample) |
| ZA (1) | ZA806007B (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4382937A (en) * | 1981-02-27 | 1983-05-10 | Dainippon Pharmaceutical Co., Ltd. | Naphthyridine derivatives and their use as anti-bacterials |
| JPS57146775A (en) * | 1981-03-06 | 1982-09-10 | Dainippon Pharmaceut Co Ltd | 1,8-naphthyridine derivative and its salt |
| JPS5925391A (ja) * | 1982-07-30 | 1984-02-09 | Dainippon Pharmaceut Co Ltd | ピリジルナフチリジン誘導体およびその塩 |
| US5281612A (en) * | 1982-09-09 | 1994-01-25 | Warner-Lambert Company | Naphthyridine antibacterial agents |
| US4665079A (en) * | 1984-02-17 | 1987-05-12 | Warner-Lambert Company | Antibacterial agents |
| IE55898B1 (en) * | 1982-09-09 | 1991-02-14 | Warner Lambert Co | Antibacterial agents |
| US4777175A (en) * | 1982-09-09 | 1988-10-11 | Warner-Lambert Company | Antibacterial agents |
| FR2559484B2 (fr) * | 1983-07-06 | 1986-09-26 | Provesan Sa | Nouveau derive 7-(pyrrol-1-yl) de l'acide 1-ethyl-1,4-dihydro-4-oxo-(1,8-naphtyridin)-3-carboxylique, sa preparation et son application en tant que medicament |
| JPS60260577A (ja) * | 1984-06-06 | 1985-12-23 | Dainippon Pharmaceut Co Ltd | 1,8−ナフチリジン誘導体 |
| CS274601B2 (en) * | 1983-07-27 | 1991-09-15 | Dainippon Pharmaceutical Co | Method of 1,8-naphthyridine derivative production |
| JPS60112790A (ja) * | 1983-11-21 | 1985-06-19 | Dainippon Pharmaceut Co Ltd | ピリジルナフチリジン誘導体 |
| NZ210847A (en) * | 1984-01-26 | 1988-02-29 | Abbott Lab | Naphthyridine and pyridopyrimidine derivatives and pharmaceutical compositions |
| DE3409922A1 (de) * | 1984-03-17 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | 1,7-diamino-1,4-dihydro-4-oxo-3-(aza)chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie ihre verwendung bei der bekaempfung bakterieller erkrankungen |
| US4571396A (en) * | 1984-04-16 | 1986-02-18 | Warner-Lambert Company | Antibacterial agents |
| US4604401A (en) * | 1984-07-20 | 1986-08-05 | Warner-Lambert Company | Antibacterial agents III |
| DE3508816A1 (de) * | 1985-01-10 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | 6,7-disubstituierte 1-cyclopropyl-1,4-dihydro-4-oxo-1,8-naphtyridin-3-carbonsaeuren |
| US4851535A (en) * | 1985-01-23 | 1989-07-25 | Toyama Chemical Co., Ltd. | Nicotinic acid derivatives |
| DE3525108A1 (de) * | 1985-06-07 | 1986-12-11 | Bayer Ag, 5090 Leverkusen | Antibakteriell wirksame chinoloncarbonsaeureester |
| US4692454A (en) * | 1986-02-03 | 1987-09-08 | Warner-Lambert Company | Opthalmic use of quinolone antibiotics |
| US4954507A (en) * | 1986-10-08 | 1990-09-04 | Bristol-Myers Company | 1-tertiary-alkyl-substituted naphthyridine carboxylic acid antibacterial agents |
| ZA877471B (en) * | 1986-10-08 | 1988-04-05 | Bristol-Myers Company | 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acid antibacterial agents |
| US4923879A (en) * | 1987-07-31 | 1990-05-08 | Warner-Lambert Company | 1,8-Naphthyridines and their use as antibacterial agents |
| US4962108A (en) * | 1987-07-31 | 1990-10-09 | Warner-Lambert Company | Antibacterial quinoline compounds |
| US4920120A (en) * | 1988-01-25 | 1990-04-24 | Warner-Lambert Company | Antibacterial agents |
| US5585491A (en) * | 1988-01-25 | 1996-12-17 | Otsuka Pharmaceutical Co., Ltd. | Antibacterial agents |
| KR910003630B1 (ko) * | 1988-06-17 | 1991-06-07 | 한국과학기술원 | 벤조일 아세틱 에스테르 유도체 및 그 제조방법 |
| US5585264A (en) * | 1988-07-15 | 1996-12-17 | University Of Saskatchewan | Nucleotide sequences encoding recombinant bovine herpesvirus type-1 GI, GIII and GIV polypeptides |
| US5151267A (en) * | 1988-07-15 | 1992-09-29 | University Of Saskatchewan | Bovine herpesvirus type 1 polypeptides and vaccines |
| IE76284B1 (en) * | 1988-09-22 | 1997-10-08 | Abbott Lab | Amino acid quinoline and naphthyridine derivatives |
| US5262417A (en) * | 1988-12-06 | 1993-11-16 | The Upjohn Company | Antibacterial quinolone compounds |
| US5527910A (en) * | 1992-12-30 | 1996-06-18 | Cheil Foods & Chemicals, Inc. | Pyridone carboxylic acid compounds and their uses for treating infectious diseases caused by bacteria |
| JPH08213881A (ja) * | 1995-02-02 | 1996-08-20 | Fujitsu Ltd | 周波数制御回路 |
| US5994365A (en) * | 1997-02-25 | 1999-11-30 | Diazans Limited | Substituted diazaanthracene compounds having pharmaceutical utility |
| ATE423776T1 (de) | 1997-09-15 | 2009-03-15 | Procter & Gamble | Antimikrobielle chinolone, ihre zusammensetzungen und ihre verwendungen |
| US6387928B1 (en) * | 1997-09-15 | 2002-05-14 | The Procter & Gamble Co. | Antimicrobial quinolones, their compositions and uses |
| PT2001862E (pt) * | 2006-03-28 | 2011-07-20 | Warner Chilcott Co Llc | Sais de malato e polimorfos do ácido (3s,5s)-7-[3- amino-5-metil-piperidinil]-1-ciclopropil-1,4-dihidro- 8-metoxi-4-oxo-3-quinolinocarboxílico |
| WO2007110836A1 (en) * | 2006-03-28 | 2007-10-04 | The Procter & Gamble Company | A hydride reduction process for preparing quinolone intermediates |
| BRPI0709220A2 (pt) * | 2006-03-28 | 2011-07-12 | Procter & Gamble | processo de acoplamento para preparo de intermediários de quinolona |
| AR096135A1 (es) | 2013-05-02 | 2015-12-09 | Actelion Pharmaceuticals Ltd | Derivados de la quinolona |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3149104A (en) * | 1961-01-03 | 1964-09-15 | Sterling Drug Inc | 4-hydroxy-7-styryl-1, 8-naphthyridine-3-carboxylic acids and esters |
| US3673193A (en) * | 1970-05-11 | 1972-06-27 | Sterling Drug Inc | 4-oxo-1,8-naphthyridine-3-carboxylates and derivatives thereof |
| US3786043A (en) * | 1972-06-19 | 1974-01-15 | Sterling Drug Inc | 7-methyl-4-chloro (or -4-lower-alkoxy)-1,8-naphthyridine-3-carboxylates |
| JPS5637232B2 (enExample) * | 1973-04-17 | 1981-08-29 | ||
| US4024255A (en) * | 1973-04-05 | 1977-05-17 | Allen & Hanburys Limited | Tetrazole containing naphthyridine-3-carboxamides |
| JPS587626B2 (ja) * | 1974-02-13 | 1983-02-10 | 大日本製薬株式会社 | ナフチリジン オヨビ キノリンユウドウタイノセイホウ |
| HU173573B (hu) * | 1975-02-18 | 1979-06-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija novykh proizvodnykh 1,8-naftridina |
| DE2607012A1 (de) * | 1976-02-18 | 1977-08-25 | Schering Ag | Neue 1,5-naphthyridincarbonsaeurederivate und verfahren zu ihrer herstellung |
| IL51092A0 (en) * | 1976-12-10 | 1977-02-28 | Abic Ltd | Naphthyridine derivatives and their preparation |
| JPS543095A (en) * | 1977-06-09 | 1979-01-11 | Daito Koeki | Preparation of 1*88naphthyridine derivative |
| SE444566B (sv) * | 1977-09-20 | 1986-04-21 | Bellon Labor Sa Roger | 7-dialkylamin-6-halogen-4-oxo-1,4-dihydrokinolin-3-karboxylsyra, forfarande for framstellning derav och farmaceutiskt preparat derav |
| AR223983A1 (es) * | 1978-08-25 | 1981-10-15 | Dainippon Pharmaceutical Co | Un procedimiento para-preparar derivados de acido 6-halogeno-4-oxo-7-(1-piperazinil)-1,8-naftiridin-3-carboxilico |
-
1979
- 1979-09-28 JP JP12622379A patent/JPS5649382A/ja active Granted
-
1980
- 1980-09-15 US US06/187,081 patent/US4341784A/en not_active Expired - Lifetime
- 1980-09-16 YU YU2364/80A patent/YU42983B/xx unknown
- 1980-09-18 CS CS806311A patent/CS215139B2/cs unknown
- 1980-09-18 AR AR282579A patent/AR226320A1/es active
- 1980-09-19 AU AU62570/80A patent/AU534288B2/en not_active Ceased
- 1980-09-25 PH PH24631A patent/PH15907A/en unknown
- 1980-09-26 DD DD80224152A patent/DD155990A5/de not_active IP Right Cessation
- 1980-09-26 EP EP80401369A patent/EP0027752B1/en not_active Expired
- 1980-09-26 DK DK408580A patent/DK155048C/da not_active IP Right Cessation
- 1980-09-26 CA CA000361099A patent/CA1147731A/en not_active Expired
- 1980-09-26 FI FI803042A patent/FI70216C/fi not_active IP Right Cessation
- 1980-09-26 SU SU802986385A patent/SU1060112A3/ru active
- 1980-09-26 DE DE8080401369T patent/DE3065949D1/de not_active Expired
- 1980-09-26 HU HU802356A patent/HU183218B/hu not_active IP Right Cessation
- 1980-09-26 ES ES495376A patent/ES8107217A1/es not_active Expired
- 1980-09-27 PL PL1980226951A patent/PL127762B1/pl unknown
- 1980-09-29 ZA ZA00806007A patent/ZA806007B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU236480A (en) | 1983-02-28 |
| DK155048B (da) | 1989-01-30 |
| CA1147731A (en) | 1983-06-07 |
| HU183218B (en) | 1984-04-28 |
| DD155990A5 (de) | 1982-07-21 |
| PL226951A1 (enExample) | 1981-10-16 |
| AU6257080A (en) | 1981-04-09 |
| EP0027752A1 (en) | 1981-04-29 |
| DK408580A (da) | 1981-03-29 |
| CS215139B2 (en) | 1982-07-30 |
| PH15907A (en) | 1983-04-15 |
| SU1060112A3 (ru) | 1983-12-07 |
| AR226320A1 (es) | 1982-06-30 |
| ZA806007B (en) | 1981-10-28 |
| PL127762B1 (en) | 1983-11-30 |
| DK155048C (da) | 1989-06-26 |
| JPS5649382A (en) | 1981-05-02 |
| FI70216B (fi) | 1986-02-28 |
| AU534288B2 (en) | 1984-01-19 |
| JPS6113717B2 (enExample) | 1986-04-15 |
| YU42983B (en) | 1989-02-28 |
| DE3065949D1 (en) | 1984-01-26 |
| EP0027752B1 (en) | 1983-12-21 |
| ES495376A0 (es) | 1981-10-01 |
| US4341784A (en) | 1982-07-27 |
| ES8107217A1 (es) | 1981-10-01 |
| FI803042A7 (fi) | 1981-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI70216C (fi) | Foerfarande foer framstaellning av nya 1-etyl-6-fluor-7-(3-substituerad-1-pyrrolidinyl)-1,8-naftyridin-3-karboxylsyraderivat anvaendbara som antibakteriella medel | |
| FI66379C (fi) | Analogifoerfarande foer framstaellning av terapeutiskt anvaendbara 6-halogen-1,4-dihydro-4-oxo-7-(1-piperazinyl)-1-substituerade 1,8-naftyridin-3-karboxylsyror och salter daerav | |
| US4017622A (en) | Piperazine derivatives | |
| EP0132845A2 (en) | Novel 1,8-Naphthyridine derivatives, and process for preparation thereof | |
| GB2086905A (en) | Benzoheterocyclic compounds and process for preparing same | |
| HU198198B (en) | Process for production of new derivatives of quinoline and medical preparatives containing them as active substance | |
| HU200452B (en) | Process for production of derivatives of quinoline and medical compositions containing them as active substance | |
| IE63492B1 (en) | A Spiro Compound | |
| IE912801A1 (en) | Novel tricyclic compound or salts thereof, method for¹producing the same and antimicrobial agent containing the¹same | |
| JPH01294680A (ja) | キノリンカルボン酸誘導体 | |
| US3962443A (en) | Antibacterial pharmaceutical compositions and processes for preparation thereof | |
| SE445917B (sv) | Benso(ij)kinolizin-2-karboxylsyraderivat, framstellning derav och terapeutisk komposition | |
| CN102834394B (zh) | 双环喹诺酮类化合物及其制备和应用 | |
| IE872444L (en) | Pyrido-benzoxadiazine derivatives | |
| SU1029829A3 (ru) | Способ получени производных 1,8-нафтиридина или их фармацевтически пригодных солей | |
| KR830000325B1 (ko) | 나프티리딘 유도체의 제조방법 | |
| KR830000336B1 (ko) | 나프티리딘 유도체의 제조방법 | |
| FI66612C (fi) | Foerfarande foer framstaellning av nya saosom antimicrobica anaendbara piperazinylbensoheterocykliska foereningar | |
| US4317820A (en) | β-Lactam series compound and antibacterial pharmaceutical composition containing the same | |
| WO2002018344A1 (en) | Novel ester or amide derivatives | |
| JPH03223289A (ja) | チエノキノリン誘導体、チエノナフチリジン誘導体およびそれらの塩 | |
| KR830000337B1 (ko) | 나프티리딘 유도체의 제조방법 | |
| KR830000335B1 (ko) | 나프티리딘 유도체의 제조방법 | |
| CS235545B2 (cs) | Způsob přípravy derivátů 1-ethyl nebo vinyl-6-halogen-1,4-dihydro-4- oxo-7-/1 -piperazinyl/-!,8-nafthyridinu | |
| CS277409B6 (cs) | Nové deriváty chinolinu, jejich estery a soli |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: DAINIPPON PHARMACEUTICAL CO.,_LTD. |