DE6948275U - Badespielzeug. - Google Patents
Badespielzeug.Info
- Publication number
- DE6948275U DE6948275U DE6948275U DE6948275U DE6948275U DE 6948275 U DE6948275 U DE 6948275U DE 6948275 U DE6948275 U DE 6948275U DE 6948275 U DE6948275 U DE 6948275U DE 6948275 U DE6948275 U DE 6948275U
- Authority
- DE
- Germany
- Prior art keywords
- water
- housing
- bath
- attached
- toy according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 98
- 239000007921 spray Substances 0.000 claims description 22
- 238000003287 bathing Methods 0.000 claims description 8
- 238000004146 energy storage Methods 0.000 claims description 6
- 239000004033 plastic Substances 0.000 claims description 5
- 239000008399 tap water Substances 0.000 claims description 2
- 235000020679 tap water Nutrition 0.000 claims description 2
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 claims 1
- 238000005086 pumping Methods 0.000 claims 1
- 239000000446 fuel Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000534414 Anotopterus nikparini Species 0.000 description 1
- 101100027969 Caenorhabditis elegans old-1 gene Proteins 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 101000933542 Homo sapiens Transcription factor BTF3 Proteins 0.000 description 1
- 241001580017 Jana Species 0.000 description 1
- 101100450138 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) hat-2 gene Proteins 0.000 description 1
- 102100026043 Transcription factor BTF3 Human genes 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- RWYFURDDADFSHT-RBBHPAOJSA-N diane Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.C1=C(Cl)C2=CC(=O)[C@@H]3CC3[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 RWYFURDDADFSHT-RBBHPAOJSA-N 0.000 description 1
- 230000035622 drinking Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000002991 molded plastic Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000009182 swimming Effects 0.000 description 1
- 210000000689 upper leg Anatomy 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H23/00—Toy boats; Floating toys; Other aquatic toy devices
- A63H23/10—Other water toys, floating toys, or like buoyant toys
Landscapes
- Toys (AREA)
- Massaging Devices (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US84187269A | 1969-07-15 | 1969-07-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE6948275U true DE6948275U (de) | 1970-07-02 |
Family
ID=25285907
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE6948275U Expired DE6948275U (de) | 1969-07-15 | 1969-12-13 | Badespielzeug. |
| DE19691962595 Pending DE1962595A1 (de) | 1969-07-15 | 1969-12-13 | Badespielzeug |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691962595 Pending DE1962595A1 (de) | 1969-07-15 | 1969-12-13 | Badespielzeug |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3577675A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS4946866B1 (cg-RX-API-DMAC10.html) |
| DE (2) | DE6948275U (cg-RX-API-DMAC10.html) |
| FR (1) | FR2055161A5 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1267185A (cg-RX-API-DMAC10.html) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4057244A (en) * | 1975-03-13 | 1977-11-08 | Gaspar Phyllis L | Child's play seat apparatus |
| US4206565A (en) * | 1978-02-09 | 1980-06-10 | Goldfarb Adolph E | Liquid activity toy |
| US4223471A (en) * | 1978-12-13 | 1980-09-23 | Shelcore, Inc. | Aquarium crib toy |
| USD262550S (en) | 1980-01-04 | 1982-01-05 | The Quaker Oats Company | Water activity toy |
| US4689032A (en) * | 1985-11-29 | 1987-08-25 | Hasbro, Inc. | Water toy |
| JPS63158372U (cg-RX-API-DMAC10.html) * | 1987-04-07 | 1988-10-17 | ||
| IT213671Z2 (it) * | 1988-01-22 | 1990-01-22 | Perego Pines Gmbh | Girello per bambini di tipo perfezionato. |
| DE3803306A1 (de) * | 1988-02-04 | 1989-08-24 | Lennart Dahlgren | Wasserspielzeug |
| US4951329A (en) * | 1988-09-14 | 1990-08-28 | Century Products Company | Child's play shower |
| US5231707A (en) * | 1991-10-07 | 1993-08-03 | Ashley Kevin M | Splash guard apparatus |
| US5336122A (en) * | 1992-10-26 | 1994-08-09 | Lewis James C | Educational apparatus with pump for use in bathtub |
| US5454745A (en) * | 1994-08-29 | 1995-10-03 | Hasbro, Inc. | Activity toy |
| US5839964A (en) * | 1997-03-03 | 1998-11-24 | Elliot A. Rudell | Water toy release mechanism |
| US6206384B1 (en) * | 1999-02-01 | 2001-03-27 | Unimax Toys Ltd. | Doll walker with activity toy |
| US6358113B1 (en) * | 2000-08-04 | 2002-03-19 | The Little Tikes Company | Doll nursery |
| US6699097B2 (en) | 2001-02-09 | 2004-03-02 | Elliot Rudell | Toys with timer-activated controllable operation time |
| US6652350B1 (en) * | 2002-07-25 | 2003-11-25 | Charles Phillips | Automobile seat toy |
| US6964595B2 (en) * | 2002-12-20 | 2005-11-15 | Mattel, Inc | Child's infant-care play center |
| US7363673B2 (en) | 2003-02-13 | 2008-04-29 | Black & Decker Inc. | Hand held scrubbing tool |
| US20050106991A1 (en) * | 2003-09-19 | 2005-05-19 | Marine Jon C. | Plush doll shampoo toy set |
| JP4895825B2 (ja) | 2004-01-20 | 2012-03-14 | トムソン ライセンシング | テレビ制作技術 |
| US7414337B2 (en) | 2005-03-14 | 2008-08-19 | Black & Decker Inc. | Scrubber |
| US20080268410A1 (en) * | 2007-04-30 | 2008-10-30 | Ed Pemberton | Method and apparatus for teaching students to hold their breath |
| US20100151766A1 (en) * | 2008-09-11 | 2010-06-17 | Louis Raymond Hartings | Toy kit for simulating a thematic food environment in a bathtub |
| GB2482804B8 (en) * | 2009-04-27 | 2013-08-14 | Mattel Inc | Floating toy |
| US8500510B2 (en) | 2009-04-27 | 2013-08-06 | Mattel, Inc. | Floating toy |
| CN102946956B (zh) | 2010-04-30 | 2015-01-21 | 美泰有限公司 | 玩具 |
| CN103025398B (zh) | 2010-04-30 | 2015-04-22 | 美泰有限公司 | 漂浮玩具 |
| US8562385B2 (en) | 2011-03-11 | 2013-10-22 | Mattel, Inc. | Doll with water squirting feature |
| US8794486B2 (en) | 2012-04-03 | 2014-08-05 | Gigglicious, LLC | Apparatus with pump and valve for use with internal and external fluid reservoir |
| US20140263714A1 (en) * | 2013-03-15 | 2014-09-18 | Aileen Chase | Water play apparatus |
| US9687751B2 (en) * | 2013-07-25 | 2017-06-27 | Samuel Peckham | Bubble generating article |
| USD789458S1 (en) * | 2014-09-10 | 2017-06-13 | Global Marketing Enterprise (G.M.E.) Ltd. | Water toy |
| USD910776S1 (en) * | 2020-03-21 | 2021-02-16 | Zhiwei Chen | Toy |
| USD923109S1 (en) * | 2020-09-08 | 2021-06-22 | Zhicheng Fang | Bath toy |
| US11684863B1 (en) * | 2023-01-24 | 2023-06-27 | Kids Squad LLC | Soft and squeezable water play toy |
| US12168186B1 (en) * | 2023-12-21 | 2024-12-17 | Mattel, Inc. | Toy vehicle playset with liquid channels |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2703407A (en) * | 1954-03-31 | 1955-03-08 | Rolph E Henoch | Boy's toilet trainer |
| US2968120A (en) * | 1958-09-08 | 1961-01-17 | Marvin I Glass | Toy |
| US3213565A (en) * | 1963-03-07 | 1965-10-26 | Peter M Grosz | Bathtub toy |
| US3425152A (en) * | 1967-03-03 | 1969-02-04 | John D Foulkes | Fluid stream generator |
-
1969
- 1969-07-15 US US841872A patent/US3577675A/en not_active Expired - Lifetime
- 1969-11-27 JP JP44094732A patent/JPS4946866B1/ja active Pending
- 1969-12-13 DE DE6948275U patent/DE6948275U/de not_active Expired
- 1969-12-13 DE DE19691962595 patent/DE1962595A1/de active Pending
-
1970
- 1970-02-12 GB GB1267185D patent/GB1267185A/en not_active Expired
- 1970-07-15 FR FR7026083A patent/FR2055161A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4946866B1 (cg-RX-API-DMAC10.html) | 1974-12-12 |
| GB1267185A (cg-RX-API-DMAC10.html) | 1972-03-15 |
| US3577675A (en) | 1971-05-04 |
| DE1962595A1 (de) | 1971-01-28 |
| FR2055161A5 (cg-RX-API-DMAC10.html) | 1971-05-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE6948275U (de) | Badespielzeug. | |
| DE2815631A1 (de) | Wasserbetriebenes spielzeug mit emporhebbarem oberen teil | |
| DE3338866A1 (de) | Fluegelgetriebene taumel-beregnungsvorrichtung | |
| DE2316497A1 (de) | Verfahren zur herstellung von blasen und spielzeug zur durchfuehrung des verfahrens | |
| DE2528979A1 (de) | Abschlagvorrichtung | |
| DE1903791U (de) | Gefluegeltraenke mit freihaengendem trinkgefaess und selbsttaetigem fuellventil. | |
| DE602005004805T2 (de) | Gerät zum Aufbrühen von Tee mit Zeitmessung | |
| DE1227188B (de) | Kuenstliche Herzklappe | |
| CN116349447A (zh) | 一种提高红豆树种子育苗率的处理装置 | |
| DE1927852U (de) | Gefaess zum ziehen von pflanzen. | |
| DE389525C (de) | Durch einen Elektromotor angetriebene Geschirrspuelvorrichtung mit drehbaren, das Wasser nach aufwaerts schleudernden Sprueharmen | |
| DE883872C (de) | Sportballspielzeug mit an einem tragbaren Haltekoerper mittels elastischer Schnur befestigtem Ball | |
| CH502756A (de) | Cache-Pot | |
| DE1779243A1 (de) | Geraet zum Aufbruehen von Getraenken | |
| DE19911791A1 (de) | Springbrunnen | |
| DE921643C (de) | Springbrunnen fuer Raeume oder Gaerten | |
| DE1941044A1 (de) | Sprueharmlagerung bei einer Geschirrspuelmaschine | |
| DE2806063C2 (cg-RX-API-DMAC10.html) | ||
| DE202007013206U1 (de) | Spiel- und Trainingsgerät zum Jonglieren mit den Füßen | |
| DE683401C (de) | Zweibeinige Spielzeuggehfigur mit zwei festen Stuetzen auf Fahrsockeln | |
| CH200637A (de) | Verfahren und Einrichtung zum Reinigen von Wäsche. | |
| DE2045208B2 (de) | Spielfigur für den Torwart eines nach Art des Fußballspieles zu spielenden Brettspieles | |
| DE58405C (de) | Spucknapf | |
| DE657914C (de) | Wasserspiel | |
| CH293965A (de) | Verfahren zum Nachspülen von WC.- und Pissoiranlagen und Spülvorrichtung zur Ausführung des Verfahrens. |