DE662140C - Schirmgitterroehre - Google Patents
SchirmgitterroehreInfo
- Publication number
- DE662140C DE662140C DEI36443D DEI0036443D DE662140C DE 662140 C DE662140 C DE 662140C DE I36443 D DEI36443 D DE I36443D DE I0036443 D DEI0036443 D DE I0036443D DE 662140 C DE662140 C DE 662140C
- Authority
- DE
- Germany
- Prior art keywords
- coating
- tube
- screen grid
- electrode
- borate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000576 coating method Methods 0.000 claims description 11
- 239000011248 coating agent Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 4
- 239000002966 varnish Substances 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 2
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 230000008020 evaporation Effects 0.000 claims 1
- 238000001704 evaporation Methods 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 150000002739 metals Chemical class 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- RIUWBIIVUYSTCN-UHFFFAOYSA-N trilithium borate Chemical compound [Li+].[Li+].[Li+].[O-]B([O-])[O-] RIUWBIIVUYSTCN-UHFFFAOYSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical class C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical class [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Chemical class 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical class [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical class OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- RTZKMGZSJBRJFI-UHFFFAOYSA-N boric acid;lithium Chemical compound [Li].OB(O)O RTZKMGZSJBRJFI-UHFFFAOYSA-N 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- 229910052749 magnesium Chemical class 0.000 description 1
- 239000011777 magnesium Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Chemical class 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/32—Secondary-electron-emitting electrodes
Landscapes
- Solid Thermionic Cathode (AREA)
- Image-Pickup Tubes, Image-Amplification Tubes, And Storage Tubes (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US240044A US1756889A (en) | 1927-12-14 | 1927-12-14 | Electron-discharge apparatus |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE662140C true DE662140C (de) | 1938-07-06 |
Family
ID=22904873
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI36443D Expired DE662140C (de) | 1927-12-14 | 1928-12-13 | Schirmgitterroehre |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US1756889A (enExample) |
| BE (1) | BE356578A (enExample) |
| DE (1) | DE662140C (enExample) |
| FR (1) | FR666222A (enExample) |
| GB (1) | GB302307A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE864423C (de) * | 1940-04-15 | 1953-01-26 | Philips Nv | Elektrische Entladungsroehre |
| DE758170C (de) * | 1939-06-10 | 1953-09-28 | Telefunken Gmbh | Schirmgitterroehre mit einem sich laengs der Kathode aendernden Durchgriff zur Verhinderung der Kreuzmodulation |
| DE1122181B (de) * | 1958-10-24 | 1962-01-18 | Egyesuelt Izzolampa | Verfahren zur Herstellung von Gitterelektroden fuer Elektronenroehren und Anwendung eines Gitters |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE426040A (enExample) * | 1937-01-30 | |||
| DE974826C (de) * | 1939-05-31 | 1961-05-10 | Fernseh Gmbh | Verfahren zur Herstellung sekundaeremittierender Schichten |
| US2430218A (en) * | 1944-03-21 | 1947-11-04 | Eitel Mccullough Inc | Electron tube with secondary emissive grid |
| US2441260A (en) * | 1945-05-17 | 1948-05-11 | Cortese Ralph | Electrode |
| US2527945A (en) * | 1946-06-25 | 1950-10-31 | Rca Corp | Method of and apparatus for generation of electrical energy from nuclear reactions |
| US2581408A (en) * | 1947-04-16 | 1952-01-08 | Sperry Corp | High-frequency electron discharge device |
-
0
- BE BE356578D patent/BE356578A/xx unknown
-
1927
- 1927-12-14 US US240044A patent/US1756889A/en not_active Expired - Lifetime
-
1928
- 1928-11-22 GB GB34436/28A patent/GB302307A/en not_active Expired
- 1928-12-13 DE DEI36443D patent/DE662140C/de not_active Expired
- 1928-12-14 FR FR666222D patent/FR666222A/fr not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE758170C (de) * | 1939-06-10 | 1953-09-28 | Telefunken Gmbh | Schirmgitterroehre mit einem sich laengs der Kathode aendernden Durchgriff zur Verhinderung der Kreuzmodulation |
| DE864423C (de) * | 1940-04-15 | 1953-01-26 | Philips Nv | Elektrische Entladungsroehre |
| DE1122181B (de) * | 1958-10-24 | 1962-01-18 | Egyesuelt Izzolampa | Verfahren zur Herstellung von Gitterelektroden fuer Elektronenroehren und Anwendung eines Gitters |
Also Published As
| Publication number | Publication date |
|---|---|
| BE356578A (enExample) | |
| US1756889A (en) | 1930-04-29 |
| GB302307A (en) | 1929-07-04 |
| FR666222A (fr) | 1929-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE662140C (de) | Schirmgitterroehre | |
| AT160558B (de) | Elektrische Entladungsröhre. | |
| DE1564398C3 (de) | Kathodenstrahlröhrenkolben | |
| DE755478C (de) | Elektronenroehre mit mindestens einer Sekundaeremissionselektrode | |
| DE574752C (de) | Verfahren zur Herstellung von Kathodenroehren | |
| DE535163C (de) | Indirekt geheizte Gluehkathode fuer Braunsche Roehren fuer Mess- oder Fernseherzwecke | |
| DE764127C (de) | Mittelbar geheizte Gluehkathode zur Erzeugung eines Elektronenstrahles grosser Stromstaerke | |
| DE748185C (de) | Verfahren zur Erzeugung kurzzeitiger Roentgenblitze | |
| DE689578C (de) | Verfahren zum Betrieb einer Schirmgitterroehre | |
| DE864423C (de) | Elektrische Entladungsroehre | |
| DE633205C (de) | Elektronenstrahlroehre mit indirekt beheizter Gluehkathode | |
| CH202649A (de) | Elektrische Entladungsröhre. | |
| DE529342C (de) | Hoechstspannungsroentgenroehre mit zwischen Kathode und Anode angeordneten Zwischenelektroden | |
| AT136486B (de) | Elektrische Entladungsröhre. | |
| AT145332B (de) | Elektronenröhre. | |
| AT157811B (de) | Vorrichtung mit einer elektrischen Entladungsröhre. | |
| DE636437C (de) | Schwingungserzeugung mittels elektrischer Entladungsgefaesse mit Oxydkathode und Gasfuellung | |
| AT150496B (de) | Gasgefüllte Entladungsröhre oder Leuchtröhre mit mindestens einer Glühelektrode. | |
| AT138884B (de) | Elektronenröhre. | |
| CH188161A (de) | Einrichtung mit einer elektrischen Entladungsröhre. | |
| DE545929C (de) | Entladungsgefaess zum Zwecke der Gleichrichtung, Verstaerkung oder Erzeugung von Schwingungen | |
| AT152240B (de) | Fernseh-Elektronenstrahlröhre. | |
| DE748720C (de) | Elektronenroehre fuer Verstaerkungszwecke mit einer Elektronen praktisch gleicher Austrittsgeschwindigkeit emittierenden Kathode | |
| DE685243C (de) | Elektrodenanordnung zur Erzielung eines scharf begrenzten Leuchtfleckes in Elektronenstrahlroehren fuer Fernsehzwecke | |
| AT300970B (de) | Verfahren zur Vorbereitung der Oberfläche des Trägers der Emissionsschicht von Oxydkathoden für Elektronenröhren |