DE2931926A1 - Dentalmassen - Google Patents
DentalmassenInfo
- Publication number
- DE2931926A1 DE2931926A1 DE19792931926 DE2931926A DE2931926A1 DE 2931926 A1 DE2931926 A1 DE 2931926A1 DE 19792931926 DE19792931926 DE 19792931926 DE 2931926 A DE2931926 A DE 2931926A DE 2931926 A1 DE2931926 A1 DE 2931926A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- paste
- bis
- monomer
- mpa
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 claims description 31
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical class CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 7
- 239000000945 filler Substances 0.000 claims description 3
- 239000000049 pigment Substances 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 60
- 239000000178 monomer Substances 0.000 description 54
- XDLMVUHYZWKMMD-UHFFFAOYSA-N 3-trimethoxysilylpropyl 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C(C)=C XDLMVUHYZWKMMD-UHFFFAOYSA-N 0.000 description 28
- 239000000047 product Substances 0.000 description 18
- 239000002241 glass-ceramic Substances 0.000 description 17
- 239000004342 Benzoyl peroxide Substances 0.000 description 16
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 16
- 229960003328 benzoyl peroxide Drugs 0.000 description 16
- 235000019400 benzoyl peroxide Nutrition 0.000 description 16
- 239000000377 silicon dioxide Substances 0.000 description 15
- 229910021485 fumed silica Inorganic materials 0.000 description 14
- 239000011034 rock crystal Substances 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- DXGLGDHPHMLXJC-UHFFFAOYSA-N oxybenzone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 DXGLGDHPHMLXJC-UHFFFAOYSA-N 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- AMFGWXWBFGVCKG-UHFFFAOYSA-N Panavia opaque Chemical compound C1=CC(OCC(O)COC(=O)C(=C)C)=CC=C1C(C)(C)C1=CC=C(OCC(O)COC(=O)C(C)=C)C=C1 AMFGWXWBFGVCKG-UHFFFAOYSA-N 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- MKARNSWMMBGSHX-UHFFFAOYSA-N 3,5-dimethylaniline Chemical compound CC1=CC(C)=CC(N)=C1 MKARNSWMMBGSHX-UHFFFAOYSA-N 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 7
- -1 ether alcohols Chemical class 0.000 description 7
- 238000011049 filling Methods 0.000 description 7
- 238000002156 mixing Methods 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 6
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 5
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical class C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 5
- 239000005548 dental material Substances 0.000 description 5
- 229910052746 lanthanum Inorganic materials 0.000 description 5
- 238000007127 saponification reaction Methods 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 4
- 239000002131 composite material Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- VZXPHDGHQXLXJC-UHFFFAOYSA-N 1,6-diisocyanato-5,6-dimethylheptane Chemical compound O=C=NC(C)(C)C(C)CCCCN=C=O VZXPHDGHQXLXJC-UHFFFAOYSA-N 0.000 description 3
- RWHRLPHEUBLJAI-UHFFFAOYSA-N 3-[n-(3-hydroxypropyl)-3,5-dimethylanilino]propan-1-ol Chemical compound CC1=CC(C)=CC(N(CCCO)CCCO)=C1 RWHRLPHEUBLJAI-UHFFFAOYSA-N 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 3
- 229960000907 methylthioninium chloride Drugs 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- KWVGIHKZDCUPEU-UHFFFAOYSA-N 2,2-dimethoxy-2-phenylacetophenone Chemical compound C=1C=CC=CC=1C(OC)(OC)C(=O)C1=CC=CC=C1 KWVGIHKZDCUPEU-UHFFFAOYSA-N 0.000 description 2
- YFICSDVNKFLZRQ-UHFFFAOYSA-N 3-trimethylsilylpropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCC[Si](C)(C)C YFICSDVNKFLZRQ-UHFFFAOYSA-N 0.000 description 2
- VVBLNCFGVYUYGU-UHFFFAOYSA-N 4,4'-Bis(dimethylamino)benzophenone Chemical compound C1=CC(N(C)C)=CC=C1C(=O)C1=CC=C(N(C)C)C=C1 VVBLNCFGVYUYGU-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 244000028419 Styrax benzoin Species 0.000 description 2
- 235000000126 Styrax benzoin Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000008411 Sumatra benzointree Nutrition 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 229960002130 benzoin Drugs 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- MHCLJIVVJQQNKQ-UHFFFAOYSA-N ethyl carbamate;2-methylprop-2-enoic acid Chemical compound CCOC(N)=O.CC(=C)C(O)=O MHCLJIVVJQQNKQ-UHFFFAOYSA-N 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- 235000019382 gum benzoic Nutrition 0.000 description 2
- 239000011256 inorganic filler Substances 0.000 description 2
- 229940038597 peroxide anti-acne preparations for topical use Drugs 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- JMYZLRSSLFFUQN-UHFFFAOYSA-N (2-chlorobenzoyl) 2-chlorobenzenecarboperoxoate Chemical compound ClC1=CC=CC=C1C(=O)OOC(=O)C1=CC=CC=C1Cl JMYZLRSSLFFUQN-UHFFFAOYSA-N 0.000 description 1
- JHPBZFOKBAGZBL-UHFFFAOYSA-N (3-hydroxy-2,2,4-trimethylpentyl) 2-methylprop-2-enoate Chemical compound CC(C)C(O)C(C)(C)COC(=O)C(C)=C JHPBZFOKBAGZBL-UHFFFAOYSA-N 0.000 description 1
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 description 1
- FFHGJCBXRQUCED-UHFFFAOYSA-N 1-methyl-2-(2-methylphenyl)peroxybenzene Chemical compound CC1=CC=CC=C1OOC1=CC=CC=C1C FFHGJCBXRQUCED-UHFFFAOYSA-N 0.000 description 1
- PIZHFBODNLEQBL-UHFFFAOYSA-N 2,2-diethoxy-1-phenylethanone Chemical compound CCOC(OCC)C(=O)C1=CC=CC=C1 PIZHFBODNLEQBL-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- 229910018068 Li 2 O Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 230000006750 UV protection Effects 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012766 organic filler Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007717 redox polymerization reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000003566 sealing material Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical class NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 150000003455 sulfinic acids Chemical class 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K6/00—Preparations for dentistry
- A61K6/80—Preparations for artificial teeth, for filling teeth or for capping teeth
- A61K6/884—Preparations for artificial teeth, for filling teeth or for capping teeth comprising natural or synthetic resins
- A61K6/887—Compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S528/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S528/92—Polymers useful for replacing hard animal tissues, e.g. dentures, bones
Landscapes
- Health & Medical Sciences (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Plastic & Reconstructive Surgery (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Dental Preparations (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792931926 DE2931926A1 (de) | 1979-08-07 | 1979-08-07 | Dentalmassen |
| EP80104404A EP0023685A3 (de) | 1979-08-07 | 1980-07-26 | Dentalmassen |
| US06/173,945 US4323348A (en) | 1979-08-07 | 1980-07-31 | Dental compositions |
| JP10684180A JPS5626809A (en) | 1979-08-07 | 1980-08-05 | Dental composition |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792931926 DE2931926A1 (de) | 1979-08-07 | 1979-08-07 | Dentalmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2931926A1 true DE2931926A1 (de) | 1981-02-26 |
Family
ID=6077800
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792931926 Withdrawn DE2931926A1 (de) | 1979-08-07 | 1979-08-07 | Dentalmassen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4323348A (enExample) |
| EP (1) | EP0023685A3 (enExample) |
| JP (1) | JPS5626809A (enExample) |
| DE (1) | DE2931926A1 (enExample) |
Cited By (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3301933A1 (de) * | 1983-01-21 | 1984-07-26 | Triumph-Adler Aktiengesellschaft für Büro- und Informationstechnik, 8500 Nürnberg | Vorrichtung zum farbbandhub und -transport in schreib- und aehnlichen maschinen |
| DE3441564A1 (de) * | 1984-11-14 | 1986-05-22 | Kulzer & Co GmbH, 6393 Wehrheim | Verfahren zum verkleben von adhaesivbruecken |
| EP0254185A1 (de) * | 1986-07-25 | 1988-01-27 | Bayer Ag | Urethangruppen enthaltende (Meth)-acrylsäurederivate von Tricyclo [5.2.1.02.6]decanen |
| US4744828A (en) * | 1985-06-20 | 1988-05-17 | Bayer Aktiengesellschaft | (Meth)-acrylic acid esters and the use thereof |
| US4744827A (en) * | 1985-06-20 | 1988-05-17 | Bayer Aktiengesellschaft | (Meth)-acrylic acid derivatives of tricyclodecanes and their use |
| DE4032505A1 (de) * | 1990-10-12 | 1991-08-14 | Thera Ges Fuer Patente | Verwendung von composite-fuellmaterialien zur befestigung von inlays, onlays, verblendschalen und dergleichen mittels hochfrequenter vibrationen |
| EP2236122A2 (de) | 2009-04-02 | 2010-10-06 | VOCO GmbH | Kunststoffmodifizierter Glasionomerzement |
| EP2374445A2 (de) | 2010-04-12 | 2011-10-12 | VOCO GmbH | Dualhärtende, mehrkomponentige dentale Zusammensetzung |
| EP2374444A2 (de) | 2010-04-12 | 2011-10-12 | VOCO GmbH | Dentale Abdeckmasse |
| DE102010003883A1 (de) | 2010-04-12 | 2011-10-13 | Voco Gmbh | Lichthärtbares Kompositmaterial |
| EP2436365A2 (de) | 2010-09-30 | 2012-04-04 | VOCO GmbH | Kompositmaterial umfassend ein Monomer mit einem polyalicyclischen Strukturelement |
| EP2436363A2 (de) | 2010-09-30 | 2012-04-04 | VOCO GmbH | Zusammensetzung umfassend ein Monomer mit einem polyalicyclischen Strukturelement zum Füllen und/oder Versiegeln eines Wurzelkanals |
| EP2716276A2 (de) | 2012-10-05 | 2014-04-09 | VOCO GmbH | Kit und Verfahren zur indirekten chairside Herstellung von Kompositinlays |
| EP3011949A1 (de) | 2014-10-23 | 2016-04-27 | VOCO GmbH | Härtbares dentalmaterial |
| EP3338756A1 (de) | 2016-12-21 | 2018-06-27 | VOCO GmbH | Lagerstabiler kunststoffmodifizierter glasionomerzement |
| DE102017105841A1 (de) | 2017-03-17 | 2018-09-20 | Voco Gmbh | Fräsrohling zur Herstellung einer indirekten dentalen Restauration, entsprechende Verwendungen und Verfahren |
| DE102018103415A1 (de) | 2018-02-15 | 2019-08-22 | Voco Gmbh | Dentale Formkörper mit kontinuierlichem Farbverlauf |
| DE102018114690A1 (de) | 2018-06-19 | 2019-12-19 | Voco Gmbh | Thermowirksame dentale Kompositzusammensetzung |
| EP3760181A1 (de) | 2017-02-15 | 2021-01-06 | VOCO GmbH | Dentaler kompositblock zur herstellung permanenter indirekter restaurationen im cad/cam verfahren |
| DE102021134260A1 (de) | 2021-12-22 | 2023-06-22 | Voco Gmbh | Dentale lichthärtbare Zusammensetzung sowie entsprechende Restaurationen, Herstellverfahren und Verwendungen |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2931925A1 (de) * | 1979-08-07 | 1981-02-26 | Bayer Ag | (meth)acrylsaeureester von ethergruppen enthaltenden tricyclischen decandiolen |
| US4400159A (en) * | 1980-06-24 | 1983-08-23 | Scientific Pharmaceuticals, Inc. | Adducts of 3-methacroyl-2-hydroxypropyl esters with diisocyanates |
| US4504231A (en) * | 1981-02-17 | 1985-03-12 | Dentsply Research & Development Corp. | Process for filling teeth |
| US4490115A (en) * | 1981-05-27 | 1984-12-25 | Scientific Pharmaceutical, Inc. | Dental material comprising adducts of 3-methacroyl-2-hydroxypropyl esters with diisocyanates |
| JPS6011410A (ja) * | 1983-06-30 | 1985-01-21 | Mitsubishi Rayon Co Ltd | 歯科用材料 |
| US4548689A (en) * | 1983-09-28 | 1985-10-22 | Mitsui Petrochemical Industries, Ltd. | Photocurable resin composition |
| USRE35135E (en) * | 1983-09-28 | 1995-12-26 | Mitsui Petrochemical Industries, Ltd. | Photocurable resin composition |
| US4551486A (en) * | 1983-11-16 | 1985-11-05 | Dentsply Research & Development Corp. | Interpenetrating polymer network compositions |
| US4711913A (en) * | 1983-11-16 | 1987-12-08 | Dentsply International Inc. | Interpenetrating polymer network compositions employing rubber-modified polymers |
| US5210109A (en) * | 1983-11-16 | 1993-05-11 | Dentsply Research & Development Corp. | Interpenetrating polymer network compositions employing rubber-modified polymers |
| US4863977A (en) * | 1983-11-16 | 1989-09-05 | Dentsply Research & Development Corp. | Process for preparing interpenetrating polymer network objects employing rubber-modified polymers |
| JPS61186304A (ja) * | 1985-02-12 | 1986-08-20 | Shiyoufuu:Kk | 歯科修復複合充填材料 |
| JPS61186303A (ja) * | 1985-02-12 | 1986-08-20 | Shiyoufuu:Kk | 歯科用接着剤組成物 |
| JPS62175412A (ja) * | 1986-01-29 | 1987-08-01 | Shiyoufuu:Kk | 歯科用修復材組成物 |
| DE3607331A1 (de) * | 1986-03-06 | 1987-09-10 | Espe Pharm Praep | (meth)acrylsaeureester und ihre verwendung zur herstellung von dentalmassen |
| JPS63230611A (ja) * | 1987-03-18 | 1988-09-27 | Lion Corp | 歯科用接着組成物 |
| JPH0374310A (ja) * | 1989-08-14 | 1991-03-28 | Mitsubishi Rayon Co Ltd | 歯科用接着剤組成物 |
| FR2687499B1 (fr) * | 1992-02-13 | 1994-04-15 | Elf Atochem Sa | Procede de conditionnement de resines echangeuses d'ions contaminees par des elements radioactifs. |
| US5362769A (en) * | 1992-05-07 | 1994-11-08 | Ormco Corporation | Orthodontic adhesives |
| DE4324431A1 (de) * | 1993-07-21 | 1995-01-26 | Bayer Ag | Acrylate und Methacrylate aus Basis von Cyclohexyldiphenolen |
| DE4426129A1 (de) * | 1994-07-22 | 1996-01-25 | Bayer Ag | Di(meth)acrylate mit cyclischen Carbonatgruppen |
| DE19608316C2 (de) * | 1996-02-22 | 2000-11-09 | Ivoclar Ag Schaan | Funktionalisierte bicyclische (Meth)acrylate, Verfahren zu deren Herstellung und deren Verwendung #### |
| US20030225182A1 (en) * | 2001-01-04 | 2003-12-04 | Dentsply Detrey Gmbh | Dental composition with improved light stability |
| US20040225029A1 (en) * | 2000-02-17 | 2004-11-11 | Uwe Walz | Dental composition with improved light stability |
| US8026295B2 (en) * | 2000-02-17 | 2011-09-27 | Dentsply International, Inc. | Dental composition with improved light stability |
| US20030069327A1 (en) * | 2001-08-09 | 2003-04-10 | Uwe Walz | Dental compostions comprising bisacrylamides and use thereof |
| US20040171716A1 (en) * | 2002-12-03 | 2004-09-02 | Uwe Walz | Dental compositions comprising bisacrylamides and use thereof |
| DE60120416T2 (de) | 2000-08-11 | 2006-12-14 | Dentsply International Inc. | Polyaminoester und ihre verwendung in dentalmassen |
| US20030045604A1 (en) * | 2001-08-13 | 2003-03-06 | Klee Joachim E. | Dental root canal filling cones |
| US20040209990A1 (en) * | 2003-04-15 | 2004-10-21 | Uwe Walz | Low shrinking polymerizable dental material |
| DE102004023071A1 (de) * | 2004-05-11 | 2005-12-08 | Basf Ag | Pumpbare Tricyclodecandimethylol enthaltende Zusammensetzung |
| ATE554740T1 (de) * | 2004-06-15 | 2012-05-15 | Dentsply Int Inc | Dentalzusammensetzungen mit geringer schwindung und geringer spannung |
| US20060287459A1 (en) * | 2004-06-15 | 2006-12-21 | Xiaoming Jin | Radical polymerizable macrocyclic resin compositions with low polymerization stress |
| US7749761B2 (en) * | 2005-09-29 | 2010-07-06 | Industrial Technology Research Institute | Hydrogel composition for cell culture apparatus |
| US8697769B2 (en) | 2010-09-30 | 2014-04-15 | Voco Gmbh | Lacquer composition comprising a monomer with a polyalicyclic structure element |
| JP5819415B2 (ja) * | 2011-05-16 | 2015-11-24 | 三井化学株式会社 | 新規な化合物、該化合物を含む組成物および硬化物 |
| EP2710994B1 (en) * | 2011-05-16 | 2018-08-01 | Mitsui Chemicals, Inc. | Dental material, dental material composition, dental repair material, and cured product |
| DE102012001978A1 (de) * | 2012-02-02 | 2013-08-08 | Voco Gmbh | Dentale Kompositmaterialien enthaltend tricyclische Weichmacher |
| JP7515361B2 (ja) * | 2020-09-30 | 2024-07-12 | 株式会社松風 | 医科歯科用低重合収縮性モノマーの合成・製造方法 |
| JP2022056984A (ja) * | 2020-09-30 | 2022-04-11 | 株式会社松風 | ラジカル重合性モノマーを溶媒とした医科歯科用低重合収縮性モノマーの合成・製造方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3066112A (en) * | 1959-01-30 | 1962-11-27 | Rafael L Bowen | Dental filling material comprising vinyl silane treated fused silica and a binder consisting of the reaction product of bis phenol and glycidyl acrylate |
| US3425988A (en) * | 1965-01-27 | 1969-02-04 | Loctite Corp | Polyurethane polyacrylate sealant compositions |
| US3759807A (en) * | 1969-01-28 | 1973-09-18 | Union Carbide Corp | Photopolymerization process using combination of organic carbonyls and amines |
| US3629187A (en) * | 1969-06-25 | 1971-12-21 | Dentsply Int Inc | Dental compositions containing adduct of 2 2' - propane bis 3-(4-phenoxy)-1 2-hydroxy propane - 1 - methacrylate and isocyanate |
| US3709866A (en) * | 1970-06-01 | 1973-01-09 | Dentsply Int Inc | Photopolymerizable dental products |
| US3815239A (en) * | 1972-01-13 | 1974-06-11 | H Lee | Method of filling and sealing developmental pit and fissures |
| US4089763A (en) * | 1973-04-24 | 1978-05-16 | Imperial Chemical Industries Limited | Method of repairing teeth using a composition which is curable by irradiation with visible light |
| US4017454A (en) * | 1973-09-21 | 1977-04-12 | Jenaer Glaswerk Schott & Gen. | Glass ceramic as filler in polymerizable dental filling compositions |
-
1979
- 1979-08-07 DE DE19792931926 patent/DE2931926A1/de not_active Withdrawn
-
1980
- 1980-07-26 EP EP80104404A patent/EP0023685A3/de not_active Withdrawn
- 1980-07-31 US US06/173,945 patent/US4323348A/en not_active Expired - Lifetime
- 1980-08-05 JP JP10684180A patent/JPS5626809A/ja active Granted
Cited By (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3301933A1 (de) * | 1983-01-21 | 1984-07-26 | Triumph-Adler Aktiengesellschaft für Büro- und Informationstechnik, 8500 Nürnberg | Vorrichtung zum farbbandhub und -transport in schreib- und aehnlichen maschinen |
| DE3441564A1 (de) * | 1984-11-14 | 1986-05-22 | Kulzer & Co GmbH, 6393 Wehrheim | Verfahren zum verkleben von adhaesivbruecken |
| US4744828A (en) * | 1985-06-20 | 1988-05-17 | Bayer Aktiengesellschaft | (Meth)-acrylic acid esters and the use thereof |
| US4744827A (en) * | 1985-06-20 | 1988-05-17 | Bayer Aktiengesellschaft | (Meth)-acrylic acid derivatives of tricyclodecanes and their use |
| EP0254185A1 (de) * | 1986-07-25 | 1988-01-27 | Bayer Ag | Urethangruppen enthaltende (Meth)-acrylsäurederivate von Tricyclo [5.2.1.02.6]decanen |
| DE4032505A1 (de) * | 1990-10-12 | 1991-08-14 | Thera Ges Fuer Patente | Verwendung von composite-fuellmaterialien zur befestigung von inlays, onlays, verblendschalen und dergleichen mittels hochfrequenter vibrationen |
| EP2236122A2 (de) | 2009-04-02 | 2010-10-06 | VOCO GmbH | Kunststoffmodifizierter Glasionomerzement |
| DE102009016025A1 (de) | 2009-04-02 | 2010-10-07 | Voco Gmbh | Kunststoffmodifizierter Glasionomerzement |
| EP2374445A2 (de) | 2010-04-12 | 2011-10-12 | VOCO GmbH | Dualhärtende, mehrkomponentige dentale Zusammensetzung |
| EP2374444A2 (de) | 2010-04-12 | 2011-10-12 | VOCO GmbH | Dentale Abdeckmasse |
| DE102010003884A1 (de) | 2010-04-12 | 2011-10-13 | Voco Gmbh | Dualhärtende, mehrkomponentige dentale Zusammensetzung |
| DE102010003883A1 (de) | 2010-04-12 | 2011-10-13 | Voco Gmbh | Lichthärtbares Kompositmaterial |
| DE102010003881A1 (de) | 2010-04-12 | 2011-10-13 | Voco Gmbh | Dentale Abdeckmasse |
| EP2436363A2 (de) | 2010-09-30 | 2012-04-04 | VOCO GmbH | Zusammensetzung umfassend ein Monomer mit einem polyalicyclischen Strukturelement zum Füllen und/oder Versiegeln eines Wurzelkanals |
| EP2436365A2 (de) | 2010-09-30 | 2012-04-04 | VOCO GmbH | Kompositmaterial umfassend ein Monomer mit einem polyalicyclischen Strukturelement |
| EP2716276A2 (de) | 2012-10-05 | 2014-04-09 | VOCO GmbH | Kit und Verfahren zur indirekten chairside Herstellung von Kompositinlays |
| DE102013008176A1 (de) | 2012-10-05 | 2014-04-10 | Voco Gmbh | Kit und Verfahren zur indirekten chairside Herstellung von Kompositinlays |
| US9833387B2 (en) | 2012-10-05 | 2017-12-05 | Voco Gmbh | Kit and method for indirect chairside production of composite inlays |
| EP3011949A1 (de) | 2014-10-23 | 2016-04-27 | VOCO GmbH | Härtbares dentalmaterial |
| DE102015220373A1 (de) | 2014-10-23 | 2016-04-28 | Voco Gmbh | Härtbares Dentalmaterial |
| EP3338756A1 (de) | 2016-12-21 | 2018-06-27 | VOCO GmbH | Lagerstabiler kunststoffmodifizierter glasionomerzement |
| EP3760181A1 (de) | 2017-02-15 | 2021-01-06 | VOCO GmbH | Dentaler kompositblock zur herstellung permanenter indirekter restaurationen im cad/cam verfahren |
| EP3685798A1 (de) | 2017-03-17 | 2020-07-29 | VOCO GmbH | Fräsrohling zur herstellung einer indirekten dentalen restauration, entsprechende verwendungen und verfahren |
| DE102017105841A1 (de) | 2017-03-17 | 2018-09-20 | Voco Gmbh | Fräsrohling zur Herstellung einer indirekten dentalen Restauration, entsprechende Verwendungen und Verfahren |
| DE102018103415A1 (de) | 2018-02-15 | 2019-08-22 | Voco Gmbh | Dentale Formkörper mit kontinuierlichem Farbverlauf |
| DE102018114690A1 (de) | 2018-06-19 | 2019-12-19 | Voco Gmbh | Thermowirksame dentale Kompositzusammensetzung |
| WO2019243339A1 (de) | 2018-06-19 | 2019-12-26 | Voco Gmbh | Thermowirksame dentale kompositzusammensetzung |
| EP4417180A2 (de) | 2018-06-19 | 2024-08-21 | VOCO GmbH | Thermowirksame dentale kompositzusammensetzung |
| DE102021134260A1 (de) | 2021-12-22 | 2023-06-22 | Voco Gmbh | Dentale lichthärtbare Zusammensetzung sowie entsprechende Restaurationen, Herstellverfahren und Verwendungen |
| EP4226907A2 (de) | 2021-12-22 | 2023-08-16 | VOCO GmbH | Dentale lichthärtbare zusammensetzung sowie entsprechende restaurationen, herstellverfahren und verwendungen |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5626809A (en) | 1981-03-16 |
| EP0023685A2 (de) | 1981-02-11 |
| US4323348A (en) | 1982-04-06 |
| EP0023685A3 (de) | 1981-09-02 |
| JPH0222043B2 (enExample) | 1990-05-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2931926A1 (de) | Dentalmassen | |
| DE3874835T2 (de) | Dentalklebstoffzusammensetzung. | |
| EP0235826B1 (de) | (Meth)acrylsäureester und ihre Verwendung zur Herstellung von Dentalmassen | |
| DE2816823C2 (de) | Verwendung von Diacrylsäure- oder Dimethacrylsäureester zur Herstellung von polymerisierbaren Dentalmassen | |
| DE3117006C2 (de) | Zahnreparaturmaterial | |
| DE2403211C3 (de) | Werkstoff für Dentalzwecke | |
| EP0325266B1 (de) | Dentalmassen | |
| DE3941629C2 (de) | Dentalglasionomerzementmasse | |
| DE69533844T2 (de) | Dentalmasse und Verfahren | |
| DE3783437T2 (de) | Heilmittel. | |
| DE2818068C2 (de) | Verwendung einer Phosphinsäureverbindung zur Herstellung eines Klebemittels zum Verkleben von Zähnen mit Zahnmaterialien | |
| DE68905532T2 (de) | Dentalklebstoffmischung. | |
| DE60201871T2 (de) | Dentalklebstoffzusammensetzung | |
| DE2432013A1 (de) | Zementmasse | |
| DE19609885C2 (de) | Prothesenbasis-Unterfütterungsharze | |
| DE3703120A1 (de) | Urethangruppen enthaltende (meth)-acrylsaeurederivate von tricyclo (5.2.1.0(pfeil hoch)2(pfeil hoch)(pfeil hoch).(pfeil hoch)(pfeil hoch)6(pfeil hoch))decanen | |
| DE69005686T2 (de) | Dentalklebstoffmischung. | |
| EP0238025A2 (de) | Röntgenopake polymerisierbare Dentalmassen | |
| EP0011735A2 (de) | Röntgenopake Dentalwerkstoffe auf Basis von organischen Kunststoffen in pastöser Form | |
| DE2357324A1 (de) | Dentalfuellmassen | |
| JP2004503477A (ja) | 低収縮重合性歯科材料 | |
| DE4412831C2 (de) | Künstlicher Zahn | |
| EP4346743A1 (de) | Monomermischung zur herstellung eines dentalmaterials | |
| EP0101807B1 (de) | Neue Tetra(meth)acrylsäureverbindungen und deren Verwendung | |
| DE2438411A1 (de) | 1,3-bis- eckige klammer auf 2,3-di(methacryloxy)-propoxy eckige klammer zu -benzol, verfahren zu dessen herstellung und diese verbindung enthaltende zementmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |