DE940505C - Verfahren zur Behandlung lichtempfindlicher Schichten sowie Behandlungsmittel und Material hierfuer - Google Patents
Verfahren zur Behandlung lichtempfindlicher Schichten sowie Behandlungsmittel und Material hierfuerInfo
- Publication number
- DE940505C DE940505C DEI2130A DEI0002130A DE940505C DE 940505 C DE940505 C DE 940505C DE I2130 A DEI2130 A DE I2130A DE I0002130 A DEI0002130 A DE I0002130A DE 940505 C DE940505 C DE 940505C
- Authority
- DE
- Germany
- Prior art keywords
- layer
- image
- silver
- treatment agent
- soluble
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 39
- 239000000463 material Substances 0.000 title claims description 33
- 230000008569 process Effects 0.000 title claims description 8
- 239000010410 layer Substances 0.000 claims description 96
- 239000003795 chemical substances by application Substances 0.000 claims description 54
- 229910052709 silver Inorganic materials 0.000 claims description 43
- 239000004332 silver Substances 0.000 claims description 43
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 22
- 239000002245 particle Substances 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 19
- -1 silver halide Chemical class 0.000 claims description 17
- 239000000839 emulsion Substances 0.000 claims description 15
- 239000013078 crystal Substances 0.000 claims description 13
- 238000005054 agglomeration Methods 0.000 claims description 11
- 230000002776 aggregation Effects 0.000 claims description 11
- 230000015572 biosynthetic process Effects 0.000 claims description 11
- 230000002378 acidificating effect Effects 0.000 claims description 10
- 238000009792 diffusion process Methods 0.000 claims description 9
- 238000006386 neutralization reaction Methods 0.000 claims description 9
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 claims description 8
- 230000009467 reduction Effects 0.000 claims description 8
- 239000011248 coating agent Substances 0.000 claims description 7
- 238000000576 coating method Methods 0.000 claims description 7
- 150000002500 ions Chemical class 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 238000001556 precipitation Methods 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 239000002344 surface layer Substances 0.000 claims description 7
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 6
- 239000006185 dispersion Substances 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 229920000642 polymer Polymers 0.000 claims description 5
- 230000001105 regulatory effect Effects 0.000 claims description 5
- 235000021314 Palmitic acid Nutrition 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 4
- 239000001913 cellulose Substances 0.000 claims description 4
- 229920006158 high molecular weight polymer Polymers 0.000 claims description 4
- 150000004679 hydroxides Chemical class 0.000 claims description 4
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 claims description 4
- 150000003346 selenoethers Chemical class 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052793 cadmium Inorganic materials 0.000 claims description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 3
- 229920002301 cellulose acetate Polymers 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 239000011973 solid acid Substances 0.000 claims description 3
- XSOKHXFFCGXDJZ-UHFFFAOYSA-N telluride(2-) Chemical compound [Te-2] XSOKHXFFCGXDJZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- 229910052976 metal sulfide Inorganic materials 0.000 claims description 2
- 230000001376 precipitating effect Effects 0.000 claims 4
- 229910002651 NO3 Inorganic materials 0.000 claims 2
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 claims 2
- 229940100890 silver compound Drugs 0.000 claims 2
- 150000003379 silver compounds Chemical class 0.000 claims 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- 230000003111 delayed effect Effects 0.000 claims 1
- 239000000243 solution Substances 0.000 description 19
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 229940046892 lead acetate Drugs 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000001768 carboxy methyl cellulose Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000004033 plastic Substances 0.000 description 6
- 229920003023 plastic Polymers 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 5
- 229910001864 baryta Inorganic materials 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 229910052946 acanthite Inorganic materials 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000003384 imaging method Methods 0.000 description 4
- RLJMLMKIBZAXJO-UHFFFAOYSA-N lead nitrate Chemical compound [O-][N+](=O)O[Pb]O[N+]([O-])=O RLJMLMKIBZAXJO-UHFFFAOYSA-N 0.000 description 4
- 229940056910 silver sulfide Drugs 0.000 description 4
- XUARKZBEFFVFRG-UHFFFAOYSA-N silver sulfide Chemical compound [S-2].[Ag+].[Ag+] XUARKZBEFFVFRG-UHFFFAOYSA-N 0.000 description 4
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 235000006708 antioxidants Nutrition 0.000 description 3
- LHQLJMJLROMYRN-UHFFFAOYSA-L cadmium acetate Chemical compound [Cd+2].CC([O-])=O.CC([O-])=O LHQLJMJLROMYRN-UHFFFAOYSA-L 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 3
- 239000002131 composite material Substances 0.000 description 3
- 238000007598 dipping method Methods 0.000 description 3
- 229910052981 lead sulfide Inorganic materials 0.000 description 3
- 229940056932 lead sulfide Drugs 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- ZSILVJLXKHGNPL-UHFFFAOYSA-L S(=S)(=O)([O-])[O-].[Ag+2] Chemical class S(=S)(=O)([O-])[O-].[Ag+2] ZSILVJLXKHGNPL-UHFFFAOYSA-L 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- RFVVBBUVWAIIBT-UHFFFAOYSA-N beryllium nitrate Chemical compound [Be+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O RFVVBBUVWAIIBT-UHFFFAOYSA-N 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 229910052979 sodium sulfide Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- OERNJTNJEZOPIA-UHFFFAOYSA-N zirconium nitrate Chemical compound [Zr+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O OERNJTNJEZOPIA-UHFFFAOYSA-N 0.000 description 2
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- MBMLMWLHJBBADN-UHFFFAOYSA-N Ferrous sulfide Chemical compound [Fe]=S MBMLMWLHJBBADN-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- HDYRYUINDGQKMC-UHFFFAOYSA-M acetyloxyaluminum;dihydrate Chemical compound O.O.CC(=O)O[Al] HDYRYUINDGQKMC-UHFFFAOYSA-M 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229940009827 aluminum acetate Drugs 0.000 description 1
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- XIEPJMXMMWZAAV-UHFFFAOYSA-N cadmium nitrate Inorganic materials [Cd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XIEPJMXMMWZAAV-UHFFFAOYSA-N 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- INPLXZPZQSLHBR-UHFFFAOYSA-N cobalt(2+);sulfide Chemical compound [S-2].[Co+2] INPLXZPZQSLHBR-UHFFFAOYSA-N 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- XOYUVEPYBYHIFZ-UHFFFAOYSA-L diperchloryloxylead Chemical compound [Pb+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O XOYUVEPYBYHIFZ-UHFFFAOYSA-L 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- YTYSNXOWNOTGMY-UHFFFAOYSA-N lanthanum(3+);trisulfide Chemical compound [S-2].[S-2].[S-2].[La+3].[La+3] YTYSNXOWNOTGMY-UHFFFAOYSA-N 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- WWNBZGLDODTKEM-UHFFFAOYSA-N sulfanylidenenickel Chemical compound [Ni]=S WWNBZGLDODTKEM-UHFFFAOYSA-N 0.000 description 1
- NRUVOKMCGYWODZ-UHFFFAOYSA-N sulfanylidenepalladium Chemical compound [Pd]=S NRUVOKMCGYWODZ-UHFFFAOYSA-N 0.000 description 1
- 150000004772 tellurides Chemical class 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/04—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of inorganic or organo-metallic compounds derived from photosensitive noble metals
- G03C8/06—Silver salt diffusion transfer
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US662000A US2584029A (en) | 1946-04-13 | 1946-04-13 | Photographic silver transfer product and process, including a lead salt |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE940505C true DE940505C (de) | 1956-03-22 |
Family
ID=24655982
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI2130A Expired DE940505C (de) | 1946-04-13 | 1950-09-24 | Verfahren zur Behandlung lichtempfindlicher Schichten sowie Behandlungsmittel und Material hierfuer |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2584029A (enFirst) |
| BE (1) | BE471336A (enFirst) |
| CH (1) | CH319602A (enFirst) |
| DE (1) | DE940505C (enFirst) |
| FR (1) | FR55253E (enFirst) |
| GB (1) | GB703231A (enFirst) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1020865B (de) * | 1955-03-29 | 1957-12-12 | Polaroid Corp | Verfahren zur Herstellung direkter photographischer Positive |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2647055A (en) * | 1946-11-06 | 1953-07-28 | Polaroid Corp | Photographic product and process for forming a white image viewable against a dark background |
| US2874299A (en) * | 1952-06-30 | 1959-02-17 | Walter H Barkas | Ionization recording capsules |
| US3030207A (en) * | 1952-07-17 | 1962-04-17 | Polaroid Corp | Photographic processes |
| GB1025651A (en) * | 1962-01-05 | 1966-04-14 | Kodak Ltd | Preparation of photographic silver halide emulsions |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR873507A (fr) * | 1939-11-02 | 1942-07-10 | Gevaert Photo Prod Nv | Procédé pour l'obtention d'images au moyen d'halogénure d'argent |
| FR879995A (fr) * | 1941-01-24 | 1943-03-10 | Ig Farbenindustrie Ag | Procédé pour la constitution d'images photographiques positives |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB391790A (enFirst) * | ||||
| US312954A (en) * | 1885-02-24 | And everett eaedon | ||
| GB189912678A (en) * | 1899-06-17 | 1899-07-22 | Thomas Thorne Baker | An Improved Method of Tinting Photographs. |
| GB190610051A (en) * | 1906-04-30 | 1906-10-11 | Oscar Hermann Steudel | Improvements in Self-toning Silver Chloride Printing Papers for use in Photography. |
| GB190624667A (enFirst) * | 1906-11-03 | 1907-10-31 | Thomas Bolas | |
| GB190713835A (en) * | 1907-06-14 | 1908-06-11 | William Fraser Claughton Kelly | Improvements in or relating to Printing Out Papers and Photographic Sensitive Surfaces for use in the Production of Positive Pictures. |
| US1610788A (en) * | 1925-08-01 | 1926-12-14 | Jelley Edwin Ernest | Production of photographs on paper, parchment, and the like |
| GB328762A (en) * | 1929-04-08 | 1930-05-08 | Kodak Ltd | Improvements in or relating to photographic films or plates |
| US1897843A (en) * | 1930-08-07 | 1933-02-14 | Eastman Kodak Co | Light sensitive tropochromic coating |
| BE381968A (enFirst) * | 1930-08-14 | |||
| US1963707A (en) * | 1932-02-02 | 1934-06-19 | Anton Jasmatxi | Toning process, particularly for toning the red color component image for multicolorphotography |
| US1962307A (en) * | 1932-06-02 | 1934-06-12 | Eastman Kodak Co | Photographically sensitive element |
| US2091689A (en) * | 1935-04-02 | 1937-08-31 | Eastman Kodak Co | Photographic hardening developer |
| US2224269A (en) * | 1937-12-04 | 1940-12-10 | Louis S Sanders | Drawing and method of and medium for making the same |
| US2224654A (en) * | 1938-12-01 | 1940-12-10 | Louis S Sanders | Media, process for the representation of figures, designs, drawings, etc., thereon and method of making said media |
| NL51331C (enFirst) * | 1938-12-05 | |||
| US2322005A (en) * | 1939-12-29 | 1943-06-15 | Eastman Kodak Co | Photographic bleach-out layer |
| US2322006A (en) * | 1939-12-29 | 1943-06-15 | Eastman Kodak Co | Photographic filter and antihalation layer |
| BE470936A (enFirst) * | 1940-02-24 | |||
| US2352014A (en) * | 1941-07-21 | 1944-06-20 | Rott Andre | Photomechanical printing process and printing material for carrying out the same |
| US2355884A (en) * | 1942-08-15 | 1944-08-15 | Louis S Sanders | Medium for use in making camera copy and method of preparing same |
-
0
- BE BE471336D patent/BE471336A/xx unknown
-
1946
- 1946-04-13 US US662000A patent/US2584029A/en not_active Expired - Lifetime
-
1947
- 1947-02-17 FR FR55253D patent/FR55253E/fr not_active Expired
- 1947-02-18 GB GB4647/47A patent/GB703231A/en not_active Expired
- 1947-02-19 CH CH319602D patent/CH319602A/fr unknown
-
1950
- 1950-09-24 DE DEI2130A patent/DE940505C/de not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR873507A (fr) * | 1939-11-02 | 1942-07-10 | Gevaert Photo Prod Nv | Procédé pour l'obtention d'images au moyen d'halogénure d'argent |
| FR879995A (fr) * | 1941-01-24 | 1943-03-10 | Ig Farbenindustrie Ag | Procédé pour la constitution d'images photographiques positives |
| FR53311E (fr) * | 1941-01-24 | 1945-10-16 | Ig Farbenindustrie Ag | Procédé pour la constitution d'images photographiques positives |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1020865B (de) * | 1955-03-29 | 1957-12-12 | Polaroid Corp | Verfahren zur Herstellung direkter photographischer Positive |
Also Published As
| Publication number | Publication date |
|---|---|
| GB703231A (en) | 1954-02-03 |
| US2584029A (en) | 1952-01-29 |
| CH319602A (fr) | 1957-02-28 |
| BE471336A (enFirst) | |
| FR55253E (fr) | 1952-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2936281C2 (de) | Verfahren zur Herstellung eines Silbersalzes einer höheren Fettsäure | |
| DE2044717A1 (de) | Direktpositivfolie und hieraus herge stellte Offsetdruckplatte | |
| DE1019559B (de) | Photographisches Direkt-Positiv-Silbersalzdiffusionsverfahren | |
| DE1772603C2 (de) | Photographisches Aufzeichnungsmaterial und Verfahren zur Silberkomplexdiffusionsübertragung | |
| DE940505C (de) | Verfahren zur Behandlung lichtempfindlicher Schichten sowie Behandlungsmittel und Material hierfuer | |
| DE1020865B (de) | Verfahren zur Herstellung direkter photographischer Positive | |
| CH514159A (de) | Photographisches Verfahren und photographisches Produkt zur Ausführung desselben | |
| DE1447900B2 (de) | Verfahren zur Herstellung von lithographischen Druckformen | |
| DE1022468B (de) | Fotografische Emulsionen mit erhoehter Empfindlichkeit fuer Roentgen- und ª-Strahlen und Verfahren zu ihrer Herstellung | |
| DE2214924A1 (de) | Diffusionsübertragungsbildempfangsmaterialien | |
| DE1235743B (de) | Verfahren zur Herstellung positiver und negativer Silberbilder | |
| DE1122835B (de) | Photographisches Diffusionsuebertragungsverfahren und Photomaterial hierfuer | |
| DE2323742A1 (de) | Bildaufnahmematerialien fuer das silbersalzdiffusionsuebertragungsverfahren und verfahren zu deren herstellung | |
| DE960607C (de) | Bildaufnahmematerial fuer Silbersalz-Diffusionsverfahren | |
| DE1803412A1 (de) | Silbersalz-Diffusionsuebertragungsverfahren | |
| DE1076491B (de) | Verfahren zur Herstellung mehrerer Positive von einem Negativ nach dem Silbersalzdiffusionsverfahren | |
| DE932344C (de) | Photographisches Verfahren und Mittel zur Durchfuehrung des Verfahrens | |
| DE1797388A1 (de) | Verfahren zur Herstellung photographischer Bilder | |
| DE923636C (de) | Verfahren zur Erzeugung von aus Edelmetall bestehenden photographischen Kontrasten | |
| DE963835C (de) | Photographisches Verfahren und lichtempfindliches Material zu seiner Durchfuehrung | |
| DE1080854B (de) | Verfahren zur Herstellung seitenrichtiger positiver Abbildungen unter Waermeeinwirkung und Positivmaterial zur Durchfuehrung dieses Verfahrens | |
| AT225030B (de) | Verfahren und Filmmaterial zum Erzeugen eines photographischen Übertragungsbildes | |
| AT223034B (de) | Für photographische Silbersalz-Diffusions-Übertragungsverfahren geeignetes photographisches Bildaufnahmeelement | |
| DE1909650C3 (de) | Silberkomplexdiffusionsubertragungsverfahren | |
| DE2736098C2 (de) | Fotographisches Aufzeichnungsmaterial und Verfahren zum Entwickeln eines Bildes |