DE69220147T2 - Detergenszusammensetzungen in Tablettenform - Google Patents
Detergenszusammensetzungen in TablettenformInfo
- Publication number
- DE69220147T2 DE69220147T2 DE69220147T DE69220147T DE69220147T2 DE 69220147 T2 DE69220147 T2 DE 69220147T2 DE 69220147 T DE69220147 T DE 69220147T DE 69220147 T DE69220147 T DE 69220147T DE 69220147 T2 DE69220147 T2 DE 69220147T2
- Authority
- DE
- Germany
- Prior art keywords
- detergent
- tablet
- weight
- particles
- tablet according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000003599 detergent Substances 0.000 title claims description 84
- 239000000203 mixture Substances 0.000 title claims description 60
- 239000002245 particle Substances 0.000 claims description 68
- 239000000843 powder Substances 0.000 claims description 30
- 239000011230 binding agent Substances 0.000 claims description 27
- 238000005056 compaction Methods 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 20
- 239000011159 matrix material Substances 0.000 claims description 20
- 238000004090 dissolution Methods 0.000 claims description 18
- 239000002585 base Substances 0.000 claims description 15
- 239000004615 ingredient Substances 0.000 claims description 14
- 239000007884 disintegrant Substances 0.000 claims description 11
- 239000000463 material Substances 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 9
- -1 alkali metal aluminosilicate Chemical class 0.000 claims description 8
- 229920000642 polymer Polymers 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 229920001223 polyethylene glycol Polymers 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 239000002202 Polyethylene glycol Substances 0.000 claims description 3
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 238000005303 weighing Methods 0.000 claims description 3
- 238000007922 dissolution test Methods 0.000 claims 4
- 239000003826 tablet Substances 0.000 description 95
- 239000008380 degradant Substances 0.000 description 20
- 238000005406 washing Methods 0.000 description 17
- 238000009472 formulation Methods 0.000 description 9
- 108090000790 Enzymes Proteins 0.000 description 8
- 102000004190 Enzymes Human genes 0.000 description 8
- 230000008901 benefit Effects 0.000 description 8
- 229940088598 enzyme Drugs 0.000 description 8
- 239000008187 granular material Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 239000010457 zeolite Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 229910021536 Zeolite Inorganic materials 0.000 description 6
- 238000004061 bleaching Methods 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 6
- 238000009826 distribution Methods 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000002518 antifoaming agent Substances 0.000 description 5
- 239000007844 bleaching agent Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000012190 activator Substances 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000002304 perfume Substances 0.000 description 4
- 229920005646 polycarboxylate Polymers 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 241000282320 Panthera leo Species 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 239000011149 active material Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 235000010980 cellulose Nutrition 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000005469 granulation Methods 0.000 description 3
- 230000003179 granulation Effects 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000004806 packaging method and process Methods 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 229940093430 polyethylene glycol 1500 Drugs 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 238000007873 sieving Methods 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000000429 sodium aluminium silicate Substances 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- 235000019832 sodium triphosphate Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000007885 tablet disintegrant Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- PMPJQLCPEQFEJW-GNTLFSRWSA-L disodium;2-[(z)-2-[4-[4-[(z)-2-(2-sulfonatophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1\C=C/C1=CC=C(C=2C=CC(\C=C/C=3C(=CC=CC=3)S([O-])(=O)=O)=CC=2)C=C1 PMPJQLCPEQFEJW-GNTLFSRWSA-L 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 229920000191 poly(N-vinyl pyrrolidone) Polymers 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical class OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- YGUMVDWOQQJBGA-VAWYXSNFSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-VAWYXSNFSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229910000632 Alusil Inorganic materials 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229920000896 Ethulose Polymers 0.000 description 1
- 239000001859 Ethyl hydroxyethyl cellulose Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 241000761557 Lamina Species 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- JYXGIOKAKDAARW-UHFFFAOYSA-N N-(2-hydroxyethyl)iminodiacetic acid Chemical class OCCN(CC(O)=O)CC(O)=O JYXGIOKAKDAARW-UHFFFAOYSA-N 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- GFUDVONXTOGWEU-UHFFFAOYSA-L O1CCN(CC1)C1=NC(=NC(=N1)NC1=CC=CC=C1)NC1=C(C(=C(C=C1)C=CC1=CC=C(C=C1)NC1=NC(=NC(=N1)N1CCOCC1)NC1=CC=CC=C1)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] Chemical compound O1CCN(CC1)C1=NC(=NC(=N1)NC1=CC=CC=C1)NC1=C(C(=C(C=C1)C=CC1=CC=C(C=C1)NC1=NC(=NC(=N1)N1CCOCC1)NC1=CC=CC=C1)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] GFUDVONXTOGWEU-UHFFFAOYSA-L 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229920003110 Primojel Polymers 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 235000015278 beef Nutrition 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- VUJGKADZTYCLIL-YHPRVSEPSA-L disodium;5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate Chemical compound [Na+].[Na+].C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S([O-])(=O)=O)C(S(=O)(=O)[O-])=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 VUJGKADZTYCLIL-YHPRVSEPSA-L 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000013467 fragmentation Methods 0.000 description 1
- 238000006062 fragmentation reaction Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 108010003855 mesentericopeptidase Proteins 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 108010020132 microbial serine proteinases Proteins 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- 229920001206 natural gum Polymers 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 235000015927 pasta Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229920005613 synthetic organic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical class [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/06—Powder; Flakes; Free-flowing mixtures; Sheets
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
- C11D17/0065—Solid detergents containing builders
- C11D17/0073—Tablets
- C11D17/0086—Laundry tablets
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0039—Coated compositions or coated components in the compositions, (micro)capsules
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
- C11D17/0065—Solid detergents containing builders
- C11D17/0073—Tablets
- C11D17/0078—Multilayered tablets
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919114184A GB9114184D0 (en) | 1991-07-01 | 1991-07-01 | Detergent composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69220147D1 DE69220147D1 (de) | 1997-07-10 |
| DE69220147T2 true DE69220147T2 (de) | 1997-09-18 |
Family
ID=10697625
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69220147T Expired - Lifetime DE69220147T2 (de) | 1991-07-01 | 1992-06-30 | Detergenszusammensetzungen in Tablettenform |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5407594A (en:Method) |
| EP (1) | EP0522766B1 (en:Method) |
| JP (1) | JPH05186800A (en:Method) |
| KR (1) | KR950013227B1 (en:Method) |
| AU (1) | AU685384B2 (en:Method) |
| BR (1) | BR9202449A (en:Method) |
| CA (1) | CA2072766C (en:Method) |
| DE (1) | DE69220147T2 (en:Method) |
| ES (1) | ES2103891T3 (en:Method) |
| GB (1) | GB9114184D0 (en:Method) |
| TW (1) | TW227015B (en:Method) |
| ZA (1) | ZA924891B (en:Method) |
Families Citing this family (125)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4315048A1 (de) * | 1993-04-01 | 1994-10-06 | Henkel Kgaa | Verfahren zur Herstellung stabiler, bifunktioneller, phosphat-, metasilikat- und polymerfreier niederalkalischer Reinigungsmitteltabletten für das maschinelle Geschirrspülen |
| EP0719325B1 (en) * | 1993-09-13 | 1998-02-11 | Unilever N.V. | Tableted detergent, method of manufacture and use |
| GB9422925D0 (en) * | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| GB9422924D0 (en) * | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| GB9422895D0 (en) * | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| GB2299956A (en) | 1995-04-13 | 1996-10-23 | Procter & Gamble | Detergent compositions for dishwashers |
| DE19606765A1 (de) * | 1996-02-23 | 1997-08-28 | Henkel Kgaa | Verfahren zur Herstellung von Geschirrspülmitteltabletten |
| US6191100B1 (en) * | 1996-05-17 | 2001-02-20 | The Procter & Gamble Company | Detergent composition having effervescent generating ingredients |
| US5885949A (en) * | 1996-06-05 | 1999-03-23 | Amway Corporation | Tableted household cleaner comprising carboxylic acid, BI carbonate and polyvinyl alcohol |
| IL120992A0 (en) * | 1996-06-14 | 1997-11-20 | Rohm & Haas | Detergent tablets |
| US5741433A (en) * | 1996-06-21 | 1998-04-21 | Betzdearborn Inc. | Controlled release supplemental coolant additive |
| US6313086B1 (en) | 1996-07-31 | 2001-11-06 | The Procter & Gamble Company | Detergent compositions containing and effervescent |
| AU3962697A (en) * | 1996-07-31 | 1998-02-20 | Procter & Gamble Company, The | Detergent compositions |
| DE69637030T2 (de) * | 1996-12-06 | 2007-12-27 | The Procter & Gamble Company, Cincinnati | Beschichtetes Reinigungsmittel in Tablettenform und Herstellungsverfahren dafür |
| GB2320254A (en) * | 1996-12-12 | 1998-06-17 | Procter & Gamble | Process for making tabletted detergent compositions |
| US6177398B1 (en) | 1996-12-12 | 2001-01-23 | The Procter & Gamble Company | Process for making tabletted detergent compositions |
| US6177393B1 (en) * | 1996-12-12 | 2001-01-23 | The Procter & Gamble Company | Process for making tabletted detergent compositions |
| GB2320255A (en) * | 1996-12-12 | 1998-06-17 | Procter & Gamble | Process for making tabletted detergent compositions |
| US5900395A (en) * | 1996-12-23 | 1999-05-04 | Lever Brothers Company | Machine dishwashing tablets containing an oxygen bleach system |
| DE19709411A1 (de) | 1997-03-07 | 1998-09-10 | Henkel Kgaa | Waschmittelformkörper |
| DE19709991C2 (de) | 1997-03-11 | 1999-12-23 | Rettenmaier & Soehne Gmbh & Co | Waschmittelpreßling und Verfahren zu seiner Herstellung |
| DE19710254A1 (de) | 1997-03-13 | 1998-09-17 | Henkel Kgaa | Wasch- oder reinigungsaktive Formkörper für den Gebrauch im Haushalt |
| CN1257536A (zh) * | 1997-03-24 | 2000-06-21 | 尤尼利弗公司 | 洗涤剂组合物 |
| GB9711831D0 (en) * | 1997-06-06 | 1997-08-06 | Unilever Plc | Cleaning compositions |
| ZA984570B (en) | 1997-06-06 | 1999-11-29 | Unilever Plc | Cleaning compositions. |
| GB9711829D0 (en) * | 1997-06-06 | 1997-08-06 | Unilever Plc | Detergent compositions |
| US6677295B1 (en) | 1997-08-08 | 2004-01-13 | The Procter & Gamble Company | Detergent tablet |
| EP0896052A1 (en) * | 1997-08-08 | 1999-02-10 | The Procter & Gamble Company | Detergent tablet |
| EP0896053B1 (en) * | 1997-08-08 | 2004-09-08 | The Procter & Gamble Company | Detergent tablet |
| DE19739383A1 (de) * | 1997-09-09 | 1999-03-11 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit verbesserter Löslichkeit |
| CA2307377A1 (en) | 1997-10-22 | 1999-04-29 | Unilever Plc | Detergent compositions in tablet form |
| US6274538B1 (en) * | 1997-11-10 | 2001-08-14 | The Procter & Gamble Company | Detergent compositions |
| CA2296354C (en) * | 1997-11-10 | 2003-05-27 | The Procter & Gamble Company | Detergent compositions |
| GB2331994A (en) * | 1997-12-02 | 1999-06-09 | Procter & Gamble | Detergent tablet |
| ATE276350T1 (de) * | 1997-11-26 | 2004-10-15 | Procter & Gamble | Verfahren zur herstellung einer waschmitteltablette |
| JP2001524593A (ja) * | 1997-11-26 | 2001-12-04 | ザ、プロクター、エンド、ギャンブル、カンパニー | 洗剤タブレット |
| DE69828816T2 (de) * | 1997-11-26 | 2005-12-22 | The Procter & Gamble Company, Cincinnati | Waschmitteltablette |
| DE19754292A1 (de) * | 1997-12-08 | 1999-06-10 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit verbesserten Zerfallseigenschaften |
| GB2332442A (en) * | 1997-12-17 | 1999-06-23 | Procter & Gamble | Detergent tablet |
| US6410500B1 (en) | 1997-12-30 | 2002-06-25 | Henkel Kommanditgesellschaft Auf Aktien | Moulded body dishwasher detergents with soil release polymers |
| US6992056B1 (en) | 1997-12-30 | 2006-01-31 | Henkel Kgaa | Process for preparing detergent tablets having two or more regions |
| DE19758178A1 (de) * | 1997-12-30 | 1999-07-01 | Henkel Kgaa | Geschirrspülmittelformkörper mit Chlorbleichmitteln |
| JP2001508493A (ja) | 1998-01-13 | 2001-06-26 | ザ、プロクター、エンド、ギャンブル、カンパニー | 改善された溶解性を有する洗剤顆粒 |
| GB9802390D0 (en) * | 1998-02-04 | 1998-04-01 | Unilever Plc | Detergent compositions |
| WO1999041353A1 (en) | 1998-02-10 | 1999-08-19 | Unilever Plc | Tablet detergent compositions |
| CZ20002935A3 (cs) * | 1998-02-10 | 2001-10-17 | Unilever N. V. | Způsob výroby pracího prostředku |
| DE19806200A1 (de) * | 1998-02-16 | 1999-08-19 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit Bleichmittel |
| EP0949327A1 (en) * | 1998-03-30 | 1999-10-13 | The Procter & Gamble Company | Shape and strength of detergent tablets |
| GB9807992D0 (en) * | 1998-04-15 | 1998-06-17 | Unilever Plc | Water softening and detergent compositions |
| WO1999055818A1 (en) * | 1998-04-27 | 1999-11-04 | The Procter & Gamble Company | Non-particulate detergent product containing bleach activator |
| DE19828579A1 (de) * | 1998-06-26 | 1999-12-30 | Henkel Kgaa | Verfahren zur Herstellung von Wasch- und Reinigungsmittelformkörpern |
| GB2340125B (en) * | 1998-07-07 | 2003-04-02 | Branko Richard Babic | Low density materials |
| ES2224681T3 (es) * | 1998-07-17 | 2005-03-01 | THE PROCTER & GAMBLE COMPANY | Tableta detergente. |
| GB9815525D0 (en) * | 1998-07-17 | 1998-09-16 | Procter & Gamble | Detergent tablet |
| US6686328B1 (en) | 1998-07-17 | 2004-02-03 | The Procter & Gamble Company | Detergent tablet |
| DE19841362A1 (de) * | 1998-09-10 | 2000-03-16 | Henkel Kgaa | ABS-haltige Wasch- und Reinigungsmittelformkörper |
| DE19843938A1 (de) * | 1998-09-24 | 2000-03-30 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit grobteiligen Aufbereitungskomponenten |
| DE19843773A1 (de) * | 1998-09-24 | 2000-03-30 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit feinteiligen Aufbereitungskomponenten |
| ATE228561T1 (de) * | 1998-10-09 | 2002-12-15 | Unilever Nv | Wasserenthärtungs- und waschmittelzusammensetzungen |
| GB9822090D0 (en) * | 1998-10-09 | 1998-12-02 | Unilever Plc | Detergent Compositions |
| DE19847277A1 (de) * | 1998-10-14 | 2000-04-20 | Henkel Kgaa | Bleichaktivator-haltige Wasch- und Reinigungsmittelformkörper |
| GB9826105D0 (en) * | 1998-11-27 | 1999-01-20 | Unilever Plc | Detergent compositions |
| AU1758500A (en) | 1999-03-05 | 2000-09-07 | Rohm And Haas Company | Improved pellet formulations |
| DE19912031A1 (de) * | 1999-03-17 | 2000-09-21 | Basf Ag | Verwendung von quervernetztem Polyvinylpyrrolidon zur Erhöhung der Zerfallgeschwindigkeit von kompakten teilchenförmigen Wasch- und Reinigungsmitteln |
| EP1048715A1 (en) * | 1999-04-30 | 2000-11-02 | The Procter & Gamble Company | Method of dispensing a detergent composition |
| EP1048716A1 (en) * | 1999-04-30 | 2000-11-02 | The Procter & Gamble Company | Detergent composition |
| JP3352977B2 (ja) | 1999-06-15 | 2002-12-03 | 花王株式会社 | 固形状洗剤 |
| US6860241B2 (en) | 1999-06-16 | 2005-03-01 | Dober Chemical Corp. | Fuel filter including slow release additive |
| JP4116195B2 (ja) * | 1999-06-16 | 2008-07-09 | 花王株式会社 | 板状洗剤 |
| GB9918020D0 (en) * | 1999-07-30 | 1999-09-29 | Unilever Plc | Detergent compositions |
| GB9918505D0 (en) | 1999-08-05 | 1999-10-06 | Unilever Plc | Water-softening and detergent compositions |
| DE19940548A1 (de) * | 1999-08-26 | 2001-03-01 | Henkel Kgaa | Wasch- oder Reinigungsmittelformkörper |
| DE19942287A1 (de) * | 1999-09-04 | 2001-03-15 | Cognis Deutschland Gmbh | Formkörper mit verbesserter Wasserlöslichkeit |
| DE19944222A1 (de) * | 1999-09-15 | 2001-03-29 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19946342A1 (de) * | 1999-09-28 | 2001-04-05 | Cognis Deutschland Gmbh | Formkörper mit verbesserter Wasserlöslichkeit |
| DE19948669A1 (de) * | 1999-10-08 | 2001-04-19 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19953792A1 (de) * | 1999-11-09 | 2001-05-17 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| EP1263814B1 (de) * | 2000-03-10 | 2004-06-02 | Basf Aktiengesellschaft | Verwendung von quervernetztem polyvinylpyrrolidon als sprengmittel in kompakten, teilchenförmigen wasch- und reinigungsmitteln |
| US6607694B1 (en) | 2000-03-31 | 2003-08-19 | Dober Chemical Corp. | Controlled release coolant additive composition |
| US20030104969A1 (en) * | 2000-05-11 | 2003-06-05 | Caswell Debra Sue | Laundry system having unitized dosing |
| US20020119196A1 (en) * | 2000-12-21 | 2002-08-29 | Narendra Parikh | Texture masked particles containing an active ingredient |
| EP1219700A1 (en) * | 2000-12-28 | 2002-07-03 | Unilever Plc | Cleaning compositions |
| US20030122104A1 (en) * | 2001-02-12 | 2003-07-03 | Dober Chemical Corporation | Liquid replacement systems |
| US6878309B2 (en) * | 2001-02-12 | 2005-04-12 | Dober Chemical Corp. | Controlled release cooling additive composition |
| DE60113059T2 (de) * | 2001-03-05 | 2006-01-12 | Unilever N.V. | Wasch- oder Reinigungsmittel |
| US6835218B1 (en) | 2001-08-24 | 2004-12-28 | Dober Chemical Corp. | Fuel additive compositions |
| US7001531B2 (en) | 2001-08-24 | 2006-02-21 | Dober Chemical Corp. | Sustained release coolant additive composition |
| US6827750B2 (en) | 2001-08-24 | 2004-12-07 | Dober Chemical Corp | Controlled release additives in fuel systems |
| US7938277B2 (en) * | 2001-08-24 | 2011-05-10 | Dober Chemical Corporation | Controlled release of microbiocides |
| WO2003019065A1 (en) * | 2001-08-24 | 2003-03-06 | Dober Chemical Corporation | Controlled release of additives in cooling system |
| JP2005502449A (ja) * | 2001-08-24 | 2005-01-27 | ドーバー ケミカル コーポレイション | 流体システムにおける添加剤の制御放出 |
| US6586386B2 (en) * | 2001-10-26 | 2003-07-01 | Isp Investments Inc. | Tablet of compacted particulate cleaning composition |
| US7550156B2 (en) | 2001-11-23 | 2009-06-23 | Rohm And Haas Company | Optimised pellet formulations |
| GB0201300D0 (en) * | 2002-01-21 | 2002-03-06 | Unilever Plc | Detergent composition in tablet form |
| DE60209673T2 (de) | 2002-10-22 | 2006-09-21 | Rohm And Haas Co. | Tablettenbeschichtung |
| DE10327682A1 (de) * | 2003-06-20 | 2005-01-05 | Bayer Chemicals Ag | Wasch- oder reinigungsaktive Formkörper für den Gebrauch im Haushalt |
| US7065825B2 (en) * | 2003-06-23 | 2006-06-27 | The Clorox Company | Cleaning tool with gripping assembly for a disposable scrubbing head |
| USD520852S1 (en) | 2003-09-30 | 2006-05-16 | The Clorox Co. | Handle for a cleaning tool |
| US7386910B2 (en) | 2003-09-30 | 2008-06-17 | The Clorox Company | Cleaning tool assembly with a disposable cleaning implement |
| US7052074B2 (en) * | 2003-10-03 | 2006-05-30 | All Sales Manufacturing, Inc. | Angularly adjustable illuminated spoiler |
| ES2293198T3 (es) * | 2004-01-12 | 2008-03-16 | THE PROCTER & GAMBLE COMPANY | Pastillas con resistencia a la rotua mejorada. |
| ES2290660T3 (es) * | 2004-01-12 | 2008-02-16 | THE PROCTER & GAMBLE COMPANY | Pastillas con resistencia mejorada a la rotura. |
| US20080115302A1 (en) * | 2004-01-16 | 2008-05-22 | Andrew Kilkenny | Cleaning Tool With Disposable Cleaning Head and Composition |
| DE102004016497B4 (de) * | 2004-04-03 | 2007-04-26 | Henkel Kgaa | Verfahren zur Herstellung von Granulaten und deren Einsatz in Wasch- und/oder Reinigungsmitteln |
| EP1832648A1 (en) | 2006-03-08 | 2007-09-12 | Unilever Plc | Laundry detergent composition and process |
| WO2008040151A1 (fr) * | 2006-09-01 | 2008-04-10 | Tao Wang | Détergent synthétique et son procédé de préparation |
| WO2008040152A1 (fr) * | 2006-09-01 | 2008-04-10 | Tao Wang | Détergent solide et son procédé de préparation |
| DE102006054436A1 (de) * | 2006-11-16 | 2008-05-21 | Henkel Kgaa | Feste, textil- und/oder hautpflegende Zusammensetzung |
| US7563368B2 (en) | 2006-12-12 | 2009-07-21 | Cummins Filtration Ip Inc. | Filtration device with releasable additive |
| CA2699092C (en) * | 2007-10-18 | 2015-02-17 | Ecolab Inc. | Pressed, waxy, solid cleaning compositions and methods of making them |
| MX2010003825A (es) | 2007-10-18 | 2010-04-27 | Ecolab Inc | Composiciones de limpieza solidas, auto-solidificables, comprimidas, y metodos para hacerlas. |
| US20090249572A1 (en) * | 2008-04-03 | 2009-10-08 | Minkler Douglas J | Cleaning Tool Assembly With A Disposable Cleaning Implement |
| US20090294379A1 (en) * | 2008-05-27 | 2009-12-03 | Dober Chemical Corporation | Controlled release of additive compositions |
| US8702995B2 (en) * | 2008-05-27 | 2014-04-22 | Dober Chemical Corp. | Controlled release of microbiocides |
| US7883638B2 (en) | 2008-05-27 | 2011-02-08 | Dober Chemical Corporation | Controlled release cooling additive compositions |
| US8591747B2 (en) * | 2008-05-27 | 2013-11-26 | Dober Chemical Corp. | Devices and methods for controlled release of additive compositions |
| US20090304868A1 (en) * | 2008-05-27 | 2009-12-10 | Dober Chemical Corporation | Controlled release cooling additive composition |
| GB0908641D0 (en) * | 2009-05-20 | 2009-06-24 | Reckitt Benckiser Nv | Product |
| US8476219B2 (en) | 2009-11-05 | 2013-07-02 | The Procter & Gamble Company | Laundry scent additive |
| CA2682636C (en) | 2009-11-05 | 2010-06-15 | The Procter & Gamble Company | Laundry scent additive |
| DE102010051226A1 (de) | 2010-11-12 | 2012-05-31 | Dental Care Innovation Gmbh | Ausspültablete mit abrasiven Bestandteilen |
| EP2935553B1 (en) | 2012-12-20 | 2018-10-24 | The Procter and Gamble Company | Laundry scent additive |
| US9711260B2 (en) * | 2014-11-11 | 2017-07-18 | General Cable Technologies Corporation | Heat shield for cables |
| WO2018144771A2 (en) | 2017-02-02 | 2018-08-09 | Water Pik, Inc. | Tablet including abrasive for dental cleaning |
| US10610066B1 (en) | 2019-01-07 | 2020-04-07 | The Clorox Company | Bleach delivery system and method for toilet biofilm disinfection |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE632373A (en:Method) * | 1959-12-31 | |||
| BE609826A (en:Method) * | 1960-11-07 | |||
| US3231505A (en) * | 1961-04-03 | 1966-01-25 | Colgate Palmolive Co | Process for manufacturing detergent tablet |
| BE628717A (en:Method) * | 1962-02-21 | |||
| JPS5070286A (en:Method) * | 1973-10-25 | 1975-06-11 | ||
| US4370250A (en) * | 1976-12-06 | 1983-01-25 | Colgate-Palmolive Company | Detergent tablet |
| DE3315950A1 (de) * | 1983-05-02 | 1984-11-15 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung von reinigungsmitteltabletten |
| JPS6015500A (ja) * | 1983-07-08 | 1985-01-26 | ライオン株式会社 | 高嵩密度洗剤組成物 |
| DE3326459A1 (de) * | 1983-07-22 | 1985-01-31 | Etol-Werk GmbH & Co KG Chemische Fabrik, 7603 Oppenau | Verfahren zur herstellung eines geschirrspuelmittels und vorrichtung zur verarbeitung desselben |
| JPS60135498A (ja) * | 1983-12-23 | 1985-07-18 | ライオン株式会社 | 高嵩密度洗浄剤組成物 |
| JPS60135497A (ja) * | 1983-12-23 | 1985-07-18 | ライオン株式会社 | 高嵩密度洗剤組成物 |
| DE3417820A1 (de) * | 1984-05-14 | 1985-11-14 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung eines waschzusatzes in tablettenform |
| DE3509661C2 (de) * | 1985-03-18 | 1987-01-22 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung eines körnigen, Natriumtriphosphat enthaltenden Produktes |
| US4673527A (en) * | 1985-05-20 | 1987-06-16 | Autotrol Corporation | Tablet granulation |
| DE3634813A1 (de) * | 1986-10-13 | 1988-04-14 | Henkel Kgaa | Reinigungsmitteltabletten fuer das maschinelle geschirrspuelen |
| GB8626691D0 (en) * | 1986-11-07 | 1986-12-10 | Unilever Plc | Detergent composition |
| JPH02182972A (ja) * | 1989-01-04 | 1990-07-17 | Kao Corp | 固体状柔軟仕上剤 |
| GB9015503D0 (en) * | 1990-07-13 | 1990-08-29 | Unilever Plc | Detergent composition |
| US5133892A (en) * | 1990-10-17 | 1992-07-28 | Lever Brothers Company, Division Of Conopco, Inc. | Machine dishwashing detergent tablets |
-
1991
- 1991-07-01 GB GB919114184A patent/GB9114184D0/en active Pending
-
1992
- 1992-06-30 KR KR1019920011518A patent/KR950013227B1/ko not_active Expired - Fee Related
- 1992-06-30 ES ES92306005T patent/ES2103891T3/es not_active Expired - Lifetime
- 1992-06-30 DE DE69220147T patent/DE69220147T2/de not_active Expired - Lifetime
- 1992-06-30 CA CA002072766A patent/CA2072766C/en not_active Expired - Fee Related
- 1992-06-30 US US07/906,907 patent/US5407594A/en not_active Expired - Fee Related
- 1992-06-30 EP EP92306005A patent/EP0522766B1/en not_active Expired - Lifetime
- 1992-07-01 JP JP4174570A patent/JPH05186800A/ja active Pending
- 1992-07-01 ZA ZA924891A patent/ZA924891B/xx unknown
- 1992-07-01 AU AU19375/92A patent/AU685384B2/en not_active Ceased
- 1992-07-07 BR BR929202449A patent/BR9202449A/pt not_active IP Right Cessation
- 1992-08-01 TW TW081106113A patent/TW227015B/zh active
Also Published As
| Publication number | Publication date |
|---|---|
| JPH05186800A (ja) | 1993-07-27 |
| AU685384B2 (en) | 1998-01-22 |
| GB9114184D0 (en) | 1991-08-21 |
| DE69220147D1 (de) | 1997-07-10 |
| EP0522766A3 (en) | 1993-04-07 |
| TW227015B (en:Method) | 1994-07-21 |
| KR950013227B1 (ko) | 1995-10-26 |
| ES2103891T3 (es) | 1997-10-01 |
| CA2072766A1 (en) | 1993-01-02 |
| BR9202449A (pt) | 1993-03-16 |
| AU1937592A (en) | 1993-01-07 |
| EP0522766A2 (en) | 1993-01-13 |
| CA2072766C (en) | 2002-12-03 |
| KR930002501A (ko) | 1993-02-23 |
| EP0522766B1 (en) | 1997-06-04 |
| US5407594A (en) | 1995-04-18 |
| ZA924891B (en) | 1994-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69220147T2 (de) | Detergenszusammensetzungen in Tablettenform | |
| DE69109192T3 (de) | Detergenszusammensetzungen. | |
| DE69522643T2 (de) | Detergenszusammensetzungen in Tablettenform | |
| DE69109193T2 (de) | Detergenszusammensetzungen. | |
| DE69819542T2 (de) | Reinigungsmittel | |
| DE69928833T2 (de) | Waschmittelformkörper | |
| DE69819522T2 (de) | Waschmittelzusammensetzungen | |
| DE69101896T2 (de) | Detergenszusammensetzungen in Tablettenform. | |
| US5916866A (en) | Preparation of laundry detergent tablets | |
| DE69713907T2 (de) | Wasserenthärtende Zusammensetzungen und Waschmittelzusammensetzungen | |
| DE69806406T2 (de) | Tablettenförmige waschmittelzusammensetzungen | |
| DE69807869T2 (de) | Reinigungsmittel in tablettenform | |
| EP0815196B1 (de) | Verfahren zur herstellung eines pulverförmigen wasch- oder reinigungsmittels | |
| DE69124334T2 (de) | Detergenszusammensetzungen in Tablettenform | |
| DE60301968T2 (de) | Waschmitteltabletten | |
| DE60013889T2 (de) | Waschmittelzusammensetzungen | |
| DE69727189T2 (de) | Waschmittelzusammensetzung | |
| DE60022761T2 (de) | Waschmittelzusammensetzungen | |
| DE69824564T2 (de) | Waschmittelzusammensetzungen | |
| DE60314348T2 (de) | Waschmittel | |
| DE60209658T2 (de) | Waschmittelzusammensetzungen | |
| DE69904226T2 (de) | Wasserenthärtungs- und waschmittelzusammensetzungen | |
| DE60024095T2 (de) | Wasserenthärtungs- und waschmittelzusammensetzungen | |
| DE60302878T2 (de) | Waschmittel | |
| DE60213005T2 (de) | Waschmittel in tablettenform |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings | ||
| R071 | Expiry of right |
Ref document number: 522766 Country of ref document: EP |