DE4038141C1 - - Google Patents
Info
- Publication number
- DE4038141C1 DE4038141C1 DE4038141A DE4038141A DE4038141C1 DE 4038141 C1 DE4038141 C1 DE 4038141C1 DE 4038141 A DE4038141 A DE 4038141A DE 4038141 A DE4038141 A DE 4038141A DE 4038141 C1 DE4038141 C1 DE 4038141C1
- Authority
- DE
- Germany
- Prior art keywords
- locking ring
- base
- clamping
- valve housing
- clamping element
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000000284 resting effect Effects 0.000 claims 1
- 239000000463 material Substances 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229920002457 flexible plastic Polymers 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
Classifications
-
- G—PHYSICS
- G05—CONTROLLING; REGULATING
- G05D—SYSTEMS FOR CONTROLLING OR REGULATING NON-ELECTRIC VARIABLES
- G05D23/00—Control of temperature
- G05D23/01—Control of temperature without auxiliary power
- G05D23/02—Control of temperature without auxiliary power with sensing element expanding and contracting in response to changes of temperature
- G05D23/021—Control of temperature without auxiliary power with sensing element expanding and contracting in response to changes of temperature the sensing element being a non-metallic solid, e.g. elastomer, paste
- G05D23/023—Control of temperature without auxiliary power with sensing element expanding and contracting in response to changes of temperature the sensing element being a non-metallic solid, e.g. elastomer, paste the sensing element being placed outside a regulating fluid flow
Landscapes
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Automation & Control Theory (AREA)
- Temperature-Responsive Valves (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4038141A DE4038141C1 (enExample) | 1990-11-30 | 1990-11-30 | |
| CH2969/91A CH685213A5 (de) | 1990-11-30 | 1991-10-08 | Thermostatventil. |
| AT0200491A AT399547B (de) | 1990-11-30 | 1991-10-09 | Thermostatventil |
| CA002053156A CA2053156C (en) | 1990-11-30 | 1991-10-10 | Thermostatic valve |
| SE9103016A SE502489C2 (sv) | 1990-11-30 | 1991-10-16 | Termostatventil |
| DK176591A DK176591A (da) | 1990-11-30 | 1991-10-23 | Termostatventil |
| US07/796,864 US5143286A (en) | 1990-11-30 | 1991-11-25 | Thermostatic valve |
| JP3312714A JPH07103944B2 (ja) | 1990-11-30 | 1991-11-27 | サーモスタットバルブ |
| BE9101095A BE1004261A3 (fr) | 1990-11-30 | 1991-11-28 | Soupape thermostatique. |
| GB9125333A GB2251487B (en) | 1990-11-30 | 1991-11-28 | Thermostat unit for a thermostatic valve |
| NL9102006A NL192054C (nl) | 1990-11-30 | 1991-11-29 | Thermostaatklep. |
| ITTO910931A IT1250235B (it) | 1990-11-30 | 1991-11-29 | Valvola termostatica. |
| FR9114822A FR2669988B1 (fr) | 1990-11-30 | 1991-11-29 | Soupape thermostatique. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4038141A DE4038141C1 (enExample) | 1990-11-30 | 1990-11-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4038141C1 true DE4038141C1 (enExample) | 1992-05-27 |
Family
ID=6419251
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4038141A Expired - Lifetime DE4038141C1 (enExample) | 1990-11-30 | 1990-11-30 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US5143286A (enExample) |
| JP (1) | JPH07103944B2 (enExample) |
| AT (1) | AT399547B (enExample) |
| BE (1) | BE1004261A3 (enExample) |
| CA (1) | CA2053156C (enExample) |
| CH (1) | CH685213A5 (enExample) |
| DE (1) | DE4038141C1 (enExample) |
| DK (1) | DK176591A (enExample) |
| FR (1) | FR2669988B1 (enExample) |
| GB (1) | GB2251487B (enExample) |
| IT (1) | IT1250235B (enExample) |
| NL (1) | NL192054C (enExample) |
| SE (1) | SE502489C2 (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1995026477A1 (en) * | 1994-03-25 | 1995-10-05 | Danfoss A/S | Valve, especially a thermostatic expansion valve |
| DE4419820A1 (de) * | 1994-06-07 | 1995-12-14 | Oventrop Sohn Kg F W | Thermostatventil |
| EP0683341A3 (de) * | 1994-05-19 | 1996-10-02 | Hansa Metallwerke Ag | Sanitärarmatur. |
| FR2757253A1 (fr) * | 1996-12-14 | 1998-06-19 | Neheim Goeke & Co Metall | Dispositif de reglage pour une soupape de radiateur |
| DE10108520B4 (de) * | 2001-02-22 | 2004-07-08 | Danfoss A/S | Heizungsventilaufsatz |
| EP3255351A1 (en) * | 2016-06-10 | 2017-12-13 | Danfoss A/S | Actuator attachment and method for demounting an actuator attachment |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4123856A1 (de) * | 1991-07-18 | 1993-01-21 | Grohe Armaturen Friedrich | Stellvorrichtung fuer ein mischventil |
| US5184851A (en) * | 1991-09-25 | 1993-02-09 | Fred Sparling | Coupling with auxiliary latch and release mechanism |
| DE4141791A1 (de) * | 1991-12-18 | 1993-06-24 | Grohe Armaturen Friedrich | Stellvorrichtung fuer ein mischventil |
| DE4141789A1 (de) * | 1991-12-18 | 1993-06-24 | Grohe Armaturen Friedrich | Stellvorrichtung fuer ein mischventil |
| SE502062C2 (sv) * | 1993-11-24 | 1995-07-31 | Tour & Andersson Ab | Koppling i synnerhet för anslutning av en termostatkropp till en ventil för ett värme- eller kylelement |
| DE9318911U1 (de) * | 1993-12-09 | 1994-02-10 | Theodor Heimeier Metallwerk GmbH & Co. KG, 59597 Erwitte | Thermostatventil |
| DE4344773A1 (de) * | 1993-12-28 | 1995-06-29 | Danfoss As | Thermostataufsatz für Heizkörperventile |
| US6471255B1 (en) * | 2000-03-13 | 2002-10-29 | Richard L. Ulrich | Anti-rotation arrangement for a detection device assembly |
| DE10022729C2 (de) * | 2000-05-10 | 2003-06-18 | Danfoss As | Ventil,insbesondere Thermostatventil für Heizungsanlagen |
| US7163157B2 (en) * | 2003-12-02 | 2007-01-16 | Watts Regulator Co. | Automatic compensating valve for individual shower and tub/shower combination fixtures |
| DE102004004636B4 (de) * | 2004-01-29 | 2007-04-26 | Danfoss A/S | Thermostatventilaufsatz-Gehäuse |
| US7141784B2 (en) * | 2004-05-24 | 2006-11-28 | University Of Massachusetts | Multiplexed tandem mass spectrometry |
| US7772549B2 (en) | 2004-05-24 | 2010-08-10 | University Of Massachusetts | Multiplexed tandem mass spectrometry |
| DE102019128364A1 (de) * | 2019-10-21 | 2021-04-22 | Horcher Gmbh | Ventilanordnung |
| EP4036421B1 (en) * | 2021-01-28 | 2023-04-12 | Danfoss Power Solutions ApS | Pressure exchanger |
| FI4124802T3 (fi) * | 2021-07-30 | 2023-10-03 | Danfoss As | Termostaattiventtiilin kiinnike |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7208717U (de) * | 1972-06-29 | Gampper O | Thermostatisches Heizkörperventil | |
| DE2905307A1 (de) * | 1979-02-12 | 1980-08-21 | Heimeier Gmbh Metall Theodor | Thermostatkopf fuer heizungsventile |
| DE3215568A1 (de) * | 1982-04-26 | 1983-11-03 | Danfoss A/S, 6430 Nordborg | Aufsatz fuer thermostatventile |
| DE3236371A1 (de) * | 1982-10-01 | 1984-04-05 | Danfoss A/S, 6430 Nordborg | Thermostatventil |
| DE3236372C2 (de) * | 1982-10-01 | 1987-04-30 | Danfoss A/S, Nordborg | Thermostataufsatz für ein Ventil |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3351359A (en) * | 1964-12-23 | 1967-11-07 | Electrolux Corp | Adjustable length wand |
| DE1232378B (de) * | 1965-07-03 | 1967-01-12 | Vdo Schindling | Steckverbindung zwischen dem Anschlussstutzen eines Tachometers und der Endhuelse des Schutzschlauches der biegsamen Antriebswelle des Tachometers |
| CH439821A (de) * | 1965-08-25 | 1967-07-15 | Lins Albert | Heizkörperventil |
| US4089461A (en) * | 1976-07-06 | 1978-05-16 | Braukmann Armaturen A.G. | Thermostatic radiator valve |
| US4176786A (en) * | 1976-11-25 | 1979-12-04 | Braukmann Armaturen Ag | Concealed thermostatic control valve |
| DE2737083C2 (de) * | 1977-08-17 | 1985-10-10 | Honeywell-Braukmann GmbH, 6950 Mosbach | Heizkörperventil |
| GB8508757D0 (en) * | 1985-04-03 | 1985-05-09 | Robson A R | Pipe couplings |
| DE3543330C1 (de) * | 1985-12-07 | 1986-10-09 | Honeywell-Braukmann GmbH, 6950 Mosbach | Thermostatventil |
| JP6030873B2 (ja) | 2012-07-13 | 2016-11-24 | 株式会社熊谷組 | 杭基礎構造体 |
-
1990
- 1990-11-30 DE DE4038141A patent/DE4038141C1/de not_active Expired - Lifetime
-
1991
- 1991-10-08 CH CH2969/91A patent/CH685213A5/de not_active IP Right Cessation
- 1991-10-09 AT AT0200491A patent/AT399547B/de not_active IP Right Cessation
- 1991-10-10 CA CA002053156A patent/CA2053156C/en not_active Expired - Fee Related
- 1991-10-16 SE SE9103016A patent/SE502489C2/sv not_active IP Right Cessation
- 1991-10-23 DK DK176591A patent/DK176591A/da not_active Application Discontinuation
- 1991-11-25 US US07/796,864 patent/US5143286A/en not_active Expired - Fee Related
- 1991-11-27 JP JP3312714A patent/JPH07103944B2/ja not_active Expired - Lifetime
- 1991-11-28 GB GB9125333A patent/GB2251487B/en not_active Expired - Fee Related
- 1991-11-28 BE BE9101095A patent/BE1004261A3/fr not_active IP Right Cessation
- 1991-11-29 IT ITTO910931A patent/IT1250235B/it active IP Right Grant
- 1991-11-29 NL NL9102006A patent/NL192054C/nl not_active IP Right Cessation
- 1991-11-29 FR FR9114822A patent/FR2669988B1/fr not_active Expired - Fee Related
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7208717U (de) * | 1972-06-29 | Gampper O | Thermostatisches Heizkörperventil | |
| DE2905307A1 (de) * | 1979-02-12 | 1980-08-21 | Heimeier Gmbh Metall Theodor | Thermostatkopf fuer heizungsventile |
| DE3215568A1 (de) * | 1982-04-26 | 1983-11-03 | Danfoss A/S, 6430 Nordborg | Aufsatz fuer thermostatventile |
| DE3236371A1 (de) * | 1982-10-01 | 1984-04-05 | Danfoss A/S, 6430 Nordborg | Thermostatventil |
| DE3236372C2 (de) * | 1982-10-01 | 1987-04-30 | Danfoss A/S, Nordborg | Thermostataufsatz für ein Ventil |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1995026477A1 (en) * | 1994-03-25 | 1995-10-05 | Danfoss A/S | Valve, especially a thermostatic expansion valve |
| GB2301654A (en) * | 1994-03-25 | 1996-12-11 | Danfoss As | Valve, especially a thermostatic expansion valve |
| GB2301654B (en) * | 1994-03-25 | 1997-12-17 | Danfoss As | Valve, especially a thermostatic expansion valve |
| EP0683341A3 (de) * | 1994-05-19 | 1996-10-02 | Hansa Metallwerke Ag | Sanitärarmatur. |
| DE4419820A1 (de) * | 1994-06-07 | 1995-12-14 | Oventrop Sohn Kg F W | Thermostatventil |
| FR2757253A1 (fr) * | 1996-12-14 | 1998-06-19 | Neheim Goeke & Co Metall | Dispositif de reglage pour une soupape de radiateur |
| DE10108520B4 (de) * | 2001-02-22 | 2004-07-08 | Danfoss A/S | Heizungsventilaufsatz |
| EP3255351A1 (en) * | 2016-06-10 | 2017-12-13 | Danfoss A/S | Actuator attachment and method for demounting an actuator attachment |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1250235B (it) | 1995-04-03 |
| JPH04266677A (ja) | 1992-09-22 |
| ATA200491A (de) | 1994-10-15 |
| SE502489C2 (sv) | 1995-10-30 |
| CA2053156C (en) | 1996-04-02 |
| GB9125333D0 (en) | 1992-01-29 |
| NL192054C (nl) | 1997-01-07 |
| AT399547B (de) | 1995-05-26 |
| DK176591D0 (da) | 1991-10-23 |
| GB2251487B (en) | 1994-05-18 |
| BE1004261A3 (fr) | 1992-10-20 |
| SE9103016L (sv) | 1992-05-31 |
| NL9102006A (nl) | 1992-06-16 |
| US5143286A (en) | 1992-09-01 |
| NL192054B (nl) | 1996-09-02 |
| DK176591A (da) | 1992-05-31 |
| GB2251487A (en) | 1992-07-08 |
| CH685213A5 (de) | 1995-04-28 |
| ITTO910931A0 (it) | 1991-11-29 |
| JPH07103944B2 (ja) | 1995-11-08 |
| CA2053156A1 (en) | 1992-05-31 |
| FR2669988B1 (fr) | 1993-07-16 |
| FR2669988A1 (fr) | 1992-06-05 |
| ITTO910931A1 (it) | 1993-05-29 |
| SE9103016D0 (sv) | 1991-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4038141C1 (enExample) | ||
| DE1962186C3 (de) | Lösbare Sicherung für eine Schraubverbindung | |
| DE19647742C2 (de) | Einrichtungs-Anziehvorrichtung für unverlierbare Schrauben | |
| DE60011580T2 (de) | Befestigungsvorrichtung | |
| EP2880334B1 (de) | Ringmutter | |
| EP3256089B1 (de) | Spannklaue zur anbringung an einer gleitschiene eines operationstisches | |
| DE102018100054B4 (de) | Verriegelbarer Drehmomentschlüssel mit einem Hinweiston | |
| DE4318816C1 (de) | Sicherungseinrichtung für einen Thermostaten | |
| DE4344773A1 (de) | Thermostataufsatz für Heizkörperventile | |
| DE19544580C1 (de) | Lenkradbefestigung | |
| DE20221889U1 (de) | Zusammenklappbarer Schraubenschlüssel | |
| DE29511547U1 (de) | Vorrichtung zur axial unverschieblichen, lösbaren Befestigung einer Handhabe an einem Lagerteil, insbesondere für Türdrücker, Fenstergriffe o.dgl. | |
| DE202022100258U1 (de) | Schwenkbarer Hebepunkt zum Heben von Lasten | |
| EP1151448B1 (de) | Vorrichtung zum schalten einer elektrischen verbindung, insbesondere scharnierschalter | |
| DE3436710C2 (de) | Rohrschelle | |
| EP0955479B1 (de) | Vorrichtung zum Verbinden von Bauteilen | |
| DE102021127470B3 (de) | Anordnung zum Einstellen eines Drehmoments | |
| DE10161026A1 (de) | Selbstsicherndes Schraubelement | |
| EP4012200B1 (de) | Federbelasteter rastbolzen | |
| DE19612494C1 (de) | Ventil, insbesondere Einbauventil | |
| DE3219011C2 (enExample) | ||
| EP4370805A1 (de) | Steckbolzen zum befestigen an einer werkzeugkomponente von einem mehrteiligen, formgebenden werkzeug | |
| DE9300841U1 (de) | Sanitärarmatur | |
| EP3815843B1 (de) | Spannvorrichtung zum einspannen eines werkstücks | |
| DE69000526T2 (de) | Vorrichtungen zur fixierung eines elementes an einer perforierten, einseitig zugaenglichen unterlage. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8100 | Publication of patent without earlier publication of application | ||
| D1 | Grant (no unexamined application published) patent law 81 | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Representative=s name: PATENTANWAELTE KNOBLAUCH UND KNOBLAUCH, 60322 FRANK |
|
| 8339 | Ceased/non-payment of the annual fee |