DK1843991T3 - Vandige emulsioner af funktionelle alkoxysilaner og kondenserede oligomerer deraf, deres fremstilling og anvendelse til overfladebehandling - Google Patents
Vandige emulsioner af funktionelle alkoxysilaner og kondenserede oligomerer deraf, deres fremstilling og anvendelse til overfladebehandling Download PDFInfo
- Publication number
- DK1843991T3 DK1843991T3 DK05815817.1T DK05815817T DK1843991T3 DK 1843991 T3 DK1843991 T3 DK 1843991T3 DK 05815817 T DK05815817 T DK 05815817T DK 1843991 T3 DK1843991 T3 DK 1843991T3
- Authority
- DK
- Denmark
- Prior art keywords
- alkyl
- carbon atoms
- weight
- emulsion
- pressure
- Prior art date
Links
- 239000000839 emulsion Substances 0.000 title claims description 93
- 238000002360 preparation method Methods 0.000 title description 8
- 238000004381 surface treatment Methods 0.000 title description 3
- -1 alkyl radical Chemical class 0.000 claims description 57
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 54
- 238000009826 distribution Methods 0.000 claims description 43
- 239000000203 mixture Substances 0.000 claims description 42
- 239000003995 emulsifying agent Substances 0.000 claims description 33
- 238000004945 emulsification Methods 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 239000003921 oil Substances 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 14
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 12
- 239000003755 preservative agent Substances 0.000 claims description 12
- 238000006384 oligomerization reaction Methods 0.000 claims description 11
- 150000003254 radicals Chemical class 0.000 claims description 11
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 11
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 10
- 239000004566 building material Substances 0.000 claims description 10
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 10
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 10
- 229920002554 vinyl polymer Polymers 0.000 claims description 10
- 239000004094 surface-active agent Substances 0.000 claims description 9
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 7
- 229910019142 PO4 Inorganic materials 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 150000003961 organosilicon compounds Chemical class 0.000 claims description 6
- 235000021317 phosphate Nutrition 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- 150000002170 ethers Chemical class 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 230000002209 hydrophobic effect Effects 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 150000001298 alcohols Chemical class 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- 229920000151 polyglycol Polymers 0.000 claims description 4
- 239000010695 polyglycol Substances 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 150000008051 alkyl sulfates Chemical group 0.000 claims description 3
- 239000000872 buffer Substances 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 229920005682 EO-PO block copolymer Polymers 0.000 claims description 2
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 claims description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000003619 algicide Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 claims description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- 230000000844 anti-bacterial effect Effects 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 239000003899 bactericide agent Substances 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 238000005260 corrosion Methods 0.000 claims description 2
- 230000007797 corrosion Effects 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000003205 fragrance Substances 0.000 claims description 2
- 239000000417 fungicide Substances 0.000 claims description 2
- 150000002402 hexoses Chemical class 0.000 claims description 2
- 239000003112 inhibitor Substances 0.000 claims description 2
- 230000003641 microbiacidal effect Effects 0.000 claims description 2
- 229940124561 microbicide Drugs 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 150000002972 pentoses Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 6
- 150000002367 halogens Chemical class 0.000 claims 6
- 239000006185 dispersion Substances 0.000 claims 3
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 claims 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 2
- 239000007764 o/w emulsion Substances 0.000 claims 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 239000010703 silicon Substances 0.000 claims 1
- 239000004034 viscosity adjusting agent Substances 0.000 claims 1
- 239000012071 phase Substances 0.000 description 25
- 229920001296 polysiloxane Polymers 0.000 description 13
- 239000005871 repellent Substances 0.000 description 13
- 238000003860 storage Methods 0.000 description 12
- 239000000470 constituent Substances 0.000 description 11
- 239000002245 particle Substances 0.000 description 11
- 230000002940 repellent Effects 0.000 description 11
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 10
- 230000002335 preservative effect Effects 0.000 description 10
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 10
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 8
- 229960003493 octyltriethoxysilane Drugs 0.000 description 8
- 229910000077 silane Inorganic materials 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000008346 aqueous phase Substances 0.000 description 7
- 238000010790 dilution Methods 0.000 description 7
- 239000012895 dilution Substances 0.000 description 7
- 230000000052 comparative effect Effects 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- MSRJTTSHWYDFIU-UHFFFAOYSA-N octyltriethoxysilane Chemical compound CCCCCCCC[Si](OCC)(OCC)OCC MSRJTTSHWYDFIU-UHFFFAOYSA-N 0.000 description 6
- 230000035515 penetration Effects 0.000 description 6
- 238000005470 impregnation Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 125000005375 organosiloxane group Chemical group 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000002902 bimodal effect Effects 0.000 description 3
- 239000011449 brick Substances 0.000 description 3
- 239000004567 concrete Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000011147 inorganic material Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229910000057 polysulfane Inorganic materials 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical compound [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 3
- NBXZNTLFQLUFES-UHFFFAOYSA-N triethoxy(propyl)silane Chemical compound CCC[Si](OCC)(OCC)OCC NBXZNTLFQLUFES-UHFFFAOYSA-N 0.000 description 3
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- 239000006087 Silane Coupling Agent Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000002318 adhesion promoter Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- FWDBOZPQNFPOLF-UHFFFAOYSA-N ethenyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)C=C FWDBOZPQNFPOLF-UHFFFAOYSA-N 0.000 description 2
- NKSJNEHGWDZZQF-UHFFFAOYSA-N ethenyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C=C NKSJNEHGWDZZQF-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- ZWRUINPWMLAQRD-UHFFFAOYSA-N nonan-1-ol Chemical compound CCCCCCCCCO ZWRUINPWMLAQRD-UHFFFAOYSA-N 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 150000001282 organosilanes Chemical class 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 150000004756 silanes Chemical class 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- HQYALQRYBUJWDH-UHFFFAOYSA-N trimethoxy(propyl)silane Chemical compound CCC[Si](OC)(OC)OC HQYALQRYBUJWDH-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- ABAAFUXTIYJPIP-UHFFFAOYSA-N (2-methyl-3-triethoxysilylpropyl) 2-methylprop-2-enoate Chemical compound CCO[Si](OCC)(OCC)CC(C)COC(=O)C(C)=C ABAAFUXTIYJPIP-UHFFFAOYSA-N 0.000 description 1
- UNCMIFFGOYZCIC-UHFFFAOYSA-N (2-methyl-3-trimethoxysilylpropyl) 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)CC(C)COC(=O)C(C)=C UNCMIFFGOYZCIC-UHFFFAOYSA-N 0.000 description 1
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 1
- WGRZHLPEQDVPET-UHFFFAOYSA-N 2-methoxyethoxysilane Chemical compound COCCO[SiH3] WGRZHLPEQDVPET-UHFFFAOYSA-N 0.000 description 1
- 229940100555 2-methyl-4-isothiazolin-3-one Drugs 0.000 description 1
- KHVIAGJJSLUYIT-UHFFFAOYSA-N 3-(4,5-dihydro-1h-imidazol-2-yl)propyl-triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCC1=NCCN1 KHVIAGJJSLUYIT-UHFFFAOYSA-N 0.000 description 1
- HXLAEGYMDGUSBD-UHFFFAOYSA-N 3-[diethoxy(methyl)silyl]propan-1-amine Chemical compound CCO[Si](C)(OCC)CCCN HXLAEGYMDGUSBD-UHFFFAOYSA-N 0.000 description 1
- DCQBZYNUSLHVJC-UHFFFAOYSA-N 3-triethoxysilylpropane-1-thiol Chemical compound CCO[Si](OCC)(OCC)CCCS DCQBZYNUSLHVJC-UHFFFAOYSA-N 0.000 description 1
- URDOJQUSEUXVRP-UHFFFAOYSA-N 3-triethoxysilylpropyl 2-methylprop-2-enoate Chemical compound CCO[Si](OCC)(OCC)CCCOC(=O)C(C)=C URDOJQUSEUXVRP-UHFFFAOYSA-N 0.000 description 1
- XDQWJFXZTAWJST-UHFFFAOYSA-N 3-triethoxysilylpropyl prop-2-enoate Chemical compound CCO[Si](OCC)(OCC)CCCOC(=O)C=C XDQWJFXZTAWJST-UHFFFAOYSA-N 0.000 description 1
- LVNLBBGBASVLLI-UHFFFAOYSA-N 3-triethoxysilylpropylurea Chemical compound CCO[Si](OCC)(OCC)CCCNC(N)=O LVNLBBGBASVLLI-UHFFFAOYSA-N 0.000 description 1
- SJECZPVISLOESU-UHFFFAOYSA-N 3-trimethoxysilylpropan-1-amine Chemical compound CO[Si](OC)(OC)CCCN SJECZPVISLOESU-UHFFFAOYSA-N 0.000 description 1
- UUEWCQRISZBELL-UHFFFAOYSA-N 3-trimethoxysilylpropane-1-thiol Chemical compound CO[Si](OC)(OC)CCCS UUEWCQRISZBELL-UHFFFAOYSA-N 0.000 description 1
- XDLMVUHYZWKMMD-UHFFFAOYSA-N 3-trimethoxysilylpropyl 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C(C)=C XDLMVUHYZWKMMD-UHFFFAOYSA-N 0.000 description 1
- LVACOMKKELLCHJ-UHFFFAOYSA-N 3-trimethoxysilylpropylurea Chemical compound CO[Si](OC)(OC)CCCNC(N)=O LVACOMKKELLCHJ-UHFFFAOYSA-N 0.000 description 1
- QDTDKYHPHANITQ-UHFFFAOYSA-N 7-methyloctan-1-ol Chemical compound CC(C)CCCCCCO QDTDKYHPHANITQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- RMKZLFMHXZAGTM-UHFFFAOYSA-N [dimethoxy(propyl)silyl]oxymethyl prop-2-enoate Chemical compound CCC[Si](OC)(OC)OCOC(=O)C=C RMKZLFMHXZAGTM-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- DHNRXBZYEKSXIM-UHFFFAOYSA-N chloromethylisothiazolinone Chemical group CN1SC(Cl)=CC1=O DHNRXBZYEKSXIM-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical class CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- SBRXLTRZCJVAPH-UHFFFAOYSA-N ethyl(trimethoxy)silane Chemical compound CC[Si](OC)(OC)OC SBRXLTRZCJVAPH-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- 239000004811 fluoropolymer Substances 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- RSKGMYDENCAJEN-UHFFFAOYSA-N hexadecyl(trimethoxy)silane Chemical compound CCCCCCCCCCCCCCCC[Si](OC)(OC)OC RSKGMYDENCAJEN-UHFFFAOYSA-N 0.000 description 1
- 239000000413 hydrolysate Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000004569 hydrophobicizing agent Substances 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- BEGLCMHJXHIJLR-UHFFFAOYSA-N methylisothiazolinone Chemical group CN1SC=CC1=O BEGLCMHJXHIJLR-UHFFFAOYSA-N 0.000 description 1
- BFXIKLCIZHOAAZ-UHFFFAOYSA-N methyltrimethoxysilane Chemical compound CO[Si](C)(OC)OC BFXIKLCIZHOAAZ-UHFFFAOYSA-N 0.000 description 1
- 239000002557 mineral fiber Substances 0.000 description 1
- INJVFBCDVXYHGQ-UHFFFAOYSA-N n'-(3-triethoxysilylpropyl)ethane-1,2-diamine Chemical compound CCO[Si](OCC)(OCC)CCCNCCN INJVFBCDVXYHGQ-UHFFFAOYSA-N 0.000 description 1
- PHQOGHDTIVQXHL-UHFFFAOYSA-N n'-(3-trimethoxysilylpropyl)ethane-1,2-diamine Chemical compound CO[Si](OC)(OC)CCCNCCN PHQOGHDTIVQXHL-UHFFFAOYSA-N 0.000 description 1
- XCOASYLMDUQBHW-UHFFFAOYSA-N n-(3-trimethoxysilylpropyl)butan-1-amine Chemical compound CCCCNCCC[Si](OC)(OC)OC XCOASYLMDUQBHW-UHFFFAOYSA-N 0.000 description 1
- SLYCYWCVSGPDFR-UHFFFAOYSA-N octadecyltrimethoxysilane Chemical compound CCCCCCCCCCCCCCCCCC[Si](OC)(OC)OC SLYCYWCVSGPDFR-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920000259 polyoxyethylene lauryl ether Chemical group 0.000 description 1
- 230000001698 pyrogenic effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000004819 silanols Chemical class 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- BPCXHCSZMTWUBW-UHFFFAOYSA-N triethoxy(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)silane Chemical compound CCO[Si](OCC)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F BPCXHCSZMTWUBW-UHFFFAOYSA-N 0.000 description 1
- DENFJSAFJTVPJR-UHFFFAOYSA-N triethoxy(ethyl)silane Chemical compound CCO[Si](CC)(OCC)OCC DENFJSAFJTVPJR-UHFFFAOYSA-N 0.000 description 1
- OYGYKEULCAINCL-UHFFFAOYSA-N triethoxy(hexadecyl)silane Chemical compound CCCCCCCCCCCCCCCC[Si](OCC)(OCC)OCC OYGYKEULCAINCL-UHFFFAOYSA-N 0.000 description 1
- CPUDPFPXCZDNGI-UHFFFAOYSA-N triethoxy(methyl)silane Chemical compound CCO[Si](C)(OCC)OCC CPUDPFPXCZDNGI-UHFFFAOYSA-N 0.000 description 1
- FZMJEGJVKFTGMU-UHFFFAOYSA-N triethoxy(octadecyl)silane Chemical compound CCCCCCCCCCCCCCCCCC[Si](OCC)(OCC)OCC FZMJEGJVKFTGMU-UHFFFAOYSA-N 0.000 description 1
- FBBATURSCRIBHN-UHFFFAOYSA-N triethoxy-[3-(3-triethoxysilylpropyldisulfanyl)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCSSCCC[Si](OCC)(OCC)OCC FBBATURSCRIBHN-UHFFFAOYSA-N 0.000 description 1
- BQXAVQVDYSDAOM-UHFFFAOYSA-N triethoxy-[3-(3-triethoxysilylpropylpentasulfanyl)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCSSSSSCCC[Si](OCC)(OCC)OCC BQXAVQVDYSDAOM-UHFFFAOYSA-N 0.000 description 1
- ZRKGYQLXOAHRRN-UHFFFAOYSA-N triethoxy-[3-(3-triethoxysilylpropylsulfanyl)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCSCCC[Si](OCC)(OCC)OCC ZRKGYQLXOAHRRN-UHFFFAOYSA-N 0.000 description 1
- VTHOKNTVYKTUPI-UHFFFAOYSA-N triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCSSSSCCC[Si](OCC)(OCC)OCC VTHOKNTVYKTUPI-UHFFFAOYSA-N 0.000 description 1
- JXUKBNICSRJFAP-UHFFFAOYSA-N triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCOCC1CO1 JXUKBNICSRJFAP-UHFFFAOYSA-N 0.000 description 1
- NQRACKNXKKOCJY-UHFFFAOYSA-N trimethoxy-[3-(3-trimethoxysilylpropyldisulfanyl)propyl]silane Chemical compound CO[Si](OC)(OC)CCCSSCCC[Si](OC)(OC)OC NQRACKNXKKOCJY-UHFFFAOYSA-N 0.000 description 1
- DMFBQMAXLPTYBP-UHFFFAOYSA-N trimethoxy-[3-(3-trimethoxysilylpropylpentasulfanyl)propyl]silane Chemical compound CO[Si](OC)(OC)CCCSSSSSCCC[Si](OC)(OC)OC DMFBQMAXLPTYBP-UHFFFAOYSA-N 0.000 description 1
- VEOWZIOSKBEQFI-UHFFFAOYSA-N trimethoxy-[3-(3-trimethoxysilylpropylsulfanyl)propyl]silane Chemical compound CO[Si](OC)(OC)CCCSCCC[Si](OC)(OC)OC VEOWZIOSKBEQFI-UHFFFAOYSA-N 0.000 description 1
- JTTSZDBCLAKKAY-UHFFFAOYSA-N trimethoxy-[3-(3-trimethoxysilylpropyltetrasulfanyl)propyl]silane Chemical compound CO[Si](OC)(OC)CCCSSSSCCC[Si](OC)(OC)OC JTTSZDBCLAKKAY-UHFFFAOYSA-N 0.000 description 1
- BPSIOYPQMFLKFR-UHFFFAOYSA-N trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CO[Si](OC)(OC)CCCOCC1CO1 BPSIOYPQMFLKFR-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- 150000003755 zirconium compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08J—WORKING-UP; GENERAL PROCESSES OF COMPOUNDING; AFTER-TREATMENT NOT COVERED BY SUBCLASSES C08B, C08C, C08F, C08G or C08H
- C08J3/00—Processes of treating or compounding macromolecular substances
- C08J3/02—Making solutions, dispersions, lattices or gels by other methods than by solution, emulsion or suspension polymerisation techniques
- C08J3/03—Making solutions, dispersions, lattices or gels by other methods than by solution, emulsion or suspension polymerisation techniques in aqueous media
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B41/00—After-treatment of mortars, concrete, artificial stone or ceramics; Treatment of natural stone
- C04B41/009—After-treatment of mortars, concrete, artificial stone or ceramics; Treatment of natural stone characterised by the material treated
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B41/00—After-treatment of mortars, concrete, artificial stone or ceramics; Treatment of natural stone
- C04B41/45—Coating or impregnating, e.g. injection in masonry, partial coating of green or fired ceramics, organic coating compositions for adhering together two concrete elements
- C04B41/46—Coating or impregnating, e.g. injection in masonry, partial coating of green or fired ceramics, organic coating compositions for adhering together two concrete elements with organic materials
- C04B41/49—Compounds having one or more carbon-to-metal or carbon-to-silicon linkages ; Organo-clay compounds; Organo-silicates, i.e. ortho- or polysilicic acid esters ; Organo-phosphorus compounds; Organo-inorganic complexes
- C04B41/4905—Compounds having one or more carbon-to-metal or carbon-to-silicon linkages ; Organo-clay compounds; Organo-silicates, i.e. ortho- or polysilicic acid esters ; Organo-phosphorus compounds; Organo-inorganic complexes containing silicon
- C04B41/495—Compounds having one or more carbon-to-metal or carbon-to-silicon linkages ; Organo-clay compounds; Organo-silicates, i.e. ortho- or polysilicic acid esters ; Organo-phosphorus compounds; Organo-inorganic complexes containing silicon applied to the substrate as oligomers or polymers
- C04B41/4961—Polyorganosiloxanes, i.e. polymers with a Si-O-Si-O-chain; "silicones"
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B2111/00—Mortars, concrete or artificial stone or mixtures to prepare them, characterised by specific function, property or use
- C04B2111/00034—Physico-chemical characteristics of the mixtures
- C04B2111/00112—Mixtures characterised by specific pH values
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08J—WORKING-UP; GENERAL PROCESSES OF COMPOUNDING; AFTER-TREATMENT NOT COVERED BY SUBCLASSES C08B, C08C, C08F, C08G or C08H
- C08J2383/00—Characterised by the use of macromolecular compounds obtained by reactions forming in the main chain of the macromolecule a linkage containing silicon with or without sulfur, nitrogen, oxygen, or carbon only; Derivatives of such polymers
- C08J2383/04—Polysiloxanes
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Ceramic Engineering (AREA)
- Organic Chemistry (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Dispersion Chemistry (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Colloid Chemistry (AREA)
- Silicon Polymers (AREA)
- Inorganic Chemistry (AREA)
- Paints Or Removers (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Claims (14)
1. Vandig olie-i-vand-emulsion, der omfatter fra 1 til 70 vægt-%, baseret på emulsionens totalvægt, af organoalkoxysiloxaner eller kondenserede oligomerer af funktionelle alkoxysilaner eller funktionelle alkoxysilaner og kondenserede oligomerer deraf eller funktionelle alkoxysilaner og organoalkoxysiloxaner, hvor andelen af kondenserede (co)oligomerer af funktionelle alkoxysilaner er fra 1 til 100 vægt-%, baseret på oliefasens totalvægt, af mindst ét emulgeringsmiddel og vand, hvor emulsionen har et pH fra 5 til 9, og bredden af dråbestørrelsesfordelingen udtrykt som spredningen D90 - D10 D50 ' er fra 0,6 til 1,2, hvor oligomererne er udvalgt blandt oligomerer eller oligomerblandinger med formlen
hvor R1 er C3-Ci8-alkyl, halogen- eller aminosubstitueret C3-C18-alkyl, vinyl, mercaptoalkyl, methacryloxyalkyl, acryloxyalkyl, alkylaminoalkyl, dialkylaminoalkyl, diethylenaminoalkyl, triethylenaminoalkyl, glycidyloxyalkyl, bisalkoxysilylalkyl, monosulfan eller polysulfan, grupperne R2 er identiske eller forskellige, og hver er et hydrogenatom eller et alkylradikal, der har fra 1 til 6 carbonatomer, fortrinsvis 1 eller 2 carbonatomer, og n bestemmer graden af oligomerisering og har en værdi fra 2 til 20, og hvor cooligomererne er udvalgt blandt organoalkoxysiloxaner og blandinger deraf, der har formlen
hvor m og n er identiske eller forskellige, og hver er fra 0 til 20, med det forbehold at (n + m) > 2, R og R2 er identiske eller forskellige, og hver er hydrogen, Ci-Cig-alkyl, halogeneller aminosubstitueret Ci-Cig-alkyl, phenyl, vinyl, mercaptoalkyl, methacryloxyalkyl, acryloxyalkyl, alkylaminoalkyl, dialkylaminoalkyl, diethylenaminoalkyl, triethylenaminoalkyl, glycidyloxyalkyl, bisalkoxysilylalkyl, monosulfan eller polysulfan, og grupperne R1 er identiske eller forskellige, og hver er et hydrogenatom eller et alkylradikal, der har fra 1 til 6 carbonatomer, fortrinsvis 1 eller 2 carbonatomer.
2. Emulsion ifølge krav 1, hvor de funktionelle alkoxysilaner er udvalgt blandt alkylalkoxysilaner eller blandinger med formlen R1-Si (OR2) 3 hvor radikalerne R1 er identiske eller forskellige, og hver er C3-Ci8-alkyl, halogen- eller aminosubstitueret C3-Ci8-alkyl, vinyl, mercaptoalkyl, methacryloxyalkyl, acryloxyalkyl, alkylaminoalkyl, dialkylaminoalkyl, diethylenaminoalkyl, triethylenaminoalkyl, glycidyloxyalkyl, bisalkoxysilylalkyl, monosulfan eller polysulfan, og R2 er et alkylradikal, der har fra 1 til 6 carbonatomer, fortrinsvis 1 eller 2 carbonatomer.
3. Emulsion ifølge krav 1 eller 2, hvor det mindst ene emulgeringsmiddel er udvalgt blandt alkylsulfater, der har et Cs-Cis-alkylradikal, alkylethersulfater og alkarylethersulf ater, der har et Cs-Cis-alkylradikal som hydrofobisk radikal, og fra 1 til 40 ethylenoxid (EO)- eller propylenoxid (PO)-enheder, alkylsulfonater, der har et Cs-Cis-alkylradikal, alkarylsulf onater, der har et Cs-Cis-alkylradikal, monoestere af sulforavsyre med monovalente alkoholer eller alkylphenoler, der har fra 5 til 15 carbonatomer, alkalimetal- og ammoniumsalte af carboxylsyrer, der har fra 8 til 20 carbonatomer i alkyl-, aryl-, alkaryl-eller aralkylradikalet, alkylphosphater og alkarylphosphater, der har fra 8 til 20 carbonatomer i det organiske radikal, alkyletherphosphater eller alkaryletherphosphater, der har fra 8 til 20 carbonatomer i alkyl- eller alkarylradikalerne, og fra 1 til 40 EO-enheder, alkylpolyglycolethere og alkarylepolyglycolethere, der har fra 8 til 40 EO-enheder og fra 8 til 20 carbonatomer i alkyl- eller arylradikalerne, ethylenoxid-propylenoxid (EO-PO)-blokcopolymerer, der har fra 8 til 40 EO- og PO-enheder, additionsprodukter af alkylaminer, der har C8-C22_alkylradikaler, med ethylenoxid eller propylenoxid, alkylpolyglycosider, der har lineære eller forgrenede, mættede eller umættede C8_C24-alkylradikaler og oligoglycosidradikaler, der har fra 1 til 10 hexose- eller pentoseenheder, siliciumfunktionelle surfaktanter eller blandinger of disse emulgeringsmidler.
4. Emulsion ifølge krav 3, hvor mindst ét emulgeringsmiddel er til stede i en mængde fra 0,02 til 2 vægt-%, baseret på emulsionens totalvægt.
5. Emulsion ifølge et hvilket som helst af kravene 1 til 4, hvor den gennemsnitlige dråbestørrelse er < 0,5 ym.
6. Emulsion ifølge et hvilket som helst af kravene 1 til 5, der endvidere omfatter yderligere almindelige hjælpestoffer, der er udvalgt blandt uorganiske eller organiske syrer, bufferstoffer, fungicider, baktericider, algecider, mikrobicider, duftstoffer, korrosionshæmmere, konserveringsmidler, midler, der øger vandafvisning, viskositetsmodificerende midler, katalysatorer.
7. Fremgangsmåde til fremstilling af vandige olie-i-vand- emulsioner ifølge et hvilket som helst af kravene 1 til 6, som omfatter (i) forblanding af bestanddelene, og ved en andel af kondenserede (co)oligomerer af funktionelle alkoxysilaner på > 25 vægt-%, baseret på organosiliciumforbindelsernes totalvægt, (ii) emulgering i en højtrykshomogenisator, der har mindst ét tryktrin og et tryk fra 2 til 15 MPa, således at bredden af dråbestørrelsesfordelingen udtrykt som spredningen D90 - D10 D50 ' er fra 0,6 til 1,2, hvor oligomererne af de funktionelle alkoxysilaner eller blandinger deraf er udvalgt blandt forbindelser med formlen
hvor R1 er C3-Cis-alkyl, halogen- eller aminosubstitueret C3-C18-alkyl, vinyl, mercaptoalkyl, methacryloxyalkyl, acryloxyalkyl, alkylaminoalkyl, dialkylaminoalkyl, diethylenaminoalkyl, triethylenaminoalkyl, glycidyloxyalkyl, bisalkoxysilylalkyl, monosulfan eller polysulfan, grupperne R2 er identiske eller forskellige, og hver er et hydrogenatom eller et alkylradikal, der har fra 1 til 6 carbonatomer, fortrinsvis 1 eller 2 carbonatomer, og n bestemmer graden af oligomerisering og har en værdi fra 2 til 20, og hvor cooligomererne er udvalgt blandt organoalkoxysiloxaner og blandinger med formlen
hvor m og n er identiske eller forskellige, og hver er fra 0 til 20, med det forbehold at (n + m) > 2, R og R2 er identiske eller forskellige, og hver er hydrogen, Ci-Ci8-alkyl, halogeneller aminosubstitueret Ci-Ci8-alkyl, phenyl, vinyl, mercaptoalkyl, methacryloxyalkyl, acryloxyalkyl, alkylaminoalkyl, dialkylaminoalkyl, diethylenaminoalkyl, triethylenaminoalkyl, glycidyloxyalkyl, bisalkoxysilylalkyl, monosulfan eller polysulfan, og grupperne R1 er identiske eller forskellige, og hver er et hydrogenatom eller et alkylradikal, der har fra 1 til 6 carbonatomer, fortrinsvis 1 eller 2 carbonatomer.
8. Fremgangsmåde til fremstilling af vandige olie-i-vand-emulsioner ifølge et hvilket som helst af kravene 1 til 6, som omfatter (i) forblanding af bestanddelene, og ved en andel af kondenserede (co)oligomerer af alkoxysilaner på fra 5 til < 25 vægt-%, baseret på organosiliciumforbindelsernes totalvægt, (iii) præemulgering i en højtrykshomogenisator, der har mindst ét tryktrin, under et tryk fra 10 til 70 MPa og (ii) emulgering i en højtrykshomogenisator, der har mindst ét tryktrin og et tryk fra 2 til 15 MPa, således at bredden af dråbestørrelsesfordelingen udtrykt som spredningen D90 - D10 D50 er fra 0,6 til 1,2, hvor oligomererne af de funktionelle alkoxysilaner eller blandinger deraf er udvalgt blandt forbindelser med formlen
hvor R1 er C3-Ci8-alkyl, halogen- eller aminosubstitueret C3-C18-alkyl, vinyl, mercaptoalkyl, methacryloxyalkyl, acryloxyalkyl, alkylaminoalkyl, dialkylaminoalkyl, diethylenaminoalkyl, triethylenaminoalkyl, glycidyloxyalkyl, bisalkoxysilylalkyl, monosulfan eller polysulfan, grupperne R2 er identiske eller forskellige, og hver er et hydrogenatom eller et alkylradikal, der har fra 1 til 6 carbonatomer, fortrinsvis 1 eller 2 carbonatomer, og n bestemmer graden af oligomerisering og har en værdi fra 2 til 20, og hvor cooligomererne er udvalgt blandt organoalkoxysiloxaner og blandinger med formlen
hvor m og n er identiske eller forskellige, og hver er fra 0 til 20, med det forbehold at (n + m) > 2, R og R2 er identiske eller forskellige, og hver er hydrogen, Ci-Ci8-alkyl, halogeneller aminosubstitueret Ci-Ci8-alkyl, phenyl, vinyl, mercaptoalkyl, methacryloxyalkyl, acryloxyalkyl, alkylaminoalkyl, dialkylaminoalkyl, diethylenaminoalkyl, triethylenaminoalkyl, glycidyloxyalkyl, bisalkoxysilylalkyl, monosulfan eller polysulfan, og grupperne R1 er identiske eller forskellige, og hver er et hydrogenatom eller et alkylradikal, der har fra 1 til 6 carbonatomer, fortrinsvis 1 eller 2 carbonatomer.
9. Fremgangsmåde ifølge krav 7 eller 8, hvor trykket i mindst ét tryktrin er fra 4 til 8 MPa, fortrinsvis fra 5 til 6 MPa.
10. Fremgangsmåde ifølge et hvilket som helst af kravene 7 til 9, hvor der yderligere udføres en præemulgering (iii) i højtrykshomogenisatoren, der har mindst ét tryktrin under et tryk fra 10 til 70 MPa, fortrinsvis fra 20 til 40 MPa, efter forblandingstrinet (i) og før emulgeringstrinet (ii) , således at den gennemsnitlige dråbestørrelse er < 0,5 ym, og bredden af dråbestørrelsesfordelingen udtrykt som spredningen D90 - DIO D50 ’ er fra 0,6 til 1,2.
11. Fremgangsmåde ifølge et hvilket som helst af kravene 7 til 10, hvor emulgeringen i trin (ii) udføres ved anvendelse af 2 tryktrin, der har forskellige tryk.
12. Fremgangsmåde ifølge et hvilket som helst af kravene 7 til 11, hvor emulsionen nedkøles, når den forlader høj trykshomogenisatoren.
13. Vandig olie-i-vand-emulsion, der kan opnås ifølge et hvilket som helst af kravene 7 til 12.
14. Anvendelse af den vandige emulsion ifølge et hvilket som helst af kravene 1 til 7, 13 eller fremstillet ved hjælp af fremgangsmåden ifølge krav 7 til 12 til hydrofobering af porøse mineralske byggematerialer.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE102005004872A DE102005004872A1 (de) | 2005-02-03 | 2005-02-03 | Wässrige Emulsionen von funktionellen Alkoxysilanen und deren kondensierten Oligomeren, deren Herstellung und Verwendung zur Oberflächenbehandlung |
| PCT/EP2005/056598 WO2006081892A1 (en) | 2005-02-03 | 2005-12-08 | Aqueous emulsions of functional alkoxysilanes and condensed oligomers thereof, their preparation and use for surface treatment |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK1843991T3 true DK1843991T3 (da) | 2015-12-07 |
Family
ID=35841145
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK05815817.1T DK1843991T3 (da) | 2005-02-03 | 2005-12-08 | Vandige emulsioner af funktionelle alkoxysilaner og kondenserede oligomerer deraf, deres fremstilling og anvendelse til overfladebehandling |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US8795784B2 (da) |
| EP (1) | EP1843991B1 (da) |
| CN (1) | CN101115696B (da) |
| DE (1) | DE102005004872A1 (da) |
| DK (1) | DK1843991T3 (da) |
| HK (1) | HK1117133A1 (da) |
| PL (1) | PL1843991T3 (da) |
| WO (1) | WO2006081892A1 (da) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10362060B4 (de) * | 2003-10-21 | 2009-07-09 | Altana Coatings & Sealants Gmbh | Verpackungsmaterial mit einer Barriereschicht für Gase |
| DE102004031785A1 (de) * | 2004-07-01 | 2006-01-26 | Degussa Ag | Polyol enthaltende Siliciumdioxid-Dispersion |
| DE102004037044A1 (de) * | 2004-07-29 | 2006-03-23 | Degussa Ag | Mittel zur Ausstattung von auf Cellulose und/oder Stärke basierenden Substraten mit Wasser abweisenden und gleichzeitig pilz-, bakterien-, insekten- sowie algenwidrigen Eigenschaften |
| DE102004037045A1 (de) * | 2004-07-29 | 2006-04-27 | Degussa Ag | Wässrige Silan-Nanokomposite |
| DE102005032427A1 (de) * | 2005-07-12 | 2007-01-18 | Degussa Ag | Aluminiumoxid-Dispersion |
| DE102006006656A1 (de) * | 2005-08-26 | 2007-03-01 | Degussa Ag | Silan enthaltendes Bindemittel für Verbundwerkstoffe |
| DE102006006654A1 (de) | 2005-08-26 | 2007-03-01 | Degussa Ag | Spezielle Aminoalkylsilanverbindungen als Bindemittel für Verbundwerkstoffe |
| DE102006006655A1 (de) * | 2005-08-26 | 2007-03-01 | Degussa Ag | Cellulose- bzw. lignocellulosehaltige Verbundwerkstoffe auf der Basis eines auf Silan basierenden Komposits als Bindemittel |
| DE102005053071A1 (de) * | 2005-11-04 | 2007-05-16 | Degussa | Verfahren zur Herstellung von ultrafeinen Pulvern auf Basis Polymaiden, ultrafeinen Polyamidpulver sowie deren Verwendung |
| DE102006003957A1 (de) | 2006-01-26 | 2007-08-02 | Degussa Gmbh | Wasserverdünnbare Sol-Gel-Zusammensetzung |
| DE102006003956A1 (de) * | 2006-01-26 | 2007-08-02 | Degussa Gmbh | Korrossionsschutzschicht auf Metalloberflächen |
| DE102006017701A1 (de) * | 2006-04-15 | 2007-10-25 | Degussa Gmbh | Silicium-Titan-Mischoxidpulver, Dispersion hiervon und daraus hergestellter titanhaltiger Zeolith |
| DE102006039269A1 (de) * | 2006-08-22 | 2008-02-28 | Evonik Degussa Gmbh | Dispersion von Aluminiumoxid, Beschichtungszusammensetzung und tintenaufnehmendes Medium |
| EP1982964B1 (de) * | 2007-04-20 | 2019-02-27 | Evonik Degussa GmbH | Organosiliciumverbindung enthaltende Mischung und deren Verwendung |
| DE102007038314A1 (de) * | 2007-08-14 | 2009-04-16 | Evonik Degussa Gmbh | Verfahren zur kontrollierten Hydrolyse und Kondensation von Epoxy-funktionellen Organosilanen sowie deren Condensation mit weiteren organofunktionellen Alkoxysilanen |
| DE102007038313A1 (de) * | 2007-08-14 | 2009-02-19 | Evonik Degussa Gmbh | Anorganisch-modifizierte Polyesterbindemittelzubereitung, Verfahren zur Herstellung und ihre Verwendung |
| DE102007040246A1 (de) | 2007-08-25 | 2009-02-26 | Evonik Degussa Gmbh | Strahlenhärtbare Formulierungen |
| DE102008007261A1 (de) | 2007-08-28 | 2009-03-05 | Evonik Degussa Gmbh | Wässrige Silansysteme basierend auf Bis(trialkoxysilyalkyl)aminen |
| DE102007049743A1 (de) * | 2007-10-16 | 2009-04-23 | Evonik Degussa Gmbh | Silicium-Titan-Mischoxidpulver, Dispersion hiervon und daraus hergestellter titanhaltiger Zeolith |
| US20100015339A1 (en) * | 2008-03-07 | 2010-01-21 | Evonik Degussa Gmbh | Silane-containing corrosion protection coatings |
| ATE508154T1 (de) * | 2008-05-15 | 2011-05-15 | Evonik Degussa Gmbh | Elektronische verpackung |
| DE102008001855A1 (de) * | 2008-05-19 | 2009-11-26 | Evonik Degussa Gmbh | Zweikomponenten-Zusammensetzung zur Herstellung von flexiblen Polyurethan-Gelcoats |
| DE102008040783A1 (de) | 2008-07-28 | 2010-02-04 | Evonik Degussa Gmbh | Zusammensetzung für Bautenschutzanwendungen basierend auf Alkylalkoxysiloxanen mit verbesserten Abperleigenschaften |
| DE102008041918A1 (de) | 2008-09-09 | 2010-03-11 | Evonik Degussa Gmbh | Silanolkondensationskatalysatoren zur Vernetzung von gefüllten und ungefüllten Polymer-Compounds |
| DE102008041919A1 (de) * | 2008-09-09 | 2010-03-11 | Evonik Degussa Gmbh | Verwendung von Silicium enthaltenden Vorläuferverbindungen einer organischen Säure als Katalysator zur Vernetzung von gefüllten und ungefüllten Polymer-Compounds |
| DE102009000614A1 (de) | 2009-02-04 | 2010-08-05 | Evonik Degussa Gmbh | Fluorfreie Zusammensetzung zur wasserabweisenden Beschichtung von Oberflächen mit verbesserten Abperleigenschaften |
| DE102009002477A1 (de) | 2009-04-20 | 2010-10-21 | Evonik Degussa Gmbh | Quartäre-aminofunktionelle, siliciumorganische Verbindungen enthaltende Zusammensetzung sowie deren Herstellung und Verwendung |
| DE102009002499A1 (de) | 2009-04-20 | 2010-10-21 | Evonik Degussa Gmbh | Dispersion enthaltend mit quartären, aminofunktionellen siliciumorganischen Verbindungen oberflächenmodifizierte Siliciumdioxidpartikel |
| DE102009017822A1 (de) | 2009-04-20 | 2010-10-21 | Evonik Degussa Gmbh | Wässrige Silansysteme basierend auf Tris(alkoxysilylalkyl)aminen und deren Verwendung |
| DE102009027090A1 (de) | 2009-06-23 | 2010-12-30 | Evonik Degussa Gmbh | Magnetische Partikel und Polyethylen enthaltendes Kompositmaterial |
| DE102010030115A1 (de) | 2009-08-11 | 2011-02-17 | Evonik Degussa Gmbh | Glycidyloxyalkylalkoxysilan-basierte wässrige Silansysteme für den Blankkorrosionsschutz und Korrosionsschutz von Metallen |
| DE102010002358A1 (de) | 2010-02-25 | 2011-08-25 | Evonik Degussa GmbH, 45128 | Carboxyfunktionalisierte Silicium enthaltende Vorläuferverbindung verschiedener organischer Carbonsäuren |
| DK2552853T3 (da) | 2010-04-01 | 2020-07-27 | Evonik Operations Gmbh | Cementholdig blanding til materialer med easy-to-clean-egenskaber ved massemodifikation ved hjælp af fluorholdige aktivstoffer |
| WO2011121027A1 (de) | 2010-04-01 | 2011-10-06 | Evonik Degussa Gmbh | Härtbare mischung |
| DE102010063563A1 (de) | 2010-12-20 | 2012-06-21 | Evonik Degussa Gmbh | Zusammensetzung mit verbesserter Witterungsstabilität der Farbe von Baustoffen und Verfahren zu deren Herstellung |
| DE202011110266U1 (de) | 2011-11-22 | 2013-03-26 | Evonik Degussa Gmbh | Besonders VOC-arme Gemische olefinisch funktionalisierter Siloxanoligomere basierend auf Alkoxysilanen |
| DE202011110267U1 (de) | 2011-11-22 | 2013-03-26 | Evonik Degussa Gmbh | Zusammensetzung olefinisch funktionalisierter Siloxanoligomere basierend auf Alkoxysilanen |
| DE102011086865A1 (de) | 2011-11-22 | 2013-05-23 | Evonik Degussa Gmbh | Chloridarme Zusammensetzungen olefinisch funktionalisierter Siloxanoligomere basierend auf Alkoxysilanen |
| CN102796387A (zh) * | 2012-09-03 | 2012-11-28 | 黄卫 | 环氧胶粉沥青材料及其制备方法 |
| JP5689210B1 (ja) * | 2013-06-13 | 2015-03-25 | 関西ペイント株式会社 | 塗料組成物 |
| DE102014206359A1 (de) | 2014-04-03 | 2015-10-08 | Evonik Degussa Gmbh | VOC-arme Dialkyl-funktionelle Alkoxysiloxane, Verfahren und deren Verwendung als hydrophobierende Imprägniermittel für mineralische Baustoffe |
| KR101805528B1 (ko) * | 2016-01-28 | 2018-01-10 | 주식회사 인실리코 | 실리콘계 에멀젼 발수제 및 이를 이용한 원단의 발수가공방법 |
| DK3243807T3 (da) | 2016-05-12 | 2019-03-18 | Evonik Degussa Gmbh | Anvendelse af vandige emulsioner på basis af propylethoxysilanoligomerer som tilsætning i hydraulisk afbindende cementblandinger til formindskelse af svind |
| CN108250454A (zh) * | 2018-01-05 | 2018-07-06 | 芜湖维软新材料有限公司 | 一种硅油乳液的制备方法 |
| EP3533854B1 (en) * | 2018-03-01 | 2022-05-04 | Momentive Performance Materials Inc. | Method of inhibiting water penetration into oil- and gas- producing formations |
| CN108753159A (zh) * | 2018-06-29 | 2018-11-06 | 无锡鸿孚硅业科技有限公司 | 一种有机硅乳液混凝土防水剂及其制备方法 |
| FR3083448B1 (fr) | 2018-07-06 | 2020-07-10 | Coatex | Formulation cosmetique lavante |
| KR20210028697A (ko) | 2018-07-11 | 2021-03-12 | 에보니크 오퍼레이션즈 게엠베하 | 적어도 1종의 미생물을 포함하는 조성물 및 그의 용도 |
| CN110591549A (zh) * | 2019-09-30 | 2019-12-20 | 北京港航晋星科技发展有限公司 | 一种机场混凝土保护剂及其施工方法 |
| WO2022073217A1 (en) * | 2020-10-10 | 2022-04-14 | Wacker Chemie Ag | Use of alkoxysilanes or alkoxysiloxanes or compositions containing the same as admixture for mass hydrophobization of cement-based materials |
| CN116601127A (zh) | 2020-12-18 | 2023-08-15 | 赢创运营有限公司 | 用于无机建筑材料的本体疏水化的稀释稳定的水性组合物 |
| WO2022161765A1 (en) | 2021-01-28 | 2022-08-04 | Evonik Operations Gmbh | Treatment composition for providing a water-repellent layer on a sur-face of a substrate |
| AU2022282417A1 (en) | 2021-05-27 | 2024-01-18 | Evonik Operations Gmbh | Environmentally friendly composition for treating mineral substrates |
| CN113527818B (zh) * | 2021-08-12 | 2022-11-29 | 广东生益科技股份有限公司 | 一种树脂组合物及其应用 |
| CN113511836B (zh) * | 2021-08-17 | 2022-09-23 | 海南大学 | 一种建筑材料防水剂及其制备方法，以及防水蒸压加气建材 |
| CN114369247B (zh) * | 2021-12-29 | 2023-08-15 | 惠州瑞德新材料科技股份有限公司 | 一种纸制品用水性氨烃基硅蜡防水剂、制备方法及应用 |
Family Cites Families (139)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3734763A (en) | 1969-05-15 | 1973-05-22 | Dow Corning | Cationic unsaturated amine-functional silane coupling agents |
| DE2744726C2 (de) | 1977-10-05 | 1983-09-29 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Orthokieselsäuretetraalkylestern oder deren Oligomeren |
| DE3230289A1 (de) | 1982-08-14 | 1984-02-16 | Bayer Ag, 5090 Leverkusen | Herstellung von pharmazeutischen oder kosmetischen dispersionen |
| US4877654A (en) | 1988-05-02 | 1989-10-31 | Pcr, Inc. | Buffered silane emulsions for rendering porous substrates water repellent |
| DE4004946A1 (de) | 1990-02-16 | 1991-08-22 | Wacker Chemie Gmbh | Feinteilige organopolysiloxanemulsionen |
| US5073195A (en) | 1990-06-25 | 1991-12-17 | Dow Corning Corporation | Aqueous silane water repellent compositions |
| DE4119332A1 (de) * | 1991-06-12 | 1992-12-17 | Huels Chemische Werke Ag | Verfahren zur herstellung von methylidengruppen enthaltenden (alpha), (omega) -ungesaettigten oligomeren aus (alpha), (omega) -diolefinen in gegenwart von aluminiumorganischen verbindungen als katalysator |
| DE4122263C1 (da) | 1991-07-05 | 1993-02-25 | Degussa Ag, 6000 Frankfurt, De | |
| DE4233021A1 (de) | 1992-10-01 | 1994-04-07 | Huels Chemische Werke Ag | Organosilanpolykondensate |
| DE4309971A1 (de) | 1993-03-26 | 1994-09-29 | Bayer Ag | Imprägnierungsemulsion für mineralische Baustoffe |
| DE4443825A1 (de) | 1994-12-09 | 1996-06-13 | Huels Chemische Werke Ag | Wasserbasierende Organopolysiloxan-haltige Zusammensetzungen, Verfahren zu deren Herstellung und deren Verwendung |
| DE4443824A1 (de) * | 1994-12-09 | 1996-06-13 | Huels Chemische Werke Ag | Organopolysiloxan-haltige Zusammensetzungen auf Wasserbasis, Verfahren zu deren Herstellung sowie deren Verwendung |
| DE19508088A1 (de) * | 1995-03-08 | 1996-09-12 | Huels Chemische Werke Ag | Verfahren zur Herstellung eines Oligomer-Gemisches aus alpha,omega-Diolefinen |
| DE19531144C2 (de) * | 1995-08-24 | 2003-08-28 | Degussa | Wasser-haltige Auflösungen von Acryl-funktionalisierten Organosilanen, Verfahren zu deren Herstellung sowie deren Verwendung |
| US5741850A (en) | 1995-08-30 | 1998-04-21 | Dow Corning Toray Silicone Co., Ltd. | Method for the continuous preparation of organopolysiloxane emulsions |
| US5746810A (en) | 1995-11-30 | 1998-05-05 | Toyo Ink Manufacturing Co., Ltd. | Aqueous emulsion of alkylalkoxysilane, process for the production thereof, and use thereof |
| DE19624032A1 (de) * | 1996-06-17 | 1997-12-18 | Huels Chemische Werke Ag | Oligomerengemisch kondensierter Alkylalkoxysilane |
| DE19628035A1 (de) | 1996-07-11 | 1998-01-15 | Wacker Chemie Gmbh | Wäßrige Cremes von Organosiliciumverbindungen für Hydrophobierung von Baustoffen |
| DE19639782A1 (de) * | 1996-09-27 | 1998-04-02 | Huels Chemische Werke Ag | Glycidether-, Acryl- und/oder Methacryl-funktionelle Organopolysiloxan-haltige Zusammensetzungen auf Wasser-Basis, Verfahren zu deren Herstellung sowie deren Verwendung |
| DE19639783A1 (de) * | 1996-09-27 | 1998-04-02 | Merck Patent Gmbh | Modifizierte Perlglanzpigmente für Wasserlacksysteme |
| DE19649953A1 (de) * | 1996-12-03 | 1998-06-04 | Huels Chemische Werke Ag | Fluoralkyl-funktionelle Organopolysiloxan-haltige Zusammensetzungen auf Wasserbasis, Verfahren zu deren Herstellung sowie deren Verwendung |
| DE19649954A1 (de) * | 1996-12-03 | 1998-06-04 | Huels Chemische Werke Ag | Fluoralkyl-funktionelle Organosiloxan-haltige Zusammensetzungen auf Alkoholbasis, Verfahren zu deren Herstellung sowie deren Verwendung |
| DE19649955A1 (de) * | 1996-12-03 | 1998-06-04 | Huels Chemische Werke Ag | Fluoralkyl-funktionelle Organopolysiloxan-haltige Zusammensetzungen auf Wasser/Alkohol-Basis, Verfahren zu deren Herstellung sowie deren Verwendung |
| US6713186B1 (en) | 1996-12-03 | 2004-03-30 | Degussa Ag | Fluoroalkyl-functional organosiloxane-containing compositions based on alcohol, a process for their preparation and their use |
| DE19814267A1 (de) | 1997-09-25 | 1999-04-01 | Ge Bayer Silicones Gmbh & Co | Vorrichtung und Verfahren zur Herstellung von Siliconemulsionen |
| DE19747794A1 (de) | 1997-10-30 | 1999-05-06 | Degussa | Verfahren zur Herstellung von in der Masse hydrophobiertem Beton |
| DE19818923A1 (de) * | 1998-04-28 | 1999-11-04 | Degussa | Stabile Zusammensetzungen wasserlöslicher, Amino- und Alkenyl-funktioneller Organosiloxane, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19818924A1 (de) * | 1998-04-28 | 1999-11-04 | Degussa | Oberflächenmodifizierte Füllstoffe, Verfahren zu deren Herstellung sowie deren Verwendung |
| DE19823390A1 (de) * | 1998-05-26 | 1999-12-16 | Degussa | Oligomerisiertes Organopolysiloxan-Cokondensat, dessen Herstellung und dessen Verwendung |
| DE19830232A1 (de) | 1998-07-07 | 2000-01-13 | Abb Research Ltd | Stromkontaktanordnungen eines Stromschalters |
| DE19834990B4 (de) | 1998-08-03 | 2005-09-15 | Degussa Ag | Acryloxypropyl- oder Methacryloxypropyl-Gruppen enthaltende Siloxan-Oligomere, Verfahren zu ihrer Herstellung sowie deren Verwendung |
| DE19848351A1 (de) * | 1998-10-21 | 2000-04-27 | Degussa | Vernetzbare Polymere, Verfahren zu deren Herstellung und Formkörper aus vernetzten Polymeren |
| DE19849308A1 (de) * | 1998-10-27 | 2000-05-04 | Degussa | Aminopropyl-funktionelle Siloxan-Oligomere |
| US6074470A (en) | 1998-12-10 | 2000-06-13 | Dow Corning Corporation | Stable, constant particle size, aqueous emulsions of nonpolar silanes suitable for use in water repellence applications |
| DE19904132C2 (de) * | 1999-02-03 | 2002-11-28 | Degussa | Zusammensetzung fluororganofunktioneller Silane und Siloxane, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19904496A1 (de) | 1999-02-04 | 2000-08-10 | Wacker Chemie Gmbh | Wäßrige Cremes von Organosiliciumverbindungen |
| DE19908636A1 (de) * | 1999-02-27 | 2000-08-31 | Degussa | Wasserbasierende Zusammensetzung aminofunktioneller Siliciumverbindungen |
| DE19929021A1 (de) * | 1999-06-25 | 2000-12-28 | Degussa | Funktionelle Organylorganyloxysilane auf Trägerstoffen in Kabelcompounds |
| DE19964310C2 (de) | 1999-11-15 | 2003-07-03 | Degussa | Triamino- und fluoralkylfunktionelle Organosiloxane enthaltende Mittel und Verfahren zu deren Herstellung |
| DE19961972A1 (de) | 1999-12-22 | 2001-06-28 | Degussa | Organosilan- und/oder Organosiloxan-haltige Mittel für gefülltes Polyamid |
| EP1197472B1 (de) * | 2000-09-26 | 2011-01-19 | Evonik Degussa GmbH | Eisenoxid- und Siliciumdioxid-Titandioxid-Mischung |
| DE10049153A1 (de) | 2000-09-27 | 2002-04-11 | Degussa | Farbe, Lack, Schadstoffe, Bioorganismen, Öl, Wasser, und/oder Schmutz abweisende Beschichtung |
| EP1195416A3 (de) * | 2000-10-05 | 2005-12-28 | Degussa AG | Polymerisierbare siliciumorganische Nanokapseln |
| EP1195417B1 (de) * | 2000-10-05 | 2009-10-14 | Evonik Degussa GmbH | Siliciumorganische Nanokapseln |
| DE10054345A1 (de) | 2000-11-02 | 2002-05-08 | Degussa | Wäßrige Dispersion, Verfahren zu deren Herstellung und Verwendung |
| DE10056343A1 (de) * | 2000-11-14 | 2002-05-16 | Degussa | Kontinuierliches Verfahren zur Herstellung von Organoalkoxysiloxanen |
| DE10056344A1 (de) * | 2000-11-14 | 2002-05-16 | Degussa | n-Propylethoxysiloxane, Verfahren zu deren Herstellung und deren Verwendung |
| DE10065027A1 (de) * | 2000-12-23 | 2002-07-04 | Degussa | Wäßrige Dispersion, Verfahren zu deren Herstellung und Verwendung |
| DE10100384A1 (de) * | 2001-01-05 | 2002-07-11 | Degussa | Verfahren zur Modifizierung der Funktionalität von organofunktionellen Substratoberflächen |
| EP1249470A3 (de) | 2001-03-30 | 2005-12-28 | Degussa AG | Hochgefüllte pastöse siliciumorganische Nano- und/oder Mikrohybridkapseln enthaltende Zusammensetzung für kratz- und/oder abriebfeste Beschichtungen |
| EP1245627B1 (de) * | 2001-03-30 | 2007-07-04 | Degussa GmbH | Siliciumorganische Nano-Mikrohybridsysteme oder Mikrohybridsysteme enthaltende Zusammensetzung für kratz- und abriebfeste Beschichtungen |
| DE10126163A1 (de) | 2001-05-30 | 2002-12-05 | Degussa | Pharmazeutische Zubereitungen |
| DE10132942A1 (de) * | 2001-07-06 | 2003-01-23 | Degussa | Siloxan-Oligomere, Verfahren zu deren Herstellung und deren Verwendung |
| ES2225366T3 (es) * | 2001-08-08 | 2005-03-16 | Degussa Aktiengesellschaft | Particulas de oxido metalico recubiertas con dioxido de silicio. |
| DE10141687A1 (de) * | 2001-08-25 | 2003-03-06 | Degussa | Siliciumverbindungen enthaltendes Mittel zur Beschichtung von Oberflächen |
| DE10142555A1 (de) * | 2001-08-30 | 2003-03-20 | Degussa | Mittel für die Verbesserung der Scorch-Bedingungen bei der Herstellung gepfropfter und/oder vernetzter Polymere sowie gefüllter Kunststoffe |
| DE10149130A1 (de) | 2001-10-05 | 2003-04-10 | Degussa | Flammenhydrolytisch hergestelltes, mit zweiwertigen Metalloxiden dotiertes Aluminiumoxid und wässerige Dispersion hiervon |
| DE10151264A1 (de) * | 2001-10-17 | 2003-04-30 | Degussa | Aminoalkylalkoxysiloxanhaltige Gemische, deren Herstellung und deren Verwendung |
| DE10152745A1 (de) * | 2001-10-25 | 2003-05-15 | Degussa | Dispersion von Aluminiumoxid |
| US7815936B2 (en) | 2001-10-30 | 2010-10-19 | Evonik Degussa Gmbh | Use of granular materials based on pyrogenically produced silicon dioxide in pharmaceutical compositions |
| US20030108580A1 (en) * | 2001-10-30 | 2003-06-12 | Steffen Hasenzahl | Use of granulates based on pyrogenically - produced silicon dioxide in cosmetic compositions |
| DE10153803A1 (de) * | 2001-11-05 | 2003-05-15 | Degussa | Korrosionsinhibitor für Stahlbeton |
| DE10159952A1 (de) * | 2001-12-06 | 2003-06-18 | Degussa | Verwendung flüssiger oder auf Trägermaterial aufgebrachter ungestättigter Organosilan/-mischungen zur Herstellung von feuchtigkeitsvernetzten und gefüllten Kabelcompounds |
| DE10163938A1 (de) * | 2001-12-22 | 2003-07-10 | Degussa | Flammenhydrolytisch hergestelltes Silicium-Titan-Mischoxidpulver mit an der Oberfläche angereichertem Siliciumdioxid, dessen Herstellung und Verwendung |
| DE10203047A1 (de) * | 2002-01-26 | 2003-08-07 | Degussa | Kationische Mischoxid-Dispersion, Streichfarbe und tintenaufnehmendes Medium |
| DE10204470C1 (de) * | 2002-02-05 | 2003-08-14 | Degussa | Verfahren und Vorrichtung zur Herstellung von Dispersionen |
| DE10204471C1 (de) * | 2002-02-05 | 2003-07-03 | Degussa | Wässerige Dispersion enthaltend mit Ceroxid umhülltes Siliciumdioxidpulver, Verfahren zu deren Herstellung und Verwendung |
| DE10205280C1 (de) * | 2002-02-07 | 2003-07-03 | Degussa | Dispersion zum chemisch-mechanischen Polieren |
| DE10212523A1 (de) * | 2002-03-21 | 2003-10-02 | Degussa | Lufttrocknende, silanhaltige Beschichtungsmittel |
| ATE273799T1 (de) | 2002-03-22 | 2004-09-15 | Degussa | Dispersion, streichfarbe und aufnahmemedium |
| DE10218871A1 (de) | 2002-04-26 | 2003-11-13 | Degussa | Verfahren zur Imprägnierung von porösen mineralischen Substraten |
| DE10225122A1 (de) | 2002-06-06 | 2003-12-18 | Goldschmidt Ag Th | Hochkonzentrierte wässrige Dispersionen enthaltend hydrophobe mikrofeine Metalloxidpartikel und Dispergierhilfsmittel |
| DE10225125A1 (de) | 2002-06-06 | 2003-12-18 | Goldschmidt Ag Th | Wässerige Dispersion enthaltend pyrogen hergestellte Metalloxidpartikel und Dispergierhilfsmittel |
| DE10225123A1 (de) * | 2002-06-06 | 2003-12-18 | Goldschmidt Ag Th | Hochkonzentrierte wässrige Dispersion enthaltend hydrophile mikrofeine Metalloxidpartikel und Dispergierhilfsmittel |
| DE10229761B4 (de) * | 2002-07-03 | 2004-08-05 | Degussa Ag | Wässerige Dispersion, enthaltend pyrogen hergestellte Metalloxidpartikel und Phosphate, Verfahren zu deren Herstellung und deren Verwendung |
| DE10238369A1 (de) | 2002-08-22 | 2004-03-04 | Degussa Ag | Mittel als Haftvermittler für gefüllte und peroxidisch zu vernetzende Gummicompounds |
| US7374787B2 (en) * | 2002-08-22 | 2008-05-20 | Dequssa Ag | Stabilized, aqueous silicon dioxide dispersion |
| DE10250711A1 (de) | 2002-10-31 | 2004-05-19 | Degussa Ag | Pharmazeutische und kosmetische Zubereitungen |
| DE10250712A1 (de) | 2002-10-31 | 2004-05-19 | Degussa Ag | Pulverförmige Stoffe |
| DE10256267A1 (de) | 2002-12-03 | 2004-06-24 | Degussa Ag | Dispersion, Streichfarbe und Aufnahmemedium |
| DE10259860A1 (de) * | 2002-12-20 | 2004-07-08 | Degussa Ag | Pulvergemisch bestehend aus Titandioxid, Zinkoxid und Zink-Titan-Mischoxid |
| DE10260718A1 (de) * | 2002-12-23 | 2004-07-08 | Degussa Ag | Mit Siliziumdioxid umhülltes Titandioxid |
| DE10316661A1 (de) * | 2003-04-11 | 2004-11-04 | Degussa Ag | Dispergiermittel enthaltende wässerige Dispersion von hydrophobiertem Siliciumdioxidpulver |
| DE10317066A1 (de) * | 2003-04-14 | 2004-11-11 | Degussa Ag | Verfahren zur Herstellung von Metalloxid- und Metalloidoxid-Dispersionen |
| DE10320765A1 (de) * | 2003-05-09 | 2004-11-25 | Degussa Ag | Mittel zur Beschichtung von Metallen zum Schutz vor Korrosion |
| DE10320779A1 (de) * | 2003-05-09 | 2004-11-18 | Degussa Ag | Korrosionsschutz auf Metallen |
| CN1308372C (zh) * | 2003-05-15 | 2007-04-04 | 广州市白云化工实业有限公司 | 一种非离子型活性硅表面活性剂及其制备方法 |
| DE10327624B3 (de) * | 2003-06-20 | 2004-12-30 | Degussa Ag | Organosiliciumverbindungen, Verfahren zu ihrer Herstellung, sowie ihre Verwendung |
| DE10330020A1 (de) * | 2003-07-03 | 2005-01-20 | Degussa Ag | Hochgefüllte Silan-Zubereitung |
| DE10336544A1 (de) * | 2003-08-05 | 2005-02-24 | Degussa Ag | Zweikomponentenbeschichtungssystem für die Ausstattung glatter Oberflächen mit "Easy-to-clean" - Eigenschaften |
| DE10337198A1 (de) | 2003-08-13 | 2005-03-17 | Degussa Ag | Träger auf Basis von Granulaten, die aus pyrogen hergestelltem Siliciumdioxiden hergestellt sind |
| DE10362060B4 (de) * | 2003-10-21 | 2009-07-09 | Altana Coatings & Sealants Gmbh | Verpackungsmaterial mit einer Barriereschicht für Gase |
| DE10358411A1 (de) * | 2003-12-13 | 2005-07-07 | Degussa Ag | Verfahren zur Herstellung alkoxyreiner Erdalkalialkoxide |
| DE10360087A1 (de) * | 2003-12-20 | 2005-07-21 | Degussa Ag | Flammenhydrolytisch hergestelltes, hochoberflächiges Aluminiumoxidpulver |
| DE10360766A1 (de) * | 2003-12-23 | 2005-07-28 | Degussa Ag | Verfahren und Vorrichtung zur Herstellung von Dispersionen |
| DE102004002499A1 (de) * | 2004-01-17 | 2005-08-11 | Degussa Ag | Verfahren zur Verhinderung von Anfeuerungseffekten bei Imprägnierungen von Substraten |
| DE102004004147A1 (de) * | 2004-01-28 | 2005-08-18 | Degussa Ag | Oberflächenmodifizierte, mit Siliziumdioxid umhüllte Metalloid/Metalloxide |
| DE102004007456A1 (de) * | 2004-02-13 | 2005-09-01 | Degussa Ag | Hochgefüllte Polyolefin-Compounds |
| DE102004021092A1 (de) * | 2004-04-29 | 2005-11-24 | Degussa Ag | Verwendung einer kationischen Siliciumdioxid-Dispersion als Textilveredlungsmittel |
| DE102004025143A1 (de) | 2004-05-21 | 2005-12-08 | Degussa Ag | Ternäres Metall-Mischoxidpulver |
| DE102004031785A1 (de) | 2004-07-01 | 2006-01-26 | Degussa Ag | Polyol enthaltende Siliciumdioxid-Dispersion |
| DE102004037045A1 (de) * | 2004-07-29 | 2006-04-27 | Degussa Ag | Wässrige Silan-Nanokomposite |
| DE102004037118A1 (de) * | 2004-07-30 | 2006-03-23 | Degussa Ag | Titandioxid enthaltende Dispersion |
| DE102004046093A1 (de) | 2004-09-23 | 2006-03-30 | Degussa Ag | Oberflächenmodifizierte Zink-Titan-Mischoxide |
| DE102004056862A1 (de) * | 2004-11-25 | 2006-06-14 | Degussa Ag | Pulverförmige, kosmetische Zubereitung mit hohem Wassergehalt |
| EP1700825A1 (de) * | 2004-12-23 | 2006-09-13 | Degussa AG | Oberflächenmodifizierte, strukturmodifizierte Titandioxide |
| EP1674427A1 (de) * | 2004-12-23 | 2006-06-28 | Degussa AG | Strukturmodifizierte Titandioxide |
| DE502004006066D1 (de) * | 2004-12-23 | 2008-03-13 | Evonik Degussa Gmbh | Oberflächenmodifizierte pyrogen hergestellte Titandioxide |
| ATE484551T1 (de) * | 2004-12-23 | 2010-10-15 | Evonik Degussa Gmbh | Oberflächenmodifizierte siliciumdioxid- titandioxid-mischoxide |
| DE102005055226A1 (de) * | 2004-12-24 | 2006-07-13 | Degussa Ag | Lagerung pulverförmiger Stoffe mit hohem Wassergehalt |
| DE102005004871A1 (de) * | 2005-02-03 | 2006-08-10 | Degussa Ag | Hochviskose wässrige Emulsionen von funktionellen Alkoxysilanen, deren kondensierten Oligomeren, Organopolysiloxanen, deren Herstellung und Verwendung zur Oerflächenbehandlung von anorganischen Materialien |
| DE102005032427A1 (de) | 2005-07-12 | 2007-01-18 | Degussa Ag | Aluminiumoxid-Dispersion |
| DE102006006655A1 (de) * | 2005-08-26 | 2007-03-01 | Degussa Ag | Cellulose- bzw. lignocellulosehaltige Verbundwerkstoffe auf der Basis eines auf Silan basierenden Komposits als Bindemittel |
| DE102006006656A1 (de) * | 2005-08-26 | 2007-03-01 | Degussa Ag | Silan enthaltendes Bindemittel für Verbundwerkstoffe |
| DE102006006654A1 (de) * | 2005-08-26 | 2007-03-01 | Degussa Ag | Spezielle Aminoalkylsilanverbindungen als Bindemittel für Verbundwerkstoffe |
| DE102005053071A1 (de) | 2005-11-04 | 2007-05-16 | Degussa | Verfahren zur Herstellung von ultrafeinen Pulvern auf Basis Polymaiden, ultrafeinen Polyamidpulver sowie deren Verwendung |
| DE102005060402A1 (de) * | 2005-12-15 | 2007-06-21 | Degussa Gmbh | Lagerstabile Beschichtungszusammensetzung für eine abriebfeste und witterungsbeständige Ausstattung glatter anorganischer Oberflächen mit "Easy-to-clean"Eigenschaften |
| DE102005060401A1 (de) * | 2005-12-15 | 2007-06-21 | Degussa Gmbh | Lagerstabile Beschichtungszusammensetzung für eine abriebfeste und witterungsbeständige Ausstattung glatter anorganischer Oberflächen mit "Easy-to-clean"-Eigenschaften |
| DE102005059960A1 (de) | 2005-12-15 | 2007-06-28 | Degussa Gmbh | Hochgefüllte Übergangs-Aluminiumoxid enthaltende Dispersion |
| DE102006003957A1 (de) * | 2006-01-26 | 2007-08-02 | Degussa Gmbh | Wasserverdünnbare Sol-Gel-Zusammensetzung |
| DE102006013090A1 (de) * | 2006-03-20 | 2007-09-27 | Georg-August-Universität Göttingen | Kompositwerkstoff aus Holz und thermoplastischem Kunststoff |
| DE102006017701A1 (de) * | 2006-04-15 | 2007-10-25 | Degussa Gmbh | Silicium-Titan-Mischoxidpulver, Dispersion hiervon und daraus hergestellter titanhaltiger Zeolith |
| DE102006033310A1 (de) * | 2006-07-17 | 2008-01-31 | Evonik Degussa Gmbh | Gemische aus siliciumhaltigen Kopplungsreagentien |
| DE102006039269A1 (de) | 2006-08-22 | 2008-02-28 | Evonik Degussa Gmbh | Dispersion von Aluminiumoxid, Beschichtungszusammensetzung und tintenaufnehmendes Medium |
| DE102008007261A1 (de) | 2007-08-28 | 2009-03-05 | Evonik Degussa Gmbh | Wässrige Silansysteme basierend auf Bis(trialkoxysilyalkyl)aminen |
| DE102007040802A1 (de) | 2007-08-28 | 2009-03-05 | Evonik Degussa Gmbh | VOC-arme aminoalkyl-funktionelle Siliciumverbindungen enthaltende Zusammensetzung für Streichfarben zur Behandlung von Papier oder Folie |
| DE102007045186A1 (de) * | 2007-09-21 | 2009-04-09 | Continental Teves Ag & Co. Ohg | Rückstandsfreies, schichtbildendes, wässriges Versiegelungssystem für metallische Oberflächen auf Silan-Basis |
| DE102007049743A1 (de) * | 2007-10-16 | 2009-04-23 | Evonik Degussa Gmbh | Silicium-Titan-Mischoxidpulver, Dispersion hiervon und daraus hergestellter titanhaltiger Zeolith |
| US20100015339A1 (en) * | 2008-03-07 | 2010-01-21 | Evonik Degussa Gmbh | Silane-containing corrosion protection coatings |
| DE102008001808A1 (de) * | 2008-05-15 | 2009-11-19 | Evonik Degussa Gmbh | Beschichtungszusammensetzung |
| DE102008001855A1 (de) * | 2008-05-19 | 2009-11-26 | Evonik Degussa Gmbh | Zweikomponenten-Zusammensetzung zur Herstellung von flexiblen Polyurethan-Gelcoats |
| DE102008040783A1 (de) * | 2008-07-28 | 2010-02-04 | Evonik Degussa Gmbh | Zusammensetzung für Bautenschutzanwendungen basierend auf Alkylalkoxysiloxanen mit verbesserten Abperleigenschaften |
| DE102009000614A1 (de) | 2009-02-04 | 2010-08-05 | Evonik Degussa Gmbh | Fluorfreie Zusammensetzung zur wasserabweisenden Beschichtung von Oberflächen mit verbesserten Abperleigenschaften |
| DE102009017822A1 (de) * | 2009-04-20 | 2010-10-21 | Evonik Degussa Gmbh | Wässrige Silansysteme basierend auf Tris(alkoxysilylalkyl)aminen und deren Verwendung |
| DE102009027090A1 (de) * | 2009-06-23 | 2010-12-30 | Evonik Degussa Gmbh | Magnetische Partikel und Polyethylen enthaltendes Kompositmaterial |
| DE102010030115A1 (de) * | 2009-08-11 | 2011-02-17 | Evonik Degussa Gmbh | Glycidyloxyalkylalkoxysilan-basierte wässrige Silansysteme für den Blankkorrosionsschutz und Korrosionsschutz von Metallen |
| DE102010002358A1 (de) * | 2010-02-25 | 2011-08-25 | Evonik Degussa GmbH, 45128 | Carboxyfunktionalisierte Silicium enthaltende Vorläuferverbindung verschiedener organischer Carbonsäuren |
| DE102010002356A1 (de) | 2010-02-25 | 2011-08-25 | Evonik Degussa GmbH, 45128 | Zusammensetzungen von mit oligomeren Siloxanolen funktionalisierten Metalloxiden und deren Verwendung |
| DE102010003579A1 (de) * | 2010-04-01 | 2011-10-06 | Evonik Degussa Gmbh | Formulierung geeignet zur Verwendung als Antigraffiti-Beschichtung mit verbesserten Benetzungseigenschaften |
-
2005
- 2005-02-03 DE DE102005004872A patent/DE102005004872A1/de not_active Withdrawn
- 2005-12-08 WO PCT/EP2005/056598 patent/WO2006081892A1/en active Application Filing
- 2005-12-08 PL PL05815817T patent/PL1843991T3/pl unknown
- 2005-12-08 DK DK05815817.1T patent/DK1843991T3/da active
- 2005-12-08 US US11/815,391 patent/US8795784B2/en active Active
- 2005-12-08 EP EP05815817.1A patent/EP1843991B1/en active Active
- 2005-12-08 CN CN2005800477594A patent/CN101115696B/zh active Active
-
2008
- 2008-07-04 HK HK08107389.6A patent/HK1117133A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US8795784B2 (en) | 2014-08-05 |
| EP1843991B1 (en) | 2015-09-02 |
| WO2006081892A1 (en) | 2006-08-10 |
| PL1843991T3 (pl) | 2016-01-29 |
| DE102005004872A1 (de) | 2006-08-10 |
| CN101115696A (zh) | 2008-01-30 |
| US20080187673A1 (en) | 2008-08-07 |
| HK1117133A1 (en) | 2009-01-09 |
| CN101115696B (zh) | 2011-08-17 |
| EP1843991A1 (en) | 2007-10-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK1843991T3 (da) | Vandige emulsioner af funktionelle alkoxysilaner og kondenserede oligomerer deraf, deres fremstilling og anvendelse til overfladebehandling | |
| US7781520B2 (en) | High-viscosity aqueous emulsions of functional alkoxysilanes, condensed oligomers thereof, organopolysiloxanes, their preparation and use for surface treatment of inorganic materials | |
| US8354480B2 (en) | Aqueous silicone emulsion for imparting water repellency | |
| US6403163B1 (en) | Method of treating surfaces with organosilicon water repellent compositions | |
| DE60121164T2 (de) | Wasserabweisende Organosilikonzusammensetzung | |
| KR970000942B1 (ko) | 구조섬유-보강시멘트성분의 함침용 오르가노폴리실록산-알킬트리알콕시실란 에멀젼 | |
| US20120015108A1 (en) | Composition Containing A Silicon-Containing Compound | |
| JP6087929B2 (ja) | コンクリート用撥水剤 | |
| EP1660584B1 (en) | Silicone oil-in-water (o/w) emulsions or compositions useful for water repellent applications | |
| JP7033124B2 (ja) | 無機多孔性材料用吸収防止材、コンクリートの改質方法およびコンクリート | |
| US9868866B2 (en) | Method of forming a hydrolysis resistant aqueous emulsion | |
| CA3219675A1 (en) | Environmentally friendly composition for treating mineral substrates |