DE3826654C1 - - Google Patents
Info
- Publication number
- DE3826654C1 DE3826654C1 DE3826654A DE3826654A DE3826654C1 DE 3826654 C1 DE3826654 C1 DE 3826654C1 DE 3826654 A DE3826654 A DE 3826654A DE 3826654 A DE3826654 A DE 3826654A DE 3826654 C1 DE3826654 C1 DE 3826654C1
- Authority
- DE
- Germany
- Prior art keywords
- solution
- betaine
- water
- aqueous
- fatty acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims description 120
- 239000000243 solution Substances 0.000 claims description 77
- 229960003237 betaine Drugs 0.000 claims description 60
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 39
- 239000000194 fatty acid Substances 0.000 claims description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 35
- 229930195729 fatty acid Natural products 0.000 claims description 35
- 150000004665 fatty acids Chemical class 0.000 claims description 30
- 239000002736 nonionic surfactant Substances 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 20
- 238000002360 preparation method Methods 0.000 claims description 19
- 239000007864 aqueous solution Substances 0.000 claims description 17
- 125000006353 oxyethylene group Chemical group 0.000 claims description 15
- 238000005956 quaternization reaction Methods 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 12
- 239000011541 reaction mixture Substances 0.000 claims description 12
- -1 polyoxyethylene Polymers 0.000 claims description 11
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 9
- 230000009969 flowable effect Effects 0.000 claims description 9
- 229920000056 polyoxyethylene ether Polymers 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 4
- 150000002191 fatty alcohols Chemical class 0.000 claims description 4
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 239000000600 sorbitol Substances 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical group 0.000 claims 1
- 238000010979 pH adjustment Methods 0.000 claims 1
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 22
- 235000013162 Cocos nucifera Nutrition 0.000 description 11
- 244000060011 Cocos nucifera Species 0.000 description 11
- 239000001103 potassium chloride Substances 0.000 description 10
- 235000011164 potassium chloride Nutrition 0.000 description 10
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 229920001213 Polysorbate 20 Polymers 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 4
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 4
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000004443 Ricinus communis Nutrition 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000002280 amphoteric surfactant Substances 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 238000001879 gelation Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 1
- DVEKCXOJTLDBFE-UHFFFAOYSA-N n-dodecyl-n,n-dimethylglycinate Chemical compound CCCCCCCCCCCC[N+](C)(C)CC([O-])=O DVEKCXOJTLDBFE-UHFFFAOYSA-N 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- GLDOVTGHNKAZLK-UHFFFAOYSA-N n-octadecyl alcohol Natural products CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 235000020354 squash Nutrition 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/35—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/36—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of an acyclic saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/04—Formation of amino groups in compounds containing carboxyl groups
- C07C227/06—Formation of amino groups in compounds containing carboxyl groups by addition or substitution reactions, without increasing the number of carbon atoms in the carbon skeleton of the acid
- C07C227/08—Formation of amino groups in compounds containing carboxyl groups by addition or substitution reactions, without increasing the number of carbon atoms in the carbon skeleton of the acid by reaction of ammonia or amines with acids containing functional groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/06—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton
- C07C229/10—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
- C07C229/12—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings to carbon atoms of acyclic carbon skeletons
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/12—Preparation of carboxylic acid amides by reactions not involving the formation of carboxamide groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Medicinal Preparation (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3826654A DE3826654C1 (enExample) | 1988-08-05 | 1988-08-05 | |
| EP89113570A EP0353580B1 (de) | 1988-08-05 | 1989-07-24 | Verfahren zur Herstellung von konzentrierten fliessfähigen wässrigen Lösungen von Betainen |
| ES89113570T ES2045290T3 (es) | 1988-08-05 | 1989-07-24 | Procedimiento para la preparacion de soluciones acuosas, concentradas y capaces de fluir. |
| DE89113570T DE58905750D1 (de) | 1988-08-05 | 1989-07-24 | Verfahren zur herstellung von konzentrierten fliessfaehigen waessrigen loesungen von betainen. |
| JP1201510A JP2523885B2 (ja) | 1988-08-05 | 1989-08-04 | 流動性ベタイン濃水溶液の製法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3826654A DE3826654C1 (enExample) | 1988-08-05 | 1988-08-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3826654C1 true DE3826654C1 (enExample) | 1991-01-31 |
Family
ID=6360312
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3826654A Expired - Lifetime DE3826654C1 (enExample) | 1988-08-05 | 1988-08-05 | |
| DE89113570T Expired - Lifetime DE58905750D1 (de) | 1988-08-05 | 1989-07-24 | Verfahren zur herstellung von konzentrierten fliessfaehigen waessrigen loesungen von betainen. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE89113570T Expired - Lifetime DE58905750D1 (de) | 1988-08-05 | 1989-07-24 | Verfahren zur herstellung von konzentrierten fliessfaehigen waessrigen loesungen von betainen. |
Country Status (4)
| Country | Link |
|---|---|
| EP (1) | EP0353580B1 (enExample) |
| JP (1) | JP2523885B2 (enExample) |
| DE (2) | DE3826654C1 (enExample) |
| ES (1) | ES2045290T3 (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4135115A1 (de) * | 1991-10-24 | 1993-04-29 | Trigon Chemie Gmbh | Kationaktive tenside |
| DE4207386C1 (enExample) * | 1992-03-09 | 1993-08-05 | Th. Goldschmidt Ag, 4300 Essen, De | |
| DE4408228A1 (de) * | 1994-03-11 | 1995-09-14 | Henkel Kgaa | Niedrigviskose wäßrige Konzentrate von Betaintensiden |
| DE19505196C1 (de) * | 1995-02-16 | 1996-05-02 | Henkel Kgaa | Niedrigviskose wäßrige Konzentrate von Betaintensiden |
| US7297675B2 (en) | 2004-11-17 | 2007-11-20 | Goldschmidt Gmbh | Process for the preparation of highly concentrated flowable aqueous solutions of betaines |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE9001862D0 (sv) * | 1990-05-23 | 1990-05-23 | Berol Nobel Ab | Nya kvaeveinnehaallande foereningar, foerfarande foer deras framstaellning samt anvaendning av foereningarna |
| DE69111082T2 (de) * | 1991-02-08 | 1995-11-02 | Albemare Corp | Verfahren zur Herstellung von festen Betainen. |
| DE4211190A1 (de) * | 1992-04-03 | 1993-10-07 | Hoechst Ag | Verfahren zur Herstellung von wäßrigen Betainlösungen |
| DE4305083A1 (de) * | 1993-02-19 | 1994-08-25 | Henkel Kgaa | Verfahren zur Herstellung wasserfreier Detergensgemische |
| DE4334467A1 (de) * | 1993-10-08 | 1995-04-13 | Rewo Chemische Werke Gmbh | Verfahren zur Herstellung hochkonzentrierter fließfähiger wäßriger Lösungen von Betainen |
| DE4337324C2 (de) * | 1993-11-02 | 1998-05-20 | Henkel Kgaa | Verfahren zur Herstellung von Detergensgemischen |
| DE4340423C1 (de) * | 1993-11-27 | 1995-07-13 | Henkel Kgaa | Niedrigviskose wäßrige Konzentrate von Betaintensiden |
| DE59305412D1 (de) * | 1993-12-02 | 1997-03-20 | Witco Surfactants Gmbh | Verfahren zur Herstellung hochkonzentrierter fliessfähiger wässriger Lösungen von Betainen |
| DE4408183C1 (de) * | 1994-03-11 | 1995-08-10 | Henkel Kgaa | Verfahren zur Herstellung von niedrigviskosen wäßrigen Konzentraten von Betaintensiden |
| DE4412481A1 (de) * | 1994-04-12 | 1995-10-19 | Witco Surfactants Gmbh | Verfahren zur Herstellung hochkonzentrierter fließfähiger wäßriger Lösungen von Betainen |
| DE4435495C2 (de) * | 1994-10-04 | 1997-08-14 | Henkel Kgaa | Pumpfähige wäßrige Tensidkonzentrate |
| US5792737A (en) * | 1994-11-07 | 1998-08-11 | Th. Goldschmidt Ag | Mild, aqueous, surfactant preparation for cosmetic purposes and as detergent |
| DE19515883A1 (de) * | 1995-04-29 | 1996-10-31 | Witco Surfactants Gmbh | Verfahren zur Herstellung hochkonzentrierter fließfähiger wäßriger Lösungen von Betainen |
| ES2126495B1 (es) | 1996-11-05 | 1999-12-01 | Kao Corp Sa | Composiciones acuosas concentradas de tensioactivos del tipo de las betainas y su procedimiento de obtencion. |
| FR2786781B1 (fr) * | 1998-12-07 | 2001-02-02 | Ceca Sa | Compositions hydroalcooliques concentrees fluides d'alkylamidopropylbetaines de coprah ou de palmiste hydrogene |
| DE10207924A1 (de) | 2002-02-23 | 2003-09-04 | Clariant Gmbh | Hochkonzentrierte wässrige Lösungen von Betainen oder Aminoxiden |
| EP3002275B1 (en) * | 2014-10-01 | 2021-07-14 | Hayat Kimya Sanayi Anonim Sirketi | Process for preparing a concentrated, non-gelling, aqueous solution of betaine |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4243549A (en) * | 1977-07-26 | 1981-01-06 | Albright & Wilson Ltd. | Concentrated aqueous surfactant compositions |
| DE3613944C1 (de) * | 1986-04-24 | 1987-08-13 | Goldschmidt Ag Th | Verfahren zur Herstellung einer hochkonzentrierten,fliess- und pumpfaehigen Betainloesung |
| DE3726322C1 (de) * | 1987-08-07 | 1988-12-08 | Goldschmidt Ag Th | Verfahren zur Herstellung konzentrierter fliessfaehiger waessriger Loesungen von Betainen |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3225074A (en) * | 1959-12-28 | 1965-12-21 | American Cyanamid Co | Betaines |
| DE2926479C2 (de) * | 1979-06-30 | 1981-10-08 | Th. Goldschmidt Ag, 4300 Essen | Verfahren zur Herstellung von Betainen |
-
1988
- 1988-08-05 DE DE3826654A patent/DE3826654C1/de not_active Expired - Lifetime
-
1989
- 1989-07-24 EP EP89113570A patent/EP0353580B1/de not_active Expired - Lifetime
- 1989-07-24 DE DE89113570T patent/DE58905750D1/de not_active Expired - Lifetime
- 1989-07-24 ES ES89113570T patent/ES2045290T3/es not_active Expired - Lifetime
- 1989-08-04 JP JP1201510A patent/JP2523885B2/ja not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4243549A (en) * | 1977-07-26 | 1981-01-06 | Albright & Wilson Ltd. | Concentrated aqueous surfactant compositions |
| DE3613944C1 (de) * | 1986-04-24 | 1987-08-13 | Goldschmidt Ag Th | Verfahren zur Herstellung einer hochkonzentrierten,fliess- und pumpfaehigen Betainloesung |
| DE3726322C1 (de) * | 1987-08-07 | 1988-12-08 | Goldschmidt Ag Th | Verfahren zur Herstellung konzentrierter fliessfaehiger waessriger Loesungen von Betainen |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4135115A1 (de) * | 1991-10-24 | 1993-04-29 | Trigon Chemie Gmbh | Kationaktive tenside |
| DE4207386C1 (enExample) * | 1992-03-09 | 1993-08-05 | Th. Goldschmidt Ag, 4300 Essen, De | |
| EP0560114A2 (de) | 1992-03-09 | 1993-09-15 | Th. Goldschmidt AG | Wässrige flüssige Lösung eines Betains mit mindestens 40 Gew.-% Festkörpergehalt |
| EP0560114A3 (en) * | 1992-03-09 | 1994-08-24 | Goldschmidt Ag Th | Betaine aqueous liquid solution with at least 40 weight-% of solid content |
| DE4408228A1 (de) * | 1994-03-11 | 1995-09-14 | Henkel Kgaa | Niedrigviskose wäßrige Konzentrate von Betaintensiden |
| DE19505196C1 (de) * | 1995-02-16 | 1996-05-02 | Henkel Kgaa | Niedrigviskose wäßrige Konzentrate von Betaintensiden |
| US7297675B2 (en) | 2004-11-17 | 2007-11-20 | Goldschmidt Gmbh | Process for the preparation of highly concentrated flowable aqueous solutions of betaines |
Also Published As
| Publication number | Publication date |
|---|---|
| ES2045290T3 (es) | 1994-01-16 |
| EP0353580A2 (de) | 1990-02-07 |
| EP0353580B1 (de) | 1993-09-29 |
| JP2523885B2 (ja) | 1996-08-14 |
| JPH0291050A (ja) | 1990-03-30 |
| DE58905750D1 (de) | 1993-11-04 |
| EP0353580A3 (de) | 1991-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3826654C1 (enExample) | ||
| EP0243619B1 (de) | Verfahren zur Herstellung einer hochkonzentrierten, fliess- und pumpfähigen Betainlösung | |
| EP0302329B1 (de) | Verfahren zur Herstellung konzentrierter fliessfähiger wässriger Lösungen von Betainen | |
| DE2941584C2 (enExample) | ||
| DE69516584T2 (de) | Verfahren zur Herstellung von Amidoethercarbonsäure oder deren Salz und diese enthaltende oberflächenaktive Mischung | |
| EP0671382B1 (de) | Fluorhaltige Carboxylbetaine und Alkylsulfobetaine sowie deren Mischungen mit gesättigten Fluoralkyaminen | |
| DE2752116C2 (de) | Salze von N-[N',N'-Bis(2-carboxyethyl)-aminoethyl]-N-(2-hydroxyethyl)-carbonsäureamiden, Verfahren zu ihrer Herstellung und ihre Verwendung als grenzflächenaktive Stoffe | |
| DE19607824A1 (de) | Niedrigschmelzende Esterquats | |
| EP0647613B1 (de) | Verfahren zur Herstellung hochkonzentrierter fliessfähiger wässriger Lösungen von Betainen | |
| EP0452349B1 (de) | Verfahren zur herstellung von amphoteren grenzflächenaktiven imidazolinderivaten | |
| EP0730572B1 (de) | Niedrigviskose wässrige konzentrate von betaintensiden | |
| EP0677509B1 (de) | Verfahren zur Herstellung hochkonzentrierter fliessfähiger wässriger Lösungen von Betainen | |
| EP0005446B1 (de) | Amphotere oberflächenaktive Aminoetherverbindungen und Verfahren zu ihrer Herstellung | |
| EP0749412B1 (de) | Niedrigviskose wässrige konzentrate von betaintensiden | |
| EP0739878B1 (de) | Verfahren zur Herstellung hochkonzentrierter fliessfähiger wässriger Lösungen von Betainen | |
| EP1033363A1 (de) | Verfahren zur Herstellung von Verdickungsmitteln auf Basis von Fettsäure-monoisopropanolamid, ihre Verwendung und diese enhaltende Zubereitungen | |
| EP0040346B1 (de) | Verfahren zur Raffination des rohen Kondensationsproduktes aus Aminoalkylalkanolaminen und Fettsäuren sowie gewünschtenfalls zur anschliessenden Gewinnung von Amphotensiden mit erhöhter Lagerstabilität | |
| DE1240872B (de) | Verfahren zur Herstellung wasserloeslicher, kapillaraktiver, als Wasch- und Reinigungsmittel und als Schaumstabilisatoren verwendbarer Ampholyte | |
| DE69314698T2 (de) | Verwendung eines Amids als Verdickungsmittel und dieses enthaltende Zusammensetzung | |
| DE1619182A1 (de) | Weichmacher fuer Textilstoffe | |
| DE69914228T2 (de) | Verfahren zur herstellung von salzfreien amphotheren mit hohem mono-amphopropionatgehalt | |
| AT266050B (de) | Cellulosedispersion | |
| DE3144342C2 (enExample) | ||
| DE19527630A1 (de) | Polyhydroxyalkylamidobetaine | |
| DE865454C (de) | Verfahren zur Herstellung von 1-Amino-2, 4, 4-trimethylpentan-2-ol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8100 | Publication of the examined application without publication of unexamined application | ||
| D1 | Grant (no unexamined application published) patent law 81 | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |