DESC014824MA - - Google Patents
Info
- Publication number
- DESC014824MA DESC014824MA DESC014824MA DE SC014824M A DESC014824M A DE SC014824MA DE SC014824M A DESC014824M A DE SC014824MA
- Authority
- DE
- Germany
- Prior art keywords
- tetrachlorobenzene
- hexachlorobenzene
- mixture
- pentachlorophenol
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- GBDZXPJXOMHESU-UHFFFAOYSA-N 1,2,3,4-tetrachlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1Cl GBDZXPJXOMHESU-UHFFFAOYSA-N 0.000 claims description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 15
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 10
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VGVRPFIJEJYOFN-UHFFFAOYSA-N 2,3,4,6-tetrachlorophenol Chemical class OC1=C(Cl)C=C(Cl)C(Cl)=C1Cl VGVRPFIJEJYOFN-UHFFFAOYSA-N 0.000 description 1
- HSQFVBWFPBKHEB-UHFFFAOYSA-N 2,3,4-trichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1Cl HSQFVBWFPBKHEB-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N gamma-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- HCJLVWUMMKIQIM-UHFFFAOYSA-M sodium;2,3,4,5,6-pentachlorophenolate Chemical compound [Na+].[O-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl HCJLVWUMMKIQIM-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DESC014824MA (enExample) | ||
| DE1279024B (de) | Verfahren zur Herstellung von Trichlorphenol | |
| DE1132113B (de) | Verfahren zur Reinigung von Vanillin | |
| DE851194C (de) | Verfahren zur Herstellung von monomerem ªŠ-Caprolactam | |
| DE1088063B (de) | Verfahren zur Rueckgewinnung von Dicarbonsaeuren und Diaminen aus Polyamiden | |
| DE860637C (de) | Verfahren zur Herstellung schwefelhaltiger cyclischer organischer Verbindungen | |
| DE920789C (de) | Verfahren zur Reinigung von Adipinsaeuredinitril | |
| DE1210807B (de) | Verfahren zur Reinigung von mit Formaldehyd verunreinigten Butin-2-diol-(1, 4) | |
| DE909810C (de) | Verfahren zur Herstellung von Cholrphenolen | |
| DE1235924B (de) | Verfahren zur Rueckgewinnung von Lactamen aus Polyamiden | |
| DE2135085B2 (de) | Verfahren zur wiedergewinnung von caprolactam aus einem gemisch, das caprolactam und dessen oligomere enthaelt | |
| DE1002339C2 (de) | Verfahren zur Aufarbeitung des bei der Oxydation von technischem trans-Dekahydronaphthalin gebildeten Reaktionsgemisches | |
| DE641675C (de) | Verfahren zur Herstellung von Oxyarylaminophenanthrenverbindungen | |
| DE878653C (de) | Verfahren zur Herstellung von Diphenylaether-4, 4'-diacetonitril | |
| DE576388C (de) | Verfahren zur Darstellung von Camphen | |
| AT162892B (de) | Verfahren zur Herstellung von Hexachlorcyclohexan von niedrigem Schmelzpunkt | |
| DE1543678C (de) | Verfahren zum Herstellen von p Hydroxy benzoesäure | |
| DE956680C (de) | Verfahren zur Reinigung von Terephthalsaeure | |
| DE741322C (de) | Verfahren zur Herstellung von Lactamen aus Oximen cyclischer Ketone | |
| DE740445C (de) | Verfahren zur Herstellung von p,p-Diaminodiphenylsulfon | |
| DE943886C (de) | Verfahren zur Reinigung von m-Kresol | |
| DE614194C (de) | Verfahren zum Reinigen von Cumarin | |
| AT162590B (de) | Verfahren zur Herstellung von Ortho-Tolyl-Äthern | |
| DE744755C (de) | Verfahren zur Reinigung von Milchsaeure | |
| DE730788C (de) | Verfahren zur Gewinnung von Phenanthridin aus Steinkohlenteer |