DE3214247A1 - Verfahren zur herstellung von tetraalkyl- oder tetraalkoxyalkyl-silicaten - Google Patents
Verfahren zur herstellung von tetraalkyl- oder tetraalkoxyalkyl-silicatenInfo
- Publication number
- DE3214247A1 DE3214247A1 DE19823214247 DE3214247A DE3214247A1 DE 3214247 A1 DE3214247 A1 DE 3214247A1 DE 19823214247 DE19823214247 DE 19823214247 DE 3214247 A DE3214247 A DE 3214247A DE 3214247 A1 DE3214247 A1 DE 3214247A1
- Authority
- DE
- Germany
- Prior art keywords
- silicon
- cologne
- alkali metal
- ethanol
- silicates
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000004760 silicates Chemical class 0.000 title claims abstract description 12
- 238000004519 manufacturing process Methods 0.000 title 1
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 41
- 239000010703 silicon Substances 0.000 claims abstract description 41
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 22
- -1 alkali metal carboxylic acid salt Chemical class 0.000 claims abstract description 12
- 238000010438 heat treatment Methods 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 60
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 26
- 150000001340 alkali metals Chemical class 0.000 claims description 11
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical group CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical compound [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 claims description 6
- 229910000519 Ferrosilicon Inorganic materials 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 3
- 150000001734 carboxylic acid salts Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- LFQCEHFDDXELDD-UHFFFAOYSA-N tetramethyl orthosilicate Chemical compound CO[Si](OC)(OC)OC LFQCEHFDDXELDD-UHFFFAOYSA-N 0.000 claims 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 abstract description 40
- 229910000676 Si alloy Inorganic materials 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000000463 material Substances 0.000 description 14
- 239000007858 starting material Substances 0.000 description 12
- 150000001298 alcohols Chemical class 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000004280 Sodium formate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 4
- 235000019254 sodium formate Nutrition 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 229910021332 silicide Inorganic materials 0.000 description 2
- FVBUAEGBCNSCDD-UHFFFAOYSA-N silicide(4-) Chemical compound [Si-4] FVBUAEGBCNSCDD-UHFFFAOYSA-N 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- JXKPEJDQGNYQSM-UHFFFAOYSA-M sodium propionate Chemical compound [Na+].CCC([O-])=O JXKPEJDQGNYQSM-UHFFFAOYSA-M 0.000 description 1
- 239000004324 sodium propionate Substances 0.000 description 1
- 235000010334 sodium propionate Nutrition 0.000 description 1
- 229960003212 sodium propionate Drugs 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/04—Esters of silicic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/255,479 US4323690A (en) | 1981-04-20 | 1981-04-20 | Method of making silicate esters |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3214247A1 true DE3214247A1 (de) | 1982-11-11 |
| DE3214247C2 DE3214247C2 (OSRAM) | 1987-09-17 |
Family
ID=22968509
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823214247 Granted DE3214247A1 (de) | 1981-04-20 | 1982-04-17 | Verfahren zur herstellung von tetraalkyl- oder tetraalkoxyalkyl-silicaten |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4323690A (OSRAM) |
| EP (1) | EP0063492B1 (OSRAM) |
| JP (1) | JPS57183795A (OSRAM) |
| KR (1) | KR870000451B1 (OSRAM) |
| AT (1) | ATE8145T1 (OSRAM) |
| AU (1) | AU542412B2 (OSRAM) |
| BR (1) | BR8202289A (OSRAM) |
| CA (1) | CA1196339A (OSRAM) |
| DE (1) | DE3214247A1 (OSRAM) |
| DK (1) | DK173482A (OSRAM) |
| ES (1) | ES511508A0 (OSRAM) |
| GB (1) | GB2097010B (OSRAM) |
| IE (1) | IE52587B1 (OSRAM) |
| IL (1) | IL65469A (OSRAM) |
| NO (1) | NO821258L (OSRAM) |
| PT (1) | PT74742B (OSRAM) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4447632A (en) * | 1983-04-18 | 1984-05-08 | Union Carbide Corporation | Process for production of alkyl silicates from silicon metal |
| US4761492A (en) * | 1987-09-28 | 1988-08-02 | Union Carbide Corporation | Process for recovering trimethoxysilane from a trimethoxysilane and methanol mixture |
| US4762939A (en) * | 1987-09-30 | 1988-08-09 | Union Carbide Corporation | Process for trialkoxysilane/tetraalkoxysilane mixtures from silicon metal and alcohol |
| US4778910A (en) * | 1987-12-14 | 1988-10-18 | Lopata Research & Development Corporation | Method of making alkylalkoxysilanes |
| JP2848908B2 (ja) * | 1990-03-23 | 1999-01-20 | 多摩化学工業株式会社 | アルコキシシラン類の製造法 |
| US6090965A (en) * | 1998-04-02 | 2000-07-18 | Osi Specialties, Inc. | Removal of dissolved silicates from alcohol-silicon direct synthesis solvents |
| US6166237A (en) * | 1999-08-13 | 2000-12-26 | Crompton Corporation | Removal of dissolved silicates from alcohol-silicon direct synthesis solvents |
| US8153566B2 (en) * | 2008-09-30 | 2012-04-10 | Cherron Oronite Company LLC | Lubricating oil compositions |
| US8933001B2 (en) | 2010-03-31 | 2015-01-13 | Chevron Oronite Company Llc | Method for improving fluorocarbon elastomer seal compatibility |
| US8901050B2 (en) | 2010-03-31 | 2014-12-02 | Chevron Oronite Company Llc | Method for improving copper corrosion performance |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2473260A (en) * | 1946-06-26 | 1949-06-14 | Gen Electric | Preparation of tetramethyl silicate |
| GB913346A (en) * | 1960-06-01 | 1962-12-19 | Hygrotherm Eng Ltd | A method for the production of aryl silicates |
| DE1768339C3 (de) * | 1968-05-02 | 1974-07-04 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Orthokieselsäuretetramethylester |
| DE1793222A1 (de) * | 1968-08-17 | 1971-04-15 | Dynamit Nobel Ag | Verfahren zur Herstellung von Orthokieselsaeuretetraalkylestern |
| US3641077A (en) * | 1970-09-01 | 1972-02-08 | Eugene G Rochow | Method for preparing alkoxy derivatives of silicon germanium tin thallium and arsenic |
| US3803197A (en) * | 1971-05-04 | 1974-04-09 | Anderson Dev Co | Method of preparation of alkyl and 2-alkoxy-ethyl silicates |
| FR2318872A1 (fr) * | 1975-07-19 | 1977-02-18 | Dynamit Nobel Ag | Procede pou l'obtention d'esters alkyliques d'acide orthosilicique |
| US4185029A (en) * | 1975-07-19 | 1980-01-22 | Dynamit Nobel Aktiengesellschaft | Method of preparing orthosilicic acid alkyl esters |
| JPS5376891A (en) * | 1976-12-20 | 1978-07-07 | Oki Electric Ind Co Ltd | Measuring method of suspension contents |
| US4107140A (en) * | 1977-02-02 | 1978-08-15 | Blount David H | Production of the reaction products of oxidated silicon compounds reacting with organic monohydroxy compounds |
| JPS54149290A (en) * | 1978-05-15 | 1979-11-22 | Toyoda Chuo Kenkyusho Kk | Skin electric resistance reflection measuring device |
| US4211717A (en) * | 1979-03-23 | 1980-07-08 | Zirconal Processes Limited | Manufacture of alkyl silicates |
-
1981
- 1981-04-20 US US06/255,479 patent/US4323690A/en not_active Expired - Lifetime
-
1982
- 1982-02-23 GB GB8205237A patent/GB2097010B/en not_active Expired
- 1982-04-05 AU AU82327/82A patent/AU542412B2/en not_active Ceased
- 1982-04-12 IL IL65469A patent/IL65469A/xx unknown
- 1982-04-13 PT PT74742A patent/PT74742B/pt unknown
- 1982-04-17 DE DE19823214247 patent/DE3214247A1/de active Granted
- 1982-04-19 DK DK173482A patent/DK173482A/da active IP Right Grant
- 1982-04-19 JP JP57064084A patent/JPS57183795A/ja active Granted
- 1982-04-19 NO NO821258A patent/NO821258L/no unknown
- 1982-04-19 ES ES511508A patent/ES511508A0/es active Granted
- 1982-04-19 IE IE919/82A patent/IE52587B1/en unknown
- 1982-04-19 CA CA000401240A patent/CA1196339A/en not_active Expired
- 1982-04-19 EP EP82301997A patent/EP0063492B1/en not_active Expired
- 1982-04-19 AT AT82301997T patent/ATE8145T1/de not_active IP Right Cessation
- 1982-04-20 BR BR8202289A patent/BR8202289A/pt unknown
- 1982-04-21 KR KR8201753A patent/KR870000451B1/ko not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT * |
Also Published As
| Publication number | Publication date |
|---|---|
| AU8232782A (en) | 1982-10-28 |
| ES8303432A1 (es) | 1983-02-01 |
| ATE8145T1 (de) | 1984-07-15 |
| JPS57183795A (en) | 1982-11-12 |
| IE52587B1 (en) | 1987-12-23 |
| US4323690A (en) | 1982-04-06 |
| KR870000451B1 (ko) | 1987-03-11 |
| PT74742A (en) | 1982-05-01 |
| BR8202289A (pt) | 1983-04-05 |
| GB2097010A (en) | 1982-10-27 |
| IL65469A (en) | 1985-12-31 |
| GB2097010B (en) | 1984-05-10 |
| CA1196339A (en) | 1985-11-05 |
| KR830010122A (ko) | 1983-12-26 |
| ES511508A0 (es) | 1983-02-01 |
| EP0063492A1 (en) | 1982-10-27 |
| JPS6254428B2 (OSRAM) | 1987-11-14 |
| AU542412B2 (en) | 1985-02-21 |
| IE820919L (en) | 1982-10-20 |
| EP0063492B1 (en) | 1984-06-27 |
| IL65469A0 (en) | 1982-07-30 |
| NO821258L (no) | 1982-10-21 |
| PT74742B (en) | 1983-11-09 |
| DE3214247C2 (OSRAM) | 1987-09-17 |
| DK173482A (da) | 1982-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH398564A (de) | Verfahren zur Herstellung von Cyclohexanon | |
| EP1530560A1 (de) | Verfahren und vorrichtung zur herstellung von ameisensauren formiaten und deren verwendung | |
| DE3214247A1 (de) | Verfahren zur herstellung von tetraalkyl- oder tetraalkoxyalkyl-silicaten | |
| DE2653290C2 (de) | Beständige Lösung eines Gemisches von Aluminium-iso- und -n-butoxiden in den entsprechenden Alkoholen und Verfahren zu ihrer Herstellung | |
| DE3435299A1 (de) | Verfahren zur herstellung von 1,1,1,3,3,3-hexafluorpropan-2-ol durch hydrogenolyse von hexafluoracetonhydrat | |
| DE2824782A1 (de) | Verfahren zum gewinnen von glycidylmethacrylat oder glycidylacrylat | |
| DE888696C (de) | Verfahren zur Herstellung von Alkylbleiverbindungen | |
| DE2823309C2 (OSRAM) | ||
| DE2235992A1 (de) | Verfahren zur herstellung gesaettigter aliphatischer amine | |
| DE2211231C3 (de) | Verfahren zur Herstellung von Jodwasserstoff und/oder Alkyljodiden | |
| DE3872916T2 (de) | Herstellung und reinigung eines n,n-diethylaminophenols. | |
| EP1035917A1 (de) | Verfahren zur herstellung eines katalysators und nach diesem verfahren erhältliche katalysatoren | |
| EP0136549A1 (de) | Verfahren zur Herstellung von Alkylchloriden aus Alkohol-Ethergemischen, die bei der Celluloseveretherung entstehen | |
| DE68918951T2 (de) | Verfahren zur herstellung eines mit einer organischen gruppe substituierten natriumaluminiumhydrids. | |
| DE1543677A1 (de) | Verfahren zur Herstellung von primaeren Aminen | |
| AT160399B (de) | Verfahren zur Anlagerung von Kohlenoxyd an Alkohole, Ester, Äther, Olefine sowie an andere organische Verbindungen, die zu Alkoholen hydrolysierbar sind. | |
| EP0406714B1 (de) | Verfahren zur Herstellung von Carbonsäurechloriden | |
| DE1288595C2 (de) | Verfahren zur herstellung von gesaettigten und bzw./oder ungesaettigten aliphatischen aminen | |
| DE1144267B (de) | Verfahren zur Herstellung von Cyclohexanon | |
| DE1272919B (de) | Verfahren zur Herstellung von 4, 4'-Diamino-dicyclohexyl-alkanen | |
| DE1643499C3 (de) | Verfahren zur Reduktion von Nitrobenzoldicarbonsäure-(3,4) | |
| DE954238C (de) | Verfahren zur Herstellung von Fluoralkanen durch chemische Reduktion von Dichlordifluormethan | |
| DE895898C (de) | Verfahren zur Herstellung von ª‡-alkylsubstituierten Carbonsaeuren | |
| DE895597C (de) | Verfahren zur Herstellung von Vinylestern | |
| DE1916533C3 (de) | Verfahren zur Herstellung von Methyl-2,5-hexadienoat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |