DE970425C - Unkrautbekaempfungsmittel - Google Patents
UnkrautbekaempfungsmittelInfo
- Publication number
- DE970425C DE970425C DEP7811A DEP0007811A DE970425C DE 970425 C DE970425 C DE 970425C DE P7811 A DEP7811 A DE P7811A DE P0007811 A DEP0007811 A DE P0007811A DE 970425 C DE970425 C DE 970425C
- Authority
- DE
- Germany
- Prior art keywords
- dimethylurea
- alkyl
- weed
- chlorophenyl
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004009 herbicide Substances 0.000 title 1
- 239000000203 mixture Substances 0.000 claims description 31
- 150000001875 compounds Chemical class 0.000 claims description 29
- 241000196324 Embryophyta Species 0.000 claims description 25
- 239000004202 carbamide Substances 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 10
- 150000001447 alkali salts Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 8
- 150000001408 amides Chemical class 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical class OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims description 6
- 239000000122 growth hormone Substances 0.000 claims description 5
- 231100000614 poison Toxicity 0.000 claims description 5
- SMYMJHWAQXWPDB-UHFFFAOYSA-N (2,4,5-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-N 0.000 claims description 4
- 239000003559 2,4,5-trichlorophenoxyacetic acid Substances 0.000 claims description 4
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 claims description 4
- MHKBMNACOMRIAW-UHFFFAOYSA-N 2,3-dinitrophenol Chemical class OC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O MHKBMNACOMRIAW-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 claims description 2
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 150000001913 cyanates Chemical class 0.000 claims 1
- 125000005429 oxyalkyl group Chemical group 0.000 claims 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical class OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 claims 1
- 235000013877 carbamide Nutrition 0.000 description 18
- 239000002270 dispersing agent Substances 0.000 description 15
- -1 Isopropyl ester Chemical class 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 14
- 239000000080 wetting agent Substances 0.000 description 13
- 239000003921 oil Substances 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000007788 liquid Substances 0.000 description 10
- 244000025254 Cannabis sativa Species 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 238000009736 wetting Methods 0.000 description 9
- 239000003995 emulsifying agent Substances 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 6
- SAQSTQBVENFSKT-UHFFFAOYSA-M TCA-sodium Chemical compound [Na+].[O-]C(=O)C(Cl)(Cl)Cl SAQSTQBVENFSKT-UHFFFAOYSA-M 0.000 description 6
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- OWZPCEFYPSAJFR-UHFFFAOYSA-N 2-(butan-2-yl)-4,6-dinitrophenol Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O OWZPCEFYPSAJFR-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 229920005610 lignin Polymers 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 102000018997 Growth Hormone Human genes 0.000 description 4
- 108010051696 Growth Hormone Proteins 0.000 description 4
- 239000004721 Polyphenylene oxide Substances 0.000 description 4
- 159000000007 calcium salts Chemical class 0.000 description 4
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 4
- 230000002363 herbicidal effect Effects 0.000 description 4
- 229920000570 polyether Polymers 0.000 description 4
- HCJLVWUMMKIQIM-UHFFFAOYSA-M sodium;2,3,4,5,6-pentachlorophenolate Chemical compound [Na+].[O-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl HCJLVWUMMKIQIM-UHFFFAOYSA-M 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 3
- 229910052903 pyrophyllite Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 150000003672 ureas Chemical class 0.000 description 3
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- MDNWOSOZYLHTCG-UHFFFAOYSA-N Dichlorophen Chemical compound OC1=CC=C(Cl)C=C1CC1=CC(Cl)=CC=C1O MDNWOSOZYLHTCG-UHFFFAOYSA-N 0.000 description 2
- 241000508725 Elymus repens Species 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 235000012343 cottonseed oil Nutrition 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 229960003887 dichlorophen Drugs 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- RFOHRSIAXQACDB-UHFFFAOYSA-M sodium;2-(2,4-dichlorophenoxy)acetate Chemical compound [Na+].[O-]C(=O)COC1=CC=C(Cl)C=C1Cl RFOHRSIAXQACDB-UHFFFAOYSA-M 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- GLCIENYSYGDNIL-UHFFFAOYSA-N (2,3-dichlorophenyl) ethaneperoxoate Chemical compound CC(=O)OOC1=CC=CC(Cl)=C1Cl GLCIENYSYGDNIL-UHFFFAOYSA-N 0.000 description 1
- SMYMJHWAQXWPDB-UHFFFAOYSA-M (2,4,5-trichlorophenoxy)acetate Chemical compound [O-]C(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-M 0.000 description 1
- SODPIMGUZLOIPE-UHFFFAOYSA-N (4-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1 SODPIMGUZLOIPE-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical class CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- DOQVROBRZSHZPQ-UHFFFAOYSA-N 1-butyl-3,3-dimethyl-1-phenylurea Chemical compound CCCCN(C(=O)N(C)C)C1=CC=CC=C1 DOQVROBRZSHZPQ-UHFFFAOYSA-N 0.000 description 1
- XEYINGFRHZCVKK-UHFFFAOYSA-N 2,2-dichloro-2-phenoxyacetic acid Chemical compound OC(=O)C(Cl)(Cl)OC1=CC=CC=C1 XEYINGFRHZCVKK-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- QMSFHWZMMPPKIR-UHFFFAOYSA-N 2-(2,3,4-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C(Cl)=C1Cl QMSFHWZMMPPKIR-UHFFFAOYSA-N 0.000 description 1
- VGVRFARTWVJNQC-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetamide Chemical compound NC(=O)COC1=CC=C(Cl)C=C1Cl VGVRFARTWVJNQC-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- SBPQNRLMTAOKBN-UHFFFAOYSA-N 2-butan-2-yl-3-nitrophenol Chemical compound CCC(C)C1=C(O)C=CC=C1[N+]([O-])=O SBPQNRLMTAOKBN-UHFFFAOYSA-N 0.000 description 1
- XENORHLEQQVHAP-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1,1-diethylurea Chemical compound CCN(CC)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XENORHLEQQVHAP-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical compound O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 239000005983 Maleic hydrazide Substances 0.000 description 1
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 229940000488 arsenic acid Drugs 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- QYTOONVFPBUIJG-UHFFFAOYSA-N azane;cyanic acid Chemical compound [NH4+].[O-]C#N QYTOONVFPBUIJG-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- CNFUKOAVELXSRS-UHFFFAOYSA-N chloro(phenyl)carbamic acid Chemical compound OC(=O)N(Cl)C1=CC=CC=C1 CNFUKOAVELXSRS-UHFFFAOYSA-N 0.000 description 1
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- XRHVZWWRFMCBAZ-PXYBLNDHSA-L disodium;(1s,2r,3s,4r)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate Chemical compound [Na+].[Na+].C1C[C@@H]2[C@@H](C([O-])=O)[C@@H](C(=O)[O-])[C@H]1O2 XRHVZWWRFMCBAZ-PXYBLNDHSA-L 0.000 description 1
- FIIUKCVFBWKLNO-UHFFFAOYSA-N dodecanoic acid octadecanoic acid oxirane Chemical compound C(CCCCCCCCCCC)(=O)O.C(CCCCCCCCCCCCCCCCC)(=O)O.C1CO1 FIIUKCVFBWKLNO-UHFFFAOYSA-N 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 235000003715 nutritional status Nutrition 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-M pentachlorophenolate Chemical compound [O-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-M 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- XEBWQGVWTUSTLN-UHFFFAOYSA-M phenylmercury acetate Chemical compound CC(=O)O[Hg]C1=CC=CC=C1 XEBWQGVWTUSTLN-UHFFFAOYSA-M 0.000 description 1
- DCNLOVYDMCVNRZ-UHFFFAOYSA-N phenylmercury(.) Chemical class [Hg]C1=CC=CC=C1 DCNLOVYDMCVNRZ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- YZHUMGUJCQRKBT-UHFFFAOYSA-M sodium chlorate Chemical class [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940087194 sodium salt 2,4-dichlorophenoxyacetic acid Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L sodium sulphate Substances [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical class [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Phenolic Resins Or Amino Resins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US691403XA | 1949-12-06 | 1949-12-06 | |
| US231051A US2709648A (en) | 1949-12-06 | 1951-06-11 | Herbicidal composition and method employing mixtures of a polychlorophenoxy compound with a phenyl dimethyl urea |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE970425C true DE970425C (de) | 1958-09-18 |
Family
ID=26749725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP7811A Expired DE970425C (de) | 1949-12-06 | 1952-06-12 | Unkrautbekaempfungsmittel |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2709648A (https=) |
| CH (1) | CH319451A (https=) |
| DE (1) | DE970425C (https=) |
| FR (2) | FR1032629A (https=) |
| GB (2) | GB691403A (https=) |
| NL (2) | NL92838C (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1110466B (de) * | 1959-03-28 | 1961-07-06 | Wacker Chemie Gmbh | Unkrautvertilgungsmittel |
| DE1135703B (de) * | 1959-07-10 | 1962-08-30 | Basf Ag | Mittel zur Bekaempfung unerwuenschten Pflanzenwuchses, insbesondere Unkrautvernichtungsmittel |
| DE1144532B (de) * | 1958-11-25 | 1963-02-28 | Hooker Chemical Corp | Herbicide Mittel |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3298820A (en) * | 1967-01-17 | Herbicidal concentrate containing monosodium acid methanearsonate | ||
| US3234002A (en) * | 1966-02-08 | Herbicidal composition and method | ||
| US3004844A (en) * | 1953-11-27 | 1961-10-17 | United States Borax Chem | Composition and method for control of vegetation |
| US2904423A (en) * | 1954-12-07 | 1959-09-15 | United States Borax Chem | Herbicidal granular composition and method of preparing the same |
| BE548038A (https=) * | 1955-05-23 | |||
| US2958595A (en) * | 1955-11-11 | 1960-11-01 | Montedison Spa | Compositions based on 2, 4-dichlorophenoxyethanol for the weed control in the rice fields |
| US3020144A (en) * | 1955-12-22 | 1962-02-06 | Du Pont | Herbicidal composition and method employing nu-cyano and nu-cyanoalkyl substituted ureas |
| US3020145A (en) * | 1955-12-22 | 1962-02-06 | Du Pont | Herbicidal composition and method employing substituted ureas |
| US2913322A (en) * | 1955-12-29 | 1959-11-17 | Monsanto Chemicals | Halogen substituted carboxanilides |
| NL99656C (https=) * | 1956-04-04 | |||
| US2915110A (en) * | 1956-09-05 | 1959-12-01 | Reed C Ferguson | Joint-sealing strip and method of manufacture |
| DE1053860B (de) * | 1957-12-30 | 1959-03-26 | Wacker Chemie Gmbh | In fluessiger oder fester Form anwendbares Unkrautbekaempfungsmittel |
| NL236579A (https=) * | 1958-02-01 | |||
| BE575550A (https=) * | 1958-03-05 | |||
| US2992090A (en) * | 1958-03-27 | 1961-07-11 | Du Pont | Herbicidal pellets |
| US2985663A (en) * | 1958-04-16 | 1961-05-23 | Du Pont | Substituted imidazolidinone and method for the control of undesired vegetation |
| US3143409A (en) * | 1958-07-02 | 1964-08-04 | Exxon Research Engineering Co | Adduct of 3-p-chloro phenyl, 1, 1-dimethyl-urea and a mixture of polychlorobenzoic acids, use as herbicidal agents |
| FR1215716A (fr) * | 1958-11-03 | 1960-04-20 | Progil | Composition herbicide |
| US3148048A (en) * | 1959-03-11 | 1964-09-08 | Hooker Chemical Corp | Synergistic herbicidal composition |
| US3007789A (en) * | 1959-03-11 | 1961-11-07 | Hooker Chemical Corp | Synergistic herbicidal composition |
| US3203780A (en) * | 1959-01-28 | 1965-08-31 | Nalco Chemical Co | Herbicidal compositions and method for the manufacture thereof |
| ZA601610B (https=) * | 1959-02-13 | |||
| BE593743A (https=) * | 1959-08-05 | |||
| NL255091A (https=) * | 1959-08-21 | |||
| US3072473A (en) * | 1959-10-07 | 1963-01-08 | Us Rubber Co | Plant growth regulants |
| US3125431A (en) * | 1959-11-06 | 1964-03-17 | Complex of phenylureas and chloro- | |
| GB966852A (en) * | 1959-12-11 | 1964-08-19 | Ici Ltd | Herbicides |
| NL127932C (https=) * | 1960-02-10 | |||
| BE600423A (https=) * | 1960-02-23 | |||
| NL262589A (https=) * | 1960-03-21 | |||
| US3095299A (en) * | 1960-05-11 | 1963-06-25 | Du Pont | Herbicidal composition and method |
| US3152880A (en) * | 1960-06-08 | 1964-10-13 | Du Pont | Herbicidal composition and method |
| US3137562A (en) * | 1960-09-28 | 1964-06-16 | Lilly Co Eli | Herbicidal compositions and methods |
| US3228762A (en) * | 1960-10-03 | 1966-01-11 | Du Pont | Method of killing weeds |
| US3095407A (en) * | 1960-10-06 | 1963-06-25 | Dow Chemical Co | Substituted urea-acid complexes |
| US3298818A (en) * | 1961-05-15 | 1967-01-17 | Jack S Newcomer | Tetrahalobenzoic acid-nu-phenyl-nu', nu'-dialkylurea herbicide compositions |
| US3253903A (en) * | 1962-01-09 | 1966-05-31 | Tenneco Chem | Herbicidal composition and method |
| US3201220A (en) * | 1962-01-29 | 1965-08-17 | Diamond Alkali Co | Herbicidal composition and method |
| US3208843A (en) * | 1962-03-01 | 1965-09-28 | Durward O Guth | Granular herbicidal composition and preparation thereof |
| US3174843A (en) * | 1962-05-01 | 1965-03-23 | Hercules Powder Co Ltd | Norbornyl-1, 1-dimethyl ureas and thioureas and use as herbicides |
| US3297425A (en) * | 1962-08-28 | 1967-01-10 | Du Pont | Herbicidal composition |
| US3278292A (en) * | 1963-01-02 | 1966-10-11 | Du Pont | Herbicidal compositions and methods employing 3-phenyl-3-alkoxyureas |
| US3254984A (en) * | 1963-01-09 | 1966-06-07 | Du Pont | Herbicidal composition and method |
| US3342584A (en) * | 1963-07-10 | 1967-09-19 | Ansul Co | Method for killing broadleaf and grassy weeds in cotton |
| US3424571A (en) * | 1963-07-26 | 1969-01-28 | Andre Bondouy | Herbicidal composition and method |
| US3356715A (en) * | 1964-01-06 | 1967-12-05 | Allied Chem | Nu-hexahalohydroxyisopropyl carbamates |
| US3434822A (en) * | 1964-03-23 | 1969-03-25 | Fmc Corp | M-ureidophenyl carbamates as herbicides |
| US3373010A (en) * | 1964-10-08 | 1968-03-12 | Du Pont | Herbicidal composition and method |
| US3309192A (en) * | 1964-12-02 | 1967-03-14 | Du Pont | Method of controlling seedling weed grasses |
| GB1135563A (en) * | 1965-03-30 | 1968-12-04 | Fisons Pest Control Ltd | Herbicidal compositions |
| US3322527A (en) * | 1965-04-30 | 1967-05-30 | Du Pont | Herbicidal compositions and methods employing 3-(3, 4-dichlorophenyl)-1-methyl-1-methoxyurea with 3-amino-1, 2, 4-triazole |
| US3403017A (en) * | 1965-09-23 | 1968-09-24 | Hercules Inc | Herbicidal composition and method comprising 1-(tetrahydrodicyclopentadienyl)-3, 3-dimethyl urea and a salt of methyl arsonic acid |
| DE1291733B (de) * | 1965-11-16 | 1969-04-03 | Lauterbach | Verfahren zur Herstellung von N-Aryl-harnstoffen |
| US3385690A (en) * | 1967-03-13 | 1968-05-28 | Du Pont | Synergistic herbicidal mixtures |
| US3635692A (en) * | 1967-10-09 | 1972-01-18 | Olin Chemical Co Inc | Halogenated aryloxyacetyl cyanamides as herbicides |
| DE1812947C3 (de) * | 1968-12-05 | 1974-03-21 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Verwendung von freie Sulfonsäuregruppen enthaltendem dinaphthylmethan disulfonsaurem Natrium als stabilisierendes Dispergiermittel für benetzbare Pulver von 4.6-Dinitro-2-sek.-butylphenolestern |
| GB1327793A (en) * | 1970-06-10 | 1973-08-22 | Fisons Ltd | Herbicide |
| US3914300A (en) * | 1971-12-23 | 1975-10-21 | Shell Oil Co | Phenyl ketoxime derivatives |
| US3903156A (en) * | 1973-03-12 | 1975-09-02 | Stauffer Chemical Co | Ether and sulfide meta-substituted phenyl ureas |
| DE2624822A1 (de) * | 1976-05-31 | 1977-12-15 | Schering Ag | Benzodioxolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| CA1106202A (en) * | 1978-12-13 | 1981-08-04 | Lawrence J. Giilck | Herbicidal concentrate containing ketone and amide solvent |
| US4473579A (en) * | 1982-01-26 | 1984-09-25 | American Cyanamid Company | Antiatherosclerotic tetrasubstituted ureas and thioureas |
| US4623662A (en) | 1985-05-23 | 1986-11-18 | American Cyanamid Company | Antiatherosclerotic ureas and thioureas |
| IL67417A (en) * | 1982-01-26 | 1989-10-31 | American Cyanamid Co | Antiatherosclerotic substituted ureas,process for their preparation and pharmaceutical compositions containing them |
| US5003106A (en) * | 1983-07-19 | 1991-03-26 | American Cyanamid Company | Antiatherosclerotic ureas and thioureas |
| US4846872A (en) * | 1986-08-11 | 1989-07-11 | Fujisawa Pharmaceutical Co., Ltd. | Herbicide |
| GB8907298D0 (en) * | 1989-03-31 | 1989-05-17 | Ici Plc | Composition and use |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE499775A (https=) * | 1949-12-06 | |||
| CH257317A (fr) * | 1945-05-14 | 1948-10-15 | Limited Pest Control | Herbicide. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2303192A (en) * | 1940-12-04 | 1942-11-24 | John H Billman | Composition and method |
| NL62973C (https=) * | 1941-04-07 | |||
| US2326471A (en) * | 1942-02-20 | 1943-08-10 | Du Pont | Composition and method |
| US2412510A (en) * | 1944-06-02 | 1946-12-10 | American Chem Paint Co | Methods and compositions for killing weeds |
-
0
- NL NL212631D patent/NL212631A/xx unknown
- NL NL92838D patent/NL92838C/xx active
-
1950
- 1950-11-28 GB GB29144/50A patent/GB691403A/en not_active Expired
- 1950-12-06 FR FR1032629D patent/FR1032629A/fr not_active Expired
-
1951
- 1951-06-11 US US231051A patent/US2709648A/en not_active Expired - Lifetime
-
1952
- 1952-06-04 GB GB14141/52A patent/GB727906A/en not_active Expired
- 1952-06-06 FR FR64618D patent/FR64618E/fr not_active Expired
- 1952-06-11 CH CH319451D patent/CH319451A/fr unknown
- 1952-06-12 DE DEP7811A patent/DE970425C/de not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH257317A (fr) * | 1945-05-14 | 1948-10-15 | Limited Pest Control | Herbicide. |
| BE499775A (https=) * | 1949-12-06 |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1144532B (de) * | 1958-11-25 | 1963-02-28 | Hooker Chemical Corp | Herbicide Mittel |
| DE1110466B (de) * | 1959-03-28 | 1961-07-06 | Wacker Chemie Gmbh | Unkrautvertilgungsmittel |
| DE1135703B (de) * | 1959-07-10 | 1962-08-30 | Basf Ag | Mittel zur Bekaempfung unerwuenschten Pflanzenwuchses, insbesondere Unkrautvernichtungsmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| GB691403A (en) | 1953-05-13 |
| FR1032629A (fr) | 1953-07-03 |
| NL212631A (https=) | |
| US2709648A (en) | 1955-05-31 |
| GB727906A (en) | 1955-04-13 |
| CH319451A (fr) | 1957-02-15 |
| FR64618E (fr) | 1955-11-30 |
| NL92838C (https=) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE970425C (de) | Unkrautbekaempfungsmittel | |
| DD267418A5 (de) | Fungizide mittel | |
| EP2416659A1 (de) | Defoliant auf basis von thidiazuron und 1, 2, 4-triazinonen | |
| DE69407658T2 (de) | Herbizide Mischungen | |
| DE1217695B (de) | Insekticide Mittel mit acaricider Wirkung | |
| DE1006203B (de) | Selektiv wirkendes Unkrautbekaempfungsmittel | |
| DE3020694A1 (de) | Molluskizide zusammensetzung | |
| AT390167B (de) | Fungizide zusammensetzungen auf phosphitbasis | |
| EP2238835A1 (de) | Defoliant auf Basis von Thidiazuron und Oxyacetamiden | |
| DD252115A5 (de) | Fungizides mittel und seine verwendung | |
| DE1443933C2 (de) | Thiocyano-phenyl-isothiocyanate und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| DEP0007811MA (https=) | ||
| DE951181C (de) | Unkrautvertilgungsmittel | |
| DE971511C (de) | Mittel zur Unkrautbekaempfung | |
| DE2343985A1 (de) | Herbizide kombinationen | |
| DE10205860A1 (de) | Schneckenköder | |
| AT362958B (de) | Herbizide zusammensetzungen zur bekaempfung von unerwuenschtem pflanzenwachstum, insbesondere von grasartigen und breit- blaetterigen unkraeutern | |
| EP0053099A1 (de) | Schädlingsbekämpfungsmittel | |
| DE2341853A1 (de) | Rodentizidverbindungen | |
| DE2131817A1 (de) | Anticryptogamisches Mittel | |
| DE1542804C3 (de) | Herbizid | |
| DE1231051B (de) | Fungizides Saatgutbeizmittel | |
| DE861167C (de) | Schaedlingsbekaempfungsmittel | |
| DE2329401A1 (de) | Herbizide mischung | |
| DE1542942C3 (de) | Herbicides Mittel |