DE3623942A1 - Stabilisiertes, enzymhaltiges fluessiges waschmittel - Google Patents
Stabilisiertes, enzymhaltiges fluessiges waschmittelInfo
- Publication number
- DE3623942A1 DE3623942A1 DE3623942A DE3623942A DE3623942A1 DE 3623942 A1 DE3623942 A1 DE 3623942A1 DE 3623942 A DE3623942 A DE 3623942A DE 3623942 A DE3623942 A DE 3623942A DE 3623942 A1 DE3623942 A1 DE 3623942A1
- Authority
- DE
- Germany
- Prior art keywords
- weight
- detergent
- enzyme
- acid
- sodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000003599 detergent Substances 0.000 title claims description 54
- 239000007788 liquid Substances 0.000 title claims description 31
- 239000000203 mixture Substances 0.000 claims description 73
- 102000004190 Enzymes Human genes 0.000 claims description 47
- 108090000790 Enzymes Proteins 0.000 claims description 47
- 229940088598 enzyme Drugs 0.000 claims description 47
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 44
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 18
- 229910021538 borax Inorganic materials 0.000 claims description 17
- 239000004328 sodium tetraborate Substances 0.000 claims description 17
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 17
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- -1 alkali metal nitrilotriacetates Chemical class 0.000 claims description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 12
- 230000000087 stabilizing effect Effects 0.000 claims description 12
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- 229930182556 Polyacetal Natural products 0.000 claims description 9
- 150000007942 carboxylates Chemical class 0.000 claims description 9
- 229920006324 polyoxymethylene Polymers 0.000 claims description 9
- 239000004094 surface-active agent Substances 0.000 claims description 9
- 239000000654 additive Substances 0.000 claims description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 6
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000002304 perfume Substances 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 238000005406 washing Methods 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001639 boron compounds Chemical class 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000004753 textile Substances 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 3
- 239000004327 boric acid Substances 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- KRTNITDCKAVIFI-UHFFFAOYSA-N tridecyl benzenesulfonate Chemical compound CCCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 KRTNITDCKAVIFI-UHFFFAOYSA-N 0.000 claims description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 108090000637 alpha-Amylases Proteins 0.000 claims description 2
- 102000004139 alpha-Amylases Human genes 0.000 claims description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052810 boron oxide Inorganic materials 0.000 claims description 2
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000001630 malic acid Substances 0.000 claims description 2
- 235000011090 malic acid Nutrition 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- DUXXGJTXFHUORE-UHFFFAOYSA-M sodium;4-tridecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1 DUXXGJTXFHUORE-UHFFFAOYSA-M 0.000 claims description 2
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 claims 2
- 108091005658 Basic proteases Proteins 0.000 claims 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims 1
- 150000008041 alkali metal carbonates Chemical class 0.000 claims 1
- 150000004996 alkyl benzenes Chemical class 0.000 claims 1
- 229940077388 benzenesulfonate Drugs 0.000 claims 1
- 150000001642 boronic acid derivatives Chemical class 0.000 claims 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 claims 1
- 235000011187 glycerol Nutrition 0.000 description 16
- 230000000694 effects Effects 0.000 description 13
- 239000000047 product Substances 0.000 description 8
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- 108091005804 Peptidases Proteins 0.000 description 4
- 239000003945 anionic surfactant Substances 0.000 description 4
- 230000001976 improved effect Effects 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 108010003855 mesentericopeptidase Proteins 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 102000035195 Peptidases Human genes 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000010457 zeolite Substances 0.000 description 3
- YGUMVDWOQQJBGA-VAWYXSNFSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-VAWYXSNFSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 229940079919 digestives enzyme preparation Drugs 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- AEQDJSLRWYMAQI-UHFFFAOYSA-N 2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline Chemical compound C1CN2CC(C(=C(OC)C=C3)OC)=C3CC2C2=C1C=C(OC)C(OC)=C2 AEQDJSLRWYMAQI-UHFFFAOYSA-N 0.000 description 1
- HOZBSSWDEKVXNO-DKWTVANSSA-N 2-aminobutanedioic acid;(2s)-2-aminobutanedioic acid Chemical compound OC(=O)C(N)CC(O)=O.OC(=O)[C@@H](N)CC(O)=O HOZBSSWDEKVXNO-DKWTVANSSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229940024171 alpha-amylase Drugs 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- IRERQBUNZFJFGC-UHFFFAOYSA-L azure blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[S-]S[S-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] IRERQBUNZFJFGC-UHFFFAOYSA-L 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000019219 chocolate Nutrition 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- SKDZEPBJPGSFHS-UHFFFAOYSA-N n,n-bis(2-hydroxyethyl)tetradecanamide Chemical compound CCCCCCCCCCCCCC(=O)N(CCO)CCO SKDZEPBJPGSFHS-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000011083 sodium citrates Nutrition 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 239000000176 sodium gluconate Substances 0.000 description 1
- 235000012207 sodium gluconate Nutrition 0.000 description 1
- 229940005574 sodium gluconate Drugs 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000019794 sodium silicate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 108010075550 termamyl Proteins 0.000 description 1
- TUNFSRHWOTWDNC-HKGQFRNVSA-N tetradecanoic acid Chemical compound CCCCCCCCCCCCC[14C](O)=O TUNFSRHWOTWDNC-HKGQFRNVSA-N 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- 235000013799 ultramarine blue Nutrition 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D7/00—Compositions of detergents based essentially on non-surface-active compounds
- C11D7/02—Inorganic compounds
- C11D7/04—Water-soluble compounds
- C11D7/10—Salts
- C11D7/16—Phosphates including polyphosphates
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75952885A | 1985-07-26 | 1985-07-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3623942A1 true DE3623942A1 (de) | 1987-04-16 |
Family
ID=25055993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3623942A Ceased DE3623942A1 (de) | 1985-07-26 | 1986-07-16 | Stabilisiertes, enzymhaltiges fluessiges waschmittel |
Country Status (33)
| Country | Link |
|---|---|
| JP (1) | JPS6232194A (enExample) |
| KR (1) | KR940010119B1 (enExample) |
| AT (1) | ATA199186A (enExample) |
| AU (1) | AU590891B2 (enExample) |
| BE (1) | BE905168A (enExample) |
| BR (1) | BR8603478A (enExample) |
| CA (1) | CA1297441C (enExample) |
| CH (1) | CH669959A5 (enExample) |
| DE (1) | DE3623942A1 (enExample) |
| DK (1) | DK164745C (enExample) |
| EG (1) | EG18014A (enExample) |
| ES (1) | ES2001484A6 (enExample) |
| FR (1) | FR2585363B1 (enExample) |
| GB (1) | GB2178054B (enExample) |
| GR (1) | GR861946B (enExample) |
| HK (1) | HK1793A (enExample) |
| IL (1) | IL79451A0 (enExample) |
| IN (1) | IN170205B (enExample) |
| IT (1) | IT1195983B (enExample) |
| LU (1) | LU86525A1 (enExample) |
| MX (1) | MX163853B (enExample) |
| MY (1) | MY102909A (enExample) |
| NL (1) | NL8601926A (enExample) |
| NO (1) | NO166006C (enExample) |
| NZ (1) | NZ216791A (enExample) |
| PH (1) | PH21637A (enExample) |
| PT (1) | PT83024B (enExample) |
| SE (1) | SE467827B (enExample) |
| SG (1) | SG108592G (enExample) |
| TR (1) | TR24209A (enExample) |
| ZA (1) | ZA865096B (enExample) |
| ZM (1) | ZM8086A1 (enExample) |
| ZW (1) | ZW13286A1 (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ216792A (en) * | 1985-07-26 | 1989-04-26 | Colgate Palmolive Co | Stabilised,fabric-softening built detergent compositions containing enzymes and swelling bentonite clay |
| GB2200132B (en) * | 1986-12-15 | 1991-09-18 | Colgate Palmolive Co | Stabilised enzyme systems and compositions containing them |
| DE3704465C2 (de) * | 1987-02-13 | 1995-11-02 | Roehm Gmbh | Flüssig-Formulierungen von Enzymen |
| AU3667189A (en) * | 1988-06-23 | 1990-01-04 | Unilever Plc | Enzyme-containing liquid detergents |
| JP3058656B2 (ja) * | 1990-06-18 | 2000-07-04 | トーメー産業株式会社 | コンタクトレンズ用液剤組成物及びそれを用いたコンタクトレンズの洗浄若しくは保存方法 |
| EP0476726A1 (en) * | 1990-07-27 | 1992-03-25 | Unilever N.V. | Protease-containing liquid detergent compositions |
| DE4319578A1 (de) * | 1993-06-14 | 1994-12-15 | Henkel Kgaa | Waschmittel, enthaltend Aminosäuren und/oder deren Salze |
| US5672213A (en) * | 1995-08-18 | 1997-09-30 | Alcon Laboratories, Inc. | Liquid enzyme compositions containing aromatic acid derivatives |
| GB2367065B (en) * | 2000-09-20 | 2002-11-20 | Reckitt Benckiser Inc | Enzyme containing laundry booster compositions |
| KR20110100874A (ko) * | 2010-03-05 | 2011-09-15 | 박해성 | 보존성이 향상된 프로테아제 및 그 제조방법 |
| JP5950557B2 (ja) * | 2011-11-18 | 2016-07-13 | サラヤ株式会社 | 液体洗浄剤組成物 |
| DE102014224747A1 (de) * | 2014-12-03 | 2016-06-09 | Henkel Ag & Co. Kgaa | Enzymstabilisatoren |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0080223A2 (en) * | 1981-11-19 | 1983-06-01 | Unilever N.V. | Enzymatic liquid detergent composition |
| EP0080748A1 (en) * | 1981-11-13 | 1983-06-08 | Unilever N.V. | Enzymatic liquid cleaning composition |
| EP0126505A1 (en) * | 1983-04-26 | 1984-11-28 | Unilever N.V. | Aqueous enzyme-containing compositions with improved stability |
| EP0181041A2 (en) * | 1984-11-09 | 1986-05-14 | The Procter & Gamble Company | Ethanol-free liquid laundry detergent compositions |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI61715C (fi) * | 1976-11-01 | 1982-09-10 | Unilever Nv | Enzymer innehaollande stabiliserad flytande detergentkomposition |
| IT1129814B (it) * | 1980-07-02 | 1986-06-11 | Unilever Nv | Composizione detergente enzimatica liquida |
| AU547579B2 (en) * | 1981-11-13 | 1985-10-24 | Unilever Plc | Low foaming liquid detergent composition |
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
| GB8305790D0 (en) * | 1983-03-02 | 1983-04-07 | Unilever Plc | Liquid detergent composition |
| NZ208157A (en) * | 1983-05-31 | 1986-11-12 | Colgate Palmolive Co | Built single-phase liquid detergent compositions containing stabilised enzymes |
| US4507219A (en) * | 1983-08-12 | 1985-03-26 | The Proctor & Gamble Company | Stable liquid detergent compositions |
| DE3574729D1 (de) * | 1984-05-14 | 1990-01-18 | Procter & Gamble | Borsaeure enthaltende fluessige reinigungsmittel zur stabilisierung von enzymen. |
| NZ216792A (en) * | 1985-07-26 | 1989-04-26 | Colgate Palmolive Co | Stabilised,fabric-softening built detergent compositions containing enzymes and swelling bentonite clay |
-
1986
- 1986-07-08 NZ NZ216791A patent/NZ216791A/xx unknown
- 1986-07-08 SE SE8603037A patent/SE467827B/sv not_active IP Right Cessation
- 1986-07-08 ZA ZA865096A patent/ZA865096B/xx unknown
- 1986-07-10 IN IN609/DEL/86A patent/IN170205B/en unknown
- 1986-07-16 ZW ZW132/86A patent/ZW13286A1/xx unknown
- 1986-07-16 DE DE3623942A patent/DE3623942A1/de not_active Ceased
- 1986-07-16 ZM ZM80/86A patent/ZM8086A1/xx unknown
- 1986-07-17 IL IL79451A patent/IL79451A0/xx not_active IP Right Cessation
- 1986-07-17 CA CA000514036A patent/CA1297441C/en not_active Expired - Lifetime
- 1986-07-17 MX MX3178A patent/MX163853B/es unknown
- 1986-07-18 FR FR868610495A patent/FR2585363B1/fr not_active Expired - Lifetime
- 1986-07-21 PH PH34039A patent/PH21637A/en unknown
- 1986-07-21 PT PT83024A patent/PT83024B/pt unknown
- 1986-07-22 AU AU60414/86A patent/AU590891B2/en not_active Ceased
- 1986-07-22 TR TR86/0405A patent/TR24209A/xx unknown
- 1986-07-23 AT AT0199186A patent/ATA199186A/de not_active IP Right Cessation
- 1986-07-23 BR BR8603478A patent/BR8603478A/pt not_active IP Right Cessation
- 1986-07-24 GB GB8618042A patent/GB2178054B/en not_active Expired
- 1986-07-24 JP JP61174702A patent/JPS6232194A/ja active Pending
- 1986-07-24 ES ES8600599A patent/ES2001484A6/es not_active Expired
- 1986-07-24 DK DK352786A patent/DK164745C/da not_active IP Right Cessation
- 1986-07-24 GR GR861946A patent/GR861946B/el unknown
- 1986-07-25 NL NL8601926A patent/NL8601926A/nl not_active Application Discontinuation
- 1986-07-25 NO NO862997A patent/NO166006C/no unknown
- 1986-07-25 IT IT48309/86A patent/IT1195983B/it active
- 1986-07-25 CH CH3006/86A patent/CH669959A5/de not_active IP Right Cessation
- 1986-07-25 KR KR1019860006066A patent/KR940010119B1/ko not_active Expired - Lifetime
- 1986-07-25 LU LU86525A patent/LU86525A1/fr unknown
- 1986-07-25 BE BE0/216972A patent/BE905168A/fr not_active IP Right Cessation
- 1986-07-27 EG EG473/86A patent/EG18014A/xx active
-
1987
- 1987-09-28 MY MYPI87002056A patent/MY102909A/en unknown
-
1992
- 1992-10-14 SG SG1085/92A patent/SG108592G/en unknown
-
1993
- 1993-01-14 HK HK17/93A patent/HK1793A/xx unknown
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0080748A1 (en) * | 1981-11-13 | 1983-06-08 | Unilever N.V. | Enzymatic liquid cleaning composition |
| EP0080223A2 (en) * | 1981-11-19 | 1983-06-01 | Unilever N.V. | Enzymatic liquid detergent composition |
| EP0126505A1 (en) * | 1983-04-26 | 1984-11-28 | Unilever N.V. | Aqueous enzyme-containing compositions with improved stability |
| EP0181041A2 (en) * | 1984-11-09 | 1986-05-14 | The Procter & Gamble Company | Ethanol-free liquid laundry detergent compositions |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2215371C2 (de) | Waschmittel | |
| DE1964088C3 (de) | Stabilisierte wässerige Enzymmischung | |
| EP0697035B1 (de) | Silberkorrosionsschutzmittel i | |
| DE1808834C3 (de) | Stabilisiertes, wäßriges Präparat der Enzyme Protease, a -Amylase oder deren Gemische | |
| AT397810B (de) | Stabilisiertes, textilweichmachendes, flüssiges waschmittel | |
| DE2514676C2 (de) | Waschmittel | |
| EP1141212B1 (de) | Pastenförmiges waschmittel | |
| DE3704903A1 (de) | Waschmittelzusammensetzung zum reinigen und weichmachen von textilien | |
| DE3518100A1 (de) | Gewebeweichmachendes builderhaltiges waschmittel | |
| DE69809598T3 (de) | Waschmittelzusammensetzung und verfahren zum geschirrwaschen | |
| DE3623942A1 (de) | Stabilisiertes, enzymhaltiges fluessiges waschmittel | |
| DE69722353T2 (de) | Reinigungs-, Desinfektions- und Bleichmittelzusammensetzung | |
| DE2327234C3 (de) | Phosphatfreies Waschmittel | |
| DE3741617A1 (de) | Wasserhaltiges fluessiges geschirrwaschmittel | |
| DE2446619A1 (de) | Reinigungsmittelzusammensetzungen | |
| DE69121286T2 (de) | Phosphatfreies Waschmittel | |
| DE1767426A1 (de) | Antimikrobielle Wirkstoffe enthaltende Wasch-,Waschhilfs- und Reinigungsmittel | |
| DE3544762A1 (de) | Fluessiges vollwaschmittel | |
| EP0758678A2 (de) | Mittel zur Reinigung von Arbeitsschutzkleidung | |
| DE69902094T2 (de) | Chemische reinigungszusammensetzung | |
| DE2544242A1 (de) | Verfahren zum waschen von textilien, sowie mittel zur durchfuehrung des verfahrens | |
| DE69200612T2 (de) | Polyphosphonatkomplexbildner enthaltende flüssige, konzentrierte Waschmittelzusammensetzung. | |
| CH657146A5 (de) | Enzyme enthaltendes fluessiges wasch- und reinigungsmittel. | |
| DE4325922A1 (de) | Silberkorrosionsschutzmittel I | |
| DE3807921A1 (de) | Aktivator fuer anorganische perverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: STOLBERG-WERNIGERODE, GRAF ZU, U., DIPL.-CHEM. DR. |
|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |