DE857738C - Verfahren zur Verhinderung von Fleckenbildungen auf Farbbildern - Google Patents
Verfahren zur Verhinderung von Fleckenbildungen auf FarbbildernInfo
- Publication number
- DE857738C DE857738C DEP49482A DEP0049482A DE857738C DE 857738 C DE857738 C DE 857738C DE P49482 A DEP49482 A DE P49482A DE P0049482 A DEP0049482 A DE P0049482A DE 857738 C DE857738 C DE 857738C
- Authority
- DE
- Germany
- Prior art keywords
- color
- water
- washed
- aqueous solution
- bleaching
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 14
- 238000010186 staining Methods 0.000 title description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- -1 amino, hydroxyl Chemical group 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 18
- 238000001035 drying Methods 0.000 claims description 11
- 239000007864 aqueous solution Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- USDJGQLNFPZEON-UHFFFAOYSA-N [[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol Chemical compound OCNC1=NC(NCO)=NC(NCO)=N1 USDJGQLNFPZEON-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims description 2
- 238000004061 bleaching Methods 0.000 claims 4
- 239000000243 solution Substances 0.000 description 10
- 239000000839 emulsion Substances 0.000 description 9
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 6
- 229910052709 silver Inorganic materials 0.000 description 6
- 239000004332 silver Substances 0.000 description 6
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 5
- 239000007844 bleaching agent Substances 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 2
- JTTIOYHBNXDJOD-UHFFFAOYSA-N 2,4,6-triaminopyrimidine Chemical compound NC1=CC(N)=NC(N)=N1 JTTIOYHBNXDJOD-UHFFFAOYSA-N 0.000 description 1
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- QMJDEXCUIQJLGO-UHFFFAOYSA-N [4-(methylamino)phenyl] hydrogen sulfate Chemical compound CNC1=CC=C(OS(O)(=O)=O)C=C1 QMJDEXCUIQJLGO-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 235000011126 aluminium potassium sulphate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229940050271 potassium alum Drugs 0.000 description 1
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/3046—Processing baths not provided for elsewhere, e.g. final or intermediate washings
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US40010A US2487569A (en) | 1948-07-21 | 1948-07-21 | Antistain baths for color photographic materials |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE857738C true DE857738C (de) | 1952-12-01 |
Family
ID=21908578
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP49482A Expired DE857738C (de) | 1948-07-21 | 1949-07-21 | Verfahren zur Verhinderung von Fleckenbildungen auf Farbbildern |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2487569A (cg-RX-API-DMAC7.html) |
| BE (1) | BE490235A (cg-RX-API-DMAC7.html) |
| CH (1) | CH291226A (cg-RX-API-DMAC7.html) |
| DE (1) | DE857738C (cg-RX-API-DMAC7.html) |
| FR (1) | FR990966A (cg-RX-API-DMAC7.html) |
| GB (1) | GB659362A (cg-RX-API-DMAC7.html) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE960517C (de) * | 1950-07-12 | 1957-03-21 | Agfa Ag Fuer Photogabrikation | Verfahren zur Herstellung haltbarer subtraktiver farbenphotographischer Bilder |
| US2647057A (en) * | 1950-10-31 | 1953-07-28 | Pavelle Color Inc | Protecting color pictures exposed to high humidities against fading and staining |
| BE507496A (cg-RX-API-DMAC7.html) * | 1950-12-01 | |||
| US3053656A (en) * | 1954-07-01 | 1962-09-11 | Polaroid Corp | Photographic silver halide developers containing triazine rings |
| BE563764A (cg-RX-API-DMAC7.html) * | 1957-01-10 | |||
| BE567153A (cg-RX-API-DMAC7.html) * | 1957-04-26 | |||
| US2983611A (en) * | 1957-09-16 | 1961-05-09 | Eastman Kodak Co | Gelatin compositions containing hardeners |
| US2994637A (en) * | 1957-11-13 | 1961-08-01 | Diamond Alkali Co | Aminopyrimidines as fungicides |
| US2980678A (en) * | 1958-01-06 | 1961-04-18 | Ici Ltd | Pyrimidines |
| US2976207A (en) * | 1959-02-27 | 1961-03-21 | Standard Oil Co | Dihydroxy-aminotriazine insecticides |
| US3249603A (en) * | 1960-08-09 | 1966-05-03 | Hoffmann La Roche | Novel pyrimidine sulfanilamides and processes for their preparation |
| US3325287A (en) * | 1963-11-26 | 1967-06-13 | Fuji Photo Film Co Ltd | Photographic gelatin hardening composition |
| GB1090802A (en) * | 1964-02-21 | 1967-11-15 | Ici Ltd | Coating process |
| US3473929A (en) * | 1965-09-09 | 1969-10-21 | Eastman Kodak Co | Method of inhibiting discoloration of color photographs |
| US3461461A (en) * | 1965-11-01 | 1969-08-12 | Upjohn Co | 6-amino-4-(substituted amino)-1,2-dihydro-1-hydroxy-2-iminopyrimidines |
| US3464987A (en) * | 1966-02-21 | 1969-09-02 | Upjohn Co | 1,2-dihydro-1-hydroxy-2-imino-6-(lower alkyl)pyrimidines |
| US3429878A (en) * | 1967-01-31 | 1969-02-25 | Smithkline Corp | 6-amino-5-methyleneaminopyrimidines |
| US4255574A (en) * | 1973-02-26 | 1981-03-10 | Hoffmann-La Roche Inc. | Process for preparing 2,4-diamino-pyrimidines |
| DE2516117C2 (de) * | 1975-04-12 | 1984-08-16 | Henkel Kgaa, 4000 Duesseldorf | Haarfärbemittel |
| US4126459A (en) * | 1976-05-14 | 1978-11-21 | Polaroid Corporation | Thioether substituted silver halide solvents |
| US4336255A (en) * | 1981-03-24 | 1982-06-22 | Smithkline Corporation | Pharmaceutical compositions containing guanidinopyrimidines |
| US4336254A (en) * | 1981-03-24 | 1982-06-22 | Smithkline Corporation | Guanidinopyrimidine compounds, compositions and method of using as a diuretic |
| JPS59218445A (ja) * | 1983-05-25 | 1984-12-08 | Fuji Photo Film Co Ltd | カラ−写真感光材料 |
| JPS60260952A (ja) * | 1984-06-08 | 1985-12-24 | Konishiroku Photo Ind Co Ltd | ハロゲン化銀写真感光材料の処理方法及び処理液 |
| US4786583A (en) * | 1987-06-22 | 1988-11-22 | Eastman Kodak Company | Stabilizing bath for use in photographic processing |
| US5217852A (en) * | 1990-12-07 | 1993-06-08 | Fuji Photo Film Co., Ltd. | Color image-stabilization processing solution used for processing a silver halide color photographic material and a processing method using the same |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2384658A (en) * | 1943-07-10 | 1945-09-11 | Eastman Kodak Co | Color photography |
| US2440954A (en) * | 1945-08-23 | 1948-05-04 | Du Pont | Process for eliminating stain from color-yielding elements by treatment with aromatic aldehydes containing an acyl group |
-
0
- BE BE490235D patent/BE490235A/xx unknown
-
1948
- 1948-07-21 US US40010A patent/US2487569A/en not_active Expired - Lifetime
-
1949
- 1949-05-27 GB GB14278/49A patent/GB659362A/en not_active Expired
- 1949-07-19 FR FR990966D patent/FR990966A/fr not_active Expired
- 1949-07-21 DE DEP49482A patent/DE857738C/de not_active Expired
- 1949-07-21 CH CH291226D patent/CH291226A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE490235A (cg-RX-API-DMAC7.html) | |
| CH291226A (fr) | 1953-06-15 |
| FR990966A (fr) | 1951-09-28 |
| GB659362A (en) | 1951-10-24 |
| US2487569A (en) | 1949-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE857738C (de) | Verfahren zur Verhinderung von Fleckenbildungen auf Farbbildern | |
| DE3333227C2 (cg-RX-API-DMAC7.html) | ||
| DE817554C (de) | Verfahren zur Erzeugung von Phenazoniumfarbstoffbildern | |
| DE2901468C2 (de) | Verfahren zum Herstellen farbiger Bilder mit einem farbphotographischen, silberhalogenidhaltigen Aufzeichnungsmaterial | |
| DE1290812B (de) | Verfahren zum Bleichfixieren von photographischen Silberbildern | |
| DE851723C (de) | Verfahren zur Herstellung von farbigen fotografischen Bildern in einer fotografischen Mehrfarbenemulsion | |
| DE2448433C2 (de) | Wässriges Behandlungsbad zur kombinierten Farb- und Silberbleichung und Verfahren zur Verarbeitung von Silberfarbbleichmaterialien | |
| DE851901C (de) | Schichten fuer die Diazotypie | |
| US2788274A (en) | Process of inhibiting the discoloration of photographic color images | |
| DE1572125B2 (de) | Fotografisches Material für die Herstellung direktpositiver Bilder | |
| DE941769C (de) | Silber-Farbstoff-Bleichbaeder mit Katalysatoren | |
| DE2554528C3 (de) | Bleichfixierbad | |
| DE1814834A1 (de) | Photographische Verarbeitungsfluessigkeit | |
| DE2708020C2 (de) | Farbentwickler für farbphotographische Aufzeichnungsmaterialien | |
| DE1043806B (de) | Verfahren zur Herstellung eines stabilen Blaubildes in photographischem Farbenentwicklungsmaterial | |
| DE1202638B (de) | Photographisches Entwicklungsverfahren zur Herstellung von Farbbildern nach dem Farbentwicklungsverfahren | |
| DE3687009T2 (de) | Verfahren zur behandlung eines farbphotographischen lichtempfindlichen silberhalogenidmaterials. | |
| DE902220C (de) | Farbbleichbad fuer die Farbenphotographie | |
| DE2727090A1 (de) | Farbphotographisches entwicklungsverfahren | |
| DE2738190A1 (de) | Verfahren zur erzeugung von photographischen bildern | |
| DE825206C (de) | Farbbleichbad fuer die Herstellung von farbigen Bildern in photographischen Emulsionsschichten | |
| DE2332426A1 (de) | Einen acyclischen harnstoff als aldehydentferner enthaltendes photographisches aufzeichnungsmaterial und verfahren zu seiner herstellung | |
| DE1271543B (de) | Photographisches Material mit mindestens einer Silberhalogenidemulsionsschicht und einer UV-Licht absorbierenden Schicht | |
| DE2548897A1 (de) | Verfahren zur behandlung farbphotographischer materialien | |
| DE2524431A1 (de) | Verfahren zur herstellung eines positiven farbphotographischen bildes |