FI58515C - Foerfarande foer kromgarvning - Google Patents
Foerfarande foer kromgarvning Download PDFInfo
- Publication number
- FI58515C FI58515C FI751430A FI751430A FI58515C FI 58515 C FI58515 C FI 58515C FI 751430 A FI751430 A FI 751430A FI 751430 A FI751430 A FI 751430A FI 58515 C FI58515 C FI 58515C
- Authority
- FI
- Finland
- Prior art keywords
- parts
- tanning
- chromium
- acid
- salts
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 14
- 239000000203 mixture Substances 0.000 claims description 62
- 239000011651 chromium Substances 0.000 claims description 59
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 38
- 229910052804 chromium Inorganic materials 0.000 claims description 30
- 229910000514 dolomite Inorganic materials 0.000 claims description 28
- 239000010459 dolomite Substances 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 22
- BFGKITSFLPAWGI-UHFFFAOYSA-N chromium(3+) Chemical class [Cr+3] BFGKITSFLPAWGI-UHFFFAOYSA-N 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 claims description 13
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 claims description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 12
- 150000007513 acids Chemical class 0.000 claims description 11
- 150000003628 tricarboxylic acids Chemical class 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 9
- -1 aliphatic dicarboxylic acids Chemical class 0.000 claims description 7
- ZUDYLZOBWIAUPC-UHFFFAOYSA-L disodium;pentanedioate Chemical compound [Na+].[Na+].[O-]C(=O)CCCC([O-])=O ZUDYLZOBWIAUPC-UHFFFAOYSA-L 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 5
- HQWKKEIVHQXCPI-UHFFFAOYSA-L disodium;phthalate Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C([O-])=O HQWKKEIVHQXCPI-UHFFFAOYSA-L 0.000 claims description 5
- 239000000843 powder Substances 0.000 claims description 5
- 239000011230 binding agent Substances 0.000 claims description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 4
- 239000002516 radical scavenger Substances 0.000 claims 1
- 235000010633 broth Nutrition 0.000 description 56
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 46
- 229910000423 chromium oxide Inorganic materials 0.000 description 46
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 46
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 44
- 235000015217 chromium(III) sulphate Nutrition 0.000 description 36
- 235000002639 sodium chloride Nutrition 0.000 description 35
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 33
- 239000011696 chromium(III) sulphate Substances 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- 229910000356 chromium(III) sulfate Inorganic materials 0.000 description 24
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 23
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 23
- 235000019253 formic acid Nutrition 0.000 description 23
- 239000011780 sodium chloride Substances 0.000 description 23
- 241000283690 Bos taurus Species 0.000 description 22
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 20
- DSHWASKZZBZKOE-UHFFFAOYSA-K chromium(3+);hydroxide;sulfate Chemical compound [OH-].[Cr+3].[O-]S([O-])(=O)=O DSHWASKZZBZKOE-UHFFFAOYSA-K 0.000 description 17
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical class [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 17
- 239000010985 leather Substances 0.000 description 14
- 239000000377 silicon dioxide Substances 0.000 description 14
- 159000000000 sodium salts Chemical class 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 8
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 8
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 8
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 239000000395 magnesium oxide Substances 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 4
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 4
- KFIRODWJCYBBHY-UHFFFAOYSA-N 3-nitrophthalic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1C(O)=O KFIRODWJCYBBHY-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 235000011037 adipic acid Nutrition 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- UZEDIBTVIIJELN-UHFFFAOYSA-N chromium(2+) Chemical class [Cr+2] UZEDIBTVIIJELN-UHFFFAOYSA-N 0.000 description 3
- RYPRIXSYXLDSOA-UHFFFAOYSA-L chromium(2+);sulfate Chemical compound [Cr+2].[O-]S([O-])(=O)=O RYPRIXSYXLDSOA-UHFFFAOYSA-L 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 235000021110 pickles Nutrition 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- KBZFDRWPMZESDI-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarboxylic acid Chemical compound NC1=CC(C(O)=O)=CC(C(O)=O)=C1 KBZFDRWPMZESDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- WKNIDMJWLWUOMZ-UHFFFAOYSA-N [K].[Cr] Chemical compound [K].[Cr] WKNIDMJWLWUOMZ-UHFFFAOYSA-N 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- 229940037003 alum Drugs 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 235000003704 aspartic acid Nutrition 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 239000004220 glutamic acid Substances 0.000 description 2
- 235000013922 glutamic acid Nutrition 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- NJKVZDOEWYNQIO-UHFFFAOYSA-N 2-chlorobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1Cl NJKVZDOEWYNQIO-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 238000010009 beating Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- HRRDCWDFRIJIQZ-UHFFFAOYSA-N naphthalene-1,8-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(C(=O)O)=CC=CC2=C1 HRRDCWDFRIJIQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 239000008237 rinsing water Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- KYKFCSHPTAVNJD-UHFFFAOYSA-L sodium adipate Chemical compound [Na+].[Na+].[O-]C(=O)CCCCC([O-])=O KYKFCSHPTAVNJD-UHFFFAOYSA-L 0.000 description 1
- 239000001601 sodium adipate Substances 0.000 description 1
- 235000011049 sodium adipate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000004065 wastewater treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C14—SKINS; HIDES; PELTS; LEATHER
- C14C—CHEMICAL TREATMENT OF HIDES, SKINS OR LEATHER, e.g. TANNING, IMPREGNATING, FINISHING; APPARATUS THEREFOR; COMPOSITIONS FOR TANNING
- C14C3/00—Tanning; Compositions for tanning
- C14C3/02—Chemical tanning
- C14C3/04—Mineral tanning
- C14C3/06—Mineral tanning using chromium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Treatment And Processing Of Natural Fur Or Leather (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2424300 | 1974-05-18 | ||
| DE2424300A DE2424300C3 (de) | 1974-05-18 | 1974-05-18 | Verfahren zum Chromgerben und Gerbmischung dafür |
| DE2424301 | 1974-05-18 | ||
| DE2424301A DE2424301C3 (de) | 1974-05-18 | 1974-05-18 | Verfahren zum Chromgerben und Gerbmischung dafür |
| BE854785 | 1977-05-18 | ||
| BE177694A BE854785A (fr) | 1974-05-18 | 1977-05-18 | Procede perfectionne pour le tannage du cuir |
| BE177694 | 1977-05-18 | ||
| BE854785 | 1977-05-18 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI751430A7 FI751430A7 (enExample) | 1975-11-19 |
| FI58515B FI58515B (fi) | 1980-10-31 |
| FI58515C true FI58515C (fi) | 1981-02-10 |
Family
ID=27424674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI751430A FI58515C (fi) | 1974-05-18 | 1975-05-15 | Foerfarande foer kromgarvning |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4042321A (enExample) |
| JP (1) | JPS5248161B2 (enExample) |
| AR (1) | AR208085A1 (enExample) |
| AT (1) | AT336758B (enExample) |
| BE (1) | BE854785A (enExample) |
| BR (1) | BR7503035A (enExample) |
| CA (1) | CA1052954A (enExample) |
| CH (1) | CH615224A5 (enExample) |
| DK (1) | DK150989C (enExample) |
| FI (1) | FI58515C (enExample) |
| FR (1) | FR2271290B1 (enExample) |
| GB (1) | GB1511017A (enExample) |
| IN (1) | IN142040B (enExample) |
| NL (1) | NL178609C (enExample) |
| SE (1) | SE422471B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2626429C3 (de) * | 1976-06-12 | 1981-06-19 | Bayer Ag, 5090 Leverkusen | Verfahren zum Chromgerben von Häuten oder Nachgerben von Leder in Gegenwart von Carbonsäuren als Komplexbildner |
| DE2626430C2 (de) * | 1976-06-12 | 1982-06-03 | Bayer Ag, 5090 Leverkusen | Verfahren zum Gerben von Leder und Gerbmischung |
| DE2822072A1 (de) * | 1978-05-20 | 1979-11-29 | Henkel Kgaa | Verwendung wasserunloeslicher aluminiumsilikate bei der lederherstellung |
| DE2739844C3 (de) * | 1977-09-03 | 1987-07-09 | Bayer Ag, 5090 Leverkusen | Verfahren zum Chromgerben |
| DE2831846A1 (de) * | 1978-07-20 | 1980-02-07 | Henkel Kgaa | Verwendung wasserunloeslicher aluminiumsilikate bei der lederherstellung |
| US4270912A (en) * | 1979-06-26 | 1981-06-02 | Seton Company | Stabilized tanning composition comprising a reaction product of (a) polyaldehyde (b) secondary amine and (c) an alcohol and method |
| US4285689A (en) * | 1979-06-26 | 1981-08-25 | Seton Company | Leather tanning composition and method |
| GB8409266D0 (en) * | 1984-04-10 | 1984-05-23 | Alcan Int Ltd | Tanning of leather using aluminium compounds |
| DE3519287A1 (de) * | 1985-05-30 | 1986-12-04 | Bayer Ag, 5090 Leverkusen | Verfahren zum nachgerben von chromledern |
| DE3726796A1 (de) * | 1987-08-12 | 1989-02-23 | Bayer Ag | Verfahren zur hochauszehrenden chromgerbung |
| DE3814220A1 (de) * | 1988-04-27 | 1989-11-09 | Hoechst Ag | Verfahren zur chromspargerbung |
| EP0583697A2 (de) * | 1992-08-14 | 1994-02-23 | Hoechst Aktiengesellschaft | Verfahren zur Chromspar- und Chromfüllgerbung |
| DE19707713A1 (de) * | 1997-02-26 | 1998-08-27 | Basf Ag | Zusammensetzung zur Behandlung von gegerbtem Leder, sowie ihre Herstellung |
| DE102005032585A1 (de) * | 2005-07-11 | 2007-01-25 | Basf Ag | Verfahren zur Herstellung von Leder |
| TR200708916A1 (tr) * | 2007-12-25 | 2009-07-21 | Soda Sanay� A.�. | Krom komplekslerinin dericilikte kullanılması. |
| EP2853605A1 (en) | 2013-09-30 | 2015-04-01 | Rhodia Poliamida E Especialidades Ltda | Tanning process for obtaining leather |
| EP2853604A1 (en) | 2013-09-30 | 2015-04-01 | Rhodia Poliamida E Especialidades Ltda | Tanning process |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE643088C (de) * | 1935-01-19 | 1937-03-24 | I G Farbenindustrie Akt Ges | Verfahren zur Chromgerbung |
| US2178874A (en) * | 1937-05-06 | 1939-11-07 | Little Inc A | Process of preparing tanning material and by-products derived therefrom |
| DE733991C (de) * | 1940-11-26 | 1943-04-06 | Ig Farbenindustrie Ag | Verfahren zur Chromgerbung |
| US2580417A (en) * | 1950-08-10 | 1952-01-01 | Little Inc A | Process for preparing chrome tanning material |
| US3010780A (en) * | 1957-03-30 | 1961-11-28 | Bohme Fettchemie Gmbh | Method of making leather water-repellent |
| DE1225809B (de) * | 1963-01-18 | 1966-09-29 | Bayer Ag | Gerbverfahren |
| DE1494825C3 (de) * | 1966-10-27 | 1970-12-03 | Basf Ag | Verfahren zum unmittelbaren Gerben gekaelkter Bloessen |
-
1975
- 1975-01-01 AR AR258845A patent/AR208085A1/es active
- 1975-04-14 IN IN739/CAL/75A patent/IN142040B/en unknown
- 1975-04-29 US US05/573,282 patent/US4042321A/en not_active Expired - Lifetime
- 1975-05-15 GB GB20585/75A patent/GB1511017A/en not_active Expired
- 1975-05-15 NL NLAANVRAGE7505743,A patent/NL178609C/xx not_active IP Right Cessation
- 1975-05-15 FI FI751430A patent/FI58515C/fi not_active IP Right Cessation
- 1975-05-15 SE SE7505599A patent/SE422471B/xx not_active IP Right Cessation
- 1975-05-16 BR BR3867/75A patent/BR7503035A/pt unknown
- 1975-05-16 DK DK218875A patent/DK150989C/da active
- 1975-05-16 AT AT376175A patent/AT336758B/de not_active IP Right Cessation
- 1975-05-16 CA CA227,183A patent/CA1052954A/en not_active Expired
- 1975-05-16 FR FR7515499A patent/FR2271290B1/fr not_active Expired
- 1975-05-16 JP JP50057529A patent/JPS5248161B2/ja not_active Expired
- 1975-05-16 CH CH635275A patent/CH615224A5/de not_active IP Right Cessation
-
1977
- 1977-05-18 BE BE177694A patent/BE854785A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL178609C (nl) | 1986-04-16 |
| BE854785A (fr) | 1977-11-18 |
| JPS50160401A (enExample) | 1975-12-25 |
| NL7505743A (nl) | 1975-11-20 |
| FI751430A7 (enExample) | 1975-11-19 |
| AU8115675A (en) | 1976-12-02 |
| CA1052954A (en) | 1979-04-24 |
| FR2271290B1 (enExample) | 1979-05-25 |
| DK218875A (da) | 1975-11-19 |
| SE7505599L (sv) | 1975-11-19 |
| GB1511017A (en) | 1978-05-17 |
| JPS5248161B2 (enExample) | 1977-12-08 |
| DK150989B (da) | 1987-10-05 |
| CH615224A5 (enExample) | 1980-01-15 |
| AR208085A1 (es) | 1976-11-30 |
| AT336758B (de) | 1977-05-25 |
| SE422471B (sv) | 1982-03-08 |
| BR7503035A (pt) | 1976-04-13 |
| FR2271290A1 (enExample) | 1975-12-12 |
| IN142040B (enExample) | 1977-05-21 |
| FI58515B (fi) | 1980-10-31 |
| DK150989C (da) | 1988-02-15 |
| US4042321A (en) | 1977-08-16 |
| ATA376175A (de) | 1976-09-15 |
| NL178609B (nl) | 1985-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI58515C (fi) | Foerfarande foer kromgarvning | |
| SU1344250A3 (ru) | Состав дл жировани кожи и шкур | |
| HU181796B (en) | Process for liming of raw hides with respect of the environment | |
| US4278432A (en) | Soaking method | |
| US4101271A (en) | Tanning skins using polycarboxylic acid partial esters | |
| CN1075559C (zh) | 稀土-植物鞣剂结合鞣制皮革的方法 | |
| FI64643B (fi) | Kromgarvning | |
| KR800000285B1 (ko) | 가죽의 탠닝방법 | |
| CN102242228A (zh) | 一种新型的无盐浸酸皮革助剂 | |
| GB2062002A (en) | Softening hides and skins | |
| US5427594A (en) | Process for pickling raw hides | |
| EP0064761B1 (en) | Pickling and tanning process and pickling composition | |
| JPS63101500A (ja) | 省クロムなめし法 | |
| US1616400A (en) | Mineral-tanned leather and method of making the same | |
| US2164101A (en) | Treating gut | |
| SU1182082A1 (ru) | Способ выработки кожи дл верха обуви | |
| CN113249532A (zh) | 一种狐狸毛皮清洁化硝制方法 | |
| RU1772157C (ru) | Способ обработки меховой овчины | |
| SU1293228A1 (ru) | Способ выработки кожи | |
| SU1490163A1 (ru) | Способ дублени кож | |
| US1378213A (en) | Leather-making process | |
| JPH0663000B2 (ja) | 銀面のきめがこまやかな、しぼの細かい鞣皮の製造方法 | |
| JPS6156279B2 (enExample) | ||
| CN106811557A (zh) | 一种用于皮革浸酸工序的新型助剂 | |
| SU1051126A1 (ru) | Способ получени полуфабриката дл выработки одежного велюра |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: BAYER AKTIENGESELLSCHAFT |