DE7025537U - Tanzende puppe. - Google Patents
Tanzende puppe.Info
- Publication number
- DE7025537U DE7025537U DE7025537U DE7025537U DE7025537U DE 7025537 U DE7025537 U DE 7025537U DE 7025537 U DE7025537 U DE 7025537U DE 7025537 U DE7025537 U DE 7025537U DE 7025537 U DE7025537 U DE 7025537U
- Authority
- DE
- Germany
- Prior art keywords
- doll
- leg
- legs
- torso
- animated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000010355 oscillation Effects 0.000 claims 2
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 239000000463 material Substances 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 239000011354 acetal resin Substances 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 235000013175 Crataegus laevigata Nutrition 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 101000933542 Homo sapiens Transcription factor BTF3 Proteins 0.000 description 1
- 241001293250 Lagascea decipiens Species 0.000 description 1
- 102100026043 Transcription factor BTF3 Human genes 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 210000001520 comb Anatomy 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 239000010977 jade Substances 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H13/00—Toy figures with self-moving parts, with or without movement of the toy as a whole
- A63H13/02—Toy figures with self-moving parts, with or without movement of the toy as a whole imitating natural actions, e.g. catching a mouse by a cat, the kicking of an animal
- A63H13/04—Mechanical figures imitating the movement of players or workers
- A63H13/12—Gymnastic or acrobatic toy figures
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H11/00—Self-movable toy figures
- A63H11/18—Figure toys which perform a realistic walking motion
Landscapes
- Toys (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US86099869A | 1969-09-25 | 1969-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE7025537U true DE7025537U (de) | 1970-10-01 |
Family
ID=25334601
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7025537U Expired DE7025537U (de) | 1969-09-25 | 1970-07-07 | Tanzende puppe. |
| DE19702033684 Pending DE2033684A1 (de) | 1969-09-25 | 1970-07-07 | Tanzende Puppe |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702033684 Pending DE2033684A1 (de) | 1969-09-25 | 1970-07-07 | Tanzende Puppe |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3599364A (enrdf_load_stackoverflow) |
| DE (2) | DE7025537U (enrdf_load_stackoverflow) |
| FR (1) | FR2060541A5 (enrdf_load_stackoverflow) |
| GB (1) | GB1304946A (enrdf_load_stackoverflow) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3949521A (en) * | 1971-10-22 | 1976-04-13 | Puppenfabrik Hans Gotz | Walking doll with sitting capability |
| US4244141A (en) * | 1977-02-18 | 1981-01-13 | Mattel, Inc. | Walking turning doll mechanism |
| US4457100A (en) * | 1982-09-27 | 1984-07-03 | Nightingale Christopher C | Figure kicking toy |
| WO1994001188A2 (en) * | 1992-07-14 | 1994-01-20 | Darren Gareth Saunders | Animated display |
| JPH08835A (ja) * | 1994-06-22 | 1996-01-09 | Seikouken Kk | 歩行人形 |
| US5695382A (en) * | 1996-11-12 | 1997-12-09 | Lin; Chung-Mei | Transmission mechanism of a motion toy doll |
| US6022263A (en) * | 1998-03-20 | 2000-02-08 | Lcd International, L.L.C. | Mechanical toy figures |
| US6093078A (en) * | 1999-02-04 | 2000-07-25 | Mattel, Inc. | Hand held doll simulating skating action |
| US6190230B1 (en) * | 2000-01-07 | 2001-02-20 | Chin-Jung Hou | Walking and rocking toy device |
| US20020193045A1 (en) * | 2001-05-08 | 2002-12-19 | Lee James S. W. | Toy robot apparatus and method |
| US20190262730A1 (en) * | 2018-02-26 | 2019-08-29 | Mattel, Inc. | Toy figurine having alternative movement configurations |
| EP4069392B1 (en) * | 2020-03-10 | 2023-12-13 | Lego A/S | Toy figurine with a button system |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US882403A (en) * | 1907-07-26 | 1908-03-17 | Wenceslaus F Mikolasek | Toy. |
| US1452134A (en) * | 1922-03-13 | 1923-04-17 | Zaiden David | Mechanical doll |
| US2644273A (en) * | 1951-04-18 | 1953-07-07 | Blinking Doll Entpr Inc | Animated motor actuated walking doll |
| US3243916A (en) * | 1963-11-27 | 1966-04-05 | John W Ryan | Walking toy |
| US3267608A (en) * | 1965-08-04 | 1966-08-23 | Mattel Inc | Walking toy |
-
1969
- 1969-09-25 US US860998A patent/US3599364A/en not_active Expired - Lifetime
-
1970
- 1970-07-07 DE DE7025537U patent/DE7025537U/de not_active Expired
- 1970-07-07 DE DE19702033684 patent/DE2033684A1/de active Pending
- 1970-07-10 FR FR7025801A patent/FR2060541A5/fr not_active Expired
- 1970-07-14 GB GB3402470A patent/GB1304946A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2033684A1 (de) | 1971-06-03 |
| FR2060541A5 (enrdf_load_stackoverflow) | 1971-06-18 |
| US3599364A (en) | 1971-08-17 |
| GB1304946A (enrdf_load_stackoverflow) | 1973-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE7025537U (de) | Tanzende puppe. | |
| DE202009001877U1 (de) | Stepper mit einer Umlenkrollen-Kopplungseinheit | |
| DE2405872A1 (de) | Mechanische puppe | |
| DE1603450C3 (de) | Antriebseinrichtung für die Beine einer selbstgehenden zweibeinigen Spielfigur | |
| DE2901107A1 (de) | Puppe | |
| DE19645703A1 (de) | Vorrichtung zum Blockieren der Räder von Motorrädern auf der Welle von Auswuchtmaschinen | |
| DE481725C (de) | Vorrichtung zur Darstellung der Schreitbewegungen von Vierfuesslern | |
| DE7636251U1 (de) | Figurenspielzeug mit einem die figurenglieder verbindenden getriebe | |
| DE1926267B2 (de) | Laufpuppe | |
| DE808556C (de) | Bewegungseinrichtung fuer Spielzeuge, welche die natuerlichen Bewegungen der menschlichen Beine nachbilden | |
| DE1603336C3 (de) | Steuereinrichtung für die Beine einer selbstgehenden zweibeinigen Spielzeugfigur | |
| EP3269430B1 (de) | Annäherung an eine natürliche gehbewegung im sitzen | |
| DE19509774A1 (de) | Fluggerät mit einem Antrieb durch Muskelkraft | |
| DE345945C (de) | Verbindung eines Apparates fuer Koerperpflege mit einem Spielzeug | |
| DE228239C (enrdf_load_stackoverflow) | ||
| DE476373C (de) | Reklamevorrichtung in Gestalt einer plastischen, beweglichen Darstellung eines Wettrennens | |
| DE582624C (de) | Fortschreitend laufende, huepfende, durch Schnurzug fortbewegte oder durch Schwerkraft auf einer schiefen Ebene selbstbewegliche Spielzeugtierfiguren | |
| DE1127817B (de) | Waeschezentrifuge mit elastischer Lagerung des Schleuderaggregats | |
| DE560872C (de) | Durch Schnurzug bewegte Spielzeugfigur, insbesondere in Gestalt eines Tieres mit vier beweglichen Beinen | |
| DE844875C (de) | Auf Raedern mittels Laufwerk fahrende Spielzeugfigur | |
| DE511493C (de) | Gewichtskraftmaschine | |
| DE698635C (de) | Durch ein Federlaufwerk angetriebene, ein Tier o. dgl. darstellende Vierfuesslerspielfigur | |
| DE833911C (de) | Laufpuppe | |
| AT87660B (de) | Menschliche oder tierische Spielzeugfigur mit gangartiger Fortbewegung. | |
| DE3501308A1 (de) | Vorrichtung zur bewegung der extremitaeten von puppen |