DE3639752C2 - Verfahren zur Herstellung von amphoteren oberflächenaktiven Agentien - Google Patents
Verfahren zur Herstellung von amphoteren oberflächenaktiven AgentienInfo
- Publication number
- DE3639752C2 DE3639752C2 DE3639752A DE3639752A DE3639752C2 DE 3639752 C2 DE3639752 C2 DE 3639752C2 DE 3639752 A DE3639752 A DE 3639752A DE 3639752 A DE3639752 A DE 3639752A DE 3639752 C2 DE3639752 C2 DE 3639752C2
- Authority
- DE
- Germany
- Prior art keywords
- water
- alkylimidazoline
- salt
- reaction
- lower alcohol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000004094 surface-active agent Substances 0.000 title claims description 24
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 10
- 239000003513 alkali Substances 0.000 claims description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- 238000007142 ring opening reaction Methods 0.000 claims description 6
- 238000001914 filtration Methods 0.000 claims description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 235000019441 ethanol Nutrition 0.000 description 15
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 238000004458 analytical method Methods 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 229910017053 inorganic salt Inorganic materials 0.000 description 7
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- 239000002280 amphoteric surfactant Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 4
- 238000010612 desalination reaction Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000004811 liquid chromatography Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N 1-Pyrroline Chemical compound C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 2
- QNDGQRJVVZJMJO-UHFFFAOYSA-N 2-(2-undecyl-4,5-dihydroimidazol-1-yl)ethanol Chemical compound CCCCCCCCCCCC1=NCCN1CCO QNDGQRJVVZJMJO-UHFFFAOYSA-N 0.000 description 2
- PCCNVKYGJWWOEW-UHFFFAOYSA-N 2-aminoethyl(methyl)carbamic acid Chemical compound OC(=O)N(C)CCN PCCNVKYGJWWOEW-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001879 gelation Methods 0.000 description 2
- -1 halogen acetate Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- UPOFBZZSDRYRHB-UHFFFAOYSA-N 1-(2-heptadecyl-4,5-dihydroimidazol-1-yl)ethanol Chemical compound CCCCCCCCCCCCCCCCCC1=NCCN1C(C)O UPOFBZZSDRYRHB-UHFFFAOYSA-N 0.000 description 1
- NCVGSSQICKMAIA-UHFFFAOYSA-N 2-heptadecyl-4,5-dihydro-1h-imidazole Chemical compound CCCCCCCCCCCCCCCCCC1=NCCN1 NCVGSSQICKMAIA-UHFFFAOYSA-N 0.000 description 1
- WVNBMMKXLDHERT-UHFFFAOYSA-N 2-heptyl-4,5-dihydro-1h-imidazole Chemical compound CCCCCCCC1=NCCN1 WVNBMMKXLDHERT-UHFFFAOYSA-N 0.000 description 1
- FQHUDZKKDCTQET-UHFFFAOYSA-N 2-undecyl-4,5-dihydro-1h-imidazole Chemical compound CCCCCCCCCCCC1=NCCN1 FQHUDZKKDCTQET-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AEKNYBWUEYNWMJ-QWOOXDRHSA-N Pramiconazole Chemical compound O=C1N(C(C)C)CCN1C1=CC=C(N2CCN(CC2)C=2C=CC(OC[C@@H]3O[C@](CN4N=CN=C4)(CO3)C=3C(=CC(F)=CC=3)F)=CC=2)C=C1 AEKNYBWUEYNWMJ-QWOOXDRHSA-N 0.000 description 1
- 235000005505 Ziziphus oenoplia Nutrition 0.000 description 1
- 244000104547 Ziziphus oenoplia Species 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-M chloroacetate Chemical compound [O-]C(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-M 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- DESVYRJXTAYBFA-UHFFFAOYSA-N n-(2-aminoethyl)dodecanamide Chemical compound CCCCCCCCCCCC(=O)NCCN DESVYRJXTAYBFA-UHFFFAOYSA-N 0.000 description 1
- FZEIBCVEQZOUQH-UHFFFAOYSA-N n-(2-aminoethyl)octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCCN FZEIBCVEQZOUQH-UHFFFAOYSA-N 0.000 description 1
- JSCRBGDMRPOYAZ-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]dodecanamide Chemical compound CCCCCCCCCCCC(=O)NCCNCCO JSCRBGDMRPOYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- IZLFUDHPNDYYHS-UHFFFAOYSA-M potassium;2-bromoacetate Chemical compound [K+].[O-]C(=O)CBr IZLFUDHPNDYYHS-UHFFFAOYSA-M 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/17—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/35—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/36—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of an acyclic saturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP60264492A JPS62126157A (ja) | 1985-11-25 | 1985-11-25 | 両性界面活性剤の製造方法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3639752A1 DE3639752A1 (de) | 1987-05-27 |
| DE3639752C2 true DE3639752C2 (de) | 1995-08-24 |
Family
ID=17403988
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3639752A Expired - Fee Related DE3639752C2 (de) | 1985-11-25 | 1986-11-21 | Verfahren zur Herstellung von amphoteren oberflächenaktiven Agentien |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4705893A (enExample) |
| JP (1) | JPS62126157A (enExample) |
| DE (1) | DE3639752C2 (enExample) |
| ES (1) | ES2002661A6 (enExample) |
| PH (1) | PH21634A (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS63130129A (ja) * | 1986-11-18 | 1988-06-02 | Kao Corp | 界面活性剤の製造法 |
| US4876034A (en) * | 1986-11-18 | 1989-10-24 | Kao Corporation | Secondary amidoamino acid based detergent composition |
| US4908538A (en) * | 1989-02-28 | 1990-03-13 | Geberth John Daniel Jun | Totally enclosed electric motor |
| DE4240154A1 (de) * | 1992-11-30 | 1994-06-01 | Henkel Kgaa | Verfahren zur Herstellung dünnflüssiger, lagerstabiler Amphotenside |
| CA2132289A1 (en) * | 1993-10-12 | 1995-04-13 | Bharat Desai | Higher purity imidazoline based amphoacetate surfactants and processes for the preparation thereof |
| US5906972A (en) * | 1994-10-14 | 1999-05-25 | Rhodia Inc. | Liquid detergent composition |
| GB9423573D0 (en) * | 1994-11-22 | 1995-01-11 | Rhone Poulenc Chemicals | Process for the preparation of amphoacetate surfactants |
| US5614473A (en) * | 1995-05-22 | 1997-03-25 | Rhone-Poulenc Inc. | Use of high purity imidazoline based amphoacetate surfactant as foaming agent in oil wells |
| JPH0995473A (ja) * | 1995-09-29 | 1997-04-08 | Henkel Japan Kk | 低塩分含有ベタイン型両性界面活性剤の製造方法 |
| DE19715383A1 (de) * | 1997-04-14 | 1998-10-15 | Clariant Gmbh | Amphoglycinate als Korrosionsschutzmittel für Eisen- und Nichteisenmetalle |
| US6379578B1 (en) * | 1998-08-14 | 2002-04-30 | Gtl Co., Ltd. | Water-based foam fire extinguisher |
| WO2001010820A1 (en) * | 1999-08-09 | 2001-02-15 | Rhodia Inc. | Process for making salt-free amphoterics with high mono amphopropionate content |
| DE10153047A1 (de) * | 2001-10-26 | 2003-05-08 | Goldschmidt Ag Th | Wässriges tensidhaltiges Reinigungsmittel mit verbessertem Trocknungsverhalten für die Reinigung harter Oberflächen, insbesondere von Geschirr |
| US20090072182A1 (en) * | 2007-09-19 | 2009-03-19 | Baum's Flame Management, Llc | Fire fighting and cooling composition |
| US8551925B2 (en) * | 2007-11-15 | 2013-10-08 | Nalco Company | Imidazoline-based heterocyclic foamers for downhole injection |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4020155A (en) * | 1965-09-06 | 1977-04-26 | Societe Anonyme Dite: L'oreal | Surface active agents |
-
1985
- 1985-11-25 JP JP60264492A patent/JPS62126157A/ja active Granted
-
1986
- 1986-11-14 US US06/931,372 patent/US4705893A/en not_active Expired - Lifetime
- 1986-11-20 PH PH34502A patent/PH21634A/en unknown
- 1986-11-21 DE DE3639752A patent/DE3639752C2/de not_active Expired - Fee Related
- 1986-11-24 ES ES8603152A patent/ES2002661A6/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES2002661A6 (es) | 1988-09-16 |
| DE3639752A1 (de) | 1987-05-27 |
| PH21634A (en) | 1988-01-13 |
| US4705893A (en) | 1987-11-10 |
| JPH0327545B2 (enExample) | 1991-04-16 |
| JPS62126157A (ja) | 1987-06-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3639752C2 (de) | Verfahren zur Herstellung von amphoteren oberflächenaktiven Agentien | |
| DE3613944C1 (de) | Verfahren zur Herstellung einer hochkonzentrierten,fliess- und pumpfaehigen Betainloesung | |
| DE3826654C1 (enExample) | ||
| DE4211190A1 (de) | Verfahren zur Herstellung von wäßrigen Betainlösungen | |
| DE2835984A1 (de) | Oberflaechenaktiver stoff | |
| EP0671382B1 (de) | Fluorhaltige Carboxylbetaine und Alkylsulfobetaine sowie deren Mischungen mit gesättigten Fluoralkyaminen | |
| DE69006789T2 (de) | Verfahren zur Herstellung von sulfoalkyl-substituierten Hydroxylaminen. | |
| DE2752116A1 (de) | Disubstituiertes aliphatisches carbonsaeureamidamin, verfahren zu seiner herstellung und es enthaltende mittel | |
| EP0452349B1 (de) | Verfahren zur herstellung von amphoteren grenzflächenaktiven imidazolinderivaten | |
| DE1467827B2 (de) | Verwendung von Salzen aus einer sauren quaternären Verbindung und einer basischen Verbindung als gelartige Verdickungsmittel für wässerige Zubereitungen | |
| DE3917113C2 (enExample) | ||
| DE3051036C2 (enExample) | ||
| EP0739878B1 (de) | Verfahren zur Herstellung hochkonzentrierter fliessfähiger wässriger Lösungen von Betainen | |
| DE69320062T2 (de) | Alpha-amino-substituierte essigsäure-derivate, ihre salze und ihre verwendung in der kosmetik | |
| EP0040346B1 (de) | Verfahren zur Raffination des rohen Kondensationsproduktes aus Aminoalkylalkanolaminen und Fettsäuren sowie gewünschtenfalls zur anschliessenden Gewinnung von Amphotensiden mit erhöhter Lagerstabilität | |
| EP0229340B1 (de) | Verfahren zur Herstellung von flüssigen, hochkonzentrierten Aminoxiden | |
| DE824635C (de) | Verfahren zur Herstellung von N-Carboanhydriden | |
| DE1593222C3 (de) | Oberflächenaktive Verbindungen, Verfahren zu deren Herstellung sowie Haarpflegemittel, die diese Verbindungen enthalten | |
| DE908613C (de) | Verfahren zur Herstellung von in ª-Stellung durch Guanidin substituierten Fettsaeuren | |
| DE2251910A1 (de) | Verfahren zur herstellung von 3hydroxy-isoxazol-derivaten | |
| DE2236120C3 (de) | Verfahren zur Herstellung von Aminocarbonsäure-Alkalimetallsalzen aus Aminoalkoholen | |
| DE2304615C3 (de) | Verfahren zur Herstellung von reinem N-Isopropyl-α -chloracetanilid | |
| DE2414597A1 (de) | Verfahren zur herstellung von alkalidithioniten | |
| DE19909907A1 (de) | Verfahren zur Herstellung von N-Alkylpolyhydroxyalkylaminen aus Monoalkylamin und reduzierendem Zucker | |
| DE825548C (de) | Verfahren zur Herstellung von neuen diquartaeren Salzen von Pyrimidylaminocinnolinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |