DE623373C - - Google Patents
Info
- Publication number
- DE623373C DE623373C DENDAT623373D DE623373DC DE623373C DE 623373 C DE623373 C DE 623373C DE NDAT623373 D DENDAT623373 D DE NDAT623373D DE 623373D C DE623373D C DE 623373DC DE 623373 C DE623373 C DE 623373C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- solution
- volume
- atom
- barbituric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000007656 barbituric acids Chemical class 0.000 claims description 9
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- 239000004202 carbamide Substances 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000002690 malonic acid derivatives Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 150000003672 ureas Chemical class 0.000 claims description 3
- 239000013067 intermediate product Substances 0.000 claims description 2
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 235000013877 carbamide Nutrition 0.000 description 4
- LDMNAUFAKBNKJB-UHFFFAOYSA-N 5-piperidin-1-yl-1,3-diazinane-2,4,6-trione Chemical compound N1(CCCCC1)C1C(NC(NC1=O)=O)=O LDMNAUFAKBNKJB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- SQBHGDSDVWCPHN-UHFFFAOYSA-N 1-methyl-3-phenylurea Chemical compound CNC(=O)NC1=CC=CC=C1 SQBHGDSDVWCPHN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- HFEHLDPGIKPNKL-UHFFFAOYSA-N allyl iodide Chemical compound ICC=C HFEHLDPGIKPNKL-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- -1 diethyl methylpiperidinomalonic acid Chemical compound 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229960000789 guanidine hydrochloride Drugs 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 231100000957 no side effect Toxicity 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- ROFVJSWBDQUQGW-UHFFFAOYSA-N piperidin-1-ium;bromide Chemical compound Br.C1CCNCC1 ROFVJSWBDQUQGW-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
Landscapes
- Hydrogenated Pyridines (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE623373C true DE623373C (enFirst) |
Family
ID=576365
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT623373D Active DE623373C (enFirst) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE623373C (enFirst) |
-
0
- DE DENDAT623373D patent/DE623373C/de active Active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2824781C3 (de) | l-Alkyl^-hydroxymethyl-SAStrihydroxy-piperidinderivate | |
| DE2503815C2 (de) | Indazol-Derivate, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2147023C3 (de) | Verfahren zur Herstellung von 1H- Tetrazol-Verbindungen | |
| DE2449492A1 (de) | Verfahren zur herstellung von optisch aktivem p-hydroxyphenylglycin | |
| DE1023039B (de) | Verfahren zur Herstellung von 5-Piperazino-pyridazon-(6)-verbindungen | |
| DE623373C (enFirst) | ||
| DE2409646A1 (de) | 3-pyrrolidinylmethanole, ihre salze, verfahren zu ihrer herstellung arzneimittel | |
| DE671787C (de) | Verfahren zur Darstellung von Pyrimidinverbindungen | |
| DE1804328A1 (de) | 3-substituierte Chinoxalinone und Verfahren zur Herstellung von 3-substituierten Chinoxalin-2-Onen | |
| DE1039063B (de) | Verfahren zur Herstellung eines antipyretisch wirksamen, substituierten 1, 2-Diphenyl-3, 5-dioxo-pyrazolidins und dessen Salzen | |
| DE2637665A1 (de) | 5-substituierte 5h-dibenz(b,f)azepin- derivate und verfahren zu deren herstellung | |
| DE1445800C (de) | Verfahren zur Herstellung von Diben zoazepinen | |
| DE947165C (de) | Verfahren zur Herstellung von in 3-Stellung substituierten 4-Oxycumarinen | |
| DE1246742B (de) | Verfahren zur Herstellung von neuen Phenothiazinen | |
| AT228211B (de) | Verfahren zur Herstellung von neuen Phenothiazinderivaten, sowie von Säureadditionssalzen und quartären Salzen dieser Phenothiazinderivate | |
| DE589146C (de) | Verfahren zur Herstellung von C, C-disubstituierten Barbitursaeuren | |
| DE1965361A1 (de) | N-Methylpiperidinderivate,ihre Verwendung und Verfahren zur Herstellung derselben | |
| CH506544A (de) | Verfahren zur Herstellung von biologisch aktiven substituierten s-Triazinen | |
| DE3506435A1 (de) | Neue ketosultame und verfahren zu ihrer herstellung | |
| AT254182B (de) | Verfahren zur Herstellung von neuen substituierten Benzamiden und deren Säureadditionssalzen | |
| DE1212955B (de) | Verfahren zur Herstellung von basisch substituierten Salicylamid-O-essigsaeure-estern | |
| AT332405B (de) | Verfahren zur herstellung neuer 1,4-dihydropyridine | |
| DE691410C (de) | Verfahren zur Herstellung von Aldehydabkoemmlingen der Thiazolin- bzw. Selenazolinreihe | |
| DE1293148B (de) | Verfahren zur Herstellung neuer 1-Benzyl-3-isopropyl-carbazinate | |
| DE1195314B (de) | Verfahren zur Herstellung von neuen Pyridinverbindungen |