DK169325B1 - Analogifremgangsmåde til fremstilling af N-heterocyclyl-4-piperidinaminer - Google Patents
Analogifremgangsmåde til fremstilling af N-heterocyclyl-4-piperidinaminer Download PDFInfo
- Publication number
- DK169325B1 DK169325B1 DK129879A DK129879A DK169325B1 DK 169325 B1 DK169325 B1 DK 169325B1 DK 129879 A DK129879 A DK 129879A DK 129879 A DK129879 A DK 129879A DK 169325 B1 DK169325 B1 DK 169325B1
- Authority
- DK
- Denmark
- Prior art keywords
- parts
- group
- methyl
- piperidinyl
- benzimidazol
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 40
- 238000002360 preparation method Methods 0.000 title claims description 15
- -1 3-cyano-3,3-diphenylpropyl Chemical group 0.000 claims description 101
- 239000000203 mixture Substances 0.000 claims description 92
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 53
- 239000011541 reaction mixture Substances 0.000 claims description 48
- 150000001875 compounds Chemical class 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 150000003839 salts Chemical class 0.000 claims description 39
- 239000002585 base Substances 0.000 claims description 31
- 239000003054 catalyst Substances 0.000 claims description 30
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 28
- 239000007858 starting material Substances 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- 238000003756 stirring Methods 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 12
- 150000003053 piperidines Chemical class 0.000 claims description 12
- 239000012458 free base Substances 0.000 claims description 11
- 150000002431 hydrogen Chemical class 0.000 claims description 11
- 239000003960 organic solvent Substances 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 10
- 125000006239 protecting group Chemical group 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 9
- 150000003585 thioureas Chemical class 0.000 claims description 7
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 150000002576 ketones Chemical class 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 5
- DDSZWBCJXDRQDU-UHFFFAOYSA-N [N].C1CCNCC1 Chemical group [N].C1CCNCC1 DDSZWBCJXDRQDU-UHFFFAOYSA-N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 150000003141 primary amines Chemical class 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000006018 1-methyl-ethenyl group Chemical group 0.000 claims description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 238000005903 acid hydrolysis reaction Methods 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 150000003335 secondary amines Chemical class 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 238000007259 addition reaction Methods 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 238000006482 condensation reaction Methods 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000000376 reactant Substances 0.000 claims description 3
- 238000006268 reductive amination reaction Methods 0.000 claims description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 2
- 230000002152 alkylating effect Effects 0.000 claims description 2
- 125000005239 aroylamino group Chemical group 0.000 claims description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 2
- 125000005002 aryl methyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 239000002574 poison Substances 0.000 claims description 2
- 231100000614 poison Toxicity 0.000 claims description 2
- 239000001632 sodium acetate Substances 0.000 claims description 2
- 235000017281 sodium acetate Nutrition 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000005100 aryl amino carbonyl group Chemical group 0.000 claims 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 2
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims 1
- 125000004949 alkyl amino carbonyl amino group Chemical group 0.000 claims 1
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims 1
- 125000001769 aryl amino group Chemical group 0.000 claims 1
- 125000004658 aryl carbonyl amino group Chemical group 0.000 claims 1
- 125000005110 aryl thio group Chemical group 0.000 claims 1
- 125000004104 aryloxy group Chemical group 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 153
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 69
- 239000003480 eluent Substances 0.000 description 49
- 229910001868 water Inorganic materials 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- 239000000047 product Substances 0.000 description 36
- 239000000543 intermediate Substances 0.000 description 35
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 31
- 229960001701 chloroform Drugs 0.000 description 31
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 229910052799 carbon Inorganic materials 0.000 description 27
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 27
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 26
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- 238000004440 column chromatography Methods 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Natural products CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 23
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000000741 silica gel Substances 0.000 description 21
- 229910002027 silica gel Inorganic materials 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 20
- 239000000284 extract Substances 0.000 description 19
- 239000000243 solution Substances 0.000 description 19
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 13
- 229910000029 sodium carbonate Inorganic materials 0.000 description 13
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 11
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 239000008186 active pharmaceutical agent Substances 0.000 description 9
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 8
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- 150000004682 monohydrates Chemical class 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000000908 ammonium hydroxide Substances 0.000 description 6
- 239000000739 antihistaminic agent Substances 0.000 description 6
- 229920002055 compound 48/80 Polymers 0.000 description 6
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 6
- 229930192474 thiophene Natural products 0.000 description 6
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 5
- 230000001387 anti-histamine Effects 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(II) oxide Inorganic materials [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- WWXJJVAGYQZHLZ-UHFFFAOYSA-N 1-benzyl-n-piperidin-4-ylbenzimidazol-2-amine Chemical compound C1CNCCC1NC1=NC2=CC=CC=C2N1CC1=CC=CC=C1 WWXJJVAGYQZHLZ-UHFFFAOYSA-N 0.000 description 4
- LCMIBBLUYABCIE-UHFFFAOYSA-N 3-(3-oxobutyl)-1h-benzimidazol-2-one Chemical compound C1=CC=C2NC(=O)N(CCC(=O)C)C2=C1 LCMIBBLUYABCIE-UHFFFAOYSA-N 0.000 description 4
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- QRPRTIQUWZCYNG-UHFFFAOYSA-N n-[1-(2-aminoethyl)piperidin-4-yl]-1-[(4-fluorophenyl)methyl]benzimidazol-2-amine Chemical compound C1CN(CCN)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 QRPRTIQUWZCYNG-UHFFFAOYSA-N 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000001294 propane Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- XHWWJZBMPZFVDF-UHFFFAOYSA-N 1-(3-oxobutyl)-3-prop-1-en-2-ylbenzimidazol-2-one Chemical compound C1=CC=C2N(C(C)=C)C(=O)N(CCC(=O)C)C2=C1 XHWWJZBMPZFVDF-UHFFFAOYSA-N 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- LAGYWHSFHIMTPE-UHFFFAOYSA-N desmethylastemizole Chemical compound C1=CC(O)=CC=C1CCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 LAGYWHSFHIMTPE-UHFFFAOYSA-N 0.000 description 3
- 150000004683 dihydrates Chemical class 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 229910052720 vanadium Inorganic materials 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 2
- KINQREQLXOOETD-UHFFFAOYSA-N 1-[2-[(4-fluorophenyl)methylamino]phenyl]-3-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]thiourea Chemical compound C1=CC(F)=CC=C1CNC1=CC=CC=C1NC(=S)NCCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 KINQREQLXOOETD-UHFFFAOYSA-N 0.000 description 2
- CBWJHIXSVFDERH-UHFFFAOYSA-N 1-isothiocyanato-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1N=C=S CBWJHIXSVFDERH-UHFFFAOYSA-N 0.000 description 2
- DRZIMEJOGKMAMC-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethanol Chemical compound C1CN(CCO)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 DRZIMEJOGKMAMC-UHFFFAOYSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- CTCBIVNUJMABHN-UHFFFAOYSA-N 3-(2-nitrophenyl)-1-[1-(2-phenylethyl)piperidin-4-yl]-1-propan-2-ylthiourea Chemical compound C=1C=CC=C([N+]([O-])=O)C=1NC(=S)N(C(C)C)C(CC1)CCN1CCC1=CC=CC=C1 CTCBIVNUJMABHN-UHFFFAOYSA-N 0.000 description 2
- PYECMAVHMMXGMT-UHFFFAOYSA-N 4-isothiocyanatopiperidine Chemical compound S=C=NC1CCNCC1 PYECMAVHMMXGMT-UHFFFAOYSA-N 0.000 description 2
- QRCGFTXRXYMJOS-UHFFFAOYSA-N 4h-1,4-benzoxazin-3-one Chemical compound C1=CC=C2NC(=O)COC2=C1 QRCGFTXRXYMJOS-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- WZELXJBMMZFDDU-UHFFFAOYSA-N Imidazol-2-one Chemical compound O=C1N=CC=N1 WZELXJBMMZFDDU-UHFFFAOYSA-N 0.000 description 2
- 238000006845 Michael addition reaction Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 2
- VZSXTYKGYWISGQ-UHFFFAOYSA-N bamipine Chemical compound C1CN(C)CCC1N(C=1C=CC=CC=1)CC1=CC=CC=C1 VZSXTYKGYWISGQ-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- DYHDWARLWBMBTJ-UHFFFAOYSA-N benzyl 4-[[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]amino]piperidine-1-carboxylate Chemical compound C1=CC(F)=CC=C1CN1C2=NC=CC=C2N=C1NC1CCN(C(=O)OCC=2C=CC=CC=2)CC1 DYHDWARLWBMBTJ-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229940101209 mercuric oxide Drugs 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- STQSEWLCSLADTG-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-3-nitropyridin-2-amine Chemical compound [O-][N+](=O)C1=CC=CN=C1NCC1=CC=C(F)C=C1 STQSEWLCSLADTG-UHFFFAOYSA-N 0.000 description 2
- ZUUFTKUMGIXWEM-UHFFFAOYSA-N n-[1-(2-chloroethyl)piperidin-4-yl]-1-[(4-fluorophenyl)methyl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCCl)CC1 ZUUFTKUMGIXWEM-UHFFFAOYSA-N 0.000 description 2
- RJLNAXGKPVBEDW-UHFFFAOYSA-N n-[1-(2-phenylethyl)piperidin-4-yl]-1h-benzimidazol-2-amine Chemical compound C1CC(NC=2NC3=CC=CC=C3N=2)CCN1CCC1=CC=CC=C1 RJLNAXGKPVBEDW-UHFFFAOYSA-N 0.000 description 2
- CFHIDWOYWUOIHU-UHFFFAOYSA-N oxomethyl Chemical group O=[CH] CFHIDWOYWUOIHU-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 1
- ZWOBTWLZWFIELC-UHFFFAOYSA-N 1-(1-chloroethyl)-4-fluorobenzene Chemical compound CC(Cl)C1=CC=C(F)C=C1 ZWOBTWLZWFIELC-UHFFFAOYSA-N 0.000 description 1
- NHMBRKFMTPPSQN-UHFFFAOYSA-N 1-(2-butoxyphenoxy)-3-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]propan-2-ol Chemical compound CCCCOC1=CC=CC=C1OCC(O)CN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 NHMBRKFMTPPSQN-UHFFFAOYSA-N 0.000 description 1
- QVDICKRPZRCVCR-UHFFFAOYSA-N 1-(2-phenylethyl)-n-propan-2-ylpiperidin-4-amine Chemical compound C1CC(NC(C)C)CCN1CCC1=CC=CC=C1 QVDICKRPZRCVCR-UHFFFAOYSA-N 0.000 description 1
- MKZOYCWVYJRSAQ-UHFFFAOYSA-N 1-(3-chloropropyl)-3-prop-1-en-2-ylbenzimidazol-2-one Chemical compound C1=CC=C2N(CCCCl)C(=O)N(C(=C)C)C2=C1 MKZOYCWVYJRSAQ-UHFFFAOYSA-N 0.000 description 1
- BPOCDMGUGDXGFA-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-(1-methylpiperidin-4-yl)benzimidazol-2-amine Chemical compound C1CN(C)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 BPOCDMGUGDXGFA-UHFFFAOYSA-N 0.000 description 1
- BKAOISZSELRNGD-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-(1-phenylpropan-2-yl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C1CC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CCN1C(C)CC1=CC=CC=C1 BKAOISZSELRNGD-UHFFFAOYSA-N 0.000 description 1
- NBWQDLOMXUCHMK-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-(2-isothiocyanatoethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCN=C=S)CC1 NBWQDLOMXUCHMK-UHFFFAOYSA-N 0.000 description 1
- OCIADLQNQKTASI-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCC=2SC=CC=2)CC1 OCIADLQNQKTASI-UHFFFAOYSA-N 0.000 description 1
- UNPPCNQQKHBGQZ-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-[2-(3-methoxyphenyl)ethyl]piperidin-4-yl]benzimidazol-2-amine Chemical compound COC1=CC=CC(CCN2CCC(CC2)NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)=C1 UNPPCNQQKHBGQZ-UHFFFAOYSA-N 0.000 description 1
- ONCZFLYTRGGESY-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-[2-(3-methyl-4-phenylmethoxyphenyl)ethyl]piperidin-4-yl]benzimidazol-2-amine Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(C)=CC=1CCN(CC1)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 ONCZFLYTRGGESY-UHFFFAOYSA-N 0.000 description 1
- KKLUKFFNRHRUTD-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 KKLUKFFNRHRUTD-UHFFFAOYSA-N 0.000 description 1
- ZTKZFZLVPHFIRG-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-[2-(4-phenylmethoxyphenyl)ethyl]piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCC=2C=CC(OCC=3C=CC=CC=3)=CC=2)CC1 ZTKZFZLVPHFIRG-UHFFFAOYSA-N 0.000 description 1
- FVJVHCWYAPQPJS-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-[1-[3-(4-methoxyphenyl)sulfanylpropyl]piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC(OC)=CC=C1SCCCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 FVJVHCWYAPQPJS-UHFFFAOYSA-N 0.000 description 1
- VBVIKRHCDMFVJS-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-methyl-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound N=1C2=CC=CC=C2N(CC=2C=CC(F)=CC=2)C=1N(C)C(CC1)CCN1CCC1=CC=CC=C1 VBVIKRHCDMFVJS-UHFFFAOYSA-N 0.000 description 1
- SFOVDSLXFUGAIV-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-piperidin-4-ylbenzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCNCC1 SFOVDSLXFUGAIV-UHFFFAOYSA-N 0.000 description 1
- KMFXNZBYGMWBAT-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-piperidin-4-ylbenzimidazol-2-amine;hydrobromide Chemical compound Br.C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCNCC1 KMFXNZBYGMWBAT-UHFFFAOYSA-N 0.000 description 1
- IVXYTQSEWOVUDL-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-n-piperidin-4-ylbenzimidazol-2-amine;hydron;dibromide Chemical compound Br.Br.C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCNCC1 IVXYTQSEWOVUDL-UHFFFAOYSA-N 0.000 description 1
- ZJCNMXJGFOYQRQ-UHFFFAOYSA-N 1-[1-(4-fluorophenyl)ethyl]-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1NC1=NC2=CC=CC=C2N1C(C)C1=CC=C(F)C=C1 ZJCNMXJGFOYQRQ-UHFFFAOYSA-N 0.000 description 1
- PUPODHYRVWESET-UHFFFAOYSA-N 1-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-3-phenylthiourea Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCN1CCC(NC(=S)NC=2C=CC=CC=2)CC1 PUPODHYRVWESET-UHFFFAOYSA-N 0.000 description 1
- REMJOENUJFBPHJ-UHFFFAOYSA-N 1-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-(2-nitrophenyl)thiourea Chemical compound [O-][N+](=O)C1=CC=CC=C1NC(=S)NCCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 REMJOENUJFBPHJ-UHFFFAOYSA-N 0.000 description 1
- DIQHPBCYBXYTEK-UHFFFAOYSA-N 1-[4-[(1-benzylbenzimidazol-2-yl)amino]piperidin-1-yl]-3-(2,6-dimethoxyphenoxy)propan-2-ol Chemical compound COC1=CC=CC(OC)=C1OCC(O)CN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC=CC=2)CC1 DIQHPBCYBXYTEK-UHFFFAOYSA-N 0.000 description 1
- JZTBVDQECJRCHP-UHFFFAOYSA-N 1-[4-[(1-benzylbenzimidazol-2-yl)amino]piperidin-1-yl]-3-(4-methoxyphenoxy)propan-2-ol Chemical compound C1=CC(OC)=CC=C1OCC(O)CN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC=CC=2)CC1 JZTBVDQECJRCHP-UHFFFAOYSA-N 0.000 description 1
- CGYQPWOEGMAZMS-UHFFFAOYSA-N 1-[4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)amino]piperidin-1-yl]-3-phenoxypropan-2-ol Chemical compound C1CC(NC=2N(C3=NC=CC=C3N=2)CC=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1 CGYQPWOEGMAZMS-UHFFFAOYSA-N 0.000 description 1
- LLAPDLPYIYKTGQ-UHFFFAOYSA-N 1-aminoethyl Chemical group C[CH]N LLAPDLPYIYKTGQ-UHFFFAOYSA-N 0.000 description 1
- LPNHTELXHBGWQR-UHFFFAOYSA-N 1-benzyl-3-(2-nitrophenyl)-1-[1-(2-phenylethyl)piperidin-4-yl]thiourea Chemical compound [O-][N+](=O)C1=CC=CC=C1NC(=S)N(C1CCN(CCC=2C=CC=CC=2)CC1)CC1=CC=CC=C1 LPNHTELXHBGWQR-UHFFFAOYSA-N 0.000 description 1
- PEXCQWULUILEAE-UHFFFAOYSA-N 1-benzyl-n-(1-methylpiperidin-4-yl)benzimidazol-2-amine Chemical compound C1CN(C)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=CC=C1 PEXCQWULUILEAE-UHFFFAOYSA-N 0.000 description 1
- MMSACAMADRXBRY-UHFFFAOYSA-N 1-benzyl-n-[1-(2-phenoxyethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C=1C=CC=CC=1OCCN(CC1)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=CC=C1 MMSACAMADRXBRY-UHFFFAOYSA-N 0.000 description 1
- UJVNLHITHIQQET-UHFFFAOYSA-N 1-benzyl-n-[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1N1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC=CC=2)CC1 UJVNLHITHIQQET-UHFFFAOYSA-N 0.000 description 1
- LXIDSOCBAAMGJX-UHFFFAOYSA-N 1-benzylbenzimidazol-2-amine Chemical compound NC1=NC2=CC=CC=C2N1CC1=CC=CC=C1 LXIDSOCBAAMGJX-UHFFFAOYSA-N 0.000 description 1
- GCIAMHUVBWXLBI-UHFFFAOYSA-N 1-cyclopropyl-3-(2-nitrophenyl)-1-[1-(2-phenylethyl)piperidin-4-yl]thiourea Chemical compound [O-][N+](=O)C1=CC=CC=C1NC(=S)N(C1CCN(CCC=2C=CC=CC=2)CC1)C1CC1 GCIAMHUVBWXLBI-UHFFFAOYSA-N 0.000 description 1
- NWZPNLHRKQQSET-UHFFFAOYSA-N 1-methyl-n-(1-methylpiperidin-4-yl)benzimidazol-2-amine Chemical compound C1CN(C)CCC1NC1=NC2=CC=CC=C2N1C NWZPNLHRKQQSET-UHFFFAOYSA-N 0.000 description 1
- XVEGCHXSQSIOKO-UHFFFAOYSA-N 1-n-benzyl-4-chlorobenzene-1,2-diamine Chemical compound NC1=CC(Cl)=CC=C1NCC1=CC=CC=C1 XVEGCHXSQSIOKO-UHFFFAOYSA-N 0.000 description 1
- UCOSRTUSVXHIMK-UHFFFAOYSA-N 1h-benzimidazol-2-ylmethanamine Chemical class C1=CC=C2NC(CN)=NC2=C1 UCOSRTUSVXHIMK-UHFFFAOYSA-N 0.000 description 1
- FWOXSJRWBDTDBQ-UHFFFAOYSA-N 2-(4-benzylpiperidin-1-yl)-n,n-dimethylethanamine;hydrochloride Chemical compound Cl.C1CN(CCN(C)C)CCC1CC1=CC=CC=C1 FWOXSJRWBDTDBQ-UHFFFAOYSA-N 0.000 description 1
- ORTPEEDBOZIXNC-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethyl methanesulfonate Chemical compound COC1=CC=C(CCOS(C)(=O)=O)C=C1 ORTPEEDBOZIXNC-UHFFFAOYSA-N 0.000 description 1
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 1
- AVWGFHZLPMLKBL-UHFFFAOYSA-N 2-[(4-methoxyphenoxy)methyl]oxirane Chemical compound C1=CC(OC)=CC=C1OCC1OC1 AVWGFHZLPMLKBL-UHFFFAOYSA-N 0.000 description 1
- XPKHIAIQCJXUSN-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethanol;dihydrochloride Chemical compound Cl.Cl.C1CN(CCO)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 XPKHIAIQCJXUSN-UHFFFAOYSA-N 0.000 description 1
- JUMZPZOSZBGRGN-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl 4-methoxybenzoate Chemical compound C1=CC(OC)=CC=C1C(=O)OCCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 JUMZPZOSZBGRGN-UHFFFAOYSA-N 0.000 description 1
- JJFOBACUIRKUPN-UHFFFAOYSA-N 2-bromoethoxybenzene Chemical compound BrCCOC1=CC=CC=C1 JJFOBACUIRKUPN-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- BNJVETMIOJOROO-UHFFFAOYSA-N 2-n-[(4-fluorophenyl)methyl]benzene-1,2-diamine Chemical compound NC1=CC=CC=C1NCC1=CC=C(F)C=C1 BNJVETMIOJOROO-UHFFFAOYSA-N 0.000 description 1
- SMVKMUNFPNCOAV-UHFFFAOYSA-N 2-n-[(4-fluorophenyl)methyl]pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1NCC1=CC=C(F)C=C1 SMVKMUNFPNCOAV-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- HLPRKWVEMYDPAU-UHFFFAOYSA-N 2-thiophen-2-ylethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=CS1 HLPRKWVEMYDPAU-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- JETPDTHMMGQCJH-UHFFFAOYSA-N 3-[(4-fluorophenyl)methyl]-n-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=NC=CC=C2N=C1NC1CCNCC1 JETPDTHMMGQCJH-UHFFFAOYSA-N 0.000 description 1
- MOVQXBHLFPDFGF-UHFFFAOYSA-N 3-[3-[4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)amino]piperidin-1-yl]propyl]-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1CCCN(CC1)CCC1NC1=NC2=CC=CN=C2N1CC1=CC=CC=C1 MOVQXBHLFPDFGF-UHFFFAOYSA-N 0.000 description 1
- CBBNZMBVQOWVSM-UHFFFAOYSA-N 3-[3-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]-3-methylpiperidin-1-yl]propyl]-1H-benzimidazol-2-one Chemical compound CC1CN(CCCN2C(NC3=CC=CC=C32)=O)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 CBBNZMBVQOWVSM-UHFFFAOYSA-N 0.000 description 1
- RHRMQGVEXSPRLP-UHFFFAOYSA-N 3-[3-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-1h-benzimidazol-2-one Chemical compound C12=CC=CC=C2NC(=O)N1CCC(C)N(CC1)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 RHRMQGVEXSPRLP-UHFFFAOYSA-N 0.000 description 1
- DYGBZMJPKGAMNZ-UHFFFAOYSA-N 3-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]propanenitrile Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCC#N)CC1 DYGBZMJPKGAMNZ-UHFFFAOYSA-N 0.000 description 1
- LNDGOSQEAYHYMO-UHFFFAOYSA-N 3-benzyl-n-(1-cyclohexylpiperidin-4-yl)imidazo[4,5-b]pyridin-2-amine Chemical compound C1CN(C2CCCCC2)CCC1NC1=NC2=CC=CN=C2N1CC1=CC=CC=C1 LNDGOSQEAYHYMO-UHFFFAOYSA-N 0.000 description 1
- ZPIMMFWNOIMRTA-UHFFFAOYSA-N 3-benzyl-n-(1-methylpiperidin-4-yl)imidazo[4,5-b]pyridin-2-amine Chemical compound C1CN(C)CCC1NC1=NC2=CC=CN=C2N1CC1=CC=CC=C1 ZPIMMFWNOIMRTA-UHFFFAOYSA-N 0.000 description 1
- RTGYAXXEAUILHJ-UHFFFAOYSA-N 3-benzyl-n-(1-propan-2-ylpiperidin-4-yl)imidazo[4,5-b]pyridin-2-amine Chemical compound C1CN(C(C)C)CCC1NC1=NC2=CC=CN=C2N1CC1=CC=CC=C1 RTGYAXXEAUILHJ-UHFFFAOYSA-N 0.000 description 1
- JSVNULQGFAHAQB-UHFFFAOYSA-N 3-benzyl-n-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine Chemical compound C1CNCCC1NC1=NC2=CC=CN=C2N1CC1=CC=CC=C1 JSVNULQGFAHAQB-UHFFFAOYSA-N 0.000 description 1
- XFASJWLBXHWUMW-UHFFFAOYSA-N 3-prop-1-en-2-yl-1h-benzimidazol-2-one Chemical compound C1=CC=C2NC(=O)N(C(=C)C)C2=C1 XFASJWLBXHWUMW-UHFFFAOYSA-N 0.000 description 1
- UXVCBWNUXYJJCS-UHFFFAOYSA-N 4-(1H-benzimidazol-2-ylamino)piperidine-1-carboxylic acid Chemical compound C1CN(C(=O)O)CCC1NC1=NC2=CC=CC=C2N1 UXVCBWNUXYJJCS-UHFFFAOYSA-N 0.000 description 1
- LWAVAWLBKZPMSS-UHFFFAOYSA-N 4-(3-chloropropyl)-1,4-benzoxazin-3-one Chemical compound C1=CC=C2N(CCCCl)C(=O)COC2=C1 LWAVAWLBKZPMSS-UHFFFAOYSA-N 0.000 description 1
- FOJOPYHHJROLKM-UHFFFAOYSA-N 4-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-1-phenylcyclohexane-1-carbonitrile;dihydrochloride Chemical compound Cl.Cl.C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(C2CCC(CC2)(C#N)C=2C=CC=CC=2)CC1 FOJOPYHHJROLKM-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- XFSAECKEPGRRJY-UHFFFAOYSA-N CC1=CC=C(S(O)(=O)=O)C(CCC=2SC=CC=2)=C1 Chemical compound CC1=CC=C(S(O)(=O)=O)C(CCC=2SC=CC=2)=C1 XFSAECKEPGRRJY-UHFFFAOYSA-N 0.000 description 1
- WGKWSCWMYZKYOX-UHFFFAOYSA-N CNC1=NC2=CC=CC=C2N1C3CCN(CC3)CCC4=CC=CC=C4 Chemical compound CNC1=NC2=CC=CC=C2N1C3CCN(CC3)CCC4=CC=CC=C4 WGKWSCWMYZKYOX-UHFFFAOYSA-N 0.000 description 1
- GFUINNSIVRYGRT-UHFFFAOYSA-N COC1=C(C(=CC=C1)OC)OCC(CN2CCC(CC2)N(CC3=CC=C(C=C3)F)C4=NC5=CC=CC=C5N4)O Chemical compound COC1=C(C(=CC=C1)OC)OCC(CN2CCC(CC2)N(CC3=CC=C(C=C3)F)C4=NC5=CC=CC=C5N4)O GFUINNSIVRYGRT-UHFFFAOYSA-N 0.000 description 1
- ZBKZDXPQHHYWRP-GHMZBOCLSA-N C[C@@H]1CN(CC[C@H]1NC(=S)NC2=CC=CC=C2[N+](=O)[O-])C(=O)OC Chemical compound C[C@@H]1CN(CC[C@H]1NC(=S)NC2=CC=CC=C2[N+](=O)[O-])C(=O)OC ZBKZDXPQHHYWRP-GHMZBOCLSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 101100480904 Drosophila melanogaster tctn gene Proteins 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 101000919504 Gallus gallus Beta-crystallin B1 Proteins 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- JCMWSVNNSPUNER-UHFFFAOYSA-N N,O-dimethyltyramine Chemical compound CNCCC1=CC=C(OC)C=C1 JCMWSVNNSPUNER-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- RBNVYKQYFZYBBP-UHFFFAOYSA-N [1-(2-phenylethyl)piperidin-4-yl]thiourea Chemical compound C1(=CC=CC=C1)CCN1CCC(CC1)NC(=S)N RBNVYKQYFZYBBP-UHFFFAOYSA-N 0.000 description 1
- LNZSZWDBBNEULS-UHFFFAOYSA-N [4-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]phenyl] 4-methoxybenzoate Chemical compound C1=CC(OC)=CC=C1C(=O)OC(C=C1)=CC=C1CCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 LNZSZWDBBNEULS-UHFFFAOYSA-N 0.000 description 1
- UTRDIHDNZUULJM-UHFFFAOYSA-N [4-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]phenyl] n-butylcarbamate Chemical compound C1=CC(OC(=O)NCCCC)=CC=C1CCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 UTRDIHDNZUULJM-UHFFFAOYSA-N 0.000 description 1
- ZXRRHFSTAFVGOC-UHFFFAOYSA-N [AlH3].[K] Chemical compound [AlH3].[K] ZXRRHFSTAFVGOC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000003440 anti-fibrillation Effects 0.000 description 1
- PXWLUICTRPHECG-UHFFFAOYSA-N azane;trihydrochloride Chemical compound N.Cl.Cl.Cl PXWLUICTRPHECG-UHFFFAOYSA-N 0.000 description 1
- WJMOWGFGRONZPA-UHFFFAOYSA-N aziridin-1-yl-(4-fluorophenyl)methanone Chemical compound C1=CC(F)=CC=C1C(=O)N1CC1 WJMOWGFGRONZPA-UHFFFAOYSA-N 0.000 description 1
- 229960002526 bamipine Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- SPTWJKJTLZNWPT-UHFFFAOYSA-N benzyl [4-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]phenyl] carbonate Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCC=2C=CC(OC(=O)OCC=3C=CC=CC=3)=CC=2)CC1 SPTWJKJTLZNWPT-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- UCGFRIAOVLXVKL-UHFFFAOYSA-N benzylthiourea Chemical compound NC(=S)NCC1=CC=CC=C1 UCGFRIAOVLXVKL-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- ZDIGNSYAACHWNL-UHFFFAOYSA-N brompheniramine Chemical compound C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Br)C=C1 ZDIGNSYAACHWNL-UHFFFAOYSA-N 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N carbamic acid methyl ester Natural products COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- XEKAUTDWPYQNFU-UHFFFAOYSA-N chlorane Chemical compound Cl.Cl.Cl XEKAUTDWPYQNFU-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 229960001140 cyproheptadine Drugs 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- IMLIPHSGYFXWAA-UHFFFAOYSA-N ethyl 4-(1h-benzimidazol-2-ylamino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC2=CC=CC=C2N1 IMLIPHSGYFXWAA-UHFFFAOYSA-N 0.000 description 1
- GPUYTVOFCHCLIF-UHFFFAOYSA-N ethyl 4-(1h-benzimidazol-2-ylmethylamino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NCC1=NC2=CC=CC=C2N1 GPUYTVOFCHCLIF-UHFFFAOYSA-N 0.000 description 1
- QKPLFXBOWHKIQH-UHFFFAOYSA-N ethyl 4-(methylamino)piperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(NC)CC1 QKPLFXBOWHKIQH-UHFFFAOYSA-N 0.000 description 1
- ZAOMGYHUDNSBGG-UHFFFAOYSA-N ethyl 4-[(2-amino-4-fluorophenyl)carbamothioylamino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC(=S)NC1=CC=C(F)C=C1N ZAOMGYHUDNSBGG-UHFFFAOYSA-N 0.000 description 1
- YYJKMMJRYUPCOY-UHFFFAOYSA-N ethyl 4-[(2-aminophenyl)carbamothioyl-butylamino]piperidine-1-carboxylate Chemical compound C=1C=CC=C(N)C=1NC(=S)N(CCCC)C1CCN(C(=O)OCC)CC1 YYJKMMJRYUPCOY-UHFFFAOYSA-N 0.000 description 1
- MTAZKVTUGXRDSU-UHFFFAOYSA-N ethyl 4-[(2-aminophenyl)carbamothioylamino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC(=S)NC1=CC=CC=C1N MTAZKVTUGXRDSU-UHFFFAOYSA-N 0.000 description 1
- KPVJXULHVIULMI-UHFFFAOYSA-N ethyl 4-[(2-aminopyridin-3-yl)carbamothioylamino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC(=S)NC1=CC=CN=C1N KPVJXULHVIULMI-UHFFFAOYSA-N 0.000 description 1
- GOPHJAFXOPBEHA-UHFFFAOYSA-N ethyl 4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC2=CC=CN=C2N1CC1=CC=CC=C1 GOPHJAFXOPBEHA-UHFFFAOYSA-N 0.000 description 1
- BLQLBGJODBPYFR-UHFFFAOYSA-N ethyl 4-[(6-chloro-1h-benzimidazol-2-yl)amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC2=CC(Cl)=CC=C2N1 BLQLBGJODBPYFR-UHFFFAOYSA-N 0.000 description 1
- GDEBHSGKCAZXEQ-UHFFFAOYSA-N ethyl 4-[(6-fluoro-1h-benzimidazol-2-yl)amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC2=CC(F)=CC=C2N1 GDEBHSGKCAZXEQ-UHFFFAOYSA-N 0.000 description 1
- SHESZUAEWMVGSW-UHFFFAOYSA-N ethyl 4-[(6-methyl-1h-benzimidazol-2-yl)amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC2=CC(C)=CC=C2N1 SHESZUAEWMVGSW-UHFFFAOYSA-N 0.000 description 1
- WUFBIABUUNHTCX-UHFFFAOYSA-N ethyl 4-[4-(1h-benzimidazol-2-yl)butylamino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NCCCCC1=NC2=CC=CC=C2N1 WUFBIABUUNHTCX-UHFFFAOYSA-N 0.000 description 1
- KMMCSHWHRVGLMQ-UHFFFAOYSA-N ethyl 4-[[1-(4-fluorophenyl)benzimidazol-2-yl]amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC2=CC=CC=C2N1C1=CC=C(F)C=C1 KMMCSHWHRVGLMQ-UHFFFAOYSA-N 0.000 description 1
- NEEZBYBEZAVOAT-UHFFFAOYSA-N ethyl 4-[[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC2=CC(C(F)(F)F)=CC=C2N1CC1=CC=CC=C1 NEEZBYBEZAVOAT-UHFFFAOYSA-N 0.000 description 1
- LVHHBTGUEJXOKO-UHFFFAOYSA-N ethyl 4-[[2-(4-fluoroanilino)phenyl]carbamothioylamino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC(=S)NC1=CC=CC=C1NC1=CC=C(F)C=C1 LVHHBTGUEJXOKO-UHFFFAOYSA-N 0.000 description 1
- LJNLGAGAEVATKJ-UHFFFAOYSA-N ethyl 4-[[2-(benzylamino)-5-(trifluoromethyl)anilino]-methanethioylamino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1N(C=S)NC1=CC(C(F)(F)F)=CC=C1NCC1=CC=CC=C1 LJNLGAGAEVATKJ-UHFFFAOYSA-N 0.000 description 1
- APGYQNWJFFQIJP-UHFFFAOYSA-N ethyl 4-[butyl-[(2-nitrophenyl)carbamothioyl]amino]piperidine-1-carboxylate Chemical compound C=1C=CC=C([N+]([O-])=O)C=1NC(=S)N(CCCC)C1CCN(C(=O)OCC)CC1 APGYQNWJFFQIJP-UHFFFAOYSA-N 0.000 description 1
- BARZVJDQYOGGEY-UHFFFAOYSA-N ethyl 4-[methyl-[(2-nitrophenyl)carbamothioyl]amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1N(C)C(=S)NC1=CC=CC=C1[N+]([O-])=O BARZVJDQYOGGEY-UHFFFAOYSA-N 0.000 description 1
- GQQQULCEHJQUJT-UHFFFAOYSA-N ethyl 4-aminopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(N)CC1 GQQQULCEHJQUJT-UHFFFAOYSA-N 0.000 description 1
- LUBGFMZTGFXIIN-UHFFFAOYSA-N ethyl 4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)CC1 LUBGFMZTGFXIIN-UHFFFAOYSA-N 0.000 description 1
- YSPVHAUJXLGZHP-UHFFFAOYSA-N ethyl piperidine-1-carboxylate Chemical class CCOC(=O)N1CCCCC1 YSPVHAUJXLGZHP-UHFFFAOYSA-N 0.000 description 1
- IFYLVUHLOOCYBG-UHFFFAOYSA-N eticyclidine Chemical compound C=1C=CC=CC=1C1(NCC)CCCCC1 IFYLVUHLOOCYBG-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- UUBJKHVFGWGJKX-UHFFFAOYSA-N hydrate tetrahydrochloride Chemical compound O.Cl.Cl.Cl.Cl UUBJKHVFGWGJKX-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- YCDPBTSAQFQAOG-UHFFFAOYSA-N methyl 4-(1h-benzimidazol-2-ylamino)-3-methylpiperidine-1-carboxylate Chemical compound CC1CN(C(=O)OC)CCC1NC1=NC2=CC=CC=C2N1 YCDPBTSAQFQAOG-UHFFFAOYSA-N 0.000 description 1
- IEGKYTVBMCRSHJ-UHFFFAOYSA-N methyl 4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]-3-methylpiperidine-1-carboxylate Chemical compound CC1CN(C(=O)OC)CCC1NC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 IEGKYTVBMCRSHJ-UHFFFAOYSA-N 0.000 description 1
- CXHHBNMLPJOKQD-UHFFFAOYSA-M methyl carbonate Chemical compound COC([O-])=O CXHHBNMLPJOKQD-UHFFFAOYSA-M 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 1
- RXEDATWQBKXUNH-UHFFFAOYSA-N n,1-dibenzyl-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C1CC(N(CC=2C=CC=CC=2)C=2N(C3=CC=CC=C3N=2)CC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 RXEDATWQBKXUNH-UHFFFAOYSA-N 0.000 description 1
- NTQFSYCNLNWKED-UHFFFAOYSA-N n-(1-cyclohexylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(C2CCCCC2)CC1 NTQFSYCNLNWKED-UHFFFAOYSA-N 0.000 description 1
- AIAAAKULVUIAJT-UHFFFAOYSA-N n-(1-methylpiperidin-4-yl)-1-phenylbenzimidazol-2-amine Chemical compound C1CN(C)CCC1NC1=NC2=CC=CC=C2N1C1=CC=CC=C1 AIAAAKULVUIAJT-UHFFFAOYSA-N 0.000 description 1
- QXEIPXZZVSYYKU-UHFFFAOYSA-N n-[1-(2-phenylethyl)piperidin-4-yl]-n-propan-2-yl-1h-benzimidazol-2-amine Chemical compound N=1C2=CC=CC=C2NC=1N(C(C)C)C(CC1)CCN1CCC1=CC=CC=C1 QXEIPXZZVSYYKU-UHFFFAOYSA-N 0.000 description 1
- PZYLEZXDWSQMAI-UHFFFAOYSA-N n-[1-(2-phenylethyl)piperidin-4-yl]-n-propyl-1h-benzimidazol-2-amine Chemical compound N=1C2=CC=CC=C2NC=1N(CCC)C(CC1)CCN1CCC1=CC=CC=C1 PZYLEZXDWSQMAI-UHFFFAOYSA-N 0.000 description 1
- NORHEQUXRGEKPS-UHFFFAOYSA-N n-[1-[2-(1h-benzimidazol-2-ylamino)ethyl]piperidin-4-yl]-1-[(4-fluorophenyl)methyl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCNC=2NC3=CC=CC=C3N=2)CC1 NORHEQUXRGEKPS-UHFFFAOYSA-N 0.000 description 1
- NUJYKVDVUYYGQC-UHFFFAOYSA-N n-[1-[2-(dibenzylamino)ethyl]piperidin-4-yl]-1-[(4-fluorophenyl)methyl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1NC1CCN(CCN(CC=2C=CC=CC=2)CC=2C=CC=CC=2)CC1 NUJYKVDVUYYGQC-UHFFFAOYSA-N 0.000 description 1
- FTYLPBZGFLTPHT-UHFFFAOYSA-N n-benzyl-1-[(2-chlorophenyl)methyl]-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound ClC1=CC=CC=C1CN1C2=CC=CC=C2N=C1N(C1CCN(CCC=2C=CC=CC=2)CC1)CC1=CC=CC=C1 FTYLPBZGFLTPHT-UHFFFAOYSA-N 0.000 description 1
- BRAJXEKWXWWLEG-UHFFFAOYSA-N n-benzyl-1-[(2-methoxyphenyl)methyl]-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound COC1=CC=CC=C1CN1C2=CC=CC=C2N=C1N(C1CCN(CCC=2C=CC=CC=2)CC1)CC1=CC=CC=C1 BRAJXEKWXWWLEG-UHFFFAOYSA-N 0.000 description 1
- KHPMFONMQZYCMG-UHFFFAOYSA-N n-benzyl-1-[(4-fluorophenyl)methyl]-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1N(C1CCN(CCC=2C=CC=CC=2)CC1)CC1=CC=CC=C1 KHPMFONMQZYCMG-UHFFFAOYSA-N 0.000 description 1
- ASEUGHCETOYURJ-UHFFFAOYSA-N n-benzyl-1-[(4-methylphenyl)methyl]-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound C1=CC(C)=CC=C1CN1C2=CC=CC=C2N=C1N(C1CCN(CCC=2C=CC=CC=2)CC1)CC1=CC=CC=C1 ASEUGHCETOYURJ-UHFFFAOYSA-N 0.000 description 1
- MDDAUMFFPCLRQD-UHFFFAOYSA-N n-benzyl-1-ethyl-n-[1-(2-phenylethyl)piperidin-4-yl]benzimidazol-2-amine Chemical compound N=1C2=CC=CC=C2N(CC)C=1N(C1CCN(CCC=2C=CC=CC=2)CC1)CC1=CC=CC=C1 MDDAUMFFPCLRQD-UHFFFAOYSA-N 0.000 description 1
- FXMPPQGQNSTUGE-UHFFFAOYSA-N n-benzyl-1h-benzimidazol-2-amine Chemical class N=1C2=CC=CC=C2NC=1NCC1=CC=CC=C1 FXMPPQGQNSTUGE-UHFFFAOYSA-N 0.000 description 1
- QGGSAXFVVSPELW-UHFFFAOYSA-N n-benzyl-n-[1-(2-phenylethyl)piperidin-4-yl]-1h-benzimidazol-2-amine Chemical compound C1CC(N(CC=2C=CC=CC=2)C=2NC3=CC=CC=C3N=2)CCN1CCC1=CC=CC=C1 QGGSAXFVVSPELW-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- JGWUVCVDDDKXLW-UHFFFAOYSA-N n-cyclopropyl-n-[1-(2-phenylethyl)piperidin-4-yl]-1h-benzimidazol-2-amine Chemical compound C1CC(N(C2CC2)C=2NC3=CC=CC=C3N=2)CCN1CCC1=CC=CC=C1 JGWUVCVDDDKXLW-UHFFFAOYSA-N 0.000 description 1
- UQYJDWQGPULEOJ-UHFFFAOYSA-N n-ethyl-n-[1-(2-phenylethyl)piperidin-4-yl]-1h-benzimidazol-2-amine Chemical compound N=1C2=CC=CC=C2NC=1N(CC)C(CC1)CCN1CCC1=CC=CC=C1 UQYJDWQGPULEOJ-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IXQGCWUGDFDQMF-UHFFFAOYSA-N o-Hydroxyethylbenzene Natural products CCC1=CC=CC=C1O IXQGCWUGDFDQMF-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229940075559 piperine Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- ZZYXNRREDYWPLN-UHFFFAOYSA-N pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1N ZZYXNRREDYWPLN-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/54—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/26—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/34—1,4-Oxazines; Hydrogenated 1,4-oxazines condensed with carbocyclic rings
- C07D265/36—1,4-Oxazines; Hydrogenated 1,4-oxazines condensed with carbocyclic rings condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK083183A DK171841B1 (da) | 1978-04-03 | 1983-02-24 | N-hetero-cyclyl-4-piperidinaminer |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US89253478A | 1978-04-03 | 1978-04-03 | |
| US89253478 | 1978-04-03 | ||
| US06/002,276 US4219559A (en) | 1979-01-10 | 1979-01-10 | N-Heterocyclyl-4-piperidinamines |
| US227679 | 1979-01-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK129879A DK129879A (da) | 1979-10-04 |
| DK169325B1 true DK169325B1 (da) | 1994-10-10 |
Family
ID=26670178
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK129879A DK169325B1 (da) | 1978-04-03 | 1979-03-29 | Analogifremgangsmåde til fremstilling af N-heterocyclyl-4-piperidinaminer |
Country Status (29)
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MA19091A1 (fr) * | 1980-03-10 | 1981-10-01 | Janssen Pharmaceutica Nv | Nouveaux derives de i-(4-aryl-cyclohexyl)piperidine . |
| IN156065B (cg-RX-API-DMAC7.html) * | 1982-07-12 | 1985-05-04 | Janssen Pharmaceutica Nv | |
| US4556660A (en) * | 1982-07-12 | 1985-12-03 | Janssen Pharmaceutica N.V. | N-(Bicyclic heterocyclyl)-4-piperidinamines |
| US4634704A (en) * | 1983-10-06 | 1987-01-06 | Janssen Pharmaceutica, N.V. | Anti-allergic five membered heterocyclic ring containing N-(bicyclic heterocycyl)-4-piperidinamines |
| DE3484096D1 (de) * | 1983-11-30 | 1991-03-14 | Janssen Pharmaceutica Nv | Bizyklisches heterozyklyl aufveisende n-(bizyklisches heterozyklyl-4-piperidinamine. |
| PL144514B1 (en) * | 1984-01-09 | 1988-06-30 | Janssen Pharmaceutica Nv | Method of obtaining novel derivatives of n-/4-piperidinolo/-2-imidazoloamine |
| KR930005004B1 (ko) * | 1985-04-15 | 1993-06-11 | 쟈안센 파아마슈우티카 엔. 부이. | 치환된 n-[(4-피페리디닐)알킬]이환 축합 옥사졸아민 및 티아졸아민의 제조방법 |
| GB8515934D0 (en) * | 1985-06-24 | 1985-07-24 | Janssen Pharmaceutica Nv | (4-piperidinomethyl and-hetero)purines |
| EG17993A (en) * | 1986-02-03 | 1991-08-30 | Janssen Pharmaceutica Nv | Anti-histaminic compositions containing n-heterocyclyl-4-piperidinanines |
| NZ223654A (en) * | 1987-03-09 | 1990-03-27 | Janssen Pharmaceutica Nv | 1-alkyl-substituted-benzimidazole-4-piperidinamines and pharmaceutical compositions |
| FR2618435B1 (fr) * | 1987-07-23 | 1989-10-27 | Synthelabo | Derives de benzimidazole, leur preparation et leur application en therapeutique |
| US5210091A (en) * | 1991-06-24 | 1993-05-11 | Neurosearch A/S | Imidazole compounds and their use |
| US5624948A (en) * | 1993-05-20 | 1997-04-29 | Kissei Pharmaceutical Co., Ltd. | 1-(2-benzimidazolyl)-1,5-diazacyclooctane compounds |
| US5547966A (en) * | 1993-10-07 | 1996-08-20 | Bristol-Myers Squibb Company | Aryl urea and related compounds |
| JP2002505277A (ja) * | 1998-03-06 | 2002-02-19 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | グリシン輸送阻害剤 |
| HRP20080390A2 (en) * | 1999-06-28 | 2008-12-31 | Janssen Pharmaceutica N.V. | Respiratory syncytial virus replication inhibitors |
| AU779516B2 (en) | 1999-06-28 | 2005-01-27 | Janssen Pharmaceutica N.V. | Respiratory syncytial virus replication inhibitors |
| AU778218B2 (en) | 1999-06-28 | 2004-11-25 | Janssen Pharmaceutica N.V. | Respiratory syncytial virus replication inhibitors |
| ATE348808T1 (de) | 2000-03-06 | 2007-01-15 | Acadia Pharm Inc | Azacyclische verbindungen zur verwendung in der behandlung von mit serotonin verwandten krankheiten |
| CZ20032351A3 (cs) | 2001-02-02 | 2004-08-18 | Tevaápharmaceuticaláindustriesáltd | Způsob výroby substituovaných @@}@@pyridylmethylB sulfinyl @�H@benzimidazolů |
| US6911452B2 (en) | 2001-12-28 | 2005-06-28 | Acadia Pharmaceuticals Inc. | Spiroazacyclic compounds as monoamine receptor modulators |
| IL163666A0 (en) | 2002-02-22 | 2005-12-18 | New River Pharmaceuticals Inc | Active agent delivery systems and methods for protecting and administering active agents |
| US7253186B2 (en) | 2002-06-24 | 2007-08-07 | Carl-Magnus Andersson | N-substituted piperidine derivatives as serotonin receptor agents |
| US7538222B2 (en) | 2002-06-24 | 2009-05-26 | Acadia Pharmaceuticals, Inc. | N-substituted piperidine derivatives as serotonin receptor agents |
| AU2003247615B2 (en) | 2002-06-24 | 2007-08-09 | Acadia Pharmaceuticals Inc. | N-substituted piperidine derivatives as serotonin receptor agents |
| NZ541146A (en) | 2003-01-16 | 2009-04-30 | Acadia Pharm Inc | N-(1-methylpiperidin-4-yl)-N-(4-fluorophenylmethyl)-N'-(4-(2-methylpropyloxy)phenylmethyl)carbamide, also known as ACP-103, and its tartrate salt as therapeutics for neurodegenerative diseases |
| PT1697343E (pt) | 2003-12-18 | 2009-09-16 | Tibotec Pharm Ltd | Aminobenzimidazolos e benzimidazolos como inibidores da replicação do vírus sincicial respiratório |
| RU2369606C2 (ru) | 2003-12-18 | 2009-10-10 | Тиботек Фармасьютикалз Лтд. | Производные 5- или 6-замещенных бензимидазолов в качестве ингибиторов репликации респираторного синцитиального вируса |
| AR046771A1 (es) * | 2003-12-18 | 2005-12-21 | Tibotec Pharm Ltd | Derivados piperidina-amino-bencimidazol como inhibidores de la replicacion del virus sincitial respiratorio |
| US7820695B2 (en) | 2004-05-21 | 2010-10-26 | Acadia Pharmaceuticals, Inc. | Selective serotonin receptor inverse agonists as therapeutics for disease |
| US20050261278A1 (en) | 2004-05-21 | 2005-11-24 | Weiner David M | Selective serotonin receptor inverse agonists as therapeutics for disease |
| US7868176B2 (en) | 2004-09-27 | 2011-01-11 | Acadia Pharmaceuticals, Inc. | Salts of N-(4-fluorobenzyl)-N-(1-methylpiperidin-4-y1)-N′-(4-(2-methylpropyloxy)phenylmethyl)carbamide and their preparation |
| US7790899B2 (en) | 2004-09-27 | 2010-09-07 | Acadia Pharmaceuticals, Inc. | Synthesis of N-(4-fluorobenzyl)-N-(1-methylpiperidin-4-yl)-N′-(4-(2-methylpropyloxy)phenylmethyl)carbamide and its tartrate salt and crystalline forms |
| CN101677971A (zh) | 2007-03-19 | 2010-03-24 | 阿卡蒂亚药品公司 | 5-ht2a反向激动剂和拮抗剂与抗精神病药物的组合 |
| JP6850282B2 (ja) | 2015-07-20 | 2021-03-31 | アカディア ファーマシューティカルズ インコーポレーテッド | N−(4−フルオロベンジル)−n−(1−メチルピペリジン−4−イル)−n’−(4−(2−メチルプロピルオキシ)フェニルメチル)カルバミドならびにその酒石酸塩および多形形態cを調製する方法 |
| US10953000B2 (en) | 2016-03-25 | 2021-03-23 | Acadia Pharmaceuticals Inc. | Combination of pimavanserin and cytochrome P450 modulators |
| WO2017165635A1 (en) | 2016-03-25 | 2017-09-28 | Acadia Pharmaceuticals Inc. | Combination of pimavanserin and cytochrome p450 modulators |
| EP3558311A1 (en) | 2016-12-20 | 2019-10-30 | Acadia Pharmaceuticals Inc. | Pimavanserin alone or in combination for use in the treatment of alzheimer's disease psychosis |
| US11135211B2 (en) | 2017-04-28 | 2021-10-05 | Acadia Pharmaceuticals Inc. | Pimavanserin for treating impulse control disorder |
| EP3675827A1 (en) | 2017-08-30 | 2020-07-08 | Acadia Pharmaceuticals Inc. | Formulations of pimavanserin |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2857391A (en) * | 1955-04-15 | 1958-10-21 | Merck & Co Inc | Aminomethylbenzimidazoles |
| US2971005A (en) * | 1958-10-17 | 1961-02-07 | Merck & Co Inc | Nu-substituted derivatives of 2-benzylaminobenzimidazoles |
| BE788065A (fr) * | 1971-08-26 | 1973-02-26 | Degussa | Nouvelles aza-benzimidazoles et procede pour leur preparation |
-
1979
- 1979-03-19 CA CA000323763A patent/CA1140119A/en not_active Expired
- 1979-03-21 AU AU45296/79A patent/AU523352B2/en not_active Expired
- 1979-03-23 NZ NZ189978A patent/NZ189978A/en unknown
- 1979-03-29 GR GR58721A patent/GR64907B/el unknown
- 1979-03-29 DK DK129879A patent/DK169325B1/da not_active IP Right Cessation
- 1979-03-30 EP EP79300525A patent/EP0005318B1/en not_active Expired
- 1979-03-30 DE DE7979300525T patent/DE2961740D1/de not_active Expired
- 1979-03-30 RO RO7997082A patent/RO79320A/ro unknown
- 1979-03-30 CY CY1250A patent/CY1250A/xx unknown
- 1979-04-01 EG EG200/79A patent/EG13913A/xx active
- 1979-04-02 ES ES479206A patent/ES479206A1/es not_active Expired
- 1979-04-02 AT AT0242579A patent/AT373887B/de not_active IP Right Cessation
- 1979-04-02 IL IL56992A patent/IL56992A/xx unknown
- 1979-04-02 NO NO791097A patent/NO154058C/no unknown
- 1979-04-02 ZA ZA791557A patent/ZA791557B/xx unknown
- 1979-04-02 JP JP3844779A patent/JPS54151982A/ja active Granted
- 1979-04-02 CS CS792227A patent/CS256358B2/cs unknown
- 1979-04-02 FI FI791084A patent/FI64801C/fi not_active IP Right Cessation
- 1979-04-03 YU YU784/79A patent/YU42484B/xx unknown
- 1979-04-03 HU HU79JA841A patent/HU182965B/hu unknown
- 1979-04-03 SU SU792747000A patent/SU1056902A3/ru active
- 1979-04-03 PH PH22344A patent/PH15877A/en unknown
- 1979-04-03 PT PT69429A patent/PT69429A/pt unknown
- 1979-04-03 BG BG043114A patent/BG38164A3/xx unknown
- 1979-04-03 PL PL1979214648A patent/PL123380B1/pl unknown
- 1979-08-08 IE IE676/79A patent/IE47818B1/en not_active IP Right Cessation
-
1983
- 1983-03-02 YU YU502/83A patent/YU43158B/xx unknown
- 1983-05-26 SG SG298/83A patent/SG29883G/en unknown
-
1984
- 1984-01-12 HK HK31/84A patent/HK3184A/en not_active IP Right Cessation
- 1984-06-25 NO NO842563A patent/NO154090C/no unknown
-
1985
- 1985-12-30 MY MY46/85A patent/MY8500046A/xx unknown
-
1988
- 1988-06-14 JP JP63144898A patent/JPH01117880A/ja active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK169325B1 (da) | Analogifremgangsmåde til fremstilling af N-heterocyclyl-4-piperidinaminer | |
| KR830000677B1 (ko) | 신규 n-헤테로 싸이클-4-피페리딘아민의 제조 방법 | |
| DK173674B1 (da) | Anti-allergiske præparater indeholdende N-heterocyclyl-4-piperidinaminer, N-heterocyclyl-4-piperidinaminer til brug som antiallergikum og hidtil ukendte N-heterocyclyl-4-piperidinaminer samt fremgangsmåde til fremstilling deraf | |
| AU621461B2 (en) | 4,5,6-Substituted-N-(substituted-phenyl)-2-pyrimidinamines | |
| SU1297728A3 (ru) | Способ получени @ -гетероциклил-4-пиперидинаминов или их фармацевтически приемлемых солей | |
| FI77231B (fi) | Analogifoerfarande foer framstaellning av piperidinderivat som aer anvaendbara som antidepsessiva medel. | |
| PT2364975E (pt) | Novo derivado de amida e sua utilização como medicamento | |
| US4835161A (en) | Anti-histaminic compositions containing n-heterocyclyl-4-piperidinamines | |
| CA2797230C (en) | Novel amide derivative and use thereof as medicine | |
| PL127679B1 (en) | Process for preparing novel derivatives of 1-/cyclohexyl/-4-aryl-4-piperidinecarboxylic acid | |
| CH634317A5 (en) | Process for preparing piperazine and piperidine derivatives | |
| DK151017B (da) | Analogifremgangsmaade til fremstiiling af substituerede n-(4-indolyl-piperidino-alkyl)-benzimidazoloner eller fysiologisk acceptable syreadditionssalte deraf | |
| FI80448C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara piperazinkarboxamidderivat. | |
| JPH01228986A (ja) | [(5(6)(1h―アゾール―1―イルメチル)ベンズイミダゾール]カーバメート | |
| JP2008526895A (ja) | ヒスタミンh3アンタゴニストとして有用なイミダゾールおよびベンゾイミダゾール誘導体 | |
| DK171841B1 (da) | N-hetero-cyclyl-4-piperidinaminer | |
| IT8247807A1 (it) | 2,1,3-benzotiadiazoli e 2,1,3,-benzossadiazoli, loro preparazione e loro applicazione come medicamenti | |
| CA2072598A1 (en) | Pharmaceutical compositions | |
| PL147092B1 (en) | Process for preparing novel n-/bicycloheterocyclo/-4-piperidinamines | |
| US4806552A (en) | Pyridyl- and/or pyridoyl-(piperid-4-yl) ureas and analogues thereof | |
| KR102447231B1 (ko) | 설폰아미드 유도체 및 이를 유효성분으로 함유하는 정신질환의 예방 또는 치료용 약학적 조성물 | |
| AU2011246095B8 (en) | Novel amide derivative and use thereof as medicine | |
| GB2108489A (en) | Pharmaceutical composition comprising piperidene derivatives | |
| JPS6230990B2 (cg-RX-API-DMAC7.html) | ||
| PL145710B1 (en) | Method of obtaining novel bicyclic piperidine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| B1 | Patent granted (law 1993) | ||
| PUP | Patent expired |