DED0013691MA - - Google Patents
Info
- Publication number
- DED0013691MA DED0013691MA DED0013691MA DE D0013691M A DED0013691M A DE D0013691MA DE D0013691M A DED0013691M A DE D0013691MA
- Authority
- DE
- Germany
- Prior art keywords
- hydrofluoric acid
- yield
- fluorosilanes
- hydrocarbon
- reacted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- KRHYYFGTRYWZRS-UHFFFAOYSA-N HF Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 48
- 238000000034 method Methods 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 150000004756 silanes Chemical class 0.000 claims description 5
- YXBGGXXOSAYEJC-UHFFFAOYSA-N difluoro-methyl-phenylsilane Chemical compound C[Si](F)(F)C1=CC=CC=C1 YXBGGXXOSAYEJC-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 150000008282 halocarbons Chemical class 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 9
- 238000009835 boiling Methods 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 7
- 229910052802 copper Inorganic materials 0.000 description 7
- 239000010949 copper Substances 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 5
- -1 bis (fluorophenyl) -dipropoxysilan Chemical compound 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 4
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910004018 SiF Inorganic materials 0.000 description 3
- OJBGGLLCYJYHPG-UHFFFAOYSA-N diethyl(difluoro)silane Chemical compound CC[Si](F)(F)CC OJBGGLLCYJYHPG-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 230000000875 corresponding Effects 0.000 description 2
- ZMAPKOCENOWQRE-UHFFFAOYSA-N diethoxy(diethyl)silane Chemical compound CCO[Si](CC)(CC)OCC ZMAPKOCENOWQRE-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- DFJDZTPFNSXNAX-UHFFFAOYSA-N ethoxy(triethyl)silane Chemical compound CCO[Si](CC)(CC)CC DFJDZTPFNSXNAX-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000001367 organochlorosilanes Chemical class 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- STAGZMKHHNNCKQ-UHFFFAOYSA-N tributyl(fluoro)silane Chemical compound CCCC[Si](F)(CCCC)CCCC STAGZMKHHNNCKQ-UHFFFAOYSA-N 0.000 description 2
- QVMRVWAOMIXFFW-UHFFFAOYSA-N triethyl(fluoro)silane Chemical compound CC[Si](F)(CC)CC QVMRVWAOMIXFFW-UHFFFAOYSA-N 0.000 description 2
- GUNJVIDCYZYFGV-UHFFFAOYSA-K Antimony trifluoride Chemical compound F[Sb](F)F GUNJVIDCYZYFGV-UHFFFAOYSA-K 0.000 description 1
- AKZSUEMPWJZYNK-UHFFFAOYSA-N C(CCCCCCCCCCCCCCC)[Si](F)(F)F Chemical compound C(CCCCCCCCCCCCCCC)[Si](F)(F)F AKZSUEMPWJZYNK-UHFFFAOYSA-N 0.000 description 1
- RJUBITRLCAWKHI-UHFFFAOYSA-N C=1C=CC=CC=1C(C=1C=CC=CC=1)(CCO[SiH3])C1=CC=CC=C1 Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(CCO[SiH3])C1=CC=CC=C1 RJUBITRLCAWKHI-UHFFFAOYSA-N 0.000 description 1
- YSALUHGLIBYTET-UHFFFAOYSA-N CCCCO[SiH](OCCCC)CC1=CC=CC=C1 Chemical compound CCCCO[SiH](OCCCC)CC1=CC=CC=C1 YSALUHGLIBYTET-UHFFFAOYSA-N 0.000 description 1
- OMZDGOHZDWOQKM-UHFFFAOYSA-N CCC[SiH](F)F Chemical compound CCC[SiH](F)F OMZDGOHZDWOQKM-UHFFFAOYSA-N 0.000 description 1
- QOGZOCDXTWGFAV-UHFFFAOYSA-N Cl[Si](OCC)(OCC)CC1=CC=CC=C1 Chemical compound Cl[Si](OCC)(OCC)CC1=CC=CC=C1 QOGZOCDXTWGFAV-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 229910000881 Cu alloy Inorganic materials 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L Magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- LXXSWZYRKAQQDI-UHFFFAOYSA-N N-ethyl-N-silylethanamine Chemical compound CCN([SiH3])CC LXXSWZYRKAQQDI-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- OKZXPCMRDWGQHZ-UHFFFAOYSA-N benzyl(diethoxy)silicon Chemical compound CCO[Si](OCC)CC1=CC=CC=C1 OKZXPCMRDWGQHZ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atoms Chemical group C* 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 231100000078 corrosive Toxicity 0.000 description 1
- 231100001010 corrosive Toxicity 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- OWTZOBMYFOECIQ-UHFFFAOYSA-N cyclohexyl(tripropoxy)silane Chemical compound CCCO[Si](OCCC)(OCCC)C1CCCCC1 OWTZOBMYFOECIQ-UHFFFAOYSA-N 0.000 description 1
- DGPFXVBYDAVXLX-UHFFFAOYSA-N dibutyl(diethoxy)silane Chemical compound CCCC[Si](OCC)(OCC)CCCC DGPFXVBYDAVXLX-UHFFFAOYSA-N 0.000 description 1
- MIVNEOYVERQQTF-UHFFFAOYSA-N dibutyl(difluoro)silane Chemical compound CCCC[Si](F)(F)CCCC MIVNEOYVERQQTF-UHFFFAOYSA-N 0.000 description 1
- ZZNQQQWFKKTOSD-UHFFFAOYSA-N diethoxy(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](OCC)(OCC)C1=CC=CC=C1 ZZNQQQWFKKTOSD-UHFFFAOYSA-N 0.000 description 1
- VSYLGGHSEIWGJV-UHFFFAOYSA-N diethyl(dimethoxy)silane Chemical compound CC[Si](CC)(OC)OC VSYLGGHSEIWGJV-UHFFFAOYSA-N 0.000 description 1
- PJDRLEMKVQKSIN-UHFFFAOYSA-N diethyl(fluoro)silane Chemical compound CC[SiH](F)CC PJDRLEMKVQKSIN-UHFFFAOYSA-N 0.000 description 1
- XRRDNAZMVAXXQP-UHFFFAOYSA-N difluoro(dimethyl)silane Chemical compound C[Si](C)(F)F XRRDNAZMVAXXQP-UHFFFAOYSA-N 0.000 description 1
- BOMPXIHODLVNMC-UHFFFAOYSA-N difluoro(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](F)(F)C1=CC=CC=C1 BOMPXIHODLVNMC-UHFFFAOYSA-N 0.000 description 1
- ZIDTUTFKRRXWTK-UHFFFAOYSA-N dimethyl(dipropoxy)silane Chemical compound CCCO[Si](C)(C)OCCC ZIDTUTFKRRXWTK-UHFFFAOYSA-N 0.000 description 1
- SLAYMDSSGGBWQB-UHFFFAOYSA-N diphenyl(dipropoxy)silane Chemical compound C=1C=CC=CC=1[Si](OCCC)(OCCC)C1=CC=CC=C1 SLAYMDSSGGBWQB-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- RSIHJDGMBDPTIM-UHFFFAOYSA-N ethoxy(trimethyl)silane Chemical compound CCO[Si](C)(C)C RSIHJDGMBDPTIM-UHFFFAOYSA-N 0.000 description 1
- STBFUFDKXHQVMJ-UHFFFAOYSA-N ethoxy(tripropyl)silane Chemical compound CCC[Si](CCC)(CCC)OCC STBFUFDKXHQVMJ-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- CTIKAHQFRQTTAY-UHFFFAOYSA-N fluoro(trimethyl)silane Chemical compound C[Si](C)(C)F CTIKAHQFRQTTAY-UHFFFAOYSA-N 0.000 description 1
- DMTSDXQHAYTVGH-UHFFFAOYSA-N fluoro(tripropyl)silane Chemical compound CCC[Si](F)(CCC)CCC DMTSDXQHAYTVGH-UHFFFAOYSA-N 0.000 description 1
- XPBBUZJBQWWFFJ-UHFFFAOYSA-N fluorosilane Chemical compound [SiH3]F XPBBUZJBQWWFFJ-UHFFFAOYSA-N 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 239000011776 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003961 organosilicon compounds Chemical class 0.000 description 1
- 125000005375 organosiloxane group Chemical group 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 125000005373 siloxane group Chemical group [SiH2](O*)* 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- ZQJYXISBATZORI-UHFFFAOYSA-N tributyl(ethoxy)silane Chemical compound CCCC[Si](CCCC)(CCCC)OCC ZQJYXISBATZORI-UHFFFAOYSA-N 0.000 description 1
- ZOYFEXPFPVDYIS-UHFFFAOYSA-N trichloro(ethyl)silane Chemical compound CC[Si](Cl)(Cl)Cl ZOYFEXPFPVDYIS-UHFFFAOYSA-N 0.000 description 1
- OYGYKEULCAINCL-UHFFFAOYSA-N triethoxy(hexadecyl)silane Chemical compound CCCCCCCCCCCCCCCC[Si](OCC)(OCC)OCC OYGYKEULCAINCL-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE954198C (de) | Verfahren zur Herstellung von Organopolysiloxanen durch kontinuierliche Hydrolyse von Organochlorsilanen mit Wasser | |
| DE102005052233A1 (de) | Verfahren zur Herstellung von Organosilanen | |
| DE2642811C3 (de) | Oxysilanol-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2828604C2 (de) | Verfahren zur Reduktion von Phosphinoxiden | |
| DE1224048B (de) | Verfahren zur Herstellung von stickstoffhaltigen Organopolysiloxanen | |
| DE1061079B (de) | Verfahren zur Herstellung von fluorkohlenstoffsubstituierten Organopolysiloxanen | |
| DE3303707C2 (ko) | ||
| DE2557624C3 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| DE1294377B (de) | Verfahren zur Herstellung von hitzestabilen Pentahalogenphenylaethylsiliciumverbindungen | |
| DE1929902A1 (de) | Reduktion halogenhaltiger Siliciumverbindungen | |
| DE957214C (de) | Verfahren zur Herstellung von kohlenwasserstoff- bzw. halogenkohlenwasserstoffsubstituierten Fluorsilanen | |
| DED0013691MA (ko) | ||
| DE3610206A1 (de) | Verfahren zur herstellung von halogensilylaroylhalogeniden | |
| EP0031436B1 (de) | Verfahren zur Spaltung von Siloxanen | |
| DE2614608A1 (de) | Eckige klammer auf perfluoralkyl (alkoxy)phenyl eckige klammer zu methyldichlorsilane und verfahren zu ihrer herstellung | |
| DE1945645A1 (de) | Verfahren zur Herstellung von Diorganochlorphosphinen | |
| DE1268143B (de) | Verfahren zur Herstellung von Chlormethylarylsilanen und Chlormethylaralkylsilanen sowie der entsprechenden Siloxane | |
| DE1936069A1 (de) | Verfahren zur Herstellung von Organodisiloxanen mit an Silicium gebundenem Wasserstoff | |
| DE1237114B (de) | Verfahren zur Herstellung von Cyclopolysiloxanen | |
| DE1019652B (de) | Verfahren zur Herstellung von fluorfreien Organosiloxanen durch Hydrolyse von Organofluorsilanen mit waessrigen AEtzalkalien | |
| DE1266301B (de) | Verfahren zur Herstellung von Alkylhalogensilanen | |
| DE959909C (de) | Verfahren zur Herstellung von Alkyl- oder Arylsilanen bzw. -siloxanen | |
| DE953797C (de) | Verfahren zur Herstellung von Tetraorganodihalogenaethinyldisilanen | |
| DE2254062C3 (de) | Verfahren zur Herstellung von Tetrachloralkyl-phosphorsäureester-dichloriden undTetrachloralkyl-thiophosphorsäureesterdichloriden | |
| DE942628C (de) | Verfahren zur Herstellung von Disiloxanen |