DE863411C - Verfahren zur Herstellung elastischer Kunststoffe - Google Patents
Verfahren zur Herstellung elastischer KunststoffeInfo
- Publication number
- DE863411C DE863411C DEC1875A DEC0001875A DE863411C DE 863411 C DE863411 C DE 863411C DE C1875 A DEC1875 A DE C1875A DE C0001875 A DEC0001875 A DE C0001875A DE 863411 C DE863411 C DE 863411C
- Authority
- DE
- Germany
- Prior art keywords
- groups
- hours
- parts
- product
- soft
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 10
- 239000004033 plastic Substances 0.000 title claims description 8
- 229920003023 plastic Polymers 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000003431 cross linking reagent Substances 0.000 claims description 33
- 125000003700 epoxy group Chemical group 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 25
- 229920000728 polyester Polymers 0.000 claims description 25
- 239000003054 catalyst Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000003368 amide group Chemical group 0.000 claims description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims 1
- 239000000047 product Substances 0.000 description 50
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 22
- 238000005266 casting Methods 0.000 description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 16
- 239000007788 liquid Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 239000001361 adipic acid Substances 0.000 description 12
- 235000011037 adipic acid Nutrition 0.000 description 12
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 11
- 239000004593 Epoxy Substances 0.000 description 10
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 10
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 10
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 10
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 8
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 229910015900 BF3 Inorganic materials 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 239000003973 paint Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- -1 Aliphatic alcohols Chemical class 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AKNUHUCEWALCOI-UHFFFAOYSA-N N-ethyldiethanolamine Chemical compound OCCN(CC)CCO AKNUHUCEWALCOI-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 description 1
- XKZQKPRCPNGNFR-UHFFFAOYSA-N 2-(3-hydroxyphenyl)phenol Chemical compound OC1=CC=CC(C=2C(=CC=CC=2)O)=C1 XKZQKPRCPNGNFR-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 238000001632 acidimetric titration Methods 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 238000004870 electrical engineering Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 150000008442 polyphenolic compounds Chemical class 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- FQUYBJOWNFKUJE-UHFFFAOYSA-N sulfo dihydrogen phosphate Chemical compound OP(O)(=O)OS(O)(=O)=O FQUYBJOWNFKUJE-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- HQHCYKULIHKCEB-UHFFFAOYSA-N tetradecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCCC(O)=O HQHCYKULIHKCEB-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- UVZICZIVKIMRNE-UHFFFAOYSA-N thiodiacetic acid Chemical compound OC(=O)CSCC(O)=O UVZICZIVKIMRNE-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L63/00—Compositions of epoxy resins; Compositions of derivatives of epoxy resins
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH739701X | 1949-08-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE863411C true DE863411C (de) | 1953-01-19 |
Family
ID=4533038
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC1875A Expired DE863411C (de) | 1949-08-12 | 1950-08-01 | Verfahren zur Herstellung elastischer Kunststoffe |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2712535A (OSRAM) |
| BE (1) | BE497540A (OSRAM) |
| CH (1) | CH284090A (OSRAM) |
| DE (1) | DE863411C (OSRAM) |
| FR (1) | FR1023976A (OSRAM) |
| GB (1) | GB739701A (OSRAM) |
| NL (1) | NL79847C (OSRAM) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1023883B (de) * | 1951-12-07 | 1958-02-06 | Nat Res Dev | Verfahren zur Herstellung von Schaumstoffen, UEberzuegen oder Klebverbindungen aus haertbaren Kunstharzen und Diisocyanaten |
| DE1076365B (de) * | 1957-09-25 | 1960-02-25 | Bayer Ag | Verfahren zum Haerten von Polyepoxyverbindungen |
| DE1096600B (de) * | 1955-12-19 | 1961-01-05 | Minnesota Mining & Mfg | Verfahren zur Herstellung ausgehaerteter Kunstharze durch Umsetzung von Epoxydgruppen aufweisenden Kunstharzen |
| DE1137428B (de) * | 1955-05-09 | 1962-10-04 | Johnson & Son Inc S C | Verfahren zur Herstellung von Weichmachern |
| DE1227660B (de) * | 1958-10-13 | 1966-10-27 | Union Carbide Corp | Verfahren zur Herstellung von Formteilen |
| DE1227659B (de) * | 1958-10-13 | 1966-10-27 | Union Carbide Corp | Verfahren zur Herstellung von Formteilen |
| DE1490427B1 (de) * | 1963-07-11 | 1969-11-20 | Siemens Ag | Glimmerband zur Herstellung einer mit einer heisshaertbaren Traenkharzmischung impraegnierten Isolierung fuer elektrische Leiter,insbesondere fuer Wicklungsstaebe bzw. Spulen elektrischer Maschinen |
Families Citing this family (84)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2830031A (en) * | 1949-08-12 | 1958-04-08 | Ciba Ltd | Compositions comprising epoxy compounds and hydroxy terminated polyester resins and process of making same |
| US2891034A (en) * | 1949-08-12 | 1959-06-16 | Ciba Ltd | Composition comprising a reaction product of a polyester and a polyepoxide and process for preparation |
| DE1107934B (de) * | 1951-10-31 | 1961-05-31 | Gen Electric | Hitzehaertbare, plastische Form-, Kleb- und UEberzugsmasse |
| DE970557C (de) * | 1952-03-11 | 1958-10-02 | Ciba Geigy | Verfahren zur Herstellung einer gehaerteten Kunstharzmasse |
| BE518763A (OSRAM) * | 1952-03-29 | |||
| US2731444A (en) * | 1952-10-21 | 1956-01-17 | Devoe & Raynolds Co | Epoxide resin cured with a polyhydric aliphatic alcohol |
| BE523503A (OSRAM) * | 1952-11-03 | |||
| US3280056A (en) * | 1953-07-30 | 1966-10-18 | Devoe & Raynolds Co | Epoxide compositions prepared from dimeric unsaturated higher fatty acids |
| NL190358A (OSRAM) * | 1953-08-28 | |||
| US2921040A (en) * | 1953-10-08 | 1960-01-12 | Shell Dev | Epoxide resin composition |
| US2939859A (en) * | 1954-03-31 | 1960-06-07 | Shell Oil Co | Process for preparing resinified product from polyepoxy polyether and aromatic-substituted-alkene-1 and composition for production of said product |
| NL199568A (OSRAM) * | 1954-08-10 | |||
| DE1009808B (de) * | 1954-09-02 | 1957-06-06 | Basf Ag | Verfahren zur Herstellung von Lack- und Giessharzen aus Polyglycidylaethern |
| US2934520A (en) * | 1954-10-04 | 1960-04-26 | Aries Lab Inc | Epoxy resin compositions |
| US2910455A (en) * | 1954-11-26 | 1959-10-27 | Pittsburgh Plate Glass Co | Glycidyl polyethers from an epihalohydrin and a bis(4-hydroxy-3 allyl phenyl) alkane |
| NL205256A (OSRAM) * | 1955-03-09 | |||
| US2909496A (en) * | 1955-07-19 | 1959-10-20 | Devoe & Raynolds Co | Reaction products of polyepoxides and monomeric partial esters of polyhydric alcohols with maleic anhydrideunsaturated organic acid adducts, and methods and compositionsfor producing the same |
| US3023190A (en) * | 1955-08-10 | 1962-02-27 | Sherwin Williams Co | Method of amine curing epoxy resins and composition therefor |
| US2915485A (en) * | 1955-09-01 | 1959-12-01 | Shell Dev | Process for preparing flexible resinified products from polyepoxides and resulting products |
| US3148199A (en) * | 1955-11-23 | 1964-09-08 | Petrolite Corp | Reaction product of epoxidized glycerides and polyamino compounds |
| US3065247A (en) * | 1955-11-23 | 1962-11-20 | Petrolte Corp | Reaction product of epoxidized fatty acid esters of lower alkanols and polyamino compounds |
| US2853467A (en) * | 1956-01-04 | 1958-09-23 | Gen Aniline & Film Corp | Liquid aromatic diamines as curing agents for epoxy ether resins |
| US2990383A (en) * | 1956-01-30 | 1961-06-27 | Gen Mills Inc | Composition comprising an epoxy resin, an amino polyamide and a polyamine |
| US3028342A (en) * | 1956-04-02 | 1962-04-03 | North American Aviation Inc | Catalyst composition |
| US2828323A (en) * | 1956-04-13 | 1958-03-25 | Petrolite Corp | Reaction product of epoxidized monohydric alcohol esters and hydroxylated tertiary monoamines |
| US2953585A (en) * | 1956-04-13 | 1960-09-20 | Petrolite Corp | Salts of reaction products of epoxidized acyl radical containing compounds and polyamino compounds |
| US3112294A (en) * | 1956-04-30 | 1963-11-26 | Shell Oil Co | Polyepoxides from epoxy-substituted monocarboxylic acids, their preparation and polymers |
| US2819278A (en) * | 1956-05-09 | 1958-01-07 | Petrolite Corp | Reaction product of epoxidized glycerides and hydroxylated tertiary monoamines |
| US2890210A (en) * | 1956-05-24 | 1959-06-09 | Union Carbide Corp | Compositions comprising epoxides and acid anhydrides |
| US2890194A (en) * | 1956-05-24 | 1959-06-09 | Union Carbide Corp | Compositions of epoxides and polycarboxylic acid compounds |
| BE557991A (OSRAM) * | 1956-06-01 | |||
| US2944996A (en) * | 1956-06-07 | 1960-07-12 | Thiokol Chemical Corp | Resinous condensation product of a polyepoxypolyether resin and a hydroxyl-terminated polyester and method of making same |
| US2947717A (en) * | 1956-06-11 | 1960-08-02 | Devoe & Raynolds Co Inc | Epoxide resin compositions |
| US2934506A (en) * | 1956-06-11 | 1960-04-26 | Devoe & Raynolds Co | Modified epoxide resins |
| US2956067A (en) * | 1956-07-05 | 1960-10-11 | Petrolite Corp | Certain surfactants and method of making same |
| CH354582A (de) * | 1956-08-20 | 1961-05-31 | Oerlikon Maschf | Verfahren zur Herstellung eines härtbaren, titanmodifizierten Epoxyharzes |
| US2987490A (en) * | 1956-09-17 | 1961-06-06 | Visco Products Co | Surface-active esters of polymerized polyethenoid fatty acids |
| US2893968A (en) * | 1956-11-07 | 1959-07-07 | Johnson & Son Inc S C | Composition of polycarboxylic acid amides, polyepoxides and ammonia derivative-aldehyde condensates |
| US2893966A (en) * | 1956-11-07 | 1959-07-07 | Johnson & Son Inc S C | Resin compositions containing tricarboxylic oxy-acids |
| US2893965A (en) * | 1956-11-07 | 1959-07-07 | Johnson & Son Inc S C | Compositions of polycarboxylic acid amides, polyepoxides, and phenolaldehyde condensates |
| US2878233A (en) * | 1957-03-11 | 1959-03-17 | Gen Mills Inc | Epoxy resins including diimidazoline curing agents |
| US2878234A (en) * | 1957-04-01 | 1959-03-17 | Gen Mills Inc | Epoxy resins including an imidazoline curing agent |
| US2962469A (en) * | 1957-07-31 | 1960-11-29 | Union Carbide Corp | Polymerizable compositions containing dicyclopentadiene dioxide and plycarboxylic acid and resins prepared therefrom |
| US2934508A (en) * | 1957-07-31 | 1960-04-26 | Union Carbide Corp | Polymerizable compositions and resins made therefrom |
| US2912389A (en) * | 1957-08-08 | 1959-11-10 | Union Carbide Corp | Polymers of divinylbenzene dioxide |
| US2918444A (en) * | 1957-08-08 | 1959-12-22 | Union Carbide Corp | Polyepoxide compositions |
| US2917493A (en) * | 1957-08-08 | 1959-12-15 | Union Carbide Corp | Polyepoxide compositions |
| NL232051A (OSRAM) * | 1957-10-07 | 1900-01-01 | ||
| US3052647A (en) * | 1957-11-22 | 1962-09-04 | Henkel & Cie Gmbh | Heat hardenable composition comprising an alkyd resin, an epoxy polyester resin, anda dipentene:maleic acid anhydride adduct and process of preparing same |
| US3098052A (en) * | 1957-12-12 | 1963-07-16 | California Research Corp | Thixotropic coating solutions |
| NL235079A (OSRAM) * | 1958-01-13 | 1900-01-01 | ||
| US3105771A (en) * | 1958-04-28 | 1963-10-01 | Shell Oil Co | Surfacing compositions comprising a mixture of a polyepoxide, a polyamide, and a petroleum derived bituminous material |
| US3047394A (en) * | 1958-08-01 | 1962-07-31 | Eastman Kodak Co | Photosensitive products containing therein layers hardened by bisepoxides |
| US2970231A (en) * | 1958-10-08 | 1961-01-31 | Westinghouse Electric Corp | Packing composition for turbine generator exciter rotors |
| US3148167A (en) * | 1958-11-14 | 1964-09-08 | Gen Tire & Rubber Co | Polyurethane composition containing an epoxy compound |
| NL254978A (OSRAM) * | 1959-08-26 | |||
| US3278636A (en) * | 1960-06-21 | 1966-10-11 | Union Carbide Corp | Thermosetting compositions of carboxyl terminated polyesters and diglycidyl ethers |
| US3288766A (en) * | 1961-01-27 | 1966-11-29 | Ciba Ltd | Polyepoxide products cured with sulfur containing polyacid compounds |
| US3346532A (en) * | 1962-09-11 | 1967-10-10 | Gen Tire & Rubber Co | Elastomeric copolymers from dihydric phenols and organic diepoxides, their preparation and cure |
| US3264273A (en) * | 1962-10-12 | 1966-08-02 | Johnson & Johnson | Process for reacting a polyepoxide with a polyacid |
| US3502618A (en) * | 1967-09-28 | 1970-03-24 | Gen Tire & Rubber Co | Adhesive products comprising an epoxy resin,an aziridinyl compound and a catalytic amount of a compound containing both -nh and s-oh or s-oh groups |
| US3609122A (en) * | 1969-01-31 | 1971-09-28 | Gerald J Fleming | Nitro-substituted hydroxy-benzene glycidyl ethers and cured products thereof |
| US3529034A (en) * | 1969-02-11 | 1970-09-15 | Minnesota Mining & Mfg | One-part long-shelf-life epoxy-based compositions |
| GB1381262A (en) * | 1970-12-23 | 1975-01-22 | Unilever Ltd | Coating composition |
| US4255553A (en) * | 1975-05-21 | 1981-03-10 | Toyo Boseki Kabushiki Kaisha | Powder coating composition |
| JPS5321300A (en) * | 1976-08-11 | 1978-02-27 | Hitachi Cable Ltd | Epoxy resin composition |
| US4164487A (en) * | 1976-12-23 | 1979-08-14 | The Dow Chemical Company | Water-thinnable mixtures of base-neutralized products of reaction of H3 PO4 with polyether epoxides and with other type epoxides |
| US4423167A (en) | 1981-07-29 | 1983-12-27 | Ppg Industries, Inc. | Resinous compositions curable through a transesterification curing mechanism |
| US4423168A (en) | 1981-07-29 | 1983-12-27 | Ppg Industries, Inc. | Resinous compositions curable through a transesterification curing mechanism |
| US4489182A (en) * | 1981-07-29 | 1984-12-18 | Ppg Industries, Inc. | Resinous compositions curable through a transesterification curing mechanism |
| US4423169A (en) | 1981-07-29 | 1983-12-27 | Ppg Industries, Inc. | Resinous compositions curable through a transesterification curing mechanism |
| US4440612A (en) * | 1981-07-29 | 1984-04-03 | Ppg Industries, Inc. | Resinous compositions curable through a transesterification curing mechanism |
| US4703101A (en) * | 1985-08-19 | 1987-10-27 | Ppg Industries, Inc. | Liquid crosslinkable compositions using polyepoxides and polyacids |
| US4650718A (en) * | 1985-08-19 | 1987-03-17 | Ppg Industries, Inc. | Color plus clear coatings employing polyepoxides and polyacid curing agents |
| US4681811A (en) * | 1985-08-19 | 1987-07-21 | Ppg Industries, Inc. | Color plus clear coatings employing polyepoxides and polyacid curing agents in the clear coat |
| US4732791A (en) * | 1986-08-21 | 1988-03-22 | Ppg Industries, Inc. | Color plus clear application of thermosetting high solids coating composition of epoxies, polyols and anhydrides |
| US4732790A (en) * | 1986-08-21 | 1988-03-22 | Ppg Industries, Inc. | Color plus clear application of thermosetting high solids coating composition of hydroxy-functional epoxies and anhydrides |
| US4755582A (en) * | 1986-08-21 | 1988-07-05 | Ppg Industries, Inc. | Thermosetting high solids coating composition of hydroxy-functional epoxies and anhydrides |
| US4917955A (en) * | 1987-07-13 | 1990-04-17 | Ppg Industries, Inc. | Color plus clear composite coating having a catalyst-free base coat comprising polyepoxides and polyacid curing agents |
| US4849283A (en) * | 1987-07-16 | 1989-07-18 | Ppg Industries, Inc. | Composite coatings employing polyepoxides and polyacid curing agents in base coats |
| US4871806A (en) * | 1987-11-16 | 1989-10-03 | The Sherwin-Williams Company | Reactive coatings comprising an acid-functional compound, an anhydride-functional compound, an epoxy-functional compound and a hydroxy-functional compound |
| US4859758A (en) * | 1987-11-16 | 1989-08-22 | The Sherwin-Williams Company | Acid-functional polymers derived from cellulose ester-unsaturated alcohol copolymers, which are reacted with cyclic anhydrides |
| US5411809A (en) * | 1987-11-16 | 1995-05-02 | The Sherwin-Williams Company | Reactive coatings comprising an acid-functional compound, an anhydride-functional compound and an epoxy-functional compound |
| US5043220A (en) * | 1987-11-16 | 1991-08-27 | The Sherwin-Williams Company | Substrate coated with a basecoat and/or a clearcoat of an acid-functional compound, an anhydride-functional compound, an epoxy-functional compound and a hydroxy-functional compound |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2403343A (en) * | 1946-07-02 | Composition-of matter and method of | ||
| NL52346C (OSRAM) * | 1938-08-23 | |||
| US2558949A (en) * | 1945-09-18 | 1951-07-03 | Devoe & Raynolds Co | Polymeric polyether polyhydric alcohols |
| US2510885A (en) * | 1946-03-08 | 1950-06-06 | Devoe & Raynolds Co | Amine-epoxy-phenol compositions |
| US2494295A (en) * | 1946-09-13 | 1950-01-10 | Devoe & Raynolds Co | Compositions of resinous epoxides and aromatic sulfonamide-aldehyde condensates |
| US2506486A (en) * | 1948-04-21 | 1950-05-02 | Union Carbide & Carbon Corp | Thermosetting resin from a diphenol and a diglycidyl ether of a diphenol |
| US2676162A (en) * | 1949-06-28 | 1954-04-20 | Monsanto Chemicals | Fire retardant coating compositions containing a reaction product of phosphoryl chloride and anhydrous ammonia and articles coated therewith |
| US2591539A (en) * | 1950-10-03 | 1952-04-01 | Devoe & Raynolds Co | Resinous compositions |
-
0
- BE BE497540D patent/BE497540A/xx unknown
- NL NL79847D patent/NL79847C/xx active
-
1949
- 1949-08-12 CH CH284090D patent/CH284090A/de unknown
-
1950
- 1950-08-01 DE DEC1875A patent/DE863411C/de not_active Expired
- 1950-08-04 US US177774A patent/US2712535A/en not_active Expired - Lifetime
- 1950-08-11 GB GB20055/50A patent/GB739701A/en not_active Expired
- 1950-08-12 FR FR1023976D patent/FR1023976A/fr not_active Expired
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1023883B (de) * | 1951-12-07 | 1958-02-06 | Nat Res Dev | Verfahren zur Herstellung von Schaumstoffen, UEberzuegen oder Klebverbindungen aus haertbaren Kunstharzen und Diisocyanaten |
| DE1137428B (de) * | 1955-05-09 | 1962-10-04 | Johnson & Son Inc S C | Verfahren zur Herstellung von Weichmachern |
| DE1096600B (de) * | 1955-12-19 | 1961-01-05 | Minnesota Mining & Mfg | Verfahren zur Herstellung ausgehaerteter Kunstharze durch Umsetzung von Epoxydgruppen aufweisenden Kunstharzen |
| DE1076365B (de) * | 1957-09-25 | 1960-02-25 | Bayer Ag | Verfahren zum Haerten von Polyepoxyverbindungen |
| DE1227660B (de) * | 1958-10-13 | 1966-10-27 | Union Carbide Corp | Verfahren zur Herstellung von Formteilen |
| DE1227659B (de) * | 1958-10-13 | 1966-10-27 | Union Carbide Corp | Verfahren zur Herstellung von Formteilen |
| DE1490427B1 (de) * | 1963-07-11 | 1969-11-20 | Siemens Ag | Glimmerband zur Herstellung einer mit einer heisshaertbaren Traenkharzmischung impraegnierten Isolierung fuer elektrische Leiter,insbesondere fuer Wicklungsstaebe bzw. Spulen elektrischer Maschinen |
Also Published As
| Publication number | Publication date |
|---|---|
| US2712535A (en) | 1955-07-05 |
| FR1023976A (fr) | 1953-03-26 |
| NL79847C (OSRAM) | |
| BE497540A (OSRAM) | |
| CH284090A (de) | 1952-07-15 |
| GB739701A (en) | 1955-11-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE863411C (de) | Verfahren zur Herstellung elastischer Kunststoffe | |
| DE895833C (de) | Verfahren zur Herstellung einer Harzloesung | |
| DE2262025A1 (de) | Epoxyharzmassen und verfahren zu ihrer herstellung | |
| DE1645414A1 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE1009808B (de) | Verfahren zur Herstellung von Lack- und Giessharzen aus Polyglycidylaethern | |
| DE1495012A1 (de) | Verfahren zur Herstellung von Epoxyharzen | |
| EP0050742A1 (de) | Transparente kochwasser- und sterilisationsbeständige Polyamide | |
| DE2602988C3 (de) | Vulkanisierbare Masse und deren Verwendung | |
| DE698389C (OSRAM) | ||
| DE888617C (de) | Verfahren zur Herstellung von stickstoffhaltigen Polykondensaten | |
| DE594197C (de) | Verfahren zur Herstellung harzartiger Massen und Lacke | |
| DE828915C (de) | Verfahren zur Herstellung von schnellhaertenden Giessharzen aus Phenol und Formaldehyd | |
| DE554857C (de) | Verfahren zur Herstellung von Harzen aus Pentaerythrit | |
| DE363917C (de) | Verfahren zur Herstellung unloeslicher und unschmelzbarer Isoliermassen | |
| DE1107934B (de) | Hitzehaertbare, plastische Form-, Kleb- und UEberzugsmasse | |
| DE1720574C3 (OSRAM) | ||
| DE1040783B (de) | Verfahren zur Herstellung von gehaerteten Kunststoffen auf Grundlage von Polyestern und Epoxyverbindungen | |
| DE1795852C2 (de) | Verfahren zur Herstellung von Epoxidpolyaddukten | |
| DE534215C (de) | Verfahren zur Herstellung von Kondensationsprodukten | |
| DE1091746B (de) | Verfahren zum Haerten von Polyepoxyden | |
| DE561050C (de) | Verfahren zur Herstellung von Harnstoff-Formaldehyd-Kondensationsprodukten | |
| DE1493075A1 (de) | Freie Aminogruppen enthaltende Stoffkompositionen und Verfahren zu deren Herstellung | |
| DE916467C (de) | Verfahren zur Herstellung von hochpolymeren Kondensationsprodukten | |
| DE555001C (de) | Verfahren zur Herstellung biegsamer Kunstharze | |
| DE1645182C (de) | Verfahren zur Herstellung stick stofThaltiger Epoxypolyaddukte |