DET0007243MA - - Google Patents
Info
- Publication number
- DET0007243MA DET0007243MA DET0007243MA DE T0007243M A DET0007243M A DE T0007243MA DE T0007243M A DET0007243M A DE T0007243MA
- Authority
- DE
- Germany
- Prior art keywords
- pyridyl
- alkyl
- derivatives
- oxy
- aryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000002989 phenols Chemical class 0.000 claims description 9
- -1 pyridine aldehydes Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 150000001622 bismuth compounds Chemical class 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 2
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- 210000004072 lung Anatomy 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 238000003756 stirring Methods 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical class O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- UMPUOBVJIYWOAX-UHFFFAOYSA-N 2-(diethoxymethyl)-6-methylpyridine Chemical compound CCOC(OCC)C1=CC=CC(C)=N1 UMPUOBVJIYWOAX-UHFFFAOYSA-N 0.000 description 1
- XLUOFXTXCUVLFJ-UHFFFAOYSA-N 2-(diethoxymethyl)pyridine Chemical compound CCOC(OCC)C1=CC=CC=N1 XLUOFXTXCUVLFJ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- QPOWUYJWCJRLEE-UHFFFAOYSA-N dipyridin-2-ylmethanone Chemical compound C=1C=CC=NC=1C(=O)C1=CC=CC=N1 QPOWUYJWCJRLEE-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008141 laxative Substances 0.000 description 1
- 229940125722 laxative agent Drugs 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3429949A1 (de) | Neue nicht -ionische 2,4,6-trijod-isophthalsaeure-bis-amide, verfahren zu ihrer herstellung und ihre verwendung als roentgenkontrastmittel | |
| DE1445186C3 (de) | 3,3'-Di-2-imidazolin-2-yl-carbanilid | |
| DET0007243MA (enrdf_load_stackoverflow) | ||
| DE956755C (de) | Verfahren zur Herstellung von Di-(4-oxy-phenyl)-pyridyl-methanen oder ihren O-Acyl- oder O-Alkyl-derivaten | |
| DE947164C (de) | Verfahren zur Herstellung von in 3-Stellung substituierten 4-Oxycumarinen | |
| DE1670583A1 (de) | Neue Piperidinderivate | |
| DE870857C (de) | Verfahren zur Herstellung monohalogenierter 1, 3-Dioxane | |
| DE951987C (de) | Verfahren zur Herstellung von Di-(4'-oxy-phenyl)-pyridyl-methanen oder deren O-Acyl-oder O-Alkyl-derivaten | |
| DE1301817B (de) | Verfahren zur Herstellung von in 5-Stellung substituierten 2-Benzolsulfonamidopyrimidinen | |
| DE2335854A1 (de) | Verfahren zur gewinnung von hochreinem 2,2,4-trimethyl-4-(4-hydroxyphenyl)-chroman | |
| DE805523C (de) | Verfahren zur Herstellung von Histaminen | |
| DE855119C (de) | Verfahren zur Herstellung von Salzen der Ester aus N-substituierten Aminoalkanolen und substituierter oder unsubstituierter p-Aminobenzoesaeure | |
| DE912209C (de) | Verfahren zur Herstellung von 1, 3, 5-Triacetylbenzol | |
| DE280225C (enrdf_load_stackoverflow) | ||
| DE623450C (enrdf_load_stackoverflow) | ||
| DE103581C (de) | verfahren zur darstellung monomolekularer Saeurederivate des eugenols und isoeugenols | |
| AT151657B (de) | Verfahren zur Darstellung von Formaldehydnatriumsulfoxylaten von Arsenobenzolverbindungen. | |
| AT228222B (de) | Verfahren zur Herstellung von neuen 4,4'-disubstituierten Diphenylsulfonen | |
| DE1545652C (de) | 3-(alpha-Hydroxyäthyl)-6-chlor-7sulfamyl-1,2,4-benzothiadiazin-1,1 dioxyd | |
| DE1271667B (de) | Verfahren zum Widerstandsfaehigmachen von Textilien aus Cellulose gegenueber Mikroorganismen | |
| DE1468388C (de) | Verfahren zur Herstellung von N Aryl thiocarbamaten | |
| AT319960B (de) | Verfahren zur Herstellung von neuen Pyridazinverbindungen | |
| DE310967C (enrdf_load_stackoverflow) | ||
| DE839938C (de) | Verfahren zur Herstellung neuer Dialkylamide von alkoxysubstituierten Benzoesaeuren | |
| DE1001990B (de) | Verfahren zur Herstellung von Pyrimidinderivaten |