DEP0009939MA - - Google Patents
Info
- Publication number
- DEP0009939MA DEP0009939MA DEP0009939MA DE P0009939M A DEP0009939M A DE P0009939MA DE P0009939M A DEP0009939M A DE P0009939MA
- Authority
- DE
- Germany
- Prior art keywords
- insecticide
- water
- head
- liquid
- therapeutic effect
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002917 insecticide Substances 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 239000007787 solid Substances 0.000 claims description 9
- 239000007788 liquid Substances 0.000 claims description 8
- 239000002689 soil Substances 0.000 claims description 7
- 230000001225 therapeutic effect Effects 0.000 claims description 7
- ZOMBKNNSYQHRCA-UHFFFAOYSA-J calcium sulfate hemihydrate Chemical compound O.[Ca+2].[Ca+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZOMBKNNSYQHRCA-UHFFFAOYSA-J 0.000 claims description 6
- 239000011248 coating agent Substances 0.000 claims description 6
- 238000000576 coating method Methods 0.000 claims description 6
- 239000004033 plastic Substances 0.000 claims description 6
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 5
- 239000011507 gypsum plaster Substances 0.000 claims description 5
- 239000001913 cellulose Substances 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 4
- 108010010803 Gelatin Proteins 0.000 claims description 2
- UOSHUBFBCPGQAY-UHFFFAOYSA-N Mipafox Chemical compound CC(C)NP(F)(=O)NC(C)C UOSHUBFBCPGQAY-UHFFFAOYSA-N 0.000 claims description 2
- 229920000159 gelatin Polymers 0.000 claims description 2
- 239000008273 gelatin Substances 0.000 claims description 2
- 235000019322 gelatine Nutrition 0.000 claims description 2
- 235000011852 gelatine desserts Nutrition 0.000 claims description 2
- 239000012764 mineral filler Substances 0.000 claims description 2
- 229920001971 elastomer Polymers 0.000 claims 2
- 239000005060 rubber Substances 0.000 claims 2
- 241000196324 Embryophyta Species 0.000 description 7
- 231100000614 poison Toxicity 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 5
- 239000002574 poison Substances 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- -1 diethyl ethyl mercaptoethyl thiophosphate Chemical compound 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- HBNYJWAFDZLWRS-UHFFFAOYSA-N ethyl isothiocyanate Chemical compound CCN=C=S HBNYJWAFDZLWRS-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000003440 toxic substance Substances 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- PGJBQBDNXAZHBP-UHFFFAOYSA-N Dimefox Chemical compound CN(C)P(F)(=O)N(C)C PGJBQBDNXAZHBP-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- XXWPHBWBNJKLMD-UHFFFAOYSA-N N-[dimethylamino(fluoro)phosphoryl]propan-2-amine Chemical compound CN(C)P(F)(NC(C)C)=O XXWPHBWBNJKLMD-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 241000530164 Volkameria aculeata Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012765 fibrous filler Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- UCFRFUMJIKZSBD-UHFFFAOYSA-N n-[azido(dimethylamino)phosphoryl]-n-methylmethanamine Chemical compound CN(C)P(=O)(N(C)C)N=[N+]=[N-] UCFRFUMJIKZSBD-UHFFFAOYSA-N 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 231100000925 very toxic Toxicity 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3835592A1 (de) | Insektizide | |
| DE950159C (de) | Vorrichtung zur Einfuehrung abgemessener Mengen innertherapeutisch wirkender Insekticide in den Erdboden | |
| DE1046938B (de) | Schaedlingsbekaempfungsmittel | |
| DE1046391B (de) | Schaedlingsbekaempfungsmittel | |
| DE2647722A1 (de) | Rodentizide mittel und verfahren zu deren herstellung | |
| DEP0009939MA (enrdf_load_stackoverflow) | ||
| DE102012006458B4 (de) | Sameneinlegebadzusammensetzung zum Impfen von Samen, Verfahren zum Impfen von Samen sowie deren Verwendung | |
| DE1272235B (de) | Verwendung von Loesungen einer Phenoxyalkansaeure als Mittel zum Wasserundurchlaessigmaschen von Erdschichten | |
| DE1147796B (de) | Mittel zur Bekaempfung von pflanzenparasitaeren Nematoden | |
| DE2207440A1 (de) | Verwendung von mikroverkapselten pflanzenschutz- und schaedlingsbekaempfungsmitteln | |
| DE2318824A1 (de) | Schaedlingsbekaempfungsmittel mit verzoegerter wirkstoffabgabe | |
| DE748413C (de) | Mittel zur Bekaempfung pilzlicher Schaedlinge an lebenden Pflanzen | |
| DE2511529C3 (de) | Verfahren zum Schutz von rohen Häuten und Wolle gegen Schädlinge und Präparat dafür | |
| DE2111804A1 (de) | Metallhaltiger,durch Wasser zersetzbarer polymerer Stoff | |
| DE963733C (de) | Mittel zum Beeinflussen der Wachstums- und Lebensaeusserungen, insbesondere zum Entblaettern von Pflanzen | |
| DE2805941C2 (de) | Hydraziniumphosphite, ihre Herstellung und funigzide Zusammensetzungen | |
| DE1542901A1 (de) | Insektizide Mittel | |
| DE2929920A1 (de) | Wohlriechendes anti-insektenmittel, insbesondere insektenpulver | |
| DE2718719A1 (de) | Pestizides mittel | |
| DE1150692B (de) | Verfahren zum Steuern der Geschwindigkeit der Pflanzennaehrstoffabgabe aus mineralischen Duengemitteln | |
| DE952666C (de) | Behandlung von Pflanzen zwecks Bekaempfung von tierischen Parasiten sowie von Krankheitserregern | |
| DE2220013A1 (de) | Fungizides Präparat | |
| DE543308C (de) | Verfahren zur Herstellung von Schaedlingsbekaempfungsmitteln | |
| DE575447C (de) | Verfahren zur laengere Zeit andauernden Pflanzenvertilgung | |
| DE544068C (de) | Verfahren zur Herstellung von Bestaeubungsmitteln fuer Pflanzenschutzzwecke und Saatgutbeizung |