US1756889A - Electron-discharge apparatus - Google Patents
Electron-discharge apparatus Download PDFInfo
- Publication number
- US1756889A US1756889A US240044A US24004427A US1756889A US 1756889 A US1756889 A US 1756889A US 240044 A US240044 A US 240044A US 24004427 A US24004427 A US 24004427A US 1756889 A US1756889 A US 1756889A
- Authority
- US
- United States
- Prior art keywords
- electrode
- electron
- metal
- coating
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229910052751 metal Inorganic materials 0.000 description 16
- 239000002184 metal Substances 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 15
- 239000011248 coating agent Substances 0.000 description 13
- 238000000576 coating method Methods 0.000 description 13
- 238000000034 method Methods 0.000 description 7
- 238000012216 screening Methods 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 150000001642 boronic acid derivatives Chemical class 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000002966 varnish Substances 0.000 description 2
- 244000228957 Ferula foetida Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- RIUWBIIVUYSTCN-UHFFFAOYSA-N trilithium borate Chemical group [Li+].[Li+].[Li+].[O-]B([O-])[O-] RIUWBIIVUYSTCN-UHFFFAOYSA-N 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
Images
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/32—Secondary-electron-emitting electrodes
Landscapes
- Solid Thermionic Cathode (AREA)
- Image-Pickup Tubes, Image-Amplification Tubes, And Storage Tubes (AREA)
- Discharge Lamp (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE356578D BE356578A (enExample) | 1927-12-14 | ||
| US240044A US1756889A (en) | 1927-12-14 | 1927-12-14 | Electron-discharge apparatus |
| GB34436/28A GB302307A (en) | 1927-12-14 | 1928-11-22 | Improvements relating to electron discharge apparatus |
| DEI36443D DE662140C (de) | 1927-12-14 | 1928-12-13 | Schirmgitterroehre |
| FR666222D FR666222A (fr) | 1927-12-14 | 1928-12-14 | Perfectionnements apportés aux tubes à décharge électronique |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US240044A US1756889A (en) | 1927-12-14 | 1927-12-14 | Electron-discharge apparatus |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US1756889A true US1756889A (en) | 1930-04-29 |
Family
ID=22904873
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US240044A Expired - Lifetime US1756889A (en) | 1927-12-14 | 1927-12-14 | Electron-discharge apparatus |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US1756889A (enExample) |
| BE (1) | BE356578A (enExample) |
| DE (1) | DE662140C (enExample) |
| FR (1) | FR666222A (enExample) |
| GB (1) | GB302307A (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2430218A (en) * | 1944-03-21 | 1947-11-04 | Eitel Mccullough Inc | Electron tube with secondary emissive grid |
| US2441260A (en) * | 1945-05-17 | 1948-05-11 | Cortese Ralph | Electrode |
| US2527945A (en) * | 1946-06-25 | 1950-10-31 | Rca Corp | Method of and apparatus for generation of electrical energy from nuclear reactions |
| US2581408A (en) * | 1947-04-16 | 1952-01-08 | Sperry Corp | High-frequency electron discharge device |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE426040A (enExample) * | 1937-01-30 | |||
| DE974826C (de) * | 1939-05-31 | 1961-05-10 | Fernseh Gmbh | Verfahren zur Herstellung sekundaeremittierender Schichten |
| DE758170C (de) * | 1939-06-10 | 1953-09-28 | Telefunken Gmbh | Schirmgitterroehre mit einem sich laengs der Kathode aendernden Durchgriff zur Verhinderung der Kreuzmodulation |
| DE864423C (de) * | 1940-04-15 | 1953-01-26 | Philips Nv | Elektrische Entladungsroehre |
| DE1122181B (de) * | 1958-10-24 | 1962-01-18 | Egyesuelt Izzolampa | Verfahren zur Herstellung von Gitterelektroden fuer Elektronenroehren und Anwendung eines Gitters |
-
0
- BE BE356578D patent/BE356578A/xx unknown
-
1927
- 1927-12-14 US US240044A patent/US1756889A/en not_active Expired - Lifetime
-
1928
- 1928-11-22 GB GB34436/28A patent/GB302307A/en not_active Expired
- 1928-12-13 DE DEI36443D patent/DE662140C/de not_active Expired
- 1928-12-14 FR FR666222D patent/FR666222A/fr not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2430218A (en) * | 1944-03-21 | 1947-11-04 | Eitel Mccullough Inc | Electron tube with secondary emissive grid |
| US2441260A (en) * | 1945-05-17 | 1948-05-11 | Cortese Ralph | Electrode |
| US2527945A (en) * | 1946-06-25 | 1950-10-31 | Rca Corp | Method of and apparatus for generation of electrical energy from nuclear reactions |
| US2581408A (en) * | 1947-04-16 | 1952-01-08 | Sperry Corp | High-frequency electron discharge device |
Also Published As
| Publication number | Publication date |
|---|---|
| GB302307A (en) | 1929-07-04 |
| BE356578A (enExample) | |
| FR666222A (fr) | 1929-09-28 |
| DE662140C (de) | 1938-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US1756889A (en) | Electron-discharge apparatus | |
| US2147447A (en) | Glow cathode | |
| US1981652A (en) | Method of coating electrodes | |
| US2600151A (en) | Ion producing mechanism | |
| US2316276A (en) | Electron discharge apparatus | |
| US2034571A (en) | Electrical discharge device and method of operating same | |
| US2323560A (en) | Electron discharge apparatus | |
| US2516675A (en) | Electrode structure for gas discharge devices | |
| US2228945A (en) | Electric discharge tube | |
| US1878338A (en) | Gaseous conduction apparatus | |
| US2159946A (en) | Electron discharge device | |
| US1723869A (en) | Electrical discharge device | |
| US1731268A (en) | Electron-discharge device | |
| US1752747A (en) | Electron-discharge device and getter therefor | |
| US1728822A (en) | Electron-discharge apparatus | |
| US1691446A (en) | Electron-discharge device with oxide-coated filament | |
| US3242374A (en) | Cold cathode with nickel base, calcium oxide interface and magnesium oxide layer | |
| US2330848A (en) | Gaseous discharge device | |
| US1849056A (en) | Electron discharge device | |
| US2012339A (en) | Rectifier | |
| US2088249A (en) | Gaseous rectifier | |
| US2115147A (en) | Electrical discharge device | |
| US1659207A (en) | Method of cleaning up residual gases | |
| US1648183A (en) | Method and apparatus for conducting current | |
| US1895437A (en) | Method of degassing cathodes of electron discharge tubes |