DE964655C - Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial mit Halogensilberemulsionsschichten - Google Patents
Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial mit HalogensilberemulsionsschichtenInfo
- Publication number
- DE964655C DE964655C DEE11571A DEE0011571A DE964655C DE 964655 C DE964655 C DE 964655C DE E11571 A DEE11571 A DE E11571A DE E0011571 A DEE0011571 A DE E0011571A DE 964655 C DE964655 C DE 964655C
- Authority
- DE
- Germany
- Prior art keywords
- color
- coupler
- colored
- colorless
- producing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 36
- 239000000839 emulsion Substances 0.000 title claims description 22
- 229910052709 silver Inorganic materials 0.000 title claims description 22
- 239000004332 silver Substances 0.000 title claims description 22
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 title claims description 20
- 239000000463 material Substances 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 150000004820 halides Chemical class 0.000 title 1
- -1 alkali metal salt Chemical class 0.000 claims description 44
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- 159000000000 sodium salts Chemical class 0.000 claims description 5
- 230000008878 coupling Effects 0.000 claims description 4
- 238000010168 coupling process Methods 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical class C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 claims description 2
- OAWPBBBROGQRON-UHFFFAOYSA-N N-[5-benzoyl-2-[(4-methylphenyl)-(3-phenylpropyl)sulfamoyl]phenyl]acetamide Chemical compound C(C1=CC=CC=C1)(=O)C1=CC(=C(C=C1)S(=O)(=O)N(C1=CC=C(C=C1)C)CCCC1=CC=CC=C1)NC(=O)C OAWPBBBROGQRON-UHFFFAOYSA-N 0.000 claims 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims 2
- RMHJJUOPOWPRBP-UHFFFAOYSA-N naphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)N)=CC=CC2=C1 RMHJJUOPOWPRBP-UHFFFAOYSA-N 0.000 claims 1
- 239000000975 dye Substances 0.000 description 22
- 150000001875 compounds Chemical class 0.000 description 14
- 239000000203 mixture Substances 0.000 description 10
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 4
- 230000000873 masking effect Effects 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000001046 green dye Substances 0.000 description 3
- 238000004382 potting Methods 0.000 description 3
- 230000003381 solubilizing effect Effects 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- XFXOLBNQYFRSLQ-UHFFFAOYSA-N 3-amino-2-naphthoic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(N)=CC2=C1 XFXOLBNQYFRSLQ-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YDDNYUJRUQYRAJ-UHFFFAOYSA-N 3-(naphthalene-2-carbonylamino)benzoic acid Chemical compound OC(=O)C1=CC=CC(NC(=O)C=2C=C3C=CC=CC3=CC=2)=C1 YDDNYUJRUQYRAJ-UHFFFAOYSA-N 0.000 description 1
- XBTWVJKPQPQTDW-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(C)=C1 XBTWVJKPQPQTDW-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical compound CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- NUWYUFIOOWDUHS-UHFFFAOYSA-M [Cl-].C(CCCCCCCCCCC)OC1=CC=C(C=C1)[N+]#N Chemical compound [Cl-].C(CCCCCCCCCCC)OC1=CC=C(C=C1)[N+]#N NUWYUFIOOWDUHS-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- DDKMFOUTRRODRE-UHFFFAOYSA-N chloromethanone Chemical compound Cl[C]=O DDKMFOUTRRODRE-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- ZWDZJRRQSXLOQR-UHFFFAOYSA-N n-butyl-n-phenylacetamide Chemical compound CCCCN(C(C)=O)C1=CC=CC=C1 ZWDZJRRQSXLOQR-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- VIXWGKYSYIBATJ-UHFFFAOYSA-N pyrrol-2-one Chemical compound O=C1C=CC=N1 VIXWGKYSYIBATJ-UHFFFAOYSA-N 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/32—Colour coupling substances
- G03C7/333—Coloured coupling substances, e.g. for the correction of the coloured image
- G03C7/3335—Coloured coupling substances, e.g. for the correction of the coloured image containing an azo chromophore
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US470499A US2808329A (en) | 1954-11-22 | 1954-11-22 | Photographic color correction using colored and uncolored couplers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE964655C true DE964655C (de) | 1957-05-23 |
Family
ID=42733058
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE11571A Expired DE964655C (de) | 1954-11-22 | 1955-11-22 | Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial mit Halogensilberemulsionsschichten |
| DEE12808A Pending DE1008574B (de) | 1954-11-22 | 1956-08-10 | Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE12808A Pending DE1008574B (de) | 1954-11-22 | 1956-08-10 | Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US2808329A (show.php) |
| BE (2) | BE540231A (show.php) |
| CH (1) | CH345532A (show.php) |
| DE (2) | DE964655C (show.php) |
| FR (3) | FR1146556A (show.php) |
| GB (2) | GB783730A (show.php) |
| NL (2) | NL202187A (show.php) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2908573A (en) * | 1956-07-25 | 1959-10-13 | Eastman Kodak Co | Photographic color couplers containing mono-n-alkyl groups |
| US3051568A (en) * | 1955-12-06 | 1962-08-28 | Edward K Kaprelian | Offset electrophotography |
| NL224469A (show.php) * | 1957-01-29 | |||
| US3230083A (en) * | 1959-04-02 | 1966-01-18 | Polaroid Corp | Photographic processes and products |
| US3148062A (en) * | 1959-04-06 | 1964-09-08 | Eastman Kodak Co | Photographic elements and processes using splittable couplers |
| BE619301A (show.php) * | 1959-04-06 | |||
| US3230084A (en) * | 1959-05-18 | 1966-01-18 | Polaroid Corp | Novel photographic products and processes |
| US3135609A (en) * | 1960-06-29 | 1964-06-02 | Gen Aniline & Film Corp | 1-hydroxy-2-naphthamide couplers for color photography |
| CA699092A (en) * | 1961-04-06 | 1964-12-01 | Polaroid Corporation | Photographic products, processes and compositions |
| US3230082A (en) * | 1962-05-14 | 1966-01-18 | Polaroid Corp | Color processes and products |
| US3227550A (en) * | 1962-09-07 | 1966-01-04 | Eastman Kodak Co | Photographic color reproduction process and element |
| US3285747A (en) * | 1964-08-26 | 1966-11-15 | Gen Analine & Film Corp | Color formers containing a m-alkyl-phenoxyacyl group |
| US3418121A (en) * | 1964-11-11 | 1968-12-24 | Fuji Photo Film Co Ltd | Photographic developer composition containing 2-(o-propionamido-beta-phenylethyl) - 1 - hydroxynaphthamide as a color former |
| US3307947A (en) * | 1964-12-16 | 1967-03-07 | Polaroid Corp | Photographic products and processes |
| GB1111342A (en) * | 1965-02-03 | 1968-04-24 | Fuji Photo Film Co Ltd | Colour photographic materials |
| DE1962574C3 (de) * | 1968-12-20 | 1975-02-13 | Konishiroku Photo Industry Co. Ltd., Tokio | Farbfotografisches Aufzeichnungsmaterial |
| JPS4817890B1 (show.php) * | 1969-07-16 | 1973-06-01 | ||
| US3859095A (en) * | 1969-12-13 | 1975-01-07 | Agfa Gevaert Ag | Color-photographic material with improved color reproduction |
| JPS49123034A (show.php) * | 1973-03-27 | 1974-11-25 | ||
| US4042394A (en) * | 1973-05-07 | 1977-08-16 | Eastman Kodak Company | Photographic dye image stabilization |
| US4002477A (en) * | 1973-11-28 | 1977-01-11 | Eastman Kodak Company | Diffusion transfer processes and elements using or containing inert transitional metal complex oxidizing agents |
| JPH0619551B2 (ja) * | 1986-02-24 | 1994-03-16 | 富士写真フイルム株式会社 | 感光材料 |
| US4871655A (en) * | 1987-01-16 | 1989-10-03 | Konica Corporation | Light-sensitive silver halide color photographic material containing multi-functional dye |
| US4777120A (en) * | 1987-05-18 | 1988-10-11 | Eastman Kodak Company | Photographic element and process comprising a masking coupler |
| US5364745A (en) * | 1990-12-19 | 1994-11-15 | Eastman Kodak Company | Azoaniline masking couplers for photographic materials |
| DE69126111T2 (de) * | 1990-12-21 | 1997-12-18 | Eastman Kodak Co | Farbphotographische Silberhalogenid-Vervielfältigungselemente sowie Verfahren |
| EP0574090A1 (en) | 1992-06-12 | 1993-12-15 | Eastman Kodak Company | One equivalent couplers and low pKa release dyes |
| US6010839A (en) * | 1998-06-26 | 2000-01-04 | Eastman Kodak Company | Color photographic elements containing yellow-colored magenta dye-forming masking couplers |
| US6132943A (en) * | 1999-10-14 | 2000-10-17 | Eastman Kodak Company | Color photographic elements containing yellow-colored magenta dye-forming masking couplers |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2428054A (en) * | 1945-08-30 | 1947-09-30 | Eastman Kodak Co | Photographic color correction using colored couplers |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2435616A (en) * | 1944-07-07 | 1948-02-10 | Eastman Kodak Co | Elimination coupling with azosubstituted couplers |
| BE496951A (show.php) * | 1949-07-15 |
-
0
- NL NL113830D patent/NL113830C/xx active
- BE BE550154D patent/BE550154A/xx unknown
- NL NL202187D patent/NL202187A/xx unknown
- BE BE540231D patent/BE540231A/xx unknown
-
1954
- 1954-11-22 US US470499A patent/US2808329A/en not_active Expired - Lifetime
-
1955
- 1955-07-26 FR FR1146556D patent/FR1146556A/fr not_active Expired
- 1955-07-27 GB GB21652/55A patent/GB783730A/en not_active Expired
- 1955-08-15 US US528516A patent/US2860974A/en not_active Expired - Lifetime
- 1955-10-03 CH CH345532D patent/CH345532A/de unknown
- 1955-11-22 DE DEE11571A patent/DE964655C/de not_active Expired
- 1955-12-29 GB GB37198/55A patent/GB853922A/en not_active Expired
-
1956
- 1956-08-10 DE DEE12808A patent/DE1008574B/de active Pending
- 1956-08-14 FR FR72012D patent/FR72012E/fr not_active Expired
-
1958
- 1958-07-08 FR FR769833A patent/FR73828E/fr not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2428054A (en) * | 1945-08-30 | 1947-09-30 | Eastman Kodak Co | Photographic color correction using colored couplers |
Also Published As
| Publication number | Publication date |
|---|---|
| NL113830C (show.php) | |
| CH345532A (de) | 1960-03-31 |
| GB853922A (en) | 1960-11-09 |
| FR1146556A (fr) | 1957-11-13 |
| NL202187A (show.php) | |
| US2860974A (en) | 1958-11-18 |
| DE1008574B (de) | 1957-05-16 |
| GB783730A (en) | 1957-09-25 |
| FR73828E (fr) | 1960-09-12 |
| FR72012E (fr) | 1960-03-21 |
| BE550154A (show.php) | |
| BE540231A (show.php) | |
| US2808329A (en) | 1957-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE964655C (de) | Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial mit Halogensilberemulsionsschichten | |
| DE2165371C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE1810464A1 (de) | Farbphotographisches Entwicklungsverfahren | |
| DE2415132C2 (de) | Farbige photographische Pyrazolon-Kuppler und diese enthaltende farbphotographische Silberhalogenid-Aufzeichnungsmaterialien | |
| DE2219917A1 (de) | Verfahren zur herstellung von gelbbildern | |
| DE1254463B (de) | Farbphotographisches Material | |
| DE2359295A1 (de) | Entwicklungsinhibitoren entbindende verbindungen, unter verwendung solcher verbindungen arbeitende entwicklungsverfahren fuer lichtempfindliche photographische silberhalogenidaufzeichnungsmaterialien und diese verbindungen enthaltende lichtempfindliche photographische silberhalogenidaufzeichnungsmaterialien | |
| DE2362752A1 (de) | Einen entwicklungsinhibitor liefernde verbindung fuer die silberhalogenidphotographie und deren verwendung zum entwickeln eines lichtempfindlichen photographischen silberhalogenidmaterials | |
| DE3135938C2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2424946A1 (de) | Kuppler fuer die photographie | |
| DE69328335T2 (de) | Verfahren zur Herstellung eines photographischen Farbbildes | |
| DE1597480B2 (de) | Verfahren zum farbentwickeln eines farbphotographischen aufzeichnungsmaterials | |
| DE2456076C3 (de) | Farbphotographisches mehrschichtiges Aufzeichnungsmaterial | |
| DE2604804C2 (de) | Fotografischer Farbentwickler | |
| DE2318807C2 (de) | Farbphotographisches Aufzeichnungsmaterial und Farbentwickler zum Entwickeln desselben | |
| DE968641C (de) | Verfahren zur Herstellung von farbwertkorrigierten Farbenteilbildern in farbenphotographischen Halogensilberemulsionen | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE1095115B (de) | Farbphotographisches Diffusionsuebertragungsverfahren und zugehoeriges photographisches Material | |
| DE2937991A1 (de) | Lichtempfindliches farbphotographisches silberhalogenid-aufzeichnungsmaterial | |
| DE876506C (de) | Photographischer Entwickler | |
| DE69203022T2 (de) | Photographische Kupplerzusammensetzungen, die Ballastgruppen aufweisende Sulfoxide oder Sulfone enthalten sowie Verfahren zur Herstellung von Farbbildern. | |
| DE3779717T2 (de) | Photographisches silberhalogenidmaterial und verfahren zur bildung eines farbbildes darauf. | |
| DE1547673C3 (de) | Verfahren zur Herstellung von blaugrünen maskierten Bildern auf photographischem Wege | |
| DE2705974C2 (show.php) | ||
| DE1002198B (de) | Verfahren zur Herstellung von farbenphotographischen Bildern |