DE60215951T2 - Piperidinderivate als antibakterielle mittel - Google Patents
Piperidinderivate als antibakterielle mittel Download PDFInfo
- Publication number
- DE60215951T2 DE60215951T2 DE60215951T DE60215951T DE60215951T2 DE 60215951 T2 DE60215951 T2 DE 60215951T2 DE 60215951 T DE60215951 T DE 60215951T DE 60215951 T DE60215951 T DE 60215951T DE 60215951 T2 DE60215951 T2 DE 60215951T2
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- hydroxy
- methoxy
- dihydro
- naphthyridin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical class C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 title claims description 131
- 230000000259 anti-tumor effect Effects 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 158
- 208000035143 Bacterial infection Diseases 0.000 claims abstract description 5
- 241000124008 Mammalia Species 0.000 claims abstract description 5
- 208000022362 bacterial infectious disease Diseases 0.000 claims abstract description 5
- -1 amino, piperidyl Chemical group 0.000 claims description 241
- 150000001875 compounds Chemical class 0.000 claims description 187
- 125000000217 alkyl group Chemical group 0.000 claims description 150
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 63
- 230000008569 process Effects 0.000 claims description 50
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 48
- 229910052739 hydrogen Inorganic materials 0.000 claims description 48
- 150000001408 amides Chemical class 0.000 claims description 40
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 40
- 239000001257 hydrogen Substances 0.000 claims description 40
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims description 38
- 125000003277 amino group Chemical group 0.000 claims description 38
- 125000003118 aryl group Chemical group 0.000 claims description 36
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 35
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 33
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 claims description 32
- 229910052736 halogen Inorganic materials 0.000 claims description 31
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 30
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 28
- 150000002367 halogens Chemical class 0.000 claims description 27
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 24
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 24
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 22
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 21
- 150000003254 radicals Chemical class 0.000 claims description 21
- 125000005137 alkenylsulfonyl group Chemical group 0.000 claims description 19
- 125000000623 heterocyclic group Chemical group 0.000 claims description 19
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 17
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 16
- 125000004414 alkyl thio group Chemical group 0.000 claims description 16
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 14
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 13
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- 125000002252 acyl group Chemical group 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 11
- 125000004429 atom Chemical group 0.000 claims description 11
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 11
- 125000005842 heteroatom Chemical group 0.000 claims description 11
- 150000002431 hydrogen Chemical group 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 10
- 238000005984 hydrogenation reaction Methods 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 9
- 125000001153 fluoro group Chemical group F* 0.000 claims description 9
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 9
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 claims description 9
- 239000003814 drug Substances 0.000 claims description 8
- 229910052721 tungsten Inorganic materials 0.000 claims description 8
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 7
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 229910052727 yttrium Inorganic materials 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 6
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 5
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 5
- 125000005035 acylthio group Chemical group 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 claims description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- 125000001414 1,2,4-triazol-5-yl group Chemical group [H]N1N=C([H])N=C1[*] 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 3
- 125000002837 carbocyclic group Chemical group 0.000 claims description 3
- 229940079593 drug Drugs 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000005948 methanesulfonyloxy group Chemical group 0.000 claims description 3
- 125000006413 ring segment Chemical group 0.000 claims description 3
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 claims description 3
- IQIOELVNILZQJR-UHFFFAOYSA-N 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxylic acid Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(C(=O)NC3=CC=NC4=CC=C(N=C43)OC)C(O)=O)=CC=C21 IQIOELVNILZQJR-UHFFFAOYSA-N 0.000 claims description 2
- XZOFUFUOKSMJHL-UHFFFAOYSA-N 6-[2-[4-fluoro-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-1-yl]ethyl]-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(F)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 XZOFUFUOKSMJHL-UHFFFAOYSA-N 0.000 claims description 2
- DYJVGEYZDNXUTF-UHFFFAOYSA-N 6-[2-[4-hydroxy-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-1-yl]ethyl]-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(O)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 DYJVGEYZDNXUTF-UHFFFAOYSA-N 0.000 claims description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 2
- 125000005360 alkyl sulfoxide group Chemical group 0.000 claims description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000005361 aryl sulfoxide group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000002619 bicyclic group Chemical group 0.000 claims description 2
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 2
- 150000003950 cyclic amides Chemical class 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 2
- 125000004468 heterocyclylthio group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 2
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 claims 3
- DPBWFNDFMCCGGJ-UHFFFAOYSA-N 4-Piperidine carboxamide Chemical compound NC(=O)C1CCNCC1 DPBWFNDFMCCGGJ-UHFFFAOYSA-N 0.000 claims 2
- OWKUCOSIMPSMJB-UHFFFAOYSA-N 6-amino-4H-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound NC1=NC=2NC(=O)CSC=2C=C1 OWKUCOSIMPSMJB-UHFFFAOYSA-N 0.000 claims 2
- QRZHDCJDCYMKAK-UHFFFAOYSA-N 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C1=C2OCOC2=CC(CCN2CCC(CC2)(O)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 QRZHDCJDCYMKAK-UHFFFAOYSA-N 0.000 claims 1
- NKUGCHGBXABNQR-UHFFFAOYSA-N 1-[2-(1,3-benzodioxol-5-yl)ethyl]-n-(6-methoxy-1,5-naphthyridin-4-yl)-4-methylpiperidine-4-carboxamide Chemical compound C1=C2OCOC2=CC(CCN2CCC(CC2)(C)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 NKUGCHGBXABNQR-UHFFFAOYSA-N 0.000 claims 1
- INHNYISGOBHQRE-UHFFFAOYSA-N 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyethyl]-4-hydroxypiperidine-4-carboxylic acid Chemical compound C=1C=C2OCCOC2=CC=1C(O)CN1CCC(O)(C(O)=O)CC1 INHNYISGOBHQRE-UHFFFAOYSA-N 0.000 claims 1
- SAHVHRAUICTINS-UHFFFAOYSA-N 1-[2-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)ethyl]-4-hydroxypiperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(O)CCN1CCC(N=C1)=CC2=C1OCCO2 SAHVHRAUICTINS-UHFFFAOYSA-N 0.000 claims 1
- QQYKHNDMZIEFOO-UHFFFAOYSA-N 1-[2-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)ethyl]-n-(8-fluoro-6-methoxyquinolin-4-yl)-4-hydroxypiperidine-4-carboxamide Chemical compound O1CCOC(C=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=C(F)C=C(OC)C=C21 QQYKHNDMZIEFOO-UHFFFAOYSA-N 0.000 claims 1
- AESLRYMZADOVDA-UHFFFAOYSA-N 1-[2-(6-oxo-5h-pyridazino[3,4-b][1,4]thiazin-3-yl)ethyl]-4-(trifluoromethyl)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(C(F)(F)F)CCN1CCC(N=N1)=CC2=C1SCC(=O)N2 AESLRYMZADOVDA-UHFFFAOYSA-N 0.000 claims 1
- KVFOPXJUIFFQCE-UHFFFAOYSA-N 4-(hydroxymethyl)-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxylic acid Chemical compound C1CC(CO)(C(O)=O)CCN1CCC1=CC=C(SCC(=O)N2)C2=C1 KVFOPXJUIFFQCE-UHFFFAOYSA-N 0.000 claims 1
- AURXPTQXLKNFGN-LBPRGKRZSA-N 4-hydroxy-1-[(2R)-2-hydroxy-2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxylic acid Chemical compound C([C@H](O)C=1C=C2NC(=O)CSC2=CC=1)N1CCC(O)(C(O)=O)CC1 AURXPTQXLKNFGN-LBPRGKRZSA-N 0.000 claims 1
- MRCSWAQDADAHKJ-UHFFFAOYSA-N 4-hydroxy-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(O)CCN1CCC1=CC=C(SCC(=O)N2)C2=C1 MRCSWAQDADAHKJ-UHFFFAOYSA-N 0.000 claims 1
- KUOGISAKTSYBBS-UHFFFAOYSA-N 4-hydroxy-1-[2-(6-oxo-5h-pyridazino[3,4-b][1,4]thiazin-3-yl)ethyl]piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(O)CCN1CCC(N=N1)=CC2=C1SCC(=O)N2 KUOGISAKTSYBBS-UHFFFAOYSA-N 0.000 claims 1
- LSDGNRVKQMOICF-UHFFFAOYSA-N 4-hydroxy-1-[2-oxo-2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(O)CCN1CC(=O)C1=CC=C(SCC(=O)N2)C2=C1 LSDGNRVKQMOICF-UHFFFAOYSA-N 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 150000003053 piperidines Chemical class 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 323
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 237
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 200
- 239000000243 solution Substances 0.000 description 130
- 238000006243 chemical reaction Methods 0.000 description 120
- 239000000203 mixture Substances 0.000 description 119
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 114
- 150000002500 ions Chemical class 0.000 description 114
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 90
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 81
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 81
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 77
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 74
- 239000007787 solid Substances 0.000 description 66
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 64
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 57
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 51
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 46
- 150000002148 esters Chemical class 0.000 description 43
- 239000000377 silicon dioxide Substances 0.000 description 43
- 238000004587 chromatography analysis Methods 0.000 description 42
- 235000019441 ethanol Nutrition 0.000 description 42
- 150000001412 amines Chemical class 0.000 description 40
- 239000012458 free base Substances 0.000 description 39
- 239000002253 acid Substances 0.000 description 38
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 35
- 239000000284 extract Substances 0.000 description 34
- 239000002904 solvent Substances 0.000 description 33
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 30
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 30
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 30
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 29
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 29
- 239000000047 product Substances 0.000 description 29
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 26
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 25
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 25
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 25
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 24
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 22
- 150000001299 aldehydes Chemical class 0.000 description 21
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 20
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 19
- 239000000741 silica gel Substances 0.000 description 19
- 229910002027 silica gel Inorganic materials 0.000 description 19
- 229960001866 silicon dioxide Drugs 0.000 description 19
- 239000012279 sodium borohydride Substances 0.000 description 19
- 229910000033 sodium borohydride Inorganic materials 0.000 description 19
- 229960004756 ethanol Drugs 0.000 description 18
- 238000001704 evaporation Methods 0.000 description 18
- 230000008020 evaporation Effects 0.000 description 18
- 239000003921 oil Substances 0.000 description 18
- 235000019198 oils Nutrition 0.000 description 18
- 239000002585 base Substances 0.000 description 17
- 239000012267 brine Substances 0.000 description 17
- 230000009467 reduction Effects 0.000 description 17
- 238000006722 reduction reaction Methods 0.000 description 17
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 230000007062 hydrolysis Effects 0.000 description 16
- 238000006460 hydrolysis reaction Methods 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- 150000003839 salts Chemical class 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- 229910000027 potassium carbonate Inorganic materials 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 14
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 14
- 230000002829 reductive effect Effects 0.000 description 14
- 239000008346 aqueous phase Substances 0.000 description 13
- 230000015572 biosynthetic process Effects 0.000 description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 13
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 12
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 12
- 125000003545 alkoxy group Chemical group 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 12
- 239000012074 organic phase Substances 0.000 description 12
- 229910000104 sodium hydride Inorganic materials 0.000 description 12
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 11
- 229910021529 ammonia Inorganic materials 0.000 description 11
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- 241000283690 Bos taurus Species 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- 229910052786 argon Inorganic materials 0.000 description 10
- 235000006408 oxalic acid Nutrition 0.000 description 10
- 150000002924 oxiranes Chemical class 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 9
- 238000007796 conventional method Methods 0.000 description 9
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 9
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 150000001336 alkenes Chemical class 0.000 description 8
- 230000008878 coupling Effects 0.000 description 8
- 238000010168 coupling process Methods 0.000 description 8
- 238000005859 coupling reaction Methods 0.000 description 8
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 8
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 8
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 150000002009 diols Chemical class 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 238000005755 formation reaction Methods 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 150000002576 ketones Chemical class 0.000 description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 7
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 6
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 6
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 6
- UQUVTQMSPZNPOG-UHFFFAOYSA-N 4-[[(6-methoxy-1,5-naphthyridin-4-yl)-methylamino]methyl]piperidin-4-ol Chemical compound C12=NC(OC)=CC=C2N=CC=C1N(C)CC1(O)CCNCC1 UQUVTQMSPZNPOG-UHFFFAOYSA-N 0.000 description 6
- ZGLPFOOZMBCICZ-UHFFFAOYSA-N 4-[[(6-methoxy-1,5-naphthyridin-4-yl)amino]methyl]piperidin-4-ol Chemical compound C12=NC(OC)=CC=C2N=CC=C1NCC1(O)CCNCC1 ZGLPFOOZMBCICZ-UHFFFAOYSA-N 0.000 description 6
- BLWCMYNTGFJVOC-UHFFFAOYSA-N 4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(O)(C(O)=O)CC1 BLWCMYNTGFJVOC-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 6
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 6
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 6
- 239000005909 Kieselgur Substances 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000012280 lithium aluminium hydride Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 6
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 6
- 229960002317 succinimide Drugs 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- CSSHRKYOZTZFCX-UHFFFAOYSA-N 2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone Chemical compound O1CCOC2=CC(C(=O)CBr)=CC=C21 CSSHRKYOZTZFCX-UHFFFAOYSA-N 0.000 description 5
- HMPUCYQSNBUJND-UHFFFAOYSA-N 4-(2-chloroethyl)-4h-1,2-benzoxazin-3-one Chemical compound C1=CC=C2C(CCCl)C(=O)NOC2=C1 HMPUCYQSNBUJND-UHFFFAOYSA-N 0.000 description 5
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 5
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 5
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 5
- 150000001350 alkyl halides Chemical class 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 150000005690 diesters Chemical class 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 125000000468 ketone group Chemical group 0.000 description 5
- 229910052744 lithium Inorganic materials 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Substances ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 4
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- WQADWIOXOXRPLN-UHFFFAOYSA-N 1,3-dithiane Chemical compound C1CSCSC1 WQADWIOXOXRPLN-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- MJNPHLBKHKJDEF-UHFFFAOYSA-N 2h-1$l^{4},2-benzothiazine 1-oxide Chemical class C1=CC=C2S(=O)NC=CC2=C1 MJNPHLBKHKJDEF-UHFFFAOYSA-N 0.000 description 4
- XYDGPGIHUGUTJS-UHFFFAOYSA-N 4-(methoxymethoxy)-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C=1C=NC2=CC=C(OC)N=C2C=1NC(=O)C1(OCOC)CCNCC1 XYDGPGIHUGUTJS-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- KKVAKUUCHRTKRK-UHFFFAOYSA-N 6-(2-chloroacetyl)-7-fluoro-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=C1C=C(F)C(C(=O)CCl)=C2 KKVAKUUCHRTKRK-UHFFFAOYSA-N 0.000 description 4
- QGEMREDZOOISMZ-UHFFFAOYSA-N 7-(2-chloroacetyl)-1h-pyrido[2,3-b][1,4]thiazin-2-one Chemical compound S1CC(=O)NC2=CC(C(=O)CCl)=CN=C21 QGEMREDZOOISMZ-UHFFFAOYSA-N 0.000 description 4
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 4
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 238000007239 Wittig reaction Methods 0.000 description 4
- 238000005903 acid hydrolysis reaction Methods 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 150000001540 azides Chemical class 0.000 description 4
- 244000309464 bull Species 0.000 description 4
- 150000003857 carboxamides Chemical class 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- ALHUXMDEZNLFTA-UHFFFAOYSA-N methyl-quinoxaline Natural products C1=CC=CC2=NC(C)=CN=C21 ALHUXMDEZNLFTA-UHFFFAOYSA-N 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 4
- 239000012285 osmium tetroxide Substances 0.000 description 4
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 4
- 150000002923 oximes Chemical class 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 238000010561 standard procedure Methods 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 3
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 3
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 3
- RGICCULPCWNRAB-UHFFFAOYSA-N 2-[2-(2-hexoxyethoxy)ethoxy]ethanol Chemical compound CCCCCCOCCOCCOCCO RGICCULPCWNRAB-UHFFFAOYSA-N 0.000 description 3
- HODYDVHWWMTUEL-UHFFFAOYSA-N 3,6-dichloropyridazin-4-amine Chemical compound NC1=CC(Cl)=NN=C1Cl HODYDVHWWMTUEL-UHFFFAOYSA-N 0.000 description 3
- HBOCBNSVLHYKNX-UHFFFAOYSA-N 3-ethenyl-2h-pyridazino[3,4-e]thiazine Chemical compound N1=CC=C2SNC(C=C)=CC2=N1 HBOCBNSVLHYKNX-UHFFFAOYSA-N 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical compound C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 3
- GDPLHNSXAWWKIF-UHFFFAOYSA-N 6-methoxy-1,5-naphthyridin-4-amine dihydrochloride Chemical compound Cl.Cl.N1=CC=C(N)C2=NC(OC)=CC=C21 GDPLHNSXAWWKIF-UHFFFAOYSA-N 0.000 description 3
- SSMACLPPRSQXHH-UHFFFAOYSA-N 6-methoxy-1h-1,5-naphthyridin-4-one Chemical compound N1C=CC(=O)C2=NC(OC)=CC=C21 SSMACLPPRSQXHH-UHFFFAOYSA-N 0.000 description 3
- UUVDJIWRSIJEBS-UHFFFAOYSA-N 6-methoxypyridin-3-amine Chemical compound COC1=CC=C(N)C=N1 UUVDJIWRSIJEBS-UHFFFAOYSA-N 0.000 description 3
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 3
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 241000606768 Haemophilus influenzae Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 3
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000006073 displacement reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000006735 epoxidation reaction Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 150000004820 halides Chemical group 0.000 description 3
- 238000011905 homologation Methods 0.000 description 3
- 150000001261 hydroxy acids Chemical class 0.000 description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 125000002524 organometallic group Chemical group 0.000 description 3
- 125000004043 oxo group Chemical group O=* 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 238000005897 peptide coupling reaction Methods 0.000 description 3
- 125000005936 piperidyl group Chemical group 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- MYPYJXKWCTUITO-UHFFFAOYSA-N vancomycin Natural products O1C(C(=C2)Cl)=CC=C2C(O)C(C(NC(C2=CC(O)=CC(O)=C2C=2C(O)=CC=C3C=2)C(O)=O)=O)NC(=O)C3NC(=O)C2NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC(C)C)NC)C(O)C(C=C3Cl)=CC=C3OC3=CC2=CC1=C3OC1OC(CO)C(O)C(O)C1OC1CC(C)(N)C(O)C(C)O1 MYPYJXKWCTUITO-UHFFFAOYSA-N 0.000 description 3
- 239000003039 volatile agent Substances 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- AZBATVXJFDYJFB-PRJDIBJQSA-N (2R)-2-methoxypiperidine-1,4-dicarboxylic acid Chemical compound CO[C@H]1N(CCC(C1)C(=O)O)C(=O)O AZBATVXJFDYJFB-PRJDIBJQSA-N 0.000 description 2
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 2
- LQQKDSXCDXHLLF-UHFFFAOYSA-N 1,3-dibromopropan-2-one Chemical class BrCC(=O)CBr LQQKDSXCDXHLLF-UHFFFAOYSA-N 0.000 description 2
- 150000005055 1,5-naphthyridines Chemical class 0.000 description 2
- HGVWMTAIIYNQSI-UHFFFAOYSA-N 1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone Chemical compound O1CCOC2=CC(C(=O)C)=CC=C21 HGVWMTAIIYNQSI-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- MYHJCTUTPIKNAT-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl piperidine-1,4-dicarboxylate Chemical compound CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 MYHJCTUTPIKNAT-UHFFFAOYSA-N 0.000 description 2
- PTZNCCIULVXFIJ-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl piperidine-1,4-dicarboxylate Chemical compound COC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 PTZNCCIULVXFIJ-UHFFFAOYSA-N 0.000 description 2
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 2
- NSPLFNGUPLZYHV-UHFFFAOYSA-N 1h-1,5-naphthyridin-4-one Chemical class C1=CN=C2C(O)=CC=NC2=C1 NSPLFNGUPLZYHV-UHFFFAOYSA-N 0.000 description 2
- OMWBUWDHEZIMGQ-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-c]pyridine-7-carbaldehyde Chemical compound O1CCOC2=C1C=C(C=O)N=C2 OMWBUWDHEZIMGQ-UHFFFAOYSA-N 0.000 description 2
- BVRNERFWPQRVJB-UHFFFAOYSA-N 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid Chemical compound O1CCOC2=CC(CC(=O)O)=CC=C21 BVRNERFWPQRVJB-UHFFFAOYSA-N 0.000 description 2
- ZWKJGSFAORXDED-UHFFFAOYSA-N 2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol Chemical compound O1CCOC2=CC(CCO)=CC=C21 ZWKJGSFAORXDED-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 2
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical class C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 2
- WZAYGEJJEMVRAN-UHFFFAOYSA-N 2-chloro-1-(thiadiazolo[5,4-b]pyridin-6-yl)ethanone Chemical compound ClCC(=O)C1=CN=C2SN=NC2=C1 WZAYGEJJEMVRAN-UHFFFAOYSA-N 0.000 description 2
- YMDZDFSUDFLGMX-UHFFFAOYSA-N 2-chloro-n-(2-chloroethyl)ethanamine;hydron;chloride Chemical compound [Cl-].ClCC[NH2+]CCCl YMDZDFSUDFLGMX-UHFFFAOYSA-N 0.000 description 2
- OYZYWAJGLRVYDF-UHFFFAOYSA-N 2-ethenyl-6,7-dihydro-[1,4]dioxino[2,3-d]pyrimidine Chemical compound O1CCOC2=NC(C=C)=NC=C21 OYZYWAJGLRVYDF-UHFFFAOYSA-N 0.000 description 2
- XLHFQWCMIWOPGG-UHFFFAOYSA-N 2-ethenylquinoxaline Chemical compound C1=CC=CC2=NC(C=C)=CN=C21 XLHFQWCMIWOPGG-UHFFFAOYSA-N 0.000 description 2
- REIVHYDACHXPNH-UHFFFAOYSA-N 2-fluoro-4-hydroxybenzonitrile Chemical compound OC1=CC=C(C#N)C(F)=C1 REIVHYDACHXPNH-UHFFFAOYSA-N 0.000 description 2
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 2
- KAIOWZZCJYAKKY-UHFFFAOYSA-N 2h-pyridazino[3,4-e]thiazine Chemical compound C1=NN=C2C=CNSC2=C1 KAIOWZZCJYAKKY-UHFFFAOYSA-N 0.000 description 2
- HRHFUHGNTSSIFS-UHFFFAOYSA-N 2h-thiazine 1-oxide Chemical group O=S1NC=CC=C1 HRHFUHGNTSSIFS-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- FQYRLEXKXQRZDH-UHFFFAOYSA-N 4-aminoquinoline Chemical compound C1=CC=C2C(N)=CC=NC2=C1 FQYRLEXKXQRZDH-UHFFFAOYSA-N 0.000 description 2
- URBDNSCLBSLLFQ-UHFFFAOYSA-N 4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C(O)=O)(C#N)CC1 URBDNSCLBSLLFQ-UHFFFAOYSA-N 0.000 description 2
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 2
- URTVZFQKWRGIRJ-UHFFFAOYSA-N 4-hydroxy-n-(6-methoxyquinolin-4-yl)piperidine-4-carboxamide Chemical compound C12=CC(OC)=CC=C2N=CC=C1NC(=O)C1(O)CCNCC1 URTVZFQKWRGIRJ-UHFFFAOYSA-N 0.000 description 2
- XQIRIYJOVQEBDL-UHFFFAOYSA-N 4h-1,2-benzothiazin-3-one Chemical compound C1=CC=C2SNC(=O)CC2=C1 XQIRIYJOVQEBDL-UHFFFAOYSA-N 0.000 description 2
- HCWFDMJNYDNDOB-UHFFFAOYSA-N 5-amino-2-fluoro-4-hydroxybenzonitrile Chemical compound NC1=CC(C#N)=C(F)C=C1O HCWFDMJNYDNDOB-UHFFFAOYSA-N 0.000 description 2
- DMIHNTNTPOLSER-UHFFFAOYSA-N 5-hydroxy-2-(hydroxymethyl)-1h-pyrimidin-6-one Chemical compound OCC1=NC=C(O)C(O)=N1 DMIHNTNTPOLSER-UHFFFAOYSA-N 0.000 description 2
- YDYLPMPVYALQKQ-UHFFFAOYSA-N 6-(2-chloroacetyl)-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(C(=O)CCl)=CC=C21 YDYLPMPVYALQKQ-UHFFFAOYSA-N 0.000 description 2
- MIAHXWVABDHISZ-UHFFFAOYSA-N 6-(2-chloroacetyl)-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(C(=O)CCl)=CC=C21 MIAHXWVABDHISZ-UHFFFAOYSA-N 0.000 description 2
- VTWSJADENSBTIS-UHFFFAOYSA-N 6-(2-chloroacetyl)-7-fluoro-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=C1C=C(F)C(C(=O)CCl)=C2 VTWSJADENSBTIS-UHFFFAOYSA-N 0.000 description 2
- XKMSVFHYIRCOTR-UHFFFAOYSA-N 6-(2-hydroxyethyl)-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CCO)=CC=C21 XKMSVFHYIRCOTR-UHFFFAOYSA-N 0.000 description 2
- MZRBLLRXFDWBHX-UHFFFAOYSA-N 6-methoxy-n-methyl-1,5-naphthyridin-4-amine Chemical compound C1=C(OC)N=C2C(NC)=CC=NC2=C1 MZRBLLRXFDWBHX-UHFFFAOYSA-N 0.000 description 2
- PHGNGVYUHOARGF-UHFFFAOYSA-N 6-methoxyquinolin-4-amine Chemical compound N1=CC=C(N)C2=CC(OC)=CC=C21 PHGNGVYUHOARGF-UHFFFAOYSA-N 0.000 description 2
- XGYUSPYZPTXLSU-UHFFFAOYSA-N 7-bromo-6-(2-chloroacetyl)-4-methylpyrido[3,2-b][1,4]thiazin-3-one Chemical compound BrC1=C(C(=O)CCl)N=C2N(C)C(=O)CSC2=C1 XGYUSPYZPTXLSU-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo(3.3.1)nonane Chemical compound C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- 0 CC(O1)=C(*)OC1=O Chemical compound CC(O1)=C(*)OC1=O 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- 241000495778 Escherichia faecalis Species 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 238000007341 Heck reaction Methods 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- 241000588655 Moraxella catarrhalis Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- PLLNWELREOKYBZ-UHFFFAOYSA-N [4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidin-4-yl] acetate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(OC(C)=O)CCNCC1 PLLNWELREOKYBZ-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- VZOVOHRDLOYBJX-UHFFFAOYSA-N benzyl 4-oxopiperidine-1-carboxylate Chemical compound C1CC(=O)CCN1C(=O)OCC1=CC=CC=C1 VZOVOHRDLOYBJX-UHFFFAOYSA-N 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 150000002013 dioxins Chemical class 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000003885 eye ointment Substances 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 238000006197 hydroboration reaction Methods 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- BEJNERDRQOWKJM-UHFFFAOYSA-N kojic acid Chemical compound OCC1=CC(=O)C(O)=CO1 BEJNERDRQOWKJM-UHFFFAOYSA-N 0.000 description 2
- 229960004705 kojic acid Drugs 0.000 description 2
- WZNJWVWKTVETCG-UHFFFAOYSA-N kojic acid Natural products OC(=O)C(N)CN1C=CC(=O)C(O)=C1 WZNJWVWKTVETCG-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- BRPREIDVQXJOJH-UHFFFAOYSA-N methyl 6-chloro-5-nitropyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(Cl)C([N+]([O-])=O)=C1 BRPREIDVQXJOJH-UHFFFAOYSA-N 0.000 description 2
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000005054 naphthyridines Chemical class 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 238000006772 olefination reaction Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- PYNUOAIJIQGACY-UHFFFAOYSA-N propylazanium;chloride Chemical compound Cl.CCCN PYNUOAIJIQGACY-UHFFFAOYSA-N 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 150000003246 quinazolines Chemical class 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000005932 reductive alkylation reaction Methods 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- ULSBMKGFFFMGOI-UHFFFAOYSA-N tert-butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC11OC1 ULSBMKGFFFMGOI-UHFFFAOYSA-N 0.000 description 2
- BCTZJOQOVMYMTI-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[[(6-methoxy-1,5-naphthyridin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NCC1(O)CCN(C(=O)OC(C)(C)C)CC1 BCTZJOQOVMYMTI-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 2
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- QIWRFOJWQSSRJZ-UHFFFAOYSA-N tributyl(ethenyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C=C QIWRFOJWQSSRJZ-UHFFFAOYSA-N 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 description 2
- QXXHXTRTGZBOGD-UHFFFAOYSA-M trifluoromethanesulfonate;5-(trifluoromethyl)dibenzothiophen-5-ium Chemical compound [O-]S(=O)(=O)C(F)(F)F.C1=CC=C2[S+](C(F)(F)F)C3=CC=CC=C3C2=C1 QXXHXTRTGZBOGD-UHFFFAOYSA-M 0.000 description 2
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 2
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 2
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- FVFAXZGNTXYGEY-YGPZHTELSA-N (2R)-2-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CO[C@@H]1CC(CCN1C(=O)OC(C)(C)C)C(O)=O FVFAXZGNTXYGEY-YGPZHTELSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- PPZNNZQHBXZAPS-UHFFFAOYSA-N (6-methoxy-1,5-naphthyridin-4-yl) trifluoromethanesulfonate Chemical compound N1=CC=C(OS(=O)(=O)C(F)(F)F)C2=NC(OC)=CC=C21 PPZNNZQHBXZAPS-UHFFFAOYSA-N 0.000 description 1
- WZLCIBVIRRXDOG-UHFFFAOYSA-N (8-fluoro-6-methoxyquinolin-4-yl) trifluoromethanesulfonate Chemical compound N1=CC=C(OS(=O)(=O)C(F)(F)F)C2=CC(OC)=CC(F)=C21 WZLCIBVIRRXDOG-UHFFFAOYSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical class NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 1
- CYPYTURSJDMMMP-UHFFFAOYSA-N 1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1.C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1.C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1 CYPYTURSJDMMMP-UHFFFAOYSA-N 0.000 description 1
- KFAJXZVDBVRZRC-UHFFFAOYSA-N 1,5-naphthyridin-4-amine Chemical compound C1=CN=C2C(N)=CC=NC2=C1 KFAJXZVDBVRZRC-UHFFFAOYSA-N 0.000 description 1
- KATXLQRXWHBXJL-UHFFFAOYSA-N 1-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)-2-trimethylsilylethanol Chemical compound O1CCOC2=C1C=C(C(O)C[Si](C)(C)C)N=C2 KATXLQRXWHBXJL-UHFFFAOYSA-N 0.000 description 1
- YEVPHFIFGUWSMG-UHFFFAOYSA-N 1-(4-chloro-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 YEVPHFIFGUWSMG-UHFFFAOYSA-N 0.000 description 1
- MNNTVCJSCKWRPC-UHFFFAOYSA-N 1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethanol Chemical compound C1CCNC2=NC(C(O)C)=CC=C21 MNNTVCJSCKWRPC-UHFFFAOYSA-N 0.000 description 1
- XMOGRJIQFWJZDG-UHFFFAOYSA-N 1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2h-pyridine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C(O)=O)=CC1 XMOGRJIQFWJZDG-UHFFFAOYSA-N 0.000 description 1
- NECZIICXICWRHJ-UHFFFAOYSA-N 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C(F)(F)F)(C(O)=O)CC1 NECZIICXICWRHJ-UHFFFAOYSA-N 0.000 description 1
- VOHDUEHSQMBSGL-UHFFFAOYSA-N 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide oxalic acid Chemical compound OC(=O)C(O)=O.COc1ccc2nccc(NC(=O)C3(O)CCN(CCc4ccc5OCOc5c4)CC3)c2n1 VOHDUEHSQMBSGL-UHFFFAOYSA-N 0.000 description 1
- ZVPFRPUPJSWVAP-UHFFFAOYSA-N 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyethyl]-4-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide dihydrochloride Chemical compound Cl.Cl.O1CCOC2=CC(C(O)CN3CCC(CC3)(O)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 ZVPFRPUPJSWVAP-UHFFFAOYSA-N 0.000 description 1
- ULINVHFNFCIEHJ-UHFFFAOYSA-N 1-[2-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)ethyl]-4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide;hydrochloride Chemical compound Cl.O1CCOC(C=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 ULINVHFNFCIEHJ-UHFFFAOYSA-N 0.000 description 1
- BNGJCINCSDUEAL-UHFFFAOYSA-N 1-[2-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)ethyl]-n-(8-fluoro-6-methoxyquinolin-4-yl)-4-hydroxypiperidine-4-carboxamide;hydrochloride Chemical compound Cl.O1CCOC(C=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=C(F)C=C(OC)C=C21 BNGJCINCSDUEAL-UHFFFAOYSA-N 0.000 description 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 description 1
- VKBXAHZIEKTJSX-UHFFFAOYSA-N 1-ethenylperoxybutane Chemical compound CCCCOOC=C VKBXAHZIEKTJSX-UHFFFAOYSA-N 0.000 description 1
- FUOVRUYTMYJRJK-UHFFFAOYSA-N 1-o-benzyl 4-o'-tert-butyl 4-o-methyl piperidine-1,4,4-tricarboxylate Chemical compound C1CC(C(=O)OC)(C(=O)OC(C)(C)C)CCN1C(=O)OCC1=CC=CC=C1 FUOVRUYTMYJRJK-UHFFFAOYSA-N 0.000 description 1
- VSCYKLWATPRQDD-UHFFFAOYSA-N 1-o-benzyl 4-o-tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1,4-dicarboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C(CC1)(C(=O)OC(C)(C)C)CCN1C(=O)OCC1=CC=CC=C1 VSCYKLWATPRQDD-UHFFFAOYSA-N 0.000 description 1
- LDMUGEKGAFIGLA-UHFFFAOYSA-N 1-o-tert-butyl 4-o,4-o'-dimethyl piperidine-1,4,4-tricarboxylate Chemical compound COC(=O)C1(C(=O)OC)CCN(C(=O)OC(C)(C)C)CC1 LDMUGEKGAFIGLA-UHFFFAOYSA-N 0.000 description 1
- HITDHRSBVMDFJF-UHFFFAOYSA-N 1-o-tert-butyl 4-o-(methoxymethyl) 4-(methoxymethoxy)piperidine-1,4-dicarboxylate Chemical compound COCOC(=O)C1(OCOC)CCN(C(=O)OC(C)(C)C)CC1 HITDHRSBVMDFJF-UHFFFAOYSA-N 0.000 description 1
- BLRYELPWMVHGPZ-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate Chemical compound CCOC(=O)C1(CC#N)CCN(C(=O)OC(C)(C)C)CC1 BLRYELPWMVHGPZ-UHFFFAOYSA-N 0.000 description 1
- ZQZVWDXMUCTNRI-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl 4-methylpiperidine-1,4-dicarboxylate Chemical compound CCOC(=O)C1(C)CCN(C(=O)OC(C)(C)C)CC1 ZQZVWDXMUCTNRI-UHFFFAOYSA-N 0.000 description 1
- BNDRQMFIDHTNGI-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl 3,6-dihydro-2h-pyridine-1,4-dicarboxylate Chemical compound COC(=O)C1=CCN(C(=O)OC(C)(C)C)CC1 BNDRQMFIDHTNGI-UHFFFAOYSA-N 0.000 description 1
- WGJHFBDWOLVJBO-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl 4-(trifluoromethyl)piperidine-1,4-dicarboxylate Chemical compound COC(=O)C1(C(F)(F)F)CCN(C(=O)OC(C)(C)C)CC1 WGJHFBDWOLVJBO-UHFFFAOYSA-N 0.000 description 1
- BNHQNHASKIVGOW-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl 4-cyanopiperidine-1,4-dicarboxylate Chemical compound COC(=O)C1(C#N)CCN(C(=O)OC(C)(C)C)CC1 BNHQNHASKIVGOW-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N 1H-quinolin-4-one Natural products C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- ZFRUGZMCGCYBRC-UHFFFAOYSA-N 1h-1,8-naphthyridin-2-one Chemical compound C1=CC=NC2=NC(O)=CC=C21 ZFRUGZMCGCYBRC-UHFFFAOYSA-N 0.000 description 1
- UFMBERDMCRCVSM-UHFFFAOYSA-N 1h-cinnolin-4-one Chemical compound C1=CC=C2C(O)=CN=NC2=C1 UFMBERDMCRCVSM-UHFFFAOYSA-N 0.000 description 1
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical compound C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 1
- ZYBZYDVRLQSWGG-UHFFFAOYSA-N 2,2-dimethyloct-7-enoic acid Chemical compound OC(=O)C(C)(C)CCCCC=C ZYBZYDVRLQSWGG-UHFFFAOYSA-N 0.000 description 1
- MTZSLQPBGNIKBC-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethanol Chemical compound O1CCOC2=C1C=C(CO)N=C2 MTZSLQPBGNIKBC-UHFFFAOYSA-N 0.000 description 1
- RJXOVESYJFXCGI-UHFFFAOYSA-N 2,4-difluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1F RJXOVESYJFXCGI-UHFFFAOYSA-N 0.000 description 1
- ODVLMCWNGKLROU-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)acetic acid Chemical compound OC(=O)CC1=CC=C2OCOC2=C1 ODVLMCWNGKLROU-UHFFFAOYSA-N 0.000 description 1
- JADSGOFBFPTCHG-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)ethanol Chemical compound OCCC1=CC=C2OCOC2=C1 JADSGOFBFPTCHG-UHFFFAOYSA-N 0.000 description 1
- RDVUPCSNRRCQRM-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)ethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CC=C2OCOC2=C1 RDVUPCSNRRCQRM-UHFFFAOYSA-N 0.000 description 1
- BAMLODPUDGNCTF-UHFFFAOYSA-N 2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl methanesulfonate Chemical compound O1CCOC2=CC(CCOS(=O)(=O)C)=CC=C21 BAMLODPUDGNCTF-UHFFFAOYSA-N 0.000 description 1
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 description 1
- MXPRKXZWUVKJCB-UHFFFAOYSA-N 2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl methanesulfonate Chemical compound S1CC(=O)NC2=CC(CCOS(=O)(=O)C)=CC=C21 MXPRKXZWUVKJCB-UHFFFAOYSA-N 0.000 description 1
- MSAVICSPFQKRGG-UHFFFAOYSA-N 2-(4-fluoro-3-nitrophenyl)ethanol Chemical compound OCCC1=CC=C(F)C([N+]([O-])=O)=C1 MSAVICSPFQKRGG-UHFFFAOYSA-N 0.000 description 1
- ZGEXYNBHYVEWKT-UHFFFAOYSA-N 2-(hydroxymethyl)-5-phenylmethoxypyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCC=2C=CC=CC=2)=C1 ZGEXYNBHYVEWKT-UHFFFAOYSA-N 0.000 description 1
- AWHCWLNCGOYNBP-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)-2-nitrophenyl]sulfanylacetic acid Chemical compound OCCC1=CC=C(SCC(O)=O)C([N+]([O-])=O)=C1 AWHCWLNCGOYNBP-UHFFFAOYSA-N 0.000 description 1
- HEQOJEGTZCTHCF-UHFFFAOYSA-N 2-amino-1-phenylethanone Chemical compound NCC(=O)C1=CC=CC=C1 HEQOJEGTZCTHCF-UHFFFAOYSA-N 0.000 description 1
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical group FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- LIJLYNWYKULUHA-UHFFFAOYSA-N 2-chloroethyl carbamate Chemical compound NC(=O)OCCCl LIJLYNWYKULUHA-UHFFFAOYSA-N 0.000 description 1
- YWUVOJJHVFLNJA-UHFFFAOYSA-N 2-fluoro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(F)=C1 YWUVOJJHVFLNJA-UHFFFAOYSA-N 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 description 1
- XYBYNVQWRLVUCY-UHFFFAOYSA-N 2-methoxy-1,5-naphthyridine Chemical class N1=CC=CC2=NC(OC)=CC=C21 XYBYNVQWRLVUCY-UHFFFAOYSA-N 0.000 description 1
- XBWHOMGWRUJNPO-UHFFFAOYSA-N 2-methoxycarbonyl-3,3-dimethylbutanoic acid Chemical compound COC(=O)C(C(O)=O)C(C)(C)C XBWHOMGWRUJNPO-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- OYERWNJQHGYSPX-UHFFFAOYSA-N 2-oxo-1h-pyrido[3,4-b][1,4]thiazine-7-carbaldehyde Chemical compound N1C(=O)CSC2=C1C=C(C=O)N=C2 OYERWNJQHGYSPX-UHFFFAOYSA-N 0.000 description 1
- ZNGINKJHQQQORD-UHFFFAOYSA-N 2-trimethylsilylethanol Chemical compound C[Si](C)(C)CCO ZNGINKJHQQQORD-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- PCJFEVUKVKQSSL-UHFFFAOYSA-N 2h-1,2,4-oxadiazol-5-one Chemical class O=C1N=CNO1 PCJFEVUKVKQSSL-UHFFFAOYSA-N 0.000 description 1
- LJDQXQOPXOLCHL-UHFFFAOYSA-N 3,4,6-trichloropyridazine Chemical compound ClC1=CC(Cl)=C(Cl)N=N1 LJDQXQOPXOLCHL-UHFFFAOYSA-N 0.000 description 1
- 150000003929 3-aminopyridines Chemical class 0.000 description 1
- XYEHXVANTLBGQZ-UHFFFAOYSA-N 3-chloro-5h-pyridazino[3,4-b][1,4]thiazin-6-one Chemical compound N1C(=O)CSC2=C1C=C(Cl)N=N2 XYEHXVANTLBGQZ-UHFFFAOYSA-N 0.000 description 1
- XFYTWICOBYEWJJ-UHFFFAOYSA-N 3-ethenyl-5h-pyridazino[3,4-b][1,4]thiazin-6-one Chemical compound N1C(=O)CSC2=C1C=C(C=C)N=N2 XFYTWICOBYEWJJ-UHFFFAOYSA-N 0.000 description 1
- GBOGHJYGGDERQX-UHFFFAOYSA-N 3-oxo-4h-1,4-benzothiazine-6-carbaldehyde Chemical compound S1CC(=O)NC2=CC(C=O)=CC=C21 GBOGHJYGGDERQX-UHFFFAOYSA-N 0.000 description 1
- NBIVLYUEDPRLGI-UHFFFAOYSA-N 3-oxo-4h-1,4-benzothiazine-6-carboxylic acid Chemical compound S1CC(=O)NC2=CC(C(=O)O)=CC=C21 NBIVLYUEDPRLGI-UHFFFAOYSA-N 0.000 description 1
- SZHYPQDQYNLZJP-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid Chemical compound S1CC(=O)NC2=NC(C(=O)O)=CC=C21 SZHYPQDQYNLZJP-UHFFFAOYSA-N 0.000 description 1
- AMVLEBHYELFWJT-UHFFFAOYSA-N 3-propan-2-yloxy-4-tributylstannylcyclobut-3-ene-1,2-dione Chemical compound CCCC[Sn](CCCC)(CCCC)C1=C(OC(C)C)C(=O)C1=O AMVLEBHYELFWJT-UHFFFAOYSA-N 0.000 description 1
- QSTJWRVMVXRUNW-UHFFFAOYSA-N 4-(hydroxymethyl)-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(CO)CCNCC1 QSTJWRVMVXRUNW-UHFFFAOYSA-N 0.000 description 1
- GUZLIIAHBPUNIG-UHFFFAOYSA-N 4-(methoxymethoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound COCOC1(C(O)=O)CCN(C(=O)OC(C)(C)C)CC1 GUZLIIAHBPUNIG-UHFFFAOYSA-N 0.000 description 1
- SKLGMKNHGDBMTG-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid Chemical compound C1CC(C(=O)OC(C)(C)C)(C(O)=O)CCN1C(=O)OCC1=CC=CC=C1 SKLGMKNHGDBMTG-UHFFFAOYSA-N 0.000 description 1
- NLGYPUPEWBHOEK-UHFFFAOYSA-N 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C(CC1)(C(O)=O)CCN1C(=O)OCC1=CC=CC=C1 NLGYPUPEWBHOEK-UHFFFAOYSA-N 0.000 description 1
- DUHFIVKIHAGKTI-UHFFFAOYSA-N 4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-ol Chemical compound C12=NC(OC)=CC=C2N=CC=C1CCC1(O)CCNCC1 DUHFIVKIHAGKTI-UHFFFAOYSA-N 0.000 description 1
- YNHLVALLAURVJF-UHFFFAOYSA-N 4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(N)(C(O)=O)CC1 YNHLVALLAURVJF-UHFFFAOYSA-N 0.000 description 1
- RUXJZGGHMMTOSH-UHFFFAOYSA-N 4-amino-n-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-oxo-2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC(C(=O)CN3CCC(CC3)(N)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 RUXJZGGHMMTOSH-UHFFFAOYSA-N 0.000 description 1
- HGLBMULARPMEBH-UHFFFAOYSA-N 4-amino-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(N)CCNCC1 HGLBMULARPMEBH-UHFFFAOYSA-N 0.000 description 1
- GVRRXASZZAKBMN-UHFFFAOYSA-N 4-chloroquinazoline Chemical compound C1=CC=C2C(Cl)=NC=NC2=C1 GVRRXASZZAKBMN-UHFFFAOYSA-N 0.000 description 1
- KNDOFJFSHZCKGT-UHFFFAOYSA-N 4-chloroquinoline Chemical compound C1=CC=C2C(Cl)=CC=NC2=C1 KNDOFJFSHZCKGT-UHFFFAOYSA-N 0.000 description 1
- YWAQDTNMQBNTMV-UHFFFAOYSA-N 4-cyano-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C#N)CCNCC1 YWAQDTNMQBNTMV-UHFFFAOYSA-N 0.000 description 1
- NGLRRGRDAGJOFH-TXEPZDRESA-N 4-hydroxy-1-[(2R)-2-hydroxy-2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide dihydrochloride Chemical compound Cl.Cl.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)C[C@@H](C=1C=CC2=C(NC(CS2)=O)C1)O)O NGLRRGRDAGJOFH-TXEPZDRESA-N 0.000 description 1
- KWAMHCZQWPPOAF-UHFFFAOYSA-N 4-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-oxo-2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide oxalic acid Chemical compound OC(=O)C(O)=O.COc1ccc2nccc(NC(=O)C3(O)CCN(CC(=O)c4ccc5SCC(=O)Nc5c4)CC3)c2n1 KWAMHCZQWPPOAF-UHFFFAOYSA-N 0.000 description 1
- CAYQJEZFVHQVED-UHFFFAOYSA-N 4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(O)CCNCC1 CAYQJEZFVHQVED-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
- XJJJVKSYSBNXLV-UHFFFAOYSA-N 4-hydroxypiperidine-4-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1(O)CCNCC1 XJJJVKSYSBNXLV-UHFFFAOYSA-N 0.000 description 1
- JPZJLASWSZCENI-UHFFFAOYSA-N 4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound COC1(C(O)=O)CCN(C(=O)OC(C)(C)C)CC1 JPZJLASWSZCENI-UHFFFAOYSA-N 0.000 description 1
- UNLCNAJNDGSAJH-UHFFFAOYSA-N 4-methoxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(OC)CCNCC1 UNLCNAJNDGSAJH-UHFFFAOYSA-N 0.000 description 1
- WLJGWZCJNVXOKW-UHFFFAOYSA-N 4-methoxypiperidine-1,4-dicarboxylic acid Chemical compound COC1(C(O)=O)CCN(C(O)=O)CC1 WLJGWZCJNVXOKW-UHFFFAOYSA-N 0.000 description 1
- WUGQEAXJFJXATL-UHFFFAOYSA-N 4-n'-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4,4-dicarboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(N)=O)CCNCC1 WUGQEAXJFJXATL-UHFFFAOYSA-N 0.000 description 1
- UYEXITWEMOJURT-UHFFFAOYSA-N 4-o-benzyl 1-o-tert-butyl 3,6-dihydro-2h-pyridine-1,4-dicarboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C(=O)OCC=2C=CC=CC=2)=C1 UYEXITWEMOJURT-UHFFFAOYSA-N 0.000 description 1
- LODIKMSUDZMCFF-UHFFFAOYSA-N 4-oxo-1h-1,5-naphthyridine-3-carboxylic acid Chemical compound C1=CN=C2C(=O)C(C(=O)O)=CNC2=C1 LODIKMSUDZMCFF-UHFFFAOYSA-N 0.000 description 1
- UAISREBYDOFHJY-UHFFFAOYSA-N 4-oxopiperidin-1-ium-2-carboxylate Chemical compound OC(=O)C1CC(=O)CCN1 UAISREBYDOFHJY-UHFFFAOYSA-N 0.000 description 1
- GTFMIJNXNMDHAB-UHFFFAOYSA-N 4h-1,4-benzothiazin-3-one Chemical compound C1=CC=C2NC(=O)CSC2=C1 GTFMIJNXNMDHAB-UHFFFAOYSA-N 0.000 description 1
- FBXGQDUVJBKEAJ-UHFFFAOYSA-N 4h-oxazin-3-one Chemical compound O=C1CC=CON1 FBXGQDUVJBKEAJ-UHFFFAOYSA-N 0.000 description 1
- FHZIDNIJVVSXDL-UHFFFAOYSA-N 4h-pyrido[2,3-e]oxazin-3-one Chemical compound C1=CC=C2ONC(=O)CC2=N1 FHZIDNIJVVSXDL-UHFFFAOYSA-N 0.000 description 1
- YUVDZHWQKUGEJK-UHFFFAOYSA-N 4h-pyrido[2,3-e]thiazin-3-one Chemical compound C1=CC=C2SNC(=O)CC2=N1 YUVDZHWQKUGEJK-UHFFFAOYSA-N 0.000 description 1
- IWJLZADTSIIYBX-UHFFFAOYSA-N 5-(benzyloxy)-2-(hydroxymethyl)-1,4-dihydropyridin-4-one Chemical compound N1C(CO)=CC(=O)C(OCC=2C=CC=CC=2)=C1 IWJLZADTSIIYBX-UHFFFAOYSA-N 0.000 description 1
- RRLXNXFZXSSOGO-UHFFFAOYSA-N 5-[[(6-methoxypyridin-3-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound C1=NC(OC)=CC=C1NC=C1C(=O)OC(C)(C)OC1=O RRLXNXFZXSSOGO-UHFFFAOYSA-N 0.000 description 1
- LXAHHHIGZXPRKQ-UHFFFAOYSA-N 5-fluoro-2-methylpyridine Chemical compound CC1=CC=C(F)C=N1 LXAHHHIGZXPRKQ-UHFFFAOYSA-N 0.000 description 1
- YZAOUVZQOBBGNS-UHFFFAOYSA-N 6-(2-chloroacetyl)-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(C(=O)CCl)=CC=C21 YZAOUVZQOBBGNS-UHFFFAOYSA-N 0.000 description 1
- HQNXRLDPFHKTGQ-UHFFFAOYSA-N 6-(2-chloroethyl)-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(CCCl)=CC=C21 HQNXRLDPFHKTGQ-UHFFFAOYSA-N 0.000 description 1
- FDHINJNZZCOWOA-UHFFFAOYSA-N 6-(hydroxymethyl)-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CO)=CC=C21 FDHINJNZZCOWOA-UHFFFAOYSA-N 0.000 description 1
- WKIWQUVFIIRFBU-UHFFFAOYSA-N 6-[2-[2-(6-methoxy-1,5-naphthyridin-4-yl)-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]acetyl]-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(C(=O)CN3CCC4(CCN(C4=O)C4=CC=NC5=CC=C(N=C54)OC)CC3)=CC=C21 WKIWQUVFIIRFBU-UHFFFAOYSA-N 0.000 description 1
- XAZBRXLFKCEBGC-UHFFFAOYSA-N 6-acetyl-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(C(=O)C)=CC=C21 XAZBRXLFKCEBGC-UHFFFAOYSA-N 0.000 description 1
- VXMYQCJQEQTZAU-UHFFFAOYSA-N 6-ethenyl-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(C=C)=CC=C21 VXMYQCJQEQTZAU-UHFFFAOYSA-N 0.000 description 1
- VUHCPMIDSUGHNO-UHFFFAOYSA-N 6-methoxy-1,5-naphthyridin-4-amine Chemical compound N1=CC=C(N)C2=NC(OC)=CC=C21 VUHCPMIDSUGHNO-UHFFFAOYSA-N 0.000 description 1
- WWHICBVKJYFFSG-UHFFFAOYSA-N 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine Chemical compound O1CCOC2=C1C=C(C=C)N=C2 WWHICBVKJYFFSG-UHFFFAOYSA-N 0.000 description 1
- ZRSCIBYAOVOFIG-UHFFFAOYSA-N 7-fluoro-4h-1,4-benzothiazin-3-one Chemical compound N1C(=O)CSC2=CC(F)=CC=C21 ZRSCIBYAOVOFIG-UHFFFAOYSA-N 0.000 description 1
- FCTUXAFQZQNNBJ-UHFFFAOYSA-N 8-[2-(4-fluoropiperidin-4-yl)ethyl]-2-methoxy-1,5-naphthyridine Chemical compound C12=NC(OC)=CC=C2N=CC=C1CCC1(F)CCNCC1 FCTUXAFQZQNNBJ-UHFFFAOYSA-N 0.000 description 1
- ROHNLVXQIAQBHB-UHFFFAOYSA-N 8-fluoro-6-methoxy-1h-quinolin-4-one Chemical compound N1C=CC(=O)C2=CC(OC)=CC(F)=C21 ROHNLVXQIAQBHB-UHFFFAOYSA-N 0.000 description 1
- OJLZRYSTMRWWQM-UHFFFAOYSA-N 8-fluoro-6-methoxyquinolin-4-amine Chemical compound N1=CC=C(N)C2=CC(OC)=CC(F)=C21 OJLZRYSTMRWWQM-UHFFFAOYSA-N 0.000 description 1
- 101710134784 Agnoprotein Proteins 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N Azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- SCDMZALJUKGWQD-UHFFFAOYSA-N C(C(=O)O)(=O)O.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)CCC=1C=CC2=C(NC(CS2)=O)C1)CO Chemical compound C(C(=O)O)(=O)O.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)CCC=1C=CC2=C(NC(CS2)=O)C1)CO SCDMZALJUKGWQD-UHFFFAOYSA-N 0.000 description 1
- JKPZTSSXFFTASZ-LNUXAPHWSA-N CO[C@@H]1CC(CCN1C(=O)O)C(=O)NC2=C3C(=NC=C2)C=CC(=N3)OC Chemical compound CO[C@@H]1CC(CCN1C(=O)O)C(=O)NC2=C3C(=NC=C2)C=CC(=N3)OC JKPZTSSXFFTASZ-LNUXAPHWSA-N 0.000 description 1
- AEFVKNMJVCEJNQ-UHFFFAOYSA-N COc1ccc2nccc(NC(=O)C3(CCN(CC3)C(=O)OC(C)(C)C)C(O)=O)c2n1 Chemical compound COc1ccc2nccc(NC(=O)C3(CCN(CC3)C(=O)OC(C)(C)C)C(O)=O)c2n1 AEFVKNMJVCEJNQ-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 101100034502 Chlamydomonas reinhardtii ERY2 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGUGMYGMHZMDQD-UHFFFAOYSA-N Cl.Cl.N1C(=O)CSC(N=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 Chemical compound Cl.Cl.N1C(=O)CSC(N=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 DGUGMYGMHZMDQD-UHFFFAOYSA-N 0.000 description 1
- WMYXXPVELXIZEW-UHFFFAOYSA-N Cl.Cl.S1CC(=O)NC2=CC(CCN3CCC(CC3)(C(=O)NC3=CC=NC4=CC=C(N=C43)OC)C#N)=CC=C21 Chemical compound Cl.Cl.S1CC(=O)NC2=CC(CCN3CCC(CC3)(C(=O)NC3=CC=NC4=CC=C(N=C43)OC)C#N)=CC=C21 WMYXXPVELXIZEW-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 238000006809 Jones oxidation reaction Methods 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 238000006751 Mitsunobu reaction Methods 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- PFONFPHNYXFALE-UHFFFAOYSA-N N-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(6-oxo-5H-pyridazino[3,4-b][1,4]thiazin-3-yl)ethyl]-4-(trifluoromethyl)piperidine-4-carboxamide dihydrochloride Chemical compound Cl.Cl.N1C(=O)CSC(N=N2)=C1C=C2CCN(CC1)CCC1(C(F)(F)F)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 PFONFPHNYXFALE-UHFFFAOYSA-N 0.000 description 1
- IRNKETNAVPUPAT-UHFFFAOYSA-N N-(6-methoxy-1,5-naphthyridin-4-yl)-4-methyl-1-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide oxalic acid Chemical compound OC(=O)C(O)=O.S1CC(=O)NC2=CC(CCN3CCC(CC3)(C)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 IRNKETNAVPUPAT-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 150000007930 O-acyl isoureas Chemical class 0.000 description 1
- FHRXIPQMFSTZPA-UHFFFAOYSA-N OC(=O)C(O)=O.C1=C2OCOC2=CC(CCN2CCC(CC2)(C)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 Chemical compound OC(=O)C(O)=O.C1=C2OCOC2=CC(CCN2CCC(CC2)(C)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 FHRXIPQMFSTZPA-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 238000006680 Reformatsky reaction Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 238000006619 Stille reaction Methods 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical class [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 108010059993 Vancomycin Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QWRYXSDXSBMOOL-UHFFFAOYSA-N [1,4]dioxino[2,3-b]pyridine Chemical group C1=CC=C2OC=COC2=N1 QWRYXSDXSBMOOL-UHFFFAOYSA-N 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- JQOBSXPWZQSOBN-UHFFFAOYSA-M [Br-].C[Si](C)(C)C[Mg+] Chemical compound [Br-].C[Si](C)(C)C[Mg+] JQOBSXPWZQSOBN-UHFFFAOYSA-M 0.000 description 1
- ZYBXCIBWFOILPE-UHFFFAOYSA-N [Na].N#CC#N Chemical compound [Na].N#CC#N ZYBXCIBWFOILPE-UHFFFAOYSA-N 0.000 description 1
- QQTVULAMCGLGLN-UHFFFAOYSA-N acetonitrile;tetrachloromethane;hydrate Chemical compound O.CC#N.ClC(Cl)(Cl)Cl QQTVULAMCGLGLN-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005103 alkyl silyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 125000006242 amine protecting group Chemical group 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-N anhydrous cyanoacetic acid Natural products OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 125000004540 benzothiazol-5-yl group Chemical group S1C=NC2=C1C=CC(=C2)* 0.000 description 1
- VTRAKUAUVOFCHJ-UHFFFAOYSA-N benzyl 4-(hydroxymethyl)-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C(CC1)(CO)CCN1C(=O)OCC1=CC=CC=C1 VTRAKUAUVOFCHJ-UHFFFAOYSA-N 0.000 description 1
- FHPRDKVTXXHEFV-UHFFFAOYSA-N benzyl 4-ethynyl-4-hydroxypiperidine-1-carboxylate Chemical compound C1CC(O)(C#C)CCN1C(=O)OCC1=CC=CC=C1 FHPRDKVTXXHEFV-UHFFFAOYSA-N 0.000 description 1
- LRAXBCKXXZYLRQ-UHFFFAOYSA-N benzyl 4-fluoro-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethynyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1C#CC(CC1)(F)CCN1C(=O)OCC1=CC=CC=C1 LRAXBCKXXZYLRQ-UHFFFAOYSA-N 0.000 description 1
- GNUAJJFEWPSTGB-UHFFFAOYSA-N benzyl 4-hydroxy-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethynyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1C#CC(CC1)(O)CCN1C(=O)OCC1=CC=CC=C1 GNUAJJFEWPSTGB-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- OBBMVFKOKGRDGS-UHFFFAOYSA-N benzyl n,n-bis(2-chloroethyl)carbamate Chemical compound ClCCN(CCCl)C(=O)OCC1=CC=CC=C1 OBBMVFKOKGRDGS-UHFFFAOYSA-N 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- PPDJNZTUDFPAHX-UHFFFAOYSA-N benzyltrimethylammonium dichloroiodate Chemical compound Cl[I-]Cl.C[N+](C)(C)CC1=CC=CC=C1 PPDJNZTUDFPAHX-UHFFFAOYSA-N 0.000 description 1
- 150000001277 beta hydroxy acids Chemical class 0.000 description 1
- 239000003781 beta lactamase inhibitor Substances 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- RUEKPBLTWGFBOD-UHFFFAOYSA-N bromoethyne Chemical compound BrC#C RUEKPBLTWGFBOD-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- HGXJOXHYPGNVNK-UHFFFAOYSA-N butane;ethenoxyethane;tin Chemical compound CCCC[Sn](CCCC)(CCCC)C(=C)OCC HGXJOXHYPGNVNK-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- QOPVNWQGBQYBBP-UHFFFAOYSA-N chloroethyl chloroformate Chemical compound CC(Cl)OC(Cl)=O QOPVNWQGBQYBBP-UHFFFAOYSA-N 0.000 description 1
- ZQKIFZGRNCIRRB-UHFFFAOYSA-N chloroform;n,n-dimethylformamide;methanol Chemical compound OC.ClC(Cl)Cl.CN(C)C=O ZQKIFZGRNCIRRB-UHFFFAOYSA-N 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- VTHIKKVKIVQWHV-UHFFFAOYSA-N chromium(6+) oxygen(2-) pyridine Chemical compound [O-2].[O-2].[O-2].[Cr+6].C1=CC=NC=C1 VTHIKKVKIVQWHV-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- GFHNAMRJFCEERV-UHFFFAOYSA-L cobalt chloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Co+2] GFHNAMRJFCEERV-UHFFFAOYSA-L 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000007269 dehydrobromination reaction Methods 0.000 description 1
- 230000003635 deoxygenating effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical class [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N dimethylsulfide Substances CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- VDQVEACBQKUUSU-UHFFFAOYSA-M disodium;sulfanide Chemical compound [Na+].[Na+].[SH-] VDQVEACBQKUUSU-UHFFFAOYSA-M 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003221 ear drop Substances 0.000 description 1
- 229940047652 ear drops Drugs 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- ZRSDQBKGDNPFLT-UHFFFAOYSA-N ethanol;oxolane Chemical compound CCO.C1CCOC1 ZRSDQBKGDNPFLT-UHFFFAOYSA-N 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- GKMQAGZRPQBLHG-UHFFFAOYSA-N ethyl 1-methyl-3,6-dihydro-2h-pyridine-4-carboxylate Chemical compound CCOC(=O)C1=CCN(C)CC1 GKMQAGZRPQBLHG-UHFFFAOYSA-N 0.000 description 1
- DSRXMRMMWIGMBO-UHFFFAOYSA-N ethyl 2-(5-fluoro-2-nitrophenyl)sulfanylacetate Chemical compound CCOC(=O)CSC1=CC(F)=CC=C1[N+]([O-])=O DSRXMRMMWIGMBO-UHFFFAOYSA-N 0.000 description 1
- ANQVKHGDALCPFZ-UHFFFAOYSA-N ethyl 2-[6-(4-methylpiperazin-1-yl)-1h-benzimidazol-2-yl]acetate Chemical compound C1=C2NC(CC(=O)OCC)=NC2=CC=C1N1CCN(C)CC1 ANQVKHGDALCPFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- RUJPPJYDHHAEEK-UHFFFAOYSA-N ethyl piperidine-4-carboxylate Chemical compound CCOC(=O)C1CCNCC1 RUJPPJYDHHAEEK-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000004130 indan-2-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])(*)C2([H])[H] 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 125000000686 lactone group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 description 1
- 229910001486 lithium perchlorate Inorganic materials 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- FXFXBGVSPSAHDI-UHFFFAOYSA-M magnesium;methanidyl(trimethyl)silane;bromide Chemical compound [Mg+2].[Br-].C[Si](C)(C)[CH2-] FXFXBGVSPSAHDI-UHFFFAOYSA-M 0.000 description 1
- BXBLTKZWYAHPKM-UHFFFAOYSA-M magnesium;methanidyl(trimethyl)silane;chloride Chemical compound [Mg+2].[Cl-].C[Si](C)(C)[CH2-] BXBLTKZWYAHPKM-UHFFFAOYSA-M 0.000 description 1
- OZOAXHQNOFIFGD-UHFFFAOYSA-N manganese(2+) oxygen(2-) Chemical compound [O-2].[O-2].[Mn+2].[Mn+2] OZOAXHQNOFIFGD-UHFFFAOYSA-N 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- GXHFUVWIGNLZSC-UHFFFAOYSA-N meldrum's acid Chemical compound CC1(C)OC(=O)CC(=O)O1 GXHFUVWIGNLZSC-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- SJFNDMHZXCUXSA-UHFFFAOYSA-M methoxymethyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(COC)C1=CC=CC=C1 SJFNDMHZXCUXSA-UHFFFAOYSA-M 0.000 description 1
- BULQWSZZDVCSQR-UHFFFAOYSA-N methyl 2-(4-acetyl-2-nitrophenyl)sulfanylacetate Chemical compound COC(=O)CSC1=CC=C(C(C)=O)C=C1[N+]([O-])=O BULQWSZZDVCSQR-UHFFFAOYSA-N 0.000 description 1
- JJCLRVOXIRHZCR-UHFFFAOYSA-N methyl 3,6-dibromopyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Br)=CC=C1Br JJCLRVOXIRHZCR-UHFFFAOYSA-N 0.000 description 1
- UFSVRHNRNVVBJR-UHFFFAOYSA-N methyl 3-oxo-4h-1,4-benzothiazine-6-carboxylate Chemical compound S1CC(=O)NC2=CC(C(=O)OC)=CC=C21 UFSVRHNRNVVBJR-UHFFFAOYSA-N 0.000 description 1
- UIAHQILQYROVCF-UHFFFAOYSA-N methyl 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylate Chemical compound S1CC(=O)NC2=NC(C(=O)OC)=CC=C21 UIAHQILQYROVCF-UHFFFAOYSA-N 0.000 description 1
- OQUCMNQHZFOMPC-UHFFFAOYSA-N methyl 6-amino-5-bromopyridine-2-carboxylate Chemical compound COC(=O)C1=CC=C(Br)C(N)=N1 OQUCMNQHZFOMPC-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- ANGDWNBGPBMQHW-UHFFFAOYSA-N methyl cyanoacetate Chemical compound COC(=O)CC#N ANGDWNBGPBMQHW-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- ANXKZXRDXAZQJT-UHFFFAOYSA-M methyl sulfate;trimethylsulfanium Chemical compound C[S+](C)C.COS([O-])(=O)=O ANXKZXRDXAZQJT-UHFFFAOYSA-M 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- KGPQKNJSZNXOPV-UHFFFAOYSA-N moniliformin Chemical group OC1=CC(=O)C1=O KGPQKNJSZNXOPV-UHFFFAOYSA-N 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- YHYUWOKWMJIPTG-UHFFFAOYSA-N n-(6-methoxy-1,5-naphthyridin-4-yl)-4-(trifluoromethyl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(F)(F)F)CCNCC1 YHYUWOKWMJIPTG-UHFFFAOYSA-N 0.000 description 1
- LNDNQQWXTWQXPN-UHFFFAOYSA-N n-(6-methoxy-1,5-naphthyridin-4-yl)-4-methylpiperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C)CCNCC1 LNDNQQWXTWQXPN-UHFFFAOYSA-N 0.000 description 1
- VZJWOKARVWMNND-UHFFFAOYSA-N n-(8-fluoro-6-methoxyquinolin-4-yl)-4-hydroxypiperidine-4-carboxamide Chemical compound C12=CC(OC)=CC(F)=C2N=CC=C1NC(=O)C1(O)CCNCC1 VZJWOKARVWMNND-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000002777 nucleoside Substances 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 125000001181 organosilyl group Chemical class [SiH3]* 0.000 description 1
- 150000004893 oxazines Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000007248 oxidative elimination reaction Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- FHLACKYUBOGPPD-UHFFFAOYSA-N piperidine-1,4,4-tricarboxylic acid Chemical compound OC(=O)N1CCC(C(O)=O)(C(O)=O)CC1 FHLACKYUBOGPPD-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- CAEWJEXPFKNBQL-UHFFFAOYSA-N prop-2-enyl carbonochloridate Chemical compound ClC(=O)OCC=C CAEWJEXPFKNBQL-UHFFFAOYSA-N 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 125000004526 pyridazin-2-yl group Chemical group N1N(C=CC=C1)* 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- VSGPVHSTVTXREH-UHFFFAOYSA-N quinolin-4-one Chemical compound C1=CC=C[C]2C(=O)C=CN=C21 VSGPVHSTVTXREH-UHFFFAOYSA-N 0.000 description 1
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000012363 selectfluor Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- UYCAUPASBSROMS-AWQJXPNKSA-M sodium;2,2,2-trifluoroacetate Chemical compound [Na+].[O-][13C](=O)[13C](F)(F)F UYCAUPASBSROMS-AWQJXPNKSA-M 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- ADPIEGXXCABJCH-UHFFFAOYSA-N tert-butyl 1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC11C(=O)NCC1 ADPIEGXXCABJCH-UHFFFAOYSA-N 0.000 description 1
- TYVWNTKLAZUAMY-UHFFFAOYSA-N tert-butyl 2-(6-methoxy-1,5-naphthyridin-4-yl)-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1N(C1=O)CCC21CCN(C(=O)OC(C)(C)C)CC2 TYVWNTKLAZUAMY-UHFFFAOYSA-N 0.000 description 1
- HZBBLCVWKNGCBS-UHFFFAOYSA-N tert-butyl 4-(1,5-naphthyridin-4-ylcarbamoyl)-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxylate Chemical compound C1=CN=C2C(NC(=O)C3(CCN(CCC=4C=C5NC(=O)CSC5=CC=4)CC3)C(=O)OC(C)(C)C)=CC=NC2=C1 HZBBLCVWKNGCBS-UHFFFAOYSA-N 0.000 description 1
- RWSAEABPDVMLJS-UHFFFAOYSA-N tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-4-(trifluoromethyl)piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(F)(F)F)CCN(C(=O)OC(C)(C)C)CC1 RWSAEABPDVMLJS-UHFFFAOYSA-N 0.000 description 1
- JYJJTYIKMGJMTR-UHFFFAOYSA-N tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-4-methylpiperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C)CCN(C(=O)OC(C)(C)C)CC1 JYJJTYIKMGJMTR-UHFFFAOYSA-N 0.000 description 1
- DEDOWMPOPVYWFM-UHFFFAOYSA-N tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-4-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(=O)OC(C)(C)C)CCNCC1 DEDOWMPOPVYWFM-UHFFFAOYSA-N 0.000 description 1
- FXAXDNMQCYEZOZ-UHFFFAOYSA-N tert-butyl 4-[(8-fluoro-6-methoxyquinolin-4-yl)carbamoyl]-4-(methoxymethoxy)piperidine-1-carboxylate Chemical compound C=1C=NC2=C(F)C=C(OC)C=C2C=1NC(=O)C1(OCOC)CCN(C(=O)OC(C)(C)C)CC1 FXAXDNMQCYEZOZ-UHFFFAOYSA-N 0.000 description 1
- STULNXOXJZACHB-UHFFFAOYSA-N tert-butyl 4-carbamoyl-4-(trifluoromethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(C(F)(F)F)(C(N)=O)CC1 STULNXOXJZACHB-UHFFFAOYSA-N 0.000 description 1
- YZXCHVNFNSZTAN-UHFFFAOYSA-N tert-butyl 4-cyano-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C#N)CCN(C(=O)OC(C)(C)C)CC1 YZXCHVNFNSZTAN-UHFFFAOYSA-N 0.000 description 1
- YVWDDHLYIXFZPL-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(O)CCN(C(=O)OC(C)(C)C)CC1 YVWDDHLYIXFZPL-UHFFFAOYSA-N 0.000 description 1
- YOWRRGPVEHZWLE-UHFFFAOYSA-N tert-butyl 4-methoxy-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(OC)CCN(C(=O)OC(C)(C)C)CC1 YOWRRGPVEHZWLE-UHFFFAOYSA-N 0.000 description 1
- FQZLNQAUUMSUHT-UHFFFAOYSA-N tert-butyl n,n-bis(2-chloroethyl)carbamate Chemical compound CC(C)(C)OC(=O)N(CCCl)CCCl FQZLNQAUUMSUHT-UHFFFAOYSA-N 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- XJPANWOKBWZVHC-UHFFFAOYSA-N tetrazol-2-amine Chemical compound NN1N=CN=N1 XJPANWOKBWZVHC-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 150000004897 thiazines Chemical class 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- JKVRTUCVPZTEQZ-UHFFFAOYSA-N tributyltin azide Chemical compound CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-] JKVRTUCVPZTEQZ-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- AHZJKOKFZJYCLG-UHFFFAOYSA-K trifluoromethanesulfonate;ytterbium(3+) Chemical compound [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F AHZJKOKFZJYCLG-UHFFFAOYSA-K 0.000 description 1
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- PGAJYUDRKAPMPA-UHFFFAOYSA-N trimethylsilyl n-ethylcarbamate Chemical compound CCNC(=O)O[Si](C)(C)C PGAJYUDRKAPMPA-UHFFFAOYSA-N 0.000 description 1
- VFJYIHQDILEQNR-UHFFFAOYSA-M trimethylsulfanium;iodide Chemical compound [I-].C[S+](C)C VFJYIHQDILEQNR-UHFFFAOYSA-M 0.000 description 1
- ADZJWYULTMTLQZ-UHFFFAOYSA-N tritylphosphane;hydrobromide Chemical compound [Br-].C=1C=CC=CC=1C(C=1C=CC=CC=1)([PH3+])C1=CC=CC=C1 ADZJWYULTMTLQZ-UHFFFAOYSA-N 0.000 description 1
- MYPYJXKWCTUITO-LYRMYLQWSA-N vancomycin Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C2C=C3C=C1OC1=CC=C(C=C1Cl)[C@@H](O)[C@H](C(N[C@@H](CC(N)=O)C(=O)N[C@H]3C(=O)N[C@H]1C(=O)N[C@H](C(N[C@@H](C3=CC(O)=CC(O)=C3C=3C(O)=CC=C1C=3)C(O)=O)=O)[C@H](O)C1=CC=C(C(=C1)Cl)O2)=O)NC(=O)[C@@H](CC(C)C)NC)[C@H]1C[C@](C)(N)[C@H](O)[C@H](C)O1 MYPYJXKWCTUITO-LYRMYLQWSA-N 0.000 description 1
- 229960003165 vancomycin Drugs 0.000 description 1
- PGOLTJPQCISRTO-UHFFFAOYSA-N vinyllithium Chemical compound [Li]C=C PGOLTJPQCISRTO-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 150000007934 α,β-unsaturated carboxylic acids Chemical class 0.000 description 1
- 229940126085 β‑Lactamase Inhibitor Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0118238.5A GB0118238D0 (en) | 2001-07-26 | 2001-07-26 | Medicaments |
| GB0118238 | 2001-07-26 | ||
| PCT/EP2002/008319 WO2003010138A2 (en) | 2001-07-26 | 2002-07-25 | Piperidine derivatives as antibacterial agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE60215951D1 DE60215951D1 (de) | 2006-12-21 |
| DE60215951T2 true DE60215951T2 (de) | 2007-04-26 |
Family
ID=9919236
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE60215951T Expired - Fee Related DE60215951T2 (de) | 2001-07-26 | 2002-07-25 | Piperidinderivate als antibakterielle mittel |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US20040198756A1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1419155B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2005504747A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE344799T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU2002328972A1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE60215951T2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2274999T3 (cg-RX-API-DMAC7.html) |
| GB (1) | GB0118238D0 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2003010138A2 (cg-RX-API-DMAC7.html) |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6803369B1 (en) | 2000-07-25 | 2004-10-12 | Smithkline Beecham Corporation | Compounds and methods for the treatment of neoplastic disease |
| EP1320529B1 (en) * | 2000-09-21 | 2006-05-24 | Smithkline Beecham Plc | Quinoline derivatives as antibacterials |
| GB0031086D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0031088D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0101577D0 (en) * | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| GB0112834D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0112836D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| US7109213B2 (en) * | 2002-01-29 | 2006-09-19 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| US7312212B2 (en) | 2002-01-29 | 2007-12-25 | Glaxo Group Limited | Aminopiperidine derivatives |
| TW200406413A (en) | 2002-06-26 | 2004-05-01 | Glaxo Group Ltd | Compounds |
| TW200409637A (en) | 2002-06-26 | 2004-06-16 | Glaxo Group Ltd | Compounds |
| ATE463494T1 (de) | 2002-10-10 | 2010-04-15 | Morphochem Ag Komb Chemie | Neue verbindungen mit antibakterieller aktivität |
| US7618959B2 (en) | 2002-11-05 | 2009-11-17 | Smithklinebeecham Corp | Antibacterial agents |
| AU2003303956A1 (en) | 2002-11-05 | 2004-11-23 | Smithkline Beecham Corporation | Antibacterial agents |
| TW200427688A (en) * | 2002-12-18 | 2004-12-16 | Glaxo Group Ltd | Antibacterial agents |
| CN100413865C (zh) * | 2004-01-08 | 2008-08-27 | 弗·哈夫曼-拉罗切有限公司 | 二氮杂-螺哌啶衍生物 |
| FR2867472B1 (fr) * | 2004-03-12 | 2008-07-18 | Aventis Pharma Sa | Derives de quinoleines-4-substituees, leurs procede et intermediaires de preparation et les compositions pharmaceutiques qui les contiennent |
| TWI350168B (en) | 2004-05-07 | 2011-10-11 | Incyte Corp | Amido compounds and their use as pharmaceuticals |
| EP1768954A4 (en) | 2004-06-24 | 2008-05-28 | Incyte Corp | 2-METHYLPROPANAMIDES AND THEIR USE AS PHARMACEUTICALS |
| WO2006017326A1 (en) | 2004-07-13 | 2006-02-16 | Glaxo Group Limited | Antibacterial agents |
| EP1650186B1 (en) * | 2004-10-22 | 2008-06-04 | Bioprojet | Novel dicarboxylic acid derivatives |
| WO2006081289A2 (en) | 2005-01-25 | 2006-08-03 | Glaxo Group Limited | Antibacterial agents |
| US7648980B2 (en) | 2005-01-25 | 2010-01-19 | Glaxo Group Limited | Antibacterial agents |
| EP1846418A4 (en) | 2005-01-25 | 2009-12-23 | Glaxo Group Ltd | ANTIBACTERIAL ACTIVE SUBSTANCES |
| US7605169B2 (en) | 2005-01-25 | 2009-10-20 | Glaxo Group Limited | Antibacterial agents |
| US7709472B2 (en) | 2005-01-25 | 2010-05-04 | Glaxo Group Limited | Antibacterial agents |
| US8193207B2 (en) | 2005-12-05 | 2012-06-05 | Incyte Corporation | Lactam compounds and methods of using the same |
| JP2009527562A (ja) * | 2006-02-21 | 2009-07-30 | アムゲン インコーポレイティッド | ホスホジエステラーゼ10阻害剤としてのシンノリン誘導体 |
| JP2009528365A (ja) * | 2006-02-28 | 2009-08-06 | アムゲン インコーポレイティッド | ホスホジエステラーゼ10阻害剤としてのシンノリン及びキナゾリン誘導体 |
| AU2007223801A1 (en) * | 2006-03-08 | 2007-09-13 | Amgen Inc. | Quinoline and isoquinoline derivatives as phosphodiesterase 10 inhibitors |
| JP2009532504A (ja) | 2006-04-06 | 2009-09-10 | グラクソ グループ リミテッド | 抗菌薬 |
| ATE481406T1 (de) | 2006-04-06 | 2010-10-15 | Glaxo Group Ltd | Pyrrolochinoxalinonderivate als antibakterielle mittel |
| GB0613208D0 (en) | 2006-07-03 | 2006-08-09 | Glaxo Group Ltd | Compounds |
| EP1992628A1 (en) | 2007-05-18 | 2008-11-19 | Glaxo Group Limited | Derivatives and analogs of N-ethylquinolones and N-ethylazaquinolones |
| US20100210633A1 (en) * | 2006-10-12 | 2010-08-19 | Epix Delaware, Inc. | Carboxamide compounds and their use |
| KR101567096B1 (ko) * | 2007-04-20 | 2015-11-06 | 글락소 그룹 리미티드 | 항균제로서의 트리시클릭 질소 함유 화합물 |
| MX2009012117A (es) | 2007-05-09 | 2009-11-23 | Pfizer | Composiciones y derivados heterociclicos sustituidos y su uso farmaceutico como antibacterianos. |
| CL2008001839A1 (es) | 2007-06-21 | 2009-01-16 | Incyte Holdings Corp | Compuestos derivados de 2,7-diazaespirociclos, inhibidores de 11-beta hidroxil esteroide deshidrogenasa tipo 1; composicion farmaceutica que comprende a dichos compuestos; utiles para tratar la obesidad, diabetes, intolerancia a la glucosa, diabetes tipo ii, entre otras enfermedades. |
| BRPI0820701A2 (pt) | 2007-12-11 | 2015-06-16 | Cytopathfinder Inc | Composto de carboxamida e seu uso como agonistas do receptor de quimiocina |
| EP2080761A1 (en) | 2008-01-18 | 2009-07-22 | Glaxo Group Limited | Compounds |
| ES2539947T3 (es) * | 2008-06-02 | 2015-07-07 | Cipla Limited | Procedimiento para la síntesis de arformoterol |
| JP2012505866A (ja) | 2008-10-17 | 2012-03-08 | グラクソ グループ リミテッド | 抗菌剤として使用される三環式窒素化合物 |
| US8318940B2 (en) | 2009-01-15 | 2012-11-27 | Glaxo Group Limited | Naphthyridin-2 (1 H)-one compounds useful as antibacterials |
| TW201209056A (en) * | 2010-05-25 | 2012-03-01 | Taisho Pharmaceutical Co Ltd | Novel heterocyclic compound or salt thereof |
| CN102267995A (zh) * | 2010-06-04 | 2011-12-07 | 艾琪康医药科技(上海)有限公司 | 一种制备二氮杂螺环化合物的方法 |
| EP2651884A2 (en) * | 2010-12-14 | 2013-10-23 | Merck Sharp & Dohme Corp. | Process and intermediates for preparing macrolactams |
| AR089929A1 (es) | 2012-02-10 | 2014-10-01 | Actelion Pharmaceuticals Ltd | Proceso para manufacturar un derivado de naftiridina |
| DK2841425T3 (en) * | 2012-04-27 | 2016-06-27 | Janssen Pharmaceutica Nv | ANTIBACTERIAL QUINOLIN DERIVATIVES |
| CN104254528B (zh) * | 2012-04-27 | 2017-06-06 | 詹森药业有限公司 | 抗菌的喹啉衍生物 |
| BR112017003705B1 (pt) | 2014-08-22 | 2022-07-12 | Glaxosmithkline Intellectual Property Development Limited | Compostos contendo nitrogênio tricíclicos para o tratamento de infecção por neisseria gonorrhoea |
| UY36851A (es) | 2015-08-16 | 2017-03-31 | Glaxosmithkline Ip Dev Ltd | Compuestos para uso en aplicaciones antibacterianas |
| WO2021076886A1 (en) | 2019-10-18 | 2021-04-22 | The Regents Of The University Of California | 3-phenylsulphonyl-quinoline derivatives as agents for treating pathogenic blood vessels disorders |
| CN116102537B (zh) * | 2021-11-10 | 2024-10-01 | 四川大学 | 一种喹啉酮类衍生物及其制备方法和用途 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7908031A (nl) * | 1979-11-01 | 1981-06-01 | Acf Chemiefarma Nv | Nieuwe chinolinederivaten en farmaceutische preparaten die een dergelijke verbinding bevatten, alsmede werk- wijze voor het bereiden van deze verbindingen. |
| EP0541486A1 (de) * | 1991-11-07 | 1993-05-12 | Ciba-Geigy Ag | Polycyclische Konjugate |
| US5977134A (en) * | 1996-12-05 | 1999-11-02 | Merck & Co., Inc. | Inhibitors of farnesyl-protein transferase |
| GB9822450D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| GB9822440D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| AU2437900A (en) * | 1999-01-20 | 2000-08-07 | Smithkline Beecham Plc | Piperidinylquinolines as protein tyrosine kinase inhibitors |
| GB9914486D0 (en) * | 1999-06-21 | 1999-08-18 | Smithkline Beecham Plc | Medicaments |
| GB9917406D0 (en) * | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| GB9917408D0 (en) * | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| US6403610B1 (en) * | 1999-09-17 | 2002-06-11 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation and the compositions which comprise them |
| US6803369B1 (en) * | 2000-07-25 | 2004-10-12 | Smithkline Beecham Corporation | Compounds and methods for the treatment of neoplastic disease |
| CN1452619A (zh) * | 2000-07-26 | 2003-10-29 | 史密斯克莱·比奇曼公司 | 具有抗细菌活性的氨基哌啶喹啉和它们的氮杂等排的类似物 |
| EP1320529B1 (en) * | 2000-09-21 | 2006-05-24 | Smithkline Beecham Plc | Quinoline derivatives as antibacterials |
| US6603005B2 (en) * | 2000-11-15 | 2003-08-05 | Aventis Pharma S.A. | Heterocyclylalkylpiperidine derivatives, their preparation and compositions containing them |
| FR2816618B1 (fr) * | 2000-11-15 | 2002-12-27 | Aventis Pharma Sa | Derives heterocyclylalcoyl piperidine, leur preparation et les compositions qui les contiennent |
| GB0031086D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0031088D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0101577D0 (en) * | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| US6602884B2 (en) * | 2001-03-13 | 2003-08-05 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation, and compositions containing them |
| GB0112834D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0112836D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| US20030203917A1 (en) * | 2001-07-25 | 2003-10-30 | Smithkline Beecham Corporation And Smithkline Beecham P.L.C. | Compounds and methods for the treatment of neoplastic disease |
| US7109213B2 (en) * | 2002-01-29 | 2006-09-19 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| US7312212B2 (en) * | 2002-01-29 | 2007-12-25 | Glaxo Group Limited | Aminopiperidine derivatives |
| GB0217294D0 (en) * | 2002-07-25 | 2002-09-04 | Glaxo Group Ltd | Medicaments |
-
2001
- 2001-07-26 GB GBGB0118238.5A patent/GB0118238D0/en not_active Ceased
-
2002
- 2002-07-25 US US10/484,563 patent/US20040198756A1/en not_active Abandoned
- 2002-07-25 WO PCT/EP2002/008319 patent/WO2003010138A2/en not_active Ceased
- 2002-07-25 DE DE60215951T patent/DE60215951T2/de not_active Expired - Fee Related
- 2002-07-25 AU AU2002328972A patent/AU2002328972A1/en not_active Abandoned
- 2002-07-25 ES ES02764786T patent/ES2274999T3/es not_active Expired - Lifetime
- 2002-07-25 JP JP2003515497A patent/JP2005504747A/ja active Pending
- 2002-07-25 EP EP02764786A patent/EP1419155B1/en not_active Expired - Lifetime
- 2002-07-25 AT AT02764786T patent/ATE344799T1/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ATE344799T1 (de) | 2006-11-15 |
| AU2002328972A1 (en) | 2003-02-17 |
| EP1419155B1 (en) | 2006-11-08 |
| DE60215951D1 (de) | 2006-12-21 |
| WO2003010138A3 (en) | 2003-12-04 |
| WO2003010138A2 (en) | 2003-02-06 |
| JP2005504747A (ja) | 2005-02-17 |
| US20040198756A1 (en) | 2004-10-07 |
| ES2274999T3 (es) | 2007-06-01 |
| EP1419155A2 (en) | 2004-05-19 |
| GB0118238D0 (en) | 2001-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE60215951T2 (de) | Piperidinderivate als antibakterielle mittel | |
| DE60215494T2 (de) | Bicyclische, stickstoffhaltige heterocyclische derivate zur verwendung als antibakterielle mittel | |
| DE60221969T2 (de) | Durch eine piperidin-enthaltende einheit an position 4 substituierte chinoline und deren stickstoff-enthaltende derivate und ihre verwendung als antibakterielle wirkstoffe | |
| DE60224039T2 (de) | Stickstoffhaltige, bicyclische heterocyclen zur verwendung als antibakterielle mittel | |
| DE60125373T2 (de) | Aminopiperidin chinoline und ihre azaisosteren analoga mit antibakterieller wirkung | |
| DE60123276T2 (de) | Piperazinderivate zur behandlung bakterieller infektionen | |
| DE60307860T2 (de) | Aminocyclohexenchinoline und ihre azaisosterischen Analoga mit antibakterieller Wirkung | |
| JP4522262B2 (ja) | 化合物 | |
| JP4445753B2 (ja) | アミノピペリジン誘導体 | |
| JP2006511622A (ja) | 抗菌剤 | |
| JP2006505505A (ja) | 化合物 | |
| JP2005519922A (ja) | アミノピペリジン化合物、当該化合物の製法および当該化合物を含有する医薬組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |