DE809564C - Viel-Kontakt-Relais - Google Patents
Viel-Kontakt-RelaisInfo
- Publication number
- DE809564C DE809564C DEP28900D DEP0028900D DE809564C DE 809564 C DE809564 C DE 809564C DE P28900 D DEP28900 D DE P28900D DE P0028900 D DEP0028900 D DE P0028900D DE 809564 C DE809564 C DE 809564C
- Authority
- DE
- Germany
- Prior art keywords
- springs
- card
- relay
- contact
- core
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004804 winding Methods 0.000 claims description 14
- 230000005284 excitation Effects 0.000 claims description 5
- 239000011810 insulating material Substances 0.000 claims description 5
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 239000000725 suspension Substances 0.000 claims 1
- 210000002105 tongue Anatomy 0.000 description 9
- 239000000696 magnetic material Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 238000005538 encapsulation Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- 230000004308 accommodation Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B28—WORKING CEMENT, CLAY, OR STONE
- B28B—SHAPING CLAY OR OTHER CERAMIC COMPOSITIONS; SHAPING SLAG; SHAPING MIXTURES CONTAINING CEMENTITIOUS MATERIAL, e.g. PLASTER
- B28B1/00—Producing shaped prefabricated articles from the material
- B28B1/52—Producing shaped prefabricated articles from the material specially adapted for producing articles from mixtures containing fibres, e.g. asbestos cement
- B28B1/526—Producing shaped prefabricated articles from the material specially adapted for producing articles from mixtures containing fibres, e.g. asbestos cement by delivering the materials on a conveyor of the endless-belt type
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H50/00—Details of electromagnetic relays
- H01H50/54—Contact arrangements
- H01H50/56—Contact spring sets
- H01H50/58—Driving arrangements structurally associated therewith; Mounting of driving arrangements on armature
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H51/00—Electromagnetic relays
- H01H51/02—Non-polarised relays
- H01H51/04—Non-polarised relays with single armature; with single set of ganged armatures
- H01H51/06—Armature is movable between two limit positions of rest and is moved in one direction due to energisation of an electromagnet and after the electromagnet is de-energised is returned by energy stored during the movement in the first direction, e.g. by using a spring, by using a permanent magnet, by gravity
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Chemical & Material Sciences (AREA)
- Ceramic Engineering (AREA)
- Mechanical Engineering (AREA)
- Electromagnets (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US993A US2608630A (en) | 1948-01-07 | 1948-01-07 | Relay |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE809564C true DE809564C (de) | 1951-07-30 |
Family
ID=21693875
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP28900D Expired DE809564C (de) | 1948-01-07 | 1948-12-31 | Viel-Kontakt-Relais |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2608630A (enFirst) |
| BE (1) | BE486190A (enFirst) |
| CH (1) | CH277468A (enFirst) |
| DE (1) | DE809564C (enFirst) |
| FR (1) | FR972273A (enFirst) |
| GB (1) | GB650220A (enFirst) |
| NL (3) | NL74048C (enFirst) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1015537B (de) * | 1952-05-24 | 1957-09-12 | Western Electric Co | Elektromagnetisches Relais |
| DE966844C (de) * | 1950-06-22 | 1957-09-12 | Rolf Albin Zander | Elektrischer Steuermagnet |
| DE1141717B (de) * | 1958-02-17 | 1962-12-27 | Wolfgang Gruner | Kleinrelais mit Drahtfederkontakten |
| DE1246880B (de) * | 1961-12-22 | 1967-08-10 | Budavox Budapesti Hiradastechn | Elektromagnetisches Mehrkontakt-Relais |
| DE1247488B (de) * | 1963-03-21 | 1967-08-17 | Guardian Electric Mfg Co | Elektromagnetisches Relais |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE959478C (de) * | 1953-09-16 | 1957-03-07 | Standard Elek K Ag | Betaetigung des Kontaktfedersatzes bei elektromagnetischen Relais |
| US2894095A (en) * | 1954-07-08 | 1959-07-07 | Ericsson Telefon Ab L M | Contact device |
| DE1074755B (de) * | 1955-06-03 | 1960-02-04 | Stockholm Erik Arne Angerby Walter Otto Wilhelm Broberg Nynäshamn und Rolf Albin Zander Stockholm Sten Daniel Vigren (Schweden) | Kontaktfedersatz |
| US2896045A (en) * | 1957-11-08 | 1959-07-21 | American Nat Bank | Relay with clamp-contact assembly |
| DE1065093B (de) * | 1958-04-24 | 1959-09-10 | Siemens Ag | Elektromagnetische Relais |
| US3211854A (en) * | 1961-11-14 | 1965-10-12 | Sigma Instruments Inc | Electro-magnetic relay utilizing spring clip means to facilitate assembly of the relay |
| US3270301A (en) * | 1963-06-13 | 1966-08-30 | Sigma Instruments Inc | Plug-in type miniature relay with transparent cover |
| US3210499A (en) * | 1963-07-02 | 1965-10-05 | Peter A Sosnoski | Small current flow relay switch |
| US3290629A (en) * | 1964-05-25 | 1966-12-06 | Bell Telephone Labor Inc | Wire spring relay with improved means for determining contact force |
| DE1764965A1 (de) * | 1968-09-13 | 1972-01-13 | Standard Elek K Lorenz Ag | Kontaktfederanordnung fuer elektromagnetische Vielkontaktrelais |
| SE334420B (enFirst) * | 1969-05-30 | 1971-04-26 | Ericsson Telefon Ab L M | |
| FR2071519A5 (enFirst) * | 1969-12-31 | 1971-09-17 | Telic | |
| US4041425A (en) * | 1975-06-18 | 1977-08-09 | Gte Automatic Electric Laboratories Incorporated | Miniature low profile relay |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB160888A (en) * | 1919-11-28 | 1921-03-29 | Siemens Brothers & Co Ltd | Improvements in or relating to electric relays |
| DE347909C (de) * | 1920-05-07 | 1922-01-27 | Hermes Erste Saechsische Akt G | Relais mit gestanztem Mantel |
| US1647792A (en) * | 1921-06-20 | 1927-11-01 | Western Electric Co | Switching device |
| US1521591A (en) * | 1921-06-20 | 1925-01-06 | Western Electric Co | Electromagnetic device |
| DE438791C (de) * | 1925-05-02 | 1926-12-23 | Zwietusch E & Co Gmbh | Elektromagnetisches Relais mit einem parallel zum flachen, gestreckten Kern angeordneten, ebenfalls flachen Anker |
| DE565492C (de) * | 1931-01-01 | 1932-12-01 | Siemens & Halske Akt Ges | Elektromagnetische Schalteinrichtung mit mehreren mit magnetischer Funkenloeschung ausgeruesteten Kontaktstellen |
| BE386615A (enFirst) * | 1931-03-10 | |||
| US1991210A (en) * | 1932-07-20 | 1935-02-12 | Western Electric Co | Electromagnetic device |
| GB511092A (en) * | 1938-06-13 | 1939-08-14 | Sten Daniel Vigren | Improvements in or relating to electrical switching apparatus and sets of contact springs therefor |
| US2323961A (en) * | 1941-12-31 | 1943-07-13 | Bell Telephone Labor Inc | Relay armature |
| NL62251C (enFirst) * | 1942-10-19 | |||
| US2461360A (en) * | 1943-10-16 | 1949-02-08 | Stromberg Carlson Co | Relay |
| US2500413A (en) * | 1945-11-26 | 1950-03-14 | Clare & Co C P | Gang relay switch arrangement |
| US2472709A (en) * | 1947-02-06 | 1949-06-07 | Bell Telephone Labor Inc | Control of electrical contacting elements |
-
0
- NL NL63299254A patent/NL143490B/xx unknown
- NL NL74043D patent/NL74043C/xx active
- NL NL74048D patent/NL74048C/xx active
- BE BE486190D patent/BE486190A/xx unknown
-
1948
- 1948-01-07 US US993A patent/US2608630A/en not_active Expired - Lifetime
- 1948-09-25 FR FR972273D patent/FR972273A/fr not_active Expired
- 1948-11-05 CH CH277468D patent/CH277468A/de unknown
- 1948-12-31 DE DEP28900D patent/DE809564C/de not_active Expired
- 1948-12-31 GB GB33613/48A patent/GB650220A/en not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE966844C (de) * | 1950-06-22 | 1957-09-12 | Rolf Albin Zander | Elektrischer Steuermagnet |
| DE1015537B (de) * | 1952-05-24 | 1957-09-12 | Western Electric Co | Elektromagnetisches Relais |
| DE1141717B (de) * | 1958-02-17 | 1962-12-27 | Wolfgang Gruner | Kleinrelais mit Drahtfederkontakten |
| DE1246880B (de) * | 1961-12-22 | 1967-08-10 | Budavox Budapesti Hiradastechn | Elektromagnetisches Mehrkontakt-Relais |
| DE1247488B (de) * | 1963-03-21 | 1967-08-17 | Guardian Electric Mfg Co | Elektromagnetisches Relais |
Also Published As
| Publication number | Publication date |
|---|---|
| CH277468A (de) | 1951-08-31 |
| NL143490B (nl) | |
| NL74043C (enFirst) | |
| FR972273A (fr) | 1951-01-29 |
| US2608630A (en) | 1952-08-26 |
| NL74048C (enFirst) | |
| BE486190A (enFirst) | |
| GB650220A (en) | 1951-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE809564C (de) | Viel-Kontakt-Relais | |
| DE4135305C2 (enFirst) | ||
| DE1238534B (de) | Schaltvorrichtung fuer Kontaktfederleisten | |
| DE9211726U1 (de) | Elektromagnetisches Relais | |
| DE69614657T2 (de) | Kontakttragender Schieber für Schütze | |
| DE3406832C2 (de) | Klappankerrelais | |
| DE2537462C3 (de) | Elektromagnetisches Relais | |
| DE1277440B (de) | Elektromagnetisch betaetigtes Schaltgeraet | |
| DE3443094C2 (de) | Elektromagnetisches Relais | |
| DE825709C (de) | Kontaktfedersatz | |
| DE2619002A1 (de) | Elektromagnetisches relais und verfahren zur herstellung desselben | |
| DE2550943B2 (de) | Schraubenlose elektrische klemme | |
| DE19710459B4 (de) | Hilfsbetätigungsorgan für einen Anschlußblock | |
| AT501539B1 (de) | Anschlussverbindungseinheit | |
| CH642195A5 (de) | Elektromagnetisches relais. | |
| DE2126154A1 (de) | Schaltsystem mit in Längs- und Querreihen angeordneten Kontaktgruppen | |
| DE1614837B2 (de) | Elektromagnetisches schuetz | |
| DE1254249B (de) | Steckbare Relais-Anordnung | |
| DE2808207C3 (de) | Elektromagnetisches Klappankerrelais | |
| DE2532527A1 (de) | Elektrisches relais | |
| DE3328684C1 (de) | Ankerhaltefeder für DIL-Relais | |
| DE2027330C3 (de) | Elektromagnetisches Flachrelais | |
| DE102004013471B4 (de) | Elektromagnetisches Relais, insbesondere Hochstromrelais | |
| DE1952476A1 (de) | Kontaktfedersatz | |
| DE2253734C3 (de) | Elektrischer Zeitschalter, insbesondere Treppenlichtzeitschalter |