JP2005504747A - 薬物 - Google Patents
薬物 Download PDFInfo
- Publication number
- JP2005504747A JP2005504747A JP2003515497A JP2003515497A JP2005504747A JP 2005504747 A JP2005504747 A JP 2005504747A JP 2003515497 A JP2003515497 A JP 2003515497A JP 2003515497 A JP2003515497 A JP 2003515497A JP 2005504747 A JP2005504747 A JP 2005504747A
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- hydroxy
- alkenyl
- methoxy
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003814 drug Substances 0.000 title claims description 6
- 229940079593 drug Drugs 0.000 title description 2
- 238000000034 method Methods 0.000 claims abstract description 91
- 241000124008 Mammalia Species 0.000 claims abstract description 9
- 208000035143 Bacterial infection Diseases 0.000 claims abstract description 7
- 208000022362 bacterial infectious disease Diseases 0.000 claims abstract description 7
- -1 amino, piperidyl Chemical group 0.000 claims description 275
- 150000001875 compounds Chemical class 0.000 claims description 172
- 125000000217 alkyl group Chemical group 0.000 claims description 114
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 75
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 66
- 229910052739 hydrogen Inorganic materials 0.000 claims description 51
- 239000002253 acid Substances 0.000 claims description 44
- 239000001257 hydrogen Substances 0.000 claims description 44
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims description 43
- 125000003277 amino group Chemical group 0.000 claims description 43
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 41
- 125000003118 aryl group Chemical group 0.000 claims description 40
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 38
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 38
- 125000003342 alkenyl group Chemical group 0.000 claims description 38
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 37
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 claims description 36
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 35
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 34
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 33
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 28
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 28
- 125000005843 halogen group Chemical group 0.000 claims description 26
- 125000000623 heterocyclic group Chemical group 0.000 claims description 26
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 24
- 125000005137 alkenylsulfonyl group Chemical group 0.000 claims description 23
- 125000001424 substituent group Chemical group 0.000 claims description 22
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 21
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 229910052760 oxygen Inorganic materials 0.000 claims description 21
- 125000004414 alkyl thio group Chemical group 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 19
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 18
- 150000002367 halogens Chemical class 0.000 claims description 18
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 18
- 125000004429 atom Chemical group 0.000 claims description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 16
- 229910052717 sulfur Inorganic materials 0.000 claims description 16
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 14
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 14
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 14
- 125000005842 heteroatom Chemical group 0.000 claims description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 14
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 14
- 125000002252 acyl group Chemical group 0.000 claims description 13
- 125000001153 fluoro group Chemical group F* 0.000 claims description 13
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 11
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 9
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- 125000004423 acyloxy group Chemical group 0.000 claims description 8
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 8
- 150000001540 azides Chemical class 0.000 claims description 8
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 claims description 8
- 229910052721 tungsten Inorganic materials 0.000 claims description 8
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 7
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 238000005984 hydrogenation reaction Methods 0.000 claims description 7
- 125000005647 linker group Chemical group 0.000 claims description 7
- 229910052727 yttrium Inorganic materials 0.000 claims description 7
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- VUHCPMIDSUGHNO-UHFFFAOYSA-N 6-methoxy-1,5-naphthyridin-4-amine Chemical compound N1=CC=C(N)C2=NC(OC)=CC=C21 VUHCPMIDSUGHNO-UHFFFAOYSA-N 0.000 claims description 4
- 125000005035 acylthio group Chemical group 0.000 claims description 4
- 238000006467 substitution reaction Methods 0.000 claims description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- IQIOELVNILZQJR-UHFFFAOYSA-N 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxylic acid Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(C(=O)NC3=CC=NC4=CC=C(N=C43)OC)C(O)=O)=CC=C21 IQIOELVNILZQJR-UHFFFAOYSA-N 0.000 claims description 3
- 239000005973 Carvone Substances 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000005948 methanesulfonyloxy group Chemical group 0.000 claims description 3
- 125000006413 ring segment Chemical group 0.000 claims description 3
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 claims description 3
- 125000001414 1,2,4-triazol-5-yl group Chemical group [H]N1N=C([H])N=C1[*] 0.000 claims description 2
- NKUGCHGBXABNQR-UHFFFAOYSA-N 1-[2-(1,3-benzodioxol-5-yl)ethyl]-n-(6-methoxy-1,5-naphthyridin-4-yl)-4-methylpiperidine-4-carboxamide Chemical compound C1=C2OCOC2=CC(CCN2CCC(CC2)(C)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 NKUGCHGBXABNQR-UHFFFAOYSA-N 0.000 claims description 2
- BNGJCINCSDUEAL-UHFFFAOYSA-N 1-[2-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)ethyl]-n-(8-fluoro-6-methoxyquinolin-4-yl)-4-hydroxypiperidine-4-carboxamide;hydrochloride Chemical compound Cl.O1CCOC(C=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=C(F)C=C(OC)C=C21 BNGJCINCSDUEAL-UHFFFAOYSA-N 0.000 claims description 2
- LMQHDESYTYKPGK-IBGZPJMESA-N 4-hydroxy-1-[(2r)-2-hydroxy-2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC([C@@H](O)CN3CCC(CC3)(O)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 LMQHDESYTYKPGK-IBGZPJMESA-N 0.000 claims description 2
- BMQOZNLUBCOQBR-UHFFFAOYSA-N 4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(O)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 BMQOZNLUBCOQBR-UHFFFAOYSA-N 0.000 claims description 2
- 125000001054 5 membered carbocyclic group Chemical group 0.000 claims description 2
- 125000004008 6 membered carbocyclic group Chemical group 0.000 claims description 2
- XZOFUFUOKSMJHL-UHFFFAOYSA-N 6-[2-[4-fluoro-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-1-yl]ethyl]-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(F)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 XZOFUFUOKSMJHL-UHFFFAOYSA-N 0.000 claims description 2
- DYJVGEYZDNXUTF-UHFFFAOYSA-N 6-[2-[4-hydroxy-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-1-yl]ethyl]-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(O)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 DYJVGEYZDNXUTF-UHFFFAOYSA-N 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000005361 aryl sulfoxide group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 2
- 125000005605 benzo group Chemical group 0.000 claims description 2
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000003950 cyclic amides Chemical class 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 claims description 2
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 2
- 125000004468 heterocyclylthio group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 2
- 229910005965 SO 2 Inorganic materials 0.000 claims 10
- 125000003396 thiol group Chemical class [H]S* 0.000 claims 3
- 101100240517 Caenorhabditis elegans nhr-11 gene Proteins 0.000 claims 2
- XVSNWPMYYVNDKC-FZYLFJGDSA-N (2R)-2-methoxy-N-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound COC=1N=C2C(=CC=NC2=CC=1)NC(=O)C1C[C@H](N(CC1)CCC=1C=CC2=C(NC(CS2)=O)C=1)OC XVSNWPMYYVNDKC-FZYLFJGDSA-N 0.000 claims 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims 1
- QRZHDCJDCYMKAK-UHFFFAOYSA-N 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C1=C2OCOC2=CC(CCN2CCC(CC2)(O)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 QRZHDCJDCYMKAK-UHFFFAOYSA-N 0.000 claims 1
- PXPHCHQEAHKWPI-UHFFFAOYSA-N 1-[2-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)ethyl]-4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound O1CCOC(C=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 PXPHCHQEAHKWPI-UHFFFAOYSA-N 0.000 claims 1
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 claims 1
- OARVAZMJJMPTEM-UHFFFAOYSA-N 4-(hydroxymethyl)-n-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(CO)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 OARVAZMJJMPTEM-UHFFFAOYSA-N 0.000 claims 1
- SKJILIRDRXLNKR-UHFFFAOYSA-N 4-amino-n-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(N)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 SKJILIRDRXLNKR-UHFFFAOYSA-N 0.000 claims 1
- PBIHPDRFBYEZGZ-UHFFFAOYSA-N 4-cyano-n-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(C(=O)NC3=CC=NC4=CC=C(N=C43)OC)C#N)=CC=C21 PBIHPDRFBYEZGZ-UHFFFAOYSA-N 0.000 claims 1
- FIMGZXMBDCMXPT-UHFFFAOYSA-N 4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-oxo-2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC(C(=O)CN3CCC(CC3)(O)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 FIMGZXMBDCMXPT-UHFFFAOYSA-N 0.000 claims 1
- 125000003302 alkenyloxy group Chemical group 0.000 claims 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 claims 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims 1
- LDUXXRURVFSEKO-UHFFFAOYSA-N n-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(6-oxo-5h-pyridazino[3,4-b][1,4]thiazin-3-yl)ethyl]-4-(trifluoromethyl)piperidine-4-carboxamide Chemical compound N1C(=O)CSC(N=N2)=C1C=C2CCN(CC1)CCC1(C(F)(F)F)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 LDUXXRURVFSEKO-UHFFFAOYSA-N 0.000 claims 1
- VPBDSFQBBRTQBO-UHFFFAOYSA-N n-(6-methoxy-1,5-naphthyridin-4-yl)-4-methyl-1-[2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide Chemical compound S1CC(=O)NC2=CC(CCN3CCC(CC3)(C)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 VPBDSFQBBRTQBO-UHFFFAOYSA-N 0.000 claims 1
- 150000003053 piperidines Chemical class 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 318
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 240
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 202
- 239000000203 mixture Substances 0.000 description 120
- 150000002500 ions Chemical class 0.000 description 114
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 111
- 239000000243 solution Substances 0.000 description 109
- 238000006243 chemical reaction Methods 0.000 description 93
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 89
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 82
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 78
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 69
- 239000007787 solid Substances 0.000 description 64
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 57
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 55
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 47
- 239000000377 silicon dioxide Substances 0.000 description 47
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 45
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 45
- 150000002148 esters Chemical class 0.000 description 43
- 150000001412 amines Chemical class 0.000 description 42
- 235000019441 ethanol Nutrition 0.000 description 41
- 239000012458 free base Substances 0.000 description 38
- 238000004587 chromatography analysis Methods 0.000 description 37
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- 239000000284 extract Substances 0.000 description 34
- 239000002904 solvent Substances 0.000 description 32
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 31
- 239000000047 product Substances 0.000 description 29
- 150000001408 amides Chemical class 0.000 description 28
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 28
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 27
- 150000001299 aldehydes Chemical class 0.000 description 27
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 25
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 25
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 24
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 22
- 239000002585 base Substances 0.000 description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- RAHZWNYVWXNFOC-UHFFFAOYSA-N sulfur dioxide Inorganic materials O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 21
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 20
- 239000003921 oil Substances 0.000 description 19
- 230000002829 reductive effect Effects 0.000 description 19
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- 239000012279 sodium borohydride Substances 0.000 description 18
- 229910000033 sodium borohydride Inorganic materials 0.000 description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 17
- 239000012267 brine Substances 0.000 description 17
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 16
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- 150000003839 salts Chemical class 0.000 description 16
- 239000000543 intermediate Substances 0.000 description 15
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 14
- 238000003795 desorption Methods 0.000 description 14
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 14
- 229910000027 potassium carbonate Inorganic materials 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 13
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 13
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 13
- 229960000583 acetic acid Drugs 0.000 description 12
- 239000008346 aqueous phase Substances 0.000 description 12
- 230000007062 hydrolysis Effects 0.000 description 12
- 238000006460 hydrolysis reaction Methods 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 230000009467 reduction Effects 0.000 description 12
- 238000006722 reduction reaction Methods 0.000 description 12
- 238000010898 silica gel chromatography Methods 0.000 description 12
- 235000017557 sodium bicarbonate Nutrition 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 11
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- 229910052786 argon Inorganic materials 0.000 description 10
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 10
- 238000007796 conventional method Methods 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 235000006408 oxalic acid Nutrition 0.000 description 10
- 150000002924 oxiranes Chemical class 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 238000005859 coupling reaction Methods 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 239000012280 lithium aluminium hydride Substances 0.000 description 9
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 230000008878 coupling Effects 0.000 description 8
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- 241000283690 Bos taurus Species 0.000 description 7
- 229940126062 Compound A Drugs 0.000 description 7
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 7
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 7
- 150000001350 alkyl halides Chemical class 0.000 description 7
- 238000005804 alkylation reaction Methods 0.000 description 7
- 229910021529 ammonia Inorganic materials 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 150000002009 diols Chemical class 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 239000007800 oxidant agent Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 7
- 239000003981 vehicle Substances 0.000 description 7
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 6
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 6
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 6
- 238000010791 quenching Methods 0.000 description 6
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 6
- 238000010561 standard procedure Methods 0.000 description 6
- 229960002317 succinimide Drugs 0.000 description 6
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 6
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 5
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 5
- 230000004913 activation Effects 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 238000005755 formation reaction Methods 0.000 description 5
- 150000004820 halides Chemical group 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- 229910052744 lithium Inorganic materials 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 125000004043 oxo group Chemical group O=* 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 4
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 4
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical compound C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 4
- MJNPHLBKHKJDEF-UHFFFAOYSA-N 2h-1$l^{4},2-benzothiazine 1-oxide Chemical class C1=CC=C2S(=O)NC=CC2=C1 MJNPHLBKHKJDEF-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical compound C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 4
- GDPLHNSXAWWKIF-UHFFFAOYSA-N 6-methoxy-1,5-naphthyridin-4-amine dihydrochloride Chemical compound Cl.Cl.N1=CC=C(N)C2=NC(OC)=CC=C21 GDPLHNSXAWWKIF-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 241000193998 Streptococcus pneumoniae Species 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 238000005903 acid hydrolysis reaction Methods 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 150000003857 carboxamides Chemical group 0.000 description 4
- 239000007822 coupling agent Substances 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- 150000005690 diesters Chemical class 0.000 description 4
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 4
- 238000006735 epoxidation reaction Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000011905 homologation Methods 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 239000012285 osmium tetroxide Substances 0.000 description 4
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 4
- 238000005932 reductive alkylation reaction Methods 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- 239000003039 volatile agent Substances 0.000 description 4
- WQADWIOXOXRPLN-UHFFFAOYSA-N 1,3-dithiane Chemical compound C1CSCSC1 WQADWIOXOXRPLN-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- CSSHRKYOZTZFCX-UHFFFAOYSA-N 2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone Chemical compound O1CCOC2=CC(C(=O)CBr)=CC=C21 CSSHRKYOZTZFCX-UHFFFAOYSA-N 0.000 description 3
- HODYDVHWWMTUEL-UHFFFAOYSA-N 3,6-dichloropyridazin-4-amine Chemical compound NC1=CC(Cl)=NN=C1Cl HODYDVHWWMTUEL-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- HBOCBNSVLHYKNX-UHFFFAOYSA-N 3-ethenyl-2h-pyridazino[3,4-e]thiazine Chemical compound N1=CC=C2SNC(C=C)=CC2=N1 HBOCBNSVLHYKNX-UHFFFAOYSA-N 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- SSMACLPPRSQXHH-UHFFFAOYSA-N 6-methoxy-1h-1,5-naphthyridin-4-one Chemical compound N1C=CC(=O)C2=NC(OC)=CC=C21 SSMACLPPRSQXHH-UHFFFAOYSA-N 0.000 description 3
- UUVDJIWRSIJEBS-UHFFFAOYSA-N 6-methoxypyridin-3-amine Chemical compound COC1=CC=C(N)C=N1 UUVDJIWRSIJEBS-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 3
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 3
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241000606768 Haemophilus influenzae Species 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 3
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 241000191967 Staphylococcus aureus Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 3
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000000468 ketone group Chemical group 0.000 description 3
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 125000002524 organometallic group Chemical group 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 238000005897 peptide coupling reaction Methods 0.000 description 3
- 125000005936 piperidyl group Chemical group 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 230000000171 quenching effect Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- MYPYJXKWCTUITO-UHFFFAOYSA-N vancomycin Natural products O1C(C(=C2)Cl)=CC=C2C(O)C(C(NC(C2=CC(O)=CC(O)=C2C=2C(O)=CC=C3C=2)C(O)=O)=O)NC(=O)C3NC(=O)C2NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC(C)C)NC)C(O)C(C=C3Cl)=CC=C3OC3=CC2=CC1=C3OC1OC(CO)C(O)C(O)C1OC1CC(C)(N)C(O)C(C)O1 MYPYJXKWCTUITO-UHFFFAOYSA-N 0.000 description 3
- FVFAXZGNTXYGEY-YGPZHTELSA-N (2R)-2-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CO[C@@H]1CC(CCN1C(=O)OC(C)(C)C)C(O)=O FVFAXZGNTXYGEY-YGPZHTELSA-N 0.000 description 2
- LQQKDSXCDXHLLF-UHFFFAOYSA-N 1,3-dibromopropan-2-one Chemical compound BrCC(=O)CBr LQQKDSXCDXHLLF-UHFFFAOYSA-N 0.000 description 2
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical group O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 2
- VMLKTERJLVWEJJ-UHFFFAOYSA-N 1,5-naphthyridine Chemical compound C1=CC=NC2=CC=CN=C21 VMLKTERJLVWEJJ-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- MYHJCTUTPIKNAT-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl piperidine-1,4-dicarboxylate Chemical compound CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 MYHJCTUTPIKNAT-UHFFFAOYSA-N 0.000 description 2
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 2
- NSPLFNGUPLZYHV-UHFFFAOYSA-N 1h-1,5-naphthyridin-4-one Chemical compound C1=CN=C2C(O)=CC=NC2=C1 NSPLFNGUPLZYHV-UHFFFAOYSA-N 0.000 description 2
- OMWBUWDHEZIMGQ-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-c]pyridine-7-carbaldehyde Chemical compound O1CCOC2=C1C=C(C=O)N=C2 OMWBUWDHEZIMGQ-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- YMDZDFSUDFLGMX-UHFFFAOYSA-N 2-chloro-n-(2-chloroethyl)ethanamine;hydron;chloride Chemical compound [Cl-].ClCC[NH2+]CCCl YMDZDFSUDFLGMX-UHFFFAOYSA-N 0.000 description 2
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- FQYRLEXKXQRZDH-UHFFFAOYSA-N 4-aminoquinoline Chemical compound C1=CC=C2C(N)=CC=NC2=C1 FQYRLEXKXQRZDH-UHFFFAOYSA-N 0.000 description 2
- URBDNSCLBSLLFQ-UHFFFAOYSA-N 4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C(O)=O)(C#N)CC1 URBDNSCLBSLLFQ-UHFFFAOYSA-N 0.000 description 2
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 2
- BLWCMYNTGFJVOC-UHFFFAOYSA-N 4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(O)(C(O)=O)CC1 BLWCMYNTGFJVOC-UHFFFAOYSA-N 0.000 description 2
- XQIRIYJOVQEBDL-UHFFFAOYSA-N 4h-1,2-benzothiazin-3-one Chemical compound C1=CC=C2SNC(=O)CC2=C1 XQIRIYJOVQEBDL-UHFFFAOYSA-N 0.000 description 2
- YDYLPMPVYALQKQ-UHFFFAOYSA-N 6-(2-chloroacetyl)-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(C(=O)CCl)=CC=C21 YDYLPMPVYALQKQ-UHFFFAOYSA-N 0.000 description 2
- MIAHXWVABDHISZ-UHFFFAOYSA-N 6-(2-chloroacetyl)-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(C(=O)CCl)=CC=C21 MIAHXWVABDHISZ-UHFFFAOYSA-N 0.000 description 2
- XKMSVFHYIRCOTR-UHFFFAOYSA-N 6-(2-hydroxyethyl)-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CCO)=CC=C21 XKMSVFHYIRCOTR-UHFFFAOYSA-N 0.000 description 2
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo(3.3.1)nonane Chemical compound C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- 241000588914 Enterobacter Species 0.000 description 2
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 2
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 239000007821 HATU Substances 0.000 description 2
- 238000007341 Heck reaction Methods 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 241000588655 Moraxella catarrhalis Species 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- BEWAVCKIOQSKQW-UHFFFAOYSA-N N1C(C=CC=C1)=O.FC=1C=C(C=C2C(=CC=NC12)OS(=O)(=O)C(F)(F)F)OC Chemical compound N1C(C=CC=C1)=O.FC=1C=C(C=C2C(=CC=NC12)OS(=O)(=O)C(F)(F)F)OC BEWAVCKIOQSKQW-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 238000007239 Wittig reaction Methods 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- NMPVEAUIHMEAQP-UHFFFAOYSA-N alpha-bromo-acetaldehyde Natural products BrCC=O NMPVEAUIHMEAQP-UHFFFAOYSA-N 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- VZOVOHRDLOYBJX-UHFFFAOYSA-N benzyl 4-oxopiperidine-1-carboxylate Chemical compound C1CC(=O)CCN1C(=O)OCC1=CC=CC=C1 VZOVOHRDLOYBJX-UHFFFAOYSA-N 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 238000006197 hydroboration reaction Methods 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- BEJNERDRQOWKJM-UHFFFAOYSA-N kojic acid Chemical compound OCC1=CC(=O)C(O)=CO1 BEJNERDRQOWKJM-UHFFFAOYSA-N 0.000 description 2
- 229960004705 kojic acid Drugs 0.000 description 2
- WZNJWVWKTVETCG-UHFFFAOYSA-N kojic acid Natural products OC(=O)C(N)CN1C=CC(=O)C(O)=C1 WZNJWVWKTVETCG-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012669 liquid formulation Substances 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 description 2
- 229910001486 lithium perchlorate Inorganic materials 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- OZOAXHQNOFIFGD-UHFFFAOYSA-N manganese(2+) oxygen(2-) Chemical compound [O-2].[O-2].[Mn+2].[Mn+2] OZOAXHQNOFIFGD-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 2
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 238000006772 olefination reaction Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- PYNUOAIJIQGACY-UHFFFAOYSA-N propylazanium;chloride Chemical compound Cl.CCCN PYNUOAIJIQGACY-UHFFFAOYSA-N 0.000 description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 238000007142 ring opening reaction Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 2
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- QIWRFOJWQSSRJZ-UHFFFAOYSA-N tributyl(ethenyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C=C QIWRFOJWQSSRJZ-UHFFFAOYSA-N 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- QXXHXTRTGZBOGD-UHFFFAOYSA-M trifluoromethanesulfonate;5-(trifluoromethyl)dibenzothiophen-5-ium Chemical compound [O-]S(=O)(=O)C(F)(F)F.C1=CC=C2[S+](C(F)(F)F)C3=CC=CC=C3C2=C1 QXXHXTRTGZBOGD-UHFFFAOYSA-M 0.000 description 2
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 2
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 2
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- PPZNNZQHBXZAPS-UHFFFAOYSA-N (6-methoxy-1,5-naphthyridin-4-yl) trifluoromethanesulfonate Chemical compound N1=CC=C(OS(=O)(=O)C(F)(F)F)C2=NC(OC)=CC=C21 PPZNNZQHBXZAPS-UHFFFAOYSA-N 0.000 description 1
- DAXJNUBSBFUTRP-RTQNCGMRSA-N (8r,9s,10r,13s,14s)-6-(hydroxymethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthrene-3,17-dione Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(CO)C2=C1 DAXJNUBSBFUTRP-RTQNCGMRSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical class NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- KVGZZAHHUNAVKZ-UHFFFAOYSA-N 1,4-Dioxin Chemical group O1C=COC=C1 KVGZZAHHUNAVKZ-UHFFFAOYSA-N 0.000 description 1
- CYPYTURSJDMMMP-UHFFFAOYSA-N 1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1.C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1.C=1C=CC=CC=1C=CC(=O)C=CC1=CC=CC=C1 CYPYTURSJDMMMP-UHFFFAOYSA-N 0.000 description 1
- KFAJXZVDBVRZRC-UHFFFAOYSA-N 1,5-naphthyridin-4-amine Chemical compound C1=CN=C2C(N)=CC=NC2=C1 KFAJXZVDBVRZRC-UHFFFAOYSA-N 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- KATXLQRXWHBXJL-UHFFFAOYSA-N 1-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)-2-trimethylsilylethanol Chemical compound O1CCOC2=C1C=C(C(O)C[Si](C)(C)C)N=C2 KATXLQRXWHBXJL-UHFFFAOYSA-N 0.000 description 1
- YEVPHFIFGUWSMG-UHFFFAOYSA-N 1-(4-chloro-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 YEVPHFIFGUWSMG-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- XMOGRJIQFWJZDG-UHFFFAOYSA-N 1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2h-pyridine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C(O)=O)=CC1 XMOGRJIQFWJZDG-UHFFFAOYSA-N 0.000 description 1
- NECZIICXICWRHJ-UHFFFAOYSA-N 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C(F)(F)F)(C(O)=O)CC1 NECZIICXICWRHJ-UHFFFAOYSA-N 0.000 description 1
- VOHDUEHSQMBSGL-UHFFFAOYSA-N 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide oxalic acid Chemical compound OC(=O)C(O)=O.COc1ccc2nccc(NC(=O)C3(O)CCN(CCc4ccc5OCOc5c4)CC3)c2n1 VOHDUEHSQMBSGL-UHFFFAOYSA-N 0.000 description 1
- INHNYISGOBHQRE-UHFFFAOYSA-N 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyethyl]-4-hydroxypiperidine-4-carboxylic acid Chemical compound C=1C=C2OCCOC2=CC=1C(O)CN1CCC(O)(C(O)=O)CC1 INHNYISGOBHQRE-UHFFFAOYSA-N 0.000 description 1
- ULINVHFNFCIEHJ-UHFFFAOYSA-N 1-[2-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-yl)ethyl]-4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide;hydrochloride Chemical compound Cl.O1CCOC(C=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 ULINVHFNFCIEHJ-UHFFFAOYSA-N 0.000 description 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 description 1
- VKBXAHZIEKTJSX-UHFFFAOYSA-N 1-ethenylperoxybutane Chemical compound CCCCOOC=C VKBXAHZIEKTJSX-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- VSCYKLWATPRQDD-UHFFFAOYSA-N 1-o-benzyl 4-o-tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1,4-dicarboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C(CC1)(C(=O)OC(C)(C)C)CCN1C(=O)OCC1=CC=CC=C1 VSCYKLWATPRQDD-UHFFFAOYSA-N 0.000 description 1
- LDMUGEKGAFIGLA-UHFFFAOYSA-N 1-o-tert-butyl 4-o,4-o'-dimethyl piperidine-1,4,4-tricarboxylate Chemical compound COC(=O)C1(C(=O)OC)CCN(C(=O)OC(C)(C)C)CC1 LDMUGEKGAFIGLA-UHFFFAOYSA-N 0.000 description 1
- HITDHRSBVMDFJF-UHFFFAOYSA-N 1-o-tert-butyl 4-o-(methoxymethyl) 4-(methoxymethoxy)piperidine-1,4-dicarboxylate Chemical compound COCOC(=O)C1(OCOC)CCN(C(=O)OC(C)(C)C)CC1 HITDHRSBVMDFJF-UHFFFAOYSA-N 0.000 description 1
- BLRYELPWMVHGPZ-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate Chemical compound CCOC(=O)C1(CC#N)CCN(C(=O)OC(C)(C)C)CC1 BLRYELPWMVHGPZ-UHFFFAOYSA-N 0.000 description 1
- ZQZVWDXMUCTNRI-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl 4-methylpiperidine-1,4-dicarboxylate Chemical compound CCOC(=O)C1(C)CCN(C(=O)OC(C)(C)C)CC1 ZQZVWDXMUCTNRI-UHFFFAOYSA-N 0.000 description 1
- BNDRQMFIDHTNGI-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl 3,6-dihydro-2h-pyridine-1,4-dicarboxylate Chemical compound COC(=O)C1=CCN(C(=O)OC(C)(C)C)CC1 BNDRQMFIDHTNGI-UHFFFAOYSA-N 0.000 description 1
- BNHQNHASKIVGOW-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl 4-cyanopiperidine-1,4-dicarboxylate Chemical compound COC(=O)C1(C#N)CCN(C(=O)OC(C)(C)C)CC1 BNHQNHASKIVGOW-UHFFFAOYSA-N 0.000 description 1
- PTZNCCIULVXFIJ-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl piperidine-1,4-dicarboxylate Chemical compound COC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 PTZNCCIULVXFIJ-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N 1H-quinolin-4-one Natural products C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 1
- ZFRUGZMCGCYBRC-UHFFFAOYSA-N 1h-1,8-naphthyridin-2-one Chemical compound C1=CC=NC2=NC(O)=CC=C21 ZFRUGZMCGCYBRC-UHFFFAOYSA-N 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 1
- ZYBZYDVRLQSWGG-UHFFFAOYSA-N 2,2-dimethyloct-7-enoic acid Chemical compound OC(=O)C(C)(C)CCCCC=C ZYBZYDVRLQSWGG-UHFFFAOYSA-N 0.000 description 1
- MTZSLQPBGNIKBC-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethanol Chemical compound O1CCOC2=C1C=C(CO)N=C2 MTZSLQPBGNIKBC-UHFFFAOYSA-N 0.000 description 1
- RJXOVESYJFXCGI-UHFFFAOYSA-N 2,4-difluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1F RJXOVESYJFXCGI-UHFFFAOYSA-N 0.000 description 1
- ODVLMCWNGKLROU-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)acetic acid Chemical compound OC(=O)CC1=CC=C2OCOC2=C1 ODVLMCWNGKLROU-UHFFFAOYSA-N 0.000 description 1
- JADSGOFBFPTCHG-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)ethanol Chemical compound OCCC1=CC=C2OCOC2=C1 JADSGOFBFPTCHG-UHFFFAOYSA-N 0.000 description 1
- RDVUPCSNRRCQRM-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)ethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CC=C2OCOC2=C1 RDVUPCSNRRCQRM-UHFFFAOYSA-N 0.000 description 1
- MXPRKXZWUVKJCB-UHFFFAOYSA-N 2-(3-oxo-4h-1,4-benzothiazin-6-yl)ethyl methanesulfonate Chemical compound S1CC(=O)NC2=CC(CCOS(=O)(=O)C)=CC=C21 MXPRKXZWUVKJCB-UHFFFAOYSA-N 0.000 description 1
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 1
- HEQOJEGTZCTHCF-UHFFFAOYSA-N 2-amino-1-phenylethanone Chemical compound NCC(=O)C1=CC=CC=C1 HEQOJEGTZCTHCF-UHFFFAOYSA-N 0.000 description 1
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical group FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- YWUVOJJHVFLNJA-UHFFFAOYSA-N 2-fluoro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(F)=C1 YWUVOJJHVFLNJA-UHFFFAOYSA-N 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- XYBYNVQWRLVUCY-UHFFFAOYSA-N 2-methoxy-1,5-naphthyridine Chemical class N1=CC=CC2=NC(OC)=CC=C21 XYBYNVQWRLVUCY-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- OYERWNJQHGYSPX-UHFFFAOYSA-N 2-oxo-1h-pyrido[3,4-b][1,4]thiazine-7-carbaldehyde Chemical compound N1C(=O)CSC2=C1C=C(C=O)N=C2 OYERWNJQHGYSPX-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ZNGINKJHQQQORD-UHFFFAOYSA-N 2-trimethylsilylethanol Chemical compound C[Si](C)(C)CCO ZNGINKJHQQQORD-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- PCJFEVUKVKQSSL-UHFFFAOYSA-N 2h-1,2,4-oxadiazol-5-one Chemical compound O=C1N=CNO1 PCJFEVUKVKQSSL-UHFFFAOYSA-N 0.000 description 1
- HRHFUHGNTSSIFS-UHFFFAOYSA-N 2h-thiazine 1-oxide Chemical compound O=S1NC=CC=C1 HRHFUHGNTSSIFS-UHFFFAOYSA-N 0.000 description 1
- LJDQXQOPXOLCHL-UHFFFAOYSA-N 3,4,6-trichloropyridazine Chemical compound ClC1=CC(Cl)=C(Cl)N=N1 LJDQXQOPXOLCHL-UHFFFAOYSA-N 0.000 description 1
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- 150000003929 3-aminopyridines Chemical class 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- XPSYZCWYRWHVCC-UHFFFAOYSA-N 3-o-tert-butyl 1-o-methyl propanedioate Chemical compound COC(=O)CC(=O)OC(C)(C)C XPSYZCWYRWHVCC-UHFFFAOYSA-N 0.000 description 1
- GBOGHJYGGDERQX-UHFFFAOYSA-N 3-oxo-4h-1,4-benzothiazine-6-carbaldehyde Chemical compound S1CC(=O)NC2=CC(C=O)=CC=C21 GBOGHJYGGDERQX-UHFFFAOYSA-N 0.000 description 1
- SZHYPQDQYNLZJP-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid Chemical compound S1CC(=O)NC2=NC(C(=O)O)=CC=C21 SZHYPQDQYNLZJP-UHFFFAOYSA-N 0.000 description 1
- QSTJWRVMVXRUNW-UHFFFAOYSA-N 4-(hydroxymethyl)-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(CO)CCNCC1 QSTJWRVMVXRUNW-UHFFFAOYSA-N 0.000 description 1
- GUZLIIAHBPUNIG-UHFFFAOYSA-N 4-(methoxymethoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound COCOC1(C(O)=O)CCN(C(=O)OC(C)(C)C)CC1 GUZLIIAHBPUNIG-UHFFFAOYSA-N 0.000 description 1
- SKLGMKNHGDBMTG-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid Chemical compound C1CC(C(=O)OC(C)(C)C)(C(O)=O)CCN1C(=O)OCC1=CC=CC=C1 SKLGMKNHGDBMTG-UHFFFAOYSA-N 0.000 description 1
- NLGYPUPEWBHOEK-UHFFFAOYSA-N 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C(CC1)(C(O)=O)CCN1C(=O)OCC1=CC=CC=C1 NLGYPUPEWBHOEK-UHFFFAOYSA-N 0.000 description 1
- DUHFIVKIHAGKTI-UHFFFAOYSA-N 4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-ol Chemical compound C12=NC(OC)=CC=C2N=CC=C1CCC1(O)CCNCC1 DUHFIVKIHAGKTI-UHFFFAOYSA-N 0.000 description 1
- YNHLVALLAURVJF-UHFFFAOYSA-N 4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(N)(C(O)=O)CC1 YNHLVALLAURVJF-UHFFFAOYSA-N 0.000 description 1
- HGLBMULARPMEBH-UHFFFAOYSA-N 4-amino-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(N)CCNCC1 HGLBMULARPMEBH-UHFFFAOYSA-N 0.000 description 1
- GVRRXASZZAKBMN-UHFFFAOYSA-N 4-chloroquinazoline Chemical compound C1=CC=C2C(Cl)=NC=NC2=C1 GVRRXASZZAKBMN-UHFFFAOYSA-N 0.000 description 1
- KNDOFJFSHZCKGT-UHFFFAOYSA-N 4-chloroquinoline Chemical compound C1=CC=C2C(Cl)=CC=NC2=C1 KNDOFJFSHZCKGT-UHFFFAOYSA-N 0.000 description 1
- YWAQDTNMQBNTMV-UHFFFAOYSA-N 4-cyano-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C#N)CCNCC1 YWAQDTNMQBNTMV-UHFFFAOYSA-N 0.000 description 1
- NGLRRGRDAGJOFH-TXEPZDRESA-N 4-hydroxy-1-[(2R)-2-hydroxy-2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide dihydrochloride Chemical compound Cl.Cl.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)C[C@@H](C=1C=CC2=C(NC(CS2)=O)C1)O)O NGLRRGRDAGJOFH-TXEPZDRESA-N 0.000 description 1
- CAYQJEZFVHQVED-UHFFFAOYSA-N 4-hydroxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(O)CCNCC1 CAYQJEZFVHQVED-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
- XJJJVKSYSBNXLV-UHFFFAOYSA-N 4-hydroxypiperidine-4-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1(O)CCNCC1 XJJJVKSYSBNXLV-UHFFFAOYSA-N 0.000 description 1
- JPZJLASWSZCENI-UHFFFAOYSA-N 4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound COC1(C(O)=O)CCN(C(=O)OC(C)(C)C)CC1 JPZJLASWSZCENI-UHFFFAOYSA-N 0.000 description 1
- UNLCNAJNDGSAJH-UHFFFAOYSA-N 4-methoxy-n-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(OC)CCNCC1 UNLCNAJNDGSAJH-UHFFFAOYSA-N 0.000 description 1
- OKBNEDPOUYRYNP-UHFFFAOYSA-N 4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C)(C(O)=O)CC1 OKBNEDPOUYRYNP-UHFFFAOYSA-N 0.000 description 1
- WUGQEAXJFJXATL-UHFFFAOYSA-N 4-n'-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-4,4-dicarboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(N)=O)CCNCC1 WUGQEAXJFJXATL-UHFFFAOYSA-N 0.000 description 1
- UYEXITWEMOJURT-UHFFFAOYSA-N 4-o-benzyl 1-o-tert-butyl 3,6-dihydro-2h-pyridine-1,4-dicarboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C(=O)OCC=2C=CC=CC=2)=C1 UYEXITWEMOJURT-UHFFFAOYSA-N 0.000 description 1
- LODIKMSUDZMCFF-UHFFFAOYSA-N 4-oxo-1h-1,5-naphthyridine-3-carboxylic acid Chemical compound C1=CN=C2C(=O)C(C(=O)O)=CNC2=C1 LODIKMSUDZMCFF-UHFFFAOYSA-N 0.000 description 1
- UAISREBYDOFHJY-UHFFFAOYSA-N 4-oxopiperidin-1-ium-2-carboxylate Chemical compound OC(=O)C1CC(=O)CCN1 UAISREBYDOFHJY-UHFFFAOYSA-N 0.000 description 1
- GTFMIJNXNMDHAB-UHFFFAOYSA-N 4h-1,4-benzothiazin-3-one Chemical compound C1=CC=C2NC(=O)CSC2=C1 GTFMIJNXNMDHAB-UHFFFAOYSA-N 0.000 description 1
- FBXGQDUVJBKEAJ-UHFFFAOYSA-N 4h-oxazin-3-one Chemical compound O=C1CC=CON1 FBXGQDUVJBKEAJ-UHFFFAOYSA-N 0.000 description 1
- FHZIDNIJVVSXDL-UHFFFAOYSA-N 4h-pyrido[2,3-e]oxazin-3-one Chemical compound C1=CC=C2ONC(=O)CC2=N1 FHZIDNIJVVSXDL-UHFFFAOYSA-N 0.000 description 1
- YUVDZHWQKUGEJK-UHFFFAOYSA-N 4h-pyrido[2,3-e]thiazin-3-one Chemical compound C1=CC=C2SNC(=O)CC2=N1 YUVDZHWQKUGEJK-UHFFFAOYSA-N 0.000 description 1
- RRLXNXFZXSSOGO-UHFFFAOYSA-N 5-[[(6-methoxypyridin-3-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound C1=NC(OC)=CC=C1NC=C1C(=O)OC(C)(C)OC1=O RRLXNXFZXSSOGO-UHFFFAOYSA-N 0.000 description 1
- LXAHHHIGZXPRKQ-UHFFFAOYSA-N 5-fluoro-2-methylpyridine Chemical compound CC1=CC=C(F)C=N1 LXAHHHIGZXPRKQ-UHFFFAOYSA-N 0.000 description 1
- YPXQSGWOGQPLQO-UHFFFAOYSA-N 5-nitro-1,3-dihydrobenzimidazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2N=C(S)NC2=C1 YPXQSGWOGQPLQO-UHFFFAOYSA-N 0.000 description 1
- YZAOUVZQOBBGNS-UHFFFAOYSA-N 6-(2-chloroacetyl)-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(C(=O)CCl)=CC=C21 YZAOUVZQOBBGNS-UHFFFAOYSA-N 0.000 description 1
- KKVAKUUCHRTKRK-UHFFFAOYSA-N 6-(2-chloroacetyl)-7-fluoro-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=C1C=C(F)C(C(=O)CCl)=C2 KKVAKUUCHRTKRK-UHFFFAOYSA-N 0.000 description 1
- HQNXRLDPFHKTGQ-UHFFFAOYSA-N 6-(2-chloroethyl)-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(CCCl)=CC=C21 HQNXRLDPFHKTGQ-UHFFFAOYSA-N 0.000 description 1
- FDHINJNZZCOWOA-UHFFFAOYSA-N 6-(hydroxymethyl)-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CO)=CC=C21 FDHINJNZZCOWOA-UHFFFAOYSA-N 0.000 description 1
- WKIWQUVFIIRFBU-UHFFFAOYSA-N 6-[2-[2-(6-methoxy-1,5-naphthyridin-4-yl)-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]acetyl]-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(C(=O)CN3CCC4(CCN(C4=O)C4=CC=NC5=CC=C(N=C54)OC)CC3)=CC=C21 WKIWQUVFIIRFBU-UHFFFAOYSA-N 0.000 description 1
- XAZBRXLFKCEBGC-UHFFFAOYSA-N 6-acetyl-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(C(=O)C)=CC=C21 XAZBRXLFKCEBGC-UHFFFAOYSA-N 0.000 description 1
- VXMYQCJQEQTZAU-UHFFFAOYSA-N 6-ethenyl-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(C=C)=CC=C21 VXMYQCJQEQTZAU-UHFFFAOYSA-N 0.000 description 1
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 1
- WWHICBVKJYFFSG-UHFFFAOYSA-N 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine Chemical compound O1CCOC2=C1C=C(C=C)N=C2 WWHICBVKJYFFSG-UHFFFAOYSA-N 0.000 description 1
- ZRSCIBYAOVOFIG-UHFFFAOYSA-N 7-fluoro-4h-1,4-benzothiazin-3-one Chemical compound N1C(=O)CSC2=CC(F)=CC=C21 ZRSCIBYAOVOFIG-UHFFFAOYSA-N 0.000 description 1
- USVZHTBPMMSRHY-UHFFFAOYSA-N 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-chlorophenyl)ethyl]purin-6-amine Chemical compound C=1C=2OCOC=2C=C(Br)C=1SC1=NC=2C(N)=NC=NC=2N1CCC1=CC=CC=C1Cl USVZHTBPMMSRHY-UHFFFAOYSA-N 0.000 description 1
- FCTUXAFQZQNNBJ-UHFFFAOYSA-N 8-[2-(4-fluoropiperidin-4-yl)ethyl]-2-methoxy-1,5-naphthyridine Chemical compound C12=NC(OC)=CC=C2N=CC=C1CCC1(F)CCNCC1 FCTUXAFQZQNNBJ-UHFFFAOYSA-N 0.000 description 1
- ROHNLVXQIAQBHB-UHFFFAOYSA-N 8-fluoro-6-methoxy-1h-quinolin-4-one Chemical compound N1C=CC(=O)C2=CC(OC)=CC(F)=C21 ROHNLVXQIAQBHB-UHFFFAOYSA-N 0.000 description 1
- OJLZRYSTMRWWQM-UHFFFAOYSA-N 8-fluoro-6-methoxyquinolin-4-amine Chemical compound N1=CC=C(N)C2=CC(OC)=CC(F)=C21 OJLZRYSTMRWWQM-UHFFFAOYSA-N 0.000 description 1
- 101710134784 Agnoprotein Proteins 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N Azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- SCDMZALJUKGWQD-UHFFFAOYSA-N C(C(=O)O)(=O)O.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)CCC=1C=CC2=C(NC(CS2)=O)C1)CO Chemical compound C(C(=O)O)(=O)O.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)CCC=1C=CC2=C(NC(CS2)=O)C1)CO SCDMZALJUKGWQD-UHFFFAOYSA-N 0.000 description 1
- SELGEQVFYQXBLN-UHFFFAOYSA-N C(C(=O)O)(=O)O.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)CCC=1C=CC2=C(NC(CS2)=O)C1)O Chemical compound C(C(=O)O)(=O)O.COC=1N=C2C(=CC=NC2=CC1)NC(=O)C1(CCN(CC1)CCC=1C=CC2=C(NC(CS2)=O)C1)O SELGEQVFYQXBLN-UHFFFAOYSA-N 0.000 description 1
- QNNOHUUYJDFQSS-UHFFFAOYSA-N C(C1=CC=CC=C1)OC=1C(C=C(OC1)CO)=O.C(C1=CC=CC=C1)OC=1C(C=C(NC1)CO)=O Chemical compound C(C1=CC=CC=C1)OC=1C(C=C(OC1)CO)=O.C(C1=CC=CC=C1)OC=1C(C=C(NC1)CO)=O QNNOHUUYJDFQSS-UHFFFAOYSA-N 0.000 description 1
- NICKHWKCGPDZFT-UHFFFAOYSA-N CC(C)(C)OC(=O)N1CCC(C(O)=O)(C(O)=O)CC1 Chemical compound CC(C)(C)OC(=O)N1CCC(C(O)=O)(C(O)=O)CC1 NICKHWKCGPDZFT-UHFFFAOYSA-N 0.000 description 1
- AFASZICMDPHTSJ-UHFFFAOYSA-N CC(C1)C(OC)=Nc2c1nccc2CCC1(CCN(CCc(cc2N3)ccc2OCC3=O)CC1)F Chemical compound CC(C1)C(OC)=Nc2c1nccc2CCC1(CCN(CCc(cc2N3)ccc2OCC3=O)CC1)F AFASZICMDPHTSJ-UHFFFAOYSA-N 0.000 description 1
- AEFVKNMJVCEJNQ-UHFFFAOYSA-N COc1ccc2nccc(NC(=O)C3(CCN(CC3)C(=O)OC(C)(C)C)C(O)=O)c2n1 Chemical compound COc1ccc2nccc(NC(=O)C3(CCN(CC3)C(=O)OC(C)(C)C)C(O)=O)c2n1 AEFVKNMJVCEJNQ-UHFFFAOYSA-N 0.000 description 1
- 0 C[C@@](*)[C@@](C)C([C@](*)[N+]([N-])N)N(C)CC* Chemical compound C[C@@](*)[C@@](C)C([C@](*)[N+]([N-])N)N(C)CC* 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGUGMYGMHZMDQD-UHFFFAOYSA-N Cl.Cl.N1C(=O)CSC(N=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 Chemical compound Cl.Cl.N1C(=O)CSC(N=N2)=C1C=C2CCN(CC1)CCC1(O)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 DGUGMYGMHZMDQD-UHFFFAOYSA-N 0.000 description 1
- WMYXXPVELXIZEW-UHFFFAOYSA-N Cl.Cl.S1CC(=O)NC2=CC(CCN3CCC(CC3)(C(=O)NC3=CC=NC4=CC=C(N=C43)OC)C#N)=CC=C21 Chemical compound Cl.Cl.S1CC(=O)NC2=CC(CCN3CCC(CC3)(C(=O)NC3=CC=NC4=CC=C(N=C43)OC)C#N)=CC=C21 WMYXXPVELXIZEW-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 238000006809 Jones oxidation reaction Methods 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- PFONFPHNYXFALE-UHFFFAOYSA-N N-(6-methoxy-1,5-naphthyridin-4-yl)-1-[2-(6-oxo-5H-pyridazino[3,4-b][1,4]thiazin-3-yl)ethyl]-4-(trifluoromethyl)piperidine-4-carboxamide dihydrochloride Chemical compound Cl.Cl.N1C(=O)CSC(N=N2)=C1C=C2CCN(CC1)CCC1(C(F)(F)F)C(=O)NC1=CC=NC2=CC=C(OC)N=C21 PFONFPHNYXFALE-UHFFFAOYSA-N 0.000 description 1
- IRNKETNAVPUPAT-UHFFFAOYSA-N N-(6-methoxy-1,5-naphthyridin-4-yl)-4-methyl-1-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]piperidine-4-carboxamide oxalic acid Chemical compound OC(=O)C(O)=O.S1CC(=O)NC2=CC(CCN3CCC(CC3)(C)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 IRNKETNAVPUPAT-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 150000007930 O-acyl isoureas Chemical class 0.000 description 1
- DAOBCFLPIGWQQS-UHFFFAOYSA-N OC(=O)C(O)=O.N1=CC=C(N)C2=NC(OC)=CC=C21 Chemical compound OC(=O)C(O)=O.N1=CC=C(N)C2=NC(OC)=CC=C21 DAOBCFLPIGWQQS-UHFFFAOYSA-N 0.000 description 1
- MOAXBHGEMQIKPE-UHFFFAOYSA-N OC(=O)C(O)=O.OC(=O)C(O)=O.S1CC(=O)NC2=CC(CCN3CCC(CC3)(N)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 Chemical compound OC(=O)C(O)=O.OC(=O)C(O)=O.S1CC(=O)NC2=CC(CCN3CCC(CC3)(N)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 MOAXBHGEMQIKPE-UHFFFAOYSA-N 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 238000006680 Reformatsky reaction Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 108010059993 Vancomycin Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QWRYXSDXSBMOOL-UHFFFAOYSA-N [1,4]dioxino[2,3-b]pyridine Chemical group C1=CC=C2OC=COC2=N1 QWRYXSDXSBMOOL-UHFFFAOYSA-N 0.000 description 1
- WXIONIWNXBAHRU-UHFFFAOYSA-N [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium Chemical compound C1=CN=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 WXIONIWNXBAHRU-UHFFFAOYSA-N 0.000 description 1
- QQTVULAMCGLGLN-UHFFFAOYSA-N acetonitrile;tetrachloromethane;hydrate Chemical compound O.CC#N.ClC(Cl)(Cl)Cl QQTVULAMCGLGLN-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005103 alkyl silyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 125000006242 amine protecting group Chemical group 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-N anhydrous cyanoacetic acid Natural products OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 125000004321 azepin-2-yl group Chemical group [H]N1C([H])=C([H])C([H])=C([H])C([H])=C1* 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 125000004540 benzothiazol-5-yl group Chemical group S1C=NC2=C1C=CC(=C2)* 0.000 description 1
- VTRAKUAUVOFCHJ-UHFFFAOYSA-N benzyl 4-(hydroxymethyl)-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C(CC1)(CO)CCN1C(=O)OCC1=CC=CC=C1 VTRAKUAUVOFCHJ-UHFFFAOYSA-N 0.000 description 1
- GUSZYKICGPJATC-UHFFFAOYSA-N benzyl 4-ethynyl-4-fluoropiperidine-1-carboxylate Chemical compound C1CC(F)(C#C)CCN1C(=O)OCC1=CC=CC=C1 GUSZYKICGPJATC-UHFFFAOYSA-N 0.000 description 1
- FHPRDKVTXXHEFV-UHFFFAOYSA-N benzyl 4-ethynyl-4-hydroxypiperidine-1-carboxylate Chemical compound C1CC(O)(C#C)CCN1C(=O)OCC1=CC=CC=C1 FHPRDKVTXXHEFV-UHFFFAOYSA-N 0.000 description 1
- LRAXBCKXXZYLRQ-UHFFFAOYSA-N benzyl 4-fluoro-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethynyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1C#CC(CC1)(F)CCN1C(=O)OCC1=CC=CC=C1 LRAXBCKXXZYLRQ-UHFFFAOYSA-N 0.000 description 1
- XVMHDAVCQBRNCX-UHFFFAOYSA-N benzyl 4-hydroxy-4-(2-trimethylsilylethynyl)piperidine-1-carboxylate Chemical compound C1CC(C#C[Si](C)(C)C)(O)CCN1C(=O)OCC1=CC=CC=C1 XVMHDAVCQBRNCX-UHFFFAOYSA-N 0.000 description 1
- GNUAJJFEWPSTGB-UHFFFAOYSA-N benzyl 4-hydroxy-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethynyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1C#CC(CC1)(O)CCN1C(=O)OCC1=CC=CC=C1 GNUAJJFEWPSTGB-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- OBBMVFKOKGRDGS-UHFFFAOYSA-N benzyl n,n-bis(2-chloroethyl)carbamate Chemical compound ClCCN(CCCl)C(=O)OCC1=CC=CC=C1 OBBMVFKOKGRDGS-UHFFFAOYSA-N 0.000 description 1
- YPJNZKUYOIXMBR-UHFFFAOYSA-N benzyl(trimethyl)azanium;dichloroiodanium Chemical compound Cl[I+]Cl.C[N+](C)(C)CC1=CC=CC=C1 YPJNZKUYOIXMBR-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 150000001277 beta hydroxy acids Chemical class 0.000 description 1
- 239000003781 beta lactamase inhibitor Substances 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- RUEKPBLTWGFBOD-UHFFFAOYSA-N bromoethyne Chemical class BrC#C RUEKPBLTWGFBOD-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- HGXJOXHYPGNVNK-UHFFFAOYSA-N butane;ethenoxyethane;tin Chemical compound CCCC[Sn](CCCC)(CCCC)C(=C)OCC HGXJOXHYPGNVNK-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- PSEHHVRCDVOTID-UHFFFAOYSA-N chloro-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane Chemical compound CC1C(C2(C)C)CC2CC1B(Cl)C(C1C)CC2C(C)(C)C1C2 PSEHHVRCDVOTID-UHFFFAOYSA-N 0.000 description 1
- QOPVNWQGBQYBBP-UHFFFAOYSA-N chloroethyl chloroformate Chemical compound CC(Cl)OC(Cl)=O QOPVNWQGBQYBBP-UHFFFAOYSA-N 0.000 description 1
- ZQKIFZGRNCIRRB-UHFFFAOYSA-N chloroform;n,n-dimethylformamide;methanol Chemical compound OC.ClC(Cl)Cl.CN(C)C=O ZQKIFZGRNCIRRB-UHFFFAOYSA-N 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical group [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- VTHIKKVKIVQWHV-UHFFFAOYSA-N chromium(6+) oxygen(2-) pyridine Chemical compound [O-2].[O-2].[O-2].[Cr+6].C1=CC=NC=C1 VTHIKKVKIVQWHV-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- DODZTSARNRLOKY-UHFFFAOYSA-N cinnolin-4-amine Chemical class C1=CC=C2C(N)=CN=NC2=C1 DODZTSARNRLOKY-UHFFFAOYSA-N 0.000 description 1
- GFHNAMRJFCEERV-UHFFFAOYSA-L cobalt chloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Co+2] GFHNAMRJFCEERV-UHFFFAOYSA-L 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- RGBVWCQARBEPPW-UHFFFAOYSA-N cyclobut-3-ene-1,2-dione Chemical compound O=C1C=CC1=O RGBVWCQARBEPPW-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- PBGGNZZGJIKBMJ-UHFFFAOYSA-N di(propan-2-yl)azanide Chemical compound CC(C)[N-]C(C)C PBGGNZZGJIKBMJ-UHFFFAOYSA-N 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical class [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003221 ear drop Substances 0.000 description 1
- 229940047652 ear drops Drugs 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- ZRSDQBKGDNPFLT-UHFFFAOYSA-N ethanol;oxolane Chemical compound CCO.C1CCOC1 ZRSDQBKGDNPFLT-UHFFFAOYSA-N 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- GKMQAGZRPQBLHG-UHFFFAOYSA-N ethyl 1-methyl-3,6-dihydro-2h-pyridine-4-carboxylate Chemical compound CCOC(=O)C1=CCN(C)CC1 GKMQAGZRPQBLHG-UHFFFAOYSA-N 0.000 description 1
- DSRXMRMMWIGMBO-UHFFFAOYSA-N ethyl 2-(5-fluoro-2-nitrophenyl)sulfanylacetate Chemical compound CCOC(=O)CSC1=CC(F)=CC=C1[N+]([O-])=O DSRXMRMMWIGMBO-UHFFFAOYSA-N 0.000 description 1
- ANQVKHGDALCPFZ-UHFFFAOYSA-N ethyl 2-[6-(4-methylpiperazin-1-yl)-1h-benzimidazol-2-yl]acetate Chemical compound C1=C2NC(CC(=O)OCC)=NC2=CC=C1N1CCN(C)CC1 ANQVKHGDALCPFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- RUJPPJYDHHAEEK-UHFFFAOYSA-N ethyl piperidine-4-carboxylate Chemical compound CCOC(=O)C1CCNCC1 RUJPPJYDHHAEEK-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229940047650 haemophilus influenzae Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- AQYSYJUIMQTRMV-UHFFFAOYSA-N hypofluorous acid Chemical compound FO AQYSYJUIMQTRMV-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000004130 indan-2-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])(*)C2([H])[H] 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 125000000686 lactone group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- BXBLTKZWYAHPKM-UHFFFAOYSA-M magnesium;methanidyl(trimethyl)silane;chloride Chemical compound [Mg+2].[Cl-].C[Si](C)(C)[CH2-] BXBLTKZWYAHPKM-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- GXHFUVWIGNLZSC-UHFFFAOYSA-N meldrum's acid Chemical compound CC1(C)OC(=O)CC(=O)O1 GXHFUVWIGNLZSC-UHFFFAOYSA-N 0.000 description 1
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- SJFNDMHZXCUXSA-UHFFFAOYSA-M methoxymethyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(COC)C1=CC=CC=C1 SJFNDMHZXCUXSA-UHFFFAOYSA-M 0.000 description 1
- BULQWSZZDVCSQR-UHFFFAOYSA-N methyl 2-(4-acetyl-2-nitrophenyl)sulfanylacetate Chemical compound COC(=O)CSC1=CC=C(C(C)=O)C=C1[N+]([O-])=O BULQWSZZDVCSQR-UHFFFAOYSA-N 0.000 description 1
- ZRLAOFFYEZAUIW-UHFFFAOYSA-N methyl 3-oxo-4h-1,4-benzothiazine-6-carboxylate;3-oxo-4h-1,4-benzothiazine-6-carboxylic acid Chemical compound S1CC(=O)NC2=CC(C(=O)O)=CC=C21.S1CC(=O)NC2=CC(C(=O)OC)=CC=C21 ZRLAOFFYEZAUIW-UHFFFAOYSA-N 0.000 description 1
- UIAHQILQYROVCF-UHFFFAOYSA-N methyl 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylate Chemical compound S1CC(=O)NC2=NC(C(=O)OC)=CC=C21 UIAHQILQYROVCF-UHFFFAOYSA-N 0.000 description 1
- OQUCMNQHZFOMPC-UHFFFAOYSA-N methyl 6-amino-5-bromopyridine-2-carboxylate Chemical compound COC(=O)C1=CC=C(Br)C(N)=N1 OQUCMNQHZFOMPC-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- ANGDWNBGPBMQHW-UHFFFAOYSA-N methyl cyanoacetate Chemical compound COC(=O)CC#N ANGDWNBGPBMQHW-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- ANXKZXRDXAZQJT-UHFFFAOYSA-M methyl sulfate;trimethylsulfanium Chemical compound C[S+](C)C.COS([O-])(=O)=O ANXKZXRDXAZQJT-UHFFFAOYSA-M 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N monoethanolamine hydrochloride Natural products NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- YHYUWOKWMJIPTG-UHFFFAOYSA-N n-(6-methoxy-1,5-naphthyridin-4-yl)-4-(trifluoromethyl)piperidine-4-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(F)(F)F)CCNCC1 YHYUWOKWMJIPTG-UHFFFAOYSA-N 0.000 description 1
- VZJWOKARVWMNND-UHFFFAOYSA-N n-(8-fluoro-6-methoxyquinolin-4-yl)-4-hydroxypiperidine-4-carboxamide Chemical compound C12=CC(OC)=CC(F)=C2N=CC=C1NC(=O)C1(O)CCNCC1 VZJWOKARVWMNND-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000005054 naphthyridines Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 239000002777 nucleoside Substances 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 150000004893 oxazines Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000007248 oxidative elimination reaction Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- CAEWJEXPFKNBQL-UHFFFAOYSA-N prop-2-enyl carbonochloridate Chemical compound ClC(=O)OCC=C CAEWJEXPFKNBQL-UHFFFAOYSA-N 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004526 pyridazin-2-yl group Chemical group N1N(C=CC=C1)* 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- VSGPVHSTVTXREH-UHFFFAOYSA-N quinolin-4-one Chemical compound C1=CC=C[C]2C(=O)C=CN=C21 VSGPVHSTVTXREH-UHFFFAOYSA-N 0.000 description 1
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000012363 selectfluor Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- UYCAUPASBSROMS-AWQJXPNKSA-M sodium;2,2,2-trifluoroacetate Chemical compound [Na+].[O-][13C](=O)[13C](F)(F)F UYCAUPASBSROMS-AWQJXPNKSA-M 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- ZOWHATOOYJUFDQ-LRHAYUFXSA-N tert-butyl (2R)-2-methoxy-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound CO[C@@H]1CC(CCN1C(=O)OC(C)(C)C)C(=O)Nc1ccnc2ccc(OC)nc12 ZOWHATOOYJUFDQ-LRHAYUFXSA-N 0.000 description 1
- ADPIEGXXCABJCH-UHFFFAOYSA-N tert-butyl 1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC11C(=O)NCC1 ADPIEGXXCABJCH-UHFFFAOYSA-N 0.000 description 1
- RWSAEABPDVMLJS-UHFFFAOYSA-N tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-4-(trifluoromethyl)piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(F)(F)F)CCN(C(=O)OC(C)(C)C)CC1 RWSAEABPDVMLJS-UHFFFAOYSA-N 0.000 description 1
- JYJJTYIKMGJMTR-UHFFFAOYSA-N tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]-4-methylpiperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C)CCN(C(=O)OC(C)(C)C)CC1 JYJJTYIKMGJMTR-UHFFFAOYSA-N 0.000 description 1
- DEDOWMPOPVYWFM-UHFFFAOYSA-N tert-butyl 4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-4-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C(=O)OC(C)(C)C)CCNCC1 DEDOWMPOPVYWFM-UHFFFAOYSA-N 0.000 description 1
- FXAXDNMQCYEZOZ-UHFFFAOYSA-N tert-butyl 4-[(8-fluoro-6-methoxyquinolin-4-yl)carbamoyl]-4-(methoxymethoxy)piperidine-1-carboxylate Chemical compound C=1C=NC2=C(F)C=C(OC)C=C2C=1NC(=O)C1(OCOC)CCN(C(=O)OC(C)(C)C)CC1 FXAXDNMQCYEZOZ-UHFFFAOYSA-N 0.000 description 1
- STULNXOXJZACHB-UHFFFAOYSA-N tert-butyl 4-carbamoyl-4-(trifluoromethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(C(F)(F)F)(C(N)=O)CC1 STULNXOXJZACHB-UHFFFAOYSA-N 0.000 description 1
- YZXCHVNFNSZTAN-UHFFFAOYSA-N tert-butyl 4-cyano-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(C#N)CCN(C(=O)OC(C)(C)C)CC1 YZXCHVNFNSZTAN-UHFFFAOYSA-N 0.000 description 1
- YVWDDHLYIXFZPL-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(O)CCN(C(=O)OC(C)(C)C)CC1 YVWDDHLYIXFZPL-UHFFFAOYSA-N 0.000 description 1
- YOWRRGPVEHZWLE-UHFFFAOYSA-N tert-butyl 4-methoxy-4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]piperidine-1-carboxylate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1(OC)CCN(C(=O)OC(C)(C)C)CC1 YOWRRGPVEHZWLE-UHFFFAOYSA-N 0.000 description 1
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 1
- FQZLNQAUUMSUHT-UHFFFAOYSA-N tert-butyl n,n-bis(2-chloroethyl)carbamate Chemical compound CC(C)(C)OC(=O)N(CCCl)CCCl FQZLNQAUUMSUHT-UHFFFAOYSA-N 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- XJPANWOKBWZVHC-UHFFFAOYSA-N tetrazol-2-amine Chemical compound NN1N=CN=N1 XJPANWOKBWZVHC-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 150000004897 thiazines Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- JKVRTUCVPZTEQZ-UHFFFAOYSA-N tributyltin azide Chemical compound CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-] JKVRTUCVPZTEQZ-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- AHZJKOKFZJYCLG-UHFFFAOYSA-K trifluoromethanesulfonate;ytterbium(3+) Chemical compound [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F AHZJKOKFZJYCLG-UHFFFAOYSA-K 0.000 description 1
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- PGAJYUDRKAPMPA-UHFFFAOYSA-N trimethylsilyl n-ethylcarbamate Chemical compound CCNC(=O)O[Si](C)(C)C PGAJYUDRKAPMPA-UHFFFAOYSA-N 0.000 description 1
- VFJYIHQDILEQNR-UHFFFAOYSA-M trimethylsulfanium;iodide Chemical compound [I-].C[S+](C)C VFJYIHQDILEQNR-UHFFFAOYSA-M 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- ADZJWYULTMTLQZ-UHFFFAOYSA-N tritylphosphane;hydrobromide Chemical compound [Br-].C=1C=CC=CC=1C(C=1C=CC=CC=1)([PH3+])C1=CC=CC=C1 ADZJWYULTMTLQZ-UHFFFAOYSA-N 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- MYPYJXKWCTUITO-LYRMYLQWSA-N vancomycin Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C2C=C3C=C1OC1=CC=C(C=C1Cl)[C@@H](O)[C@H](C(N[C@@H](CC(N)=O)C(=O)N[C@H]3C(=O)N[C@H]1C(=O)N[C@H](C(N[C@@H](C3=CC(O)=CC(O)=C3C=3C(O)=CC=C1C=3)C(O)=O)=O)[C@H](O)C1=CC=C(C(=C1)Cl)O2)=O)NC(=O)[C@@H](CC(C)C)NC)[C@H]1C[C@](C)(N)[C@H](O)[C@H](C)O1 MYPYJXKWCTUITO-LYRMYLQWSA-N 0.000 description 1
- 229960003165 vancomycin Drugs 0.000 description 1
- PGOLTJPQCISRTO-UHFFFAOYSA-N vinyllithium Chemical compound [Li]C=C PGOLTJPQCISRTO-UHFFFAOYSA-N 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0118238.5A GB0118238D0 (en) | 2001-07-26 | 2001-07-26 | Medicaments |
| PCT/EP2002/008319 WO2003010138A2 (en) | 2001-07-26 | 2002-07-25 | Piperidine derivatives as antibacterial agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2005504747A true JP2005504747A (ja) | 2005-02-17 |
| JP2005504747A5 JP2005504747A5 (cg-RX-API-DMAC7.html) | 2006-01-05 |
Family
ID=9919236
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2003515497A Pending JP2005504747A (ja) | 2001-07-26 | 2002-07-25 | 薬物 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US20040198756A1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1419155B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2005504747A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE344799T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU2002328972A1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE60215951T2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2274999T3 (cg-RX-API-DMAC7.html) |
| GB (1) | GB0118238D0 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2003010138A2 (cg-RX-API-DMAC7.html) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011148962A1 (ja) * | 2010-05-25 | 2011-12-01 | 大正製薬株式会社 | 新規な複素環化合物又はその塩 |
| JP2014508116A (ja) * | 2010-12-14 | 2014-04-03 | メルク・シャープ・アンド・ドーム・コーポレーション | 大環状ラクタムの調製のための方法および中間体 |
| JP2015514795A (ja) * | 2012-04-27 | 2015-05-21 | ヤンセン ファーマシューティカ エヌ.ベー. | 抗菌性キノリン誘導体 |
| JP2015518003A (ja) * | 2012-04-27 | 2015-06-25 | ヤンセン ファーマシューティカ エヌ.ベー. | 抗菌性キノリン誘導体 |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6803369B1 (en) | 2000-07-25 | 2004-10-12 | Smithkline Beecham Corporation | Compounds and methods for the treatment of neoplastic disease |
| EP1320529B1 (en) * | 2000-09-21 | 2006-05-24 | Smithkline Beecham Plc | Quinoline derivatives as antibacterials |
| GB0031086D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0031088D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0101577D0 (en) * | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| GB0112834D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0112836D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| US7109213B2 (en) * | 2002-01-29 | 2006-09-19 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| US7312212B2 (en) | 2002-01-29 | 2007-12-25 | Glaxo Group Limited | Aminopiperidine derivatives |
| TW200406413A (en) | 2002-06-26 | 2004-05-01 | Glaxo Group Ltd | Compounds |
| TW200409637A (en) | 2002-06-26 | 2004-06-16 | Glaxo Group Ltd | Compounds |
| ATE463494T1 (de) | 2002-10-10 | 2010-04-15 | Morphochem Ag Komb Chemie | Neue verbindungen mit antibakterieller aktivität |
| US7618959B2 (en) | 2002-11-05 | 2009-11-17 | Smithklinebeecham Corp | Antibacterial agents |
| AU2003303956A1 (en) | 2002-11-05 | 2004-11-23 | Smithkline Beecham Corporation | Antibacterial agents |
| TW200427688A (en) * | 2002-12-18 | 2004-12-16 | Glaxo Group Ltd | Antibacterial agents |
| CN100413865C (zh) * | 2004-01-08 | 2008-08-27 | 弗·哈夫曼-拉罗切有限公司 | 二氮杂-螺哌啶衍生物 |
| FR2867472B1 (fr) * | 2004-03-12 | 2008-07-18 | Aventis Pharma Sa | Derives de quinoleines-4-substituees, leurs procede et intermediaires de preparation et les compositions pharmaceutiques qui les contiennent |
| TWI350168B (en) | 2004-05-07 | 2011-10-11 | Incyte Corp | Amido compounds and their use as pharmaceuticals |
| EP1768954A4 (en) | 2004-06-24 | 2008-05-28 | Incyte Corp | 2-METHYLPROPANAMIDES AND THEIR USE AS PHARMACEUTICALS |
| WO2006017326A1 (en) | 2004-07-13 | 2006-02-16 | Glaxo Group Limited | Antibacterial agents |
| EP1650186B1 (en) * | 2004-10-22 | 2008-06-04 | Bioprojet | Novel dicarboxylic acid derivatives |
| WO2006081289A2 (en) | 2005-01-25 | 2006-08-03 | Glaxo Group Limited | Antibacterial agents |
| US7648980B2 (en) | 2005-01-25 | 2010-01-19 | Glaxo Group Limited | Antibacterial agents |
| EP1846418A4 (en) | 2005-01-25 | 2009-12-23 | Glaxo Group Ltd | ANTIBACTERIAL ACTIVE SUBSTANCES |
| US7605169B2 (en) | 2005-01-25 | 2009-10-20 | Glaxo Group Limited | Antibacterial agents |
| US7709472B2 (en) | 2005-01-25 | 2010-05-04 | Glaxo Group Limited | Antibacterial agents |
| US8193207B2 (en) | 2005-12-05 | 2012-06-05 | Incyte Corporation | Lactam compounds and methods of using the same |
| JP2009527562A (ja) * | 2006-02-21 | 2009-07-30 | アムゲン インコーポレイティッド | ホスホジエステラーゼ10阻害剤としてのシンノリン誘導体 |
| JP2009528365A (ja) * | 2006-02-28 | 2009-08-06 | アムゲン インコーポレイティッド | ホスホジエステラーゼ10阻害剤としてのシンノリン及びキナゾリン誘導体 |
| AU2007223801A1 (en) * | 2006-03-08 | 2007-09-13 | Amgen Inc. | Quinoline and isoquinoline derivatives as phosphodiesterase 10 inhibitors |
| JP2009532504A (ja) | 2006-04-06 | 2009-09-10 | グラクソ グループ リミテッド | 抗菌薬 |
| ATE481406T1 (de) | 2006-04-06 | 2010-10-15 | Glaxo Group Ltd | Pyrrolochinoxalinonderivate als antibakterielle mittel |
| GB0613208D0 (en) | 2006-07-03 | 2006-08-09 | Glaxo Group Ltd | Compounds |
| EP1992628A1 (en) | 2007-05-18 | 2008-11-19 | Glaxo Group Limited | Derivatives and analogs of N-ethylquinolones and N-ethylazaquinolones |
| US20100210633A1 (en) * | 2006-10-12 | 2010-08-19 | Epix Delaware, Inc. | Carboxamide compounds and their use |
| KR101567096B1 (ko) * | 2007-04-20 | 2015-11-06 | 글락소 그룹 리미티드 | 항균제로서의 트리시클릭 질소 함유 화합물 |
| MX2009012117A (es) | 2007-05-09 | 2009-11-23 | Pfizer | Composiciones y derivados heterociclicos sustituidos y su uso farmaceutico como antibacterianos. |
| CL2008001839A1 (es) | 2007-06-21 | 2009-01-16 | Incyte Holdings Corp | Compuestos derivados de 2,7-diazaespirociclos, inhibidores de 11-beta hidroxil esteroide deshidrogenasa tipo 1; composicion farmaceutica que comprende a dichos compuestos; utiles para tratar la obesidad, diabetes, intolerancia a la glucosa, diabetes tipo ii, entre otras enfermedades. |
| BRPI0820701A2 (pt) | 2007-12-11 | 2015-06-16 | Cytopathfinder Inc | Composto de carboxamida e seu uso como agonistas do receptor de quimiocina |
| EP2080761A1 (en) | 2008-01-18 | 2009-07-22 | Glaxo Group Limited | Compounds |
| ES2539947T3 (es) * | 2008-06-02 | 2015-07-07 | Cipla Limited | Procedimiento para la síntesis de arformoterol |
| JP2012505866A (ja) | 2008-10-17 | 2012-03-08 | グラクソ グループ リミテッド | 抗菌剤として使用される三環式窒素化合物 |
| US8318940B2 (en) | 2009-01-15 | 2012-11-27 | Glaxo Group Limited | Naphthyridin-2 (1 H)-one compounds useful as antibacterials |
| CN102267995A (zh) * | 2010-06-04 | 2011-12-07 | 艾琪康医药科技(上海)有限公司 | 一种制备二氮杂螺环化合物的方法 |
| AR089929A1 (es) | 2012-02-10 | 2014-10-01 | Actelion Pharmaceuticals Ltd | Proceso para manufacturar un derivado de naftiridina |
| BR112017003705B1 (pt) | 2014-08-22 | 2022-07-12 | Glaxosmithkline Intellectual Property Development Limited | Compostos contendo nitrogênio tricíclicos para o tratamento de infecção por neisseria gonorrhoea |
| UY36851A (es) | 2015-08-16 | 2017-03-31 | Glaxosmithkline Ip Dev Ltd | Compuestos para uso en aplicaciones antibacterianas |
| WO2021076886A1 (en) | 2019-10-18 | 2021-04-22 | The Regents Of The University Of California | 3-phenylsulphonyl-quinoline derivatives as agents for treating pathogenic blood vessels disorders |
| CN116102537B (zh) * | 2021-11-10 | 2024-10-01 | 四川大学 | 一种喹啉酮类衍生物及其制备方法和用途 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7908031A (nl) * | 1979-11-01 | 1981-06-01 | Acf Chemiefarma Nv | Nieuwe chinolinederivaten en farmaceutische preparaten die een dergelijke verbinding bevatten, alsmede werk- wijze voor het bereiden van deze verbindingen. |
| EP0541486A1 (de) * | 1991-11-07 | 1993-05-12 | Ciba-Geigy Ag | Polycyclische Konjugate |
| US5977134A (en) * | 1996-12-05 | 1999-11-02 | Merck & Co., Inc. | Inhibitors of farnesyl-protein transferase |
| GB9822450D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| GB9822440D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| AU2437900A (en) * | 1999-01-20 | 2000-08-07 | Smithkline Beecham Plc | Piperidinylquinolines as protein tyrosine kinase inhibitors |
| GB9914486D0 (en) * | 1999-06-21 | 1999-08-18 | Smithkline Beecham Plc | Medicaments |
| GB9917406D0 (en) * | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| GB9917408D0 (en) * | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| US6403610B1 (en) * | 1999-09-17 | 2002-06-11 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation and the compositions which comprise them |
| US6803369B1 (en) * | 2000-07-25 | 2004-10-12 | Smithkline Beecham Corporation | Compounds and methods for the treatment of neoplastic disease |
| CN1452619A (zh) * | 2000-07-26 | 2003-10-29 | 史密斯克莱·比奇曼公司 | 具有抗细菌活性的氨基哌啶喹啉和它们的氮杂等排的类似物 |
| EP1320529B1 (en) * | 2000-09-21 | 2006-05-24 | Smithkline Beecham Plc | Quinoline derivatives as antibacterials |
| US6603005B2 (en) * | 2000-11-15 | 2003-08-05 | Aventis Pharma S.A. | Heterocyclylalkylpiperidine derivatives, their preparation and compositions containing them |
| FR2816618B1 (fr) * | 2000-11-15 | 2002-12-27 | Aventis Pharma Sa | Derives heterocyclylalcoyl piperidine, leur preparation et les compositions qui les contiennent |
| GB0031086D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0031088D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0101577D0 (en) * | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| US6602884B2 (en) * | 2001-03-13 | 2003-08-05 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation, and compositions containing them |
| GB0112834D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0112836D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| US20030203917A1 (en) * | 2001-07-25 | 2003-10-30 | Smithkline Beecham Corporation And Smithkline Beecham P.L.C. | Compounds and methods for the treatment of neoplastic disease |
| US7109213B2 (en) * | 2002-01-29 | 2006-09-19 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| US7312212B2 (en) * | 2002-01-29 | 2007-12-25 | Glaxo Group Limited | Aminopiperidine derivatives |
| GB0217294D0 (en) * | 2002-07-25 | 2002-09-04 | Glaxo Group Ltd | Medicaments |
-
2001
- 2001-07-26 GB GBGB0118238.5A patent/GB0118238D0/en not_active Ceased
-
2002
- 2002-07-25 US US10/484,563 patent/US20040198756A1/en not_active Abandoned
- 2002-07-25 WO PCT/EP2002/008319 patent/WO2003010138A2/en not_active Ceased
- 2002-07-25 DE DE60215951T patent/DE60215951T2/de not_active Expired - Fee Related
- 2002-07-25 AU AU2002328972A patent/AU2002328972A1/en not_active Abandoned
- 2002-07-25 ES ES02764786T patent/ES2274999T3/es not_active Expired - Lifetime
- 2002-07-25 JP JP2003515497A patent/JP2005504747A/ja active Pending
- 2002-07-25 EP EP02764786A patent/EP1419155B1/en not_active Expired - Lifetime
- 2002-07-25 AT AT02764786T patent/ATE344799T1/de not_active IP Right Cessation
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011148962A1 (ja) * | 2010-05-25 | 2011-12-01 | 大正製薬株式会社 | 新規な複素環化合物又はその塩 |
| JPWO2011148962A1 (ja) * | 2010-05-25 | 2013-07-25 | 大正製薬株式会社 | 新規な複素環化合物又はその塩 |
| JP2014508116A (ja) * | 2010-12-14 | 2014-04-03 | メルク・シャープ・アンド・ドーム・コーポレーション | 大環状ラクタムの調製のための方法および中間体 |
| JP2015514795A (ja) * | 2012-04-27 | 2015-05-21 | ヤンセン ファーマシューティカ エヌ.ベー. | 抗菌性キノリン誘導体 |
| JP2015518003A (ja) * | 2012-04-27 | 2015-06-25 | ヤンセン ファーマシューティカ エヌ.ベー. | 抗菌性キノリン誘導体 |
Also Published As
| Publication number | Publication date |
|---|---|
| ATE344799T1 (de) | 2006-11-15 |
| AU2002328972A1 (en) | 2003-02-17 |
| EP1419155B1 (en) | 2006-11-08 |
| DE60215951D1 (de) | 2006-12-21 |
| WO2003010138A3 (en) | 2003-12-04 |
| WO2003010138A2 (en) | 2003-02-06 |
| DE60215951T2 (de) | 2007-04-26 |
| US20040198756A1 (en) | 2004-10-07 |
| ES2274999T3 (es) | 2007-06-01 |
| EP1419155A2 (en) | 2004-05-19 |
| GB0118238D0 (en) | 2001-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1419155B1 (en) | Piperidine derivatives as antibacterial agents | |
| US7186730B2 (en) | Bicyclic nitrogen-containing heterocyclic derivatives for use as antibacterials | |
| DE60221969T2 (de) | Durch eine piperidin-enthaltende einheit an position 4 substituierte chinoline und deren stickstoff-enthaltende derivate und ihre verwendung als antibakterielle wirkstoffe | |
| JP4522262B2 (ja) | 化合物 | |
| JP4463565B2 (ja) | 抗菌剤として用いるための窒素含有二環式複素環 | |
| JP4445753B2 (ja) | アミノピペリジン誘導体 | |
| JP4515260B2 (ja) | アミノシクロヘキセンキノリンおよび抗菌活性を有するそのアザアイソステリック類似体 | |
| JP2004504397A (ja) | 抗菌活性を有するアミノピペリジンキノリン類およびそれらのアザイソステリックアナログ類 | |
| JP2006505505A (ja) | 化合物 | |
| JP2006511622A (ja) | 抗菌剤 | |
| JP2004518661A (ja) | 細菌感染の治療用ピペラジン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20050722 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20050722 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20090428 |
|
| A02 | Decision of refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A02 Effective date: 20091027 |