DE762522A - - Google Patents
Info
- Publication number
- DE762522A DE762522A DE762522A DE 762522 A DE762522 A DE 762522A DE 762522 A DE762522 A DE 762522A
- Authority
- DE
- Germany
- Prior art keywords
- diazo
- compounds
- light
- aminodiazo
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 7
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 2
- 150000008049 diazo compounds Chemical class 0.000 description 8
- 235000002639 sodium chloride Nutrition 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000011514 reflex Effects 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- JLDKNVUJLUGIBQ-UHFFFAOYSA-N 1-chloro-3-methyl-2-nitrobenzene Chemical compound CC1=CC=CC(Cl)=C1[N+]([O-])=O JLDKNVUJLUGIBQ-UHFFFAOYSA-N 0.000 description 2
- VCHSXYHBMFKRBK-UHFFFAOYSA-N 4771-47-5 Chemical compound OC(=O)C1=CC=CC(Cl)=C1[N+]([O-])=O VCHSXYHBMFKRBK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- -1 2-methyl-6-dimethylamino-i-benzene diazonium chloride Chemical compound 0.000 description 1
- FGMRHNYMZYMARX-UHFFFAOYSA-N 3-amino-2-nitrobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1[N+]([O-])=O FGMRHNYMZYMARX-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ZBHADFXDTSTADC-UHFFFAOYSA-M [Cd]Cl Chemical compound [Cd]Cl ZBHADFXDTSTADC-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FCAMUPIRWKNASD-UHFFFAOYSA-N n,n-dimethyl-1-(2-nitrophenyl)methanamine Chemical compound CN(C)CC1=CC=CC=C1[N+]([O-])=O FCAMUPIRWKNASD-UHFFFAOYSA-N 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 1
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE1930215C3 (de) | Farbfotografisches Diffusionsübertragungsverfahren und zugehöriges fotografisches Material | |
DE676394C (de) | Verfahren zur Herstellung von lichtempfindlichen Schichten fuer die Diazotypie | |
DE2952280A1 (de) | Lichtempfindliches fotografisches material, verfahren zur herstellung fotografischer bilder, entwicklungsbaeder sowie neue hydrochinone | |
DE762522A (enrdf_load_stackoverflow) | ||
DE885815C (de) | Hochempfindliche Halogensilberemulsion fuer das Silber-Farbstoff-Ausbleichverfahren | |
DE1174612B (de) | Diazotypiematerial | |
DE1768687A1 (de) | Lichtempfindliche Diazoverbindungen und lichtempfindliches,mit diesen Diazoverbindungen hergestelltes Material | |
EP0250954B1 (de) | Farbfotografisches Aufzeichnungsmaterial mit einem Farbabspalter für blaugrüne Farbstoffe und ein mit diesen Farbstoffen erzeugtes Farbbild | |
DE1064807B (de) | Photographisches Silbersalz-Diffusionsuebertragungsverfahren | |
DE694078C (de) | Lichtempfindliche Schichten | |
DE2719371A1 (de) | Photographisches umkehrverfahren | |
DE2027279C3 (de) | Gelbe Azomethin-Chromkomplex-Entwicklerfarbstoffe und ihre Verwendung | |
DE530850C (de) | Lichtempfindliche Schicht | |
DE2353470C2 (enrdf_load_stackoverflow) | ||
DE1291623B (de) | Lichtempfindliches farbphotographisches Material | |
DE1299223B (de) | Verwendung von Benzoylacetaniliden als Farbbildner fuer Gelb | |
DE720959C (de) | Verfahren zur Herstellung von Kopien mit Hilfe von lichtempfindlichen Eisensalzen | |
AT247717B (de) | Verfahren zur Herstellung farbiger Bilder nach der Silberfarbbleichmethode | |
DE1930006C3 (de) | Lichtempfindliches Zweikomponenten-Diazotypiematerial | |
DE1239568B (de) | Zweikomponenten-Diazotypiematerial | |
DE1547998C3 (de) | Verwendung von 2,3,5- oder 2,3,6- Trimethyl-p-aminophenol zur Entwicklung unterbelichteter Aufzeichnungsmaterialien für das Silbersalzdiffusionsübertragungsverfahren | |
DE1497013C (de) | Elektrophotographisches Aufzeichnungs material | |
AT151987B (de) | Verfahren zur Herstellung von lichtempfindlichen Schichten. | |
DE838690C (de) | Azokomponenten fuer Diazotypie-Lichtpausen | |
DE1246401B (de) | Diazotypieverfahren, bei dem als Azokomponente ein 2-Hydroxy-3-naphthoesaeureamid verwendet wird |