DE2923697A1 - Neue 1-pyrrol- und pyrrolidin-carbonsaeure-derivate und verfahren zu deren herstellung - Google Patents
Neue 1-pyrrol- und pyrrolidin-carbonsaeure-derivate und verfahren zu deren herstellungInfo
- Publication number
- DE2923697A1 DE2923697A1 DE19792923697 DE2923697A DE2923697A1 DE 2923697 A1 DE2923697 A1 DE 2923697A1 DE 19792923697 DE19792923697 DE 19792923697 DE 2923697 A DE2923697 A DE 2923697A DE 2923697 A1 DE2923697 A1 DE 2923697A1
- Authority
- DE
- Germany
- Prior art keywords
- oxo
- pyrrole
- ethyl
- group
- pyrrolidine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title description 10
- XINMORMWVLCCDK-UHFFFAOYSA-N carbonic acid;pyrrolidine Chemical class OC(O)=O.C1CCNC1 XINMORMWVLCCDK-UHFFFAOYSA-N 0.000 title 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 24
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 22
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000000243 solution Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 238000010992 reflux Methods 0.000 claims description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 5
- 239000007853 buffer solution Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 150000002081 enamines Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- FDDQRDMHICUGQC-UHFFFAOYSA-N pyrrole-1-carboxylic acid Chemical class OC(=O)N1C=CC=C1 FDDQRDMHICUGQC-UHFFFAOYSA-N 0.000 claims description 4
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical class OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 claims description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical group [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- YVHSJXQPSCUBBM-UHFFFAOYSA-N ethyl 3-oxo-4-(3-oxobutyl)pyrrolidine-1-carboxylate Chemical compound CCOC(=O)N1CC(CCC(C)=O)C(=O)C1 YVHSJXQPSCUBBM-UHFFFAOYSA-N 0.000 claims description 3
- LFSCJMYCDUTGLX-UHFFFAOYSA-N ethyl 3-oxo-4-(3-oxooctyl)pyrrolidine-1-carboxylate Chemical compound CCCCCC(=O)CCC1CN(C(=O)OCC)CC1=O LFSCJMYCDUTGLX-UHFFFAOYSA-N 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 239000001632 sodium acetate Substances 0.000 claims description 3
- 235000017281 sodium acetate Nutrition 0.000 claims description 3
- 239000008351 acetate buffer Substances 0.000 claims description 2
- MKJDTCRQHSIGKX-UHFFFAOYSA-N ethyl 3-oxo-2,4-bis(3-oxobutyl)pyrrolidine-1-carboxylate Chemical compound CCOC(=O)N1CC(CCC(C)=O)C(=O)C1CCC(C)=O MKJDTCRQHSIGKX-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- -1 alkyl 3-oxo-l-pyrrolidine carboxylate Chemical compound 0.000 description 6
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 238000000862 absorption spectrum Methods 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- KLTVSWGXIAYTHO-UHFFFAOYSA-N 1-Octen-3-one Chemical compound CCCCCC(=O)C=C KLTVSWGXIAYTHO-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- DQYGBMLEVQLDQC-UHFFFAOYSA-N ethyl 3-oxopyrrolidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)C1 DQYGBMLEVQLDQC-UHFFFAOYSA-N 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7817424A FR2428641A1 (fr) | 1978-06-12 | 1978-06-12 | Nouveaux derives d'acides pyrrole-1 et pyrrolidine-1 carboxyliques ainsi que leur procede de preparation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2923697A1 true DE2923697A1 (de) | 1979-12-20 |
Family
ID=9209345
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792923697 Ceased DE2923697A1 (de) | 1978-06-12 | 1979-06-12 | Neue 1-pyrrol- und pyrrolidin-carbonsaeure-derivate und verfahren zu deren herstellung |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4299768A (enExample) |
| JP (1) | JPS5540663A (enExample) |
| BE (1) | BE876786A (enExample) |
| CA (1) | CA1121823A (enExample) |
| CH (1) | CH640532A5 (enExample) |
| DD (1) | DD144262A5 (enExample) |
| DE (1) | DE2923697A1 (enExample) |
| DK (1) | DK241679A (enExample) |
| ES (1) | ES481486A1 (enExample) |
| FR (1) | FR2428641A1 (enExample) |
| GB (1) | GB2023585B (enExample) |
| HU (1) | HU180258B (enExample) |
| IT (1) | IT1121530B (enExample) |
| NL (1) | NL7904560A (enExample) |
| NO (1) | NO791937L (enExample) |
| PL (1) | PL118131B1 (enExample) |
| SE (1) | SE439161B (enExample) |
| SU (1) | SU843737A3 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4127796A1 (de) * | 1991-08-22 | 1993-02-25 | Iro Ab | Faden-fournisseur |
| CN103044418B (zh) * | 2011-10-14 | 2015-02-04 | 上海朴颐化学科技有限公司 | (s,s)-2,8-二氮杂双环[4,3,0]壬烷的不对称合成方法、相关原料及制备方法 |
| CN104277036B (zh) * | 2013-07-02 | 2016-12-28 | 上海朴颐化学科技有限公司 | 一种(4aS,7aS)‑八氢‑1H‑吡咯并[3,4‑b]吡啶的纯化方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3060194A (en) * | 1960-03-29 | 1962-10-23 | American Cyanamid Co | 4-cyano-3-oxo-pyrrolidine carboxylates |
-
1978
- 1978-06-12 FR FR7817424A patent/FR2428641A1/fr active Granted
-
1979
- 1979-05-30 IT IT23119/79A patent/IT1121530B/it active
- 1979-06-06 BE BE0/195583A patent/BE876786A/xx not_active IP Right Cessation
- 1979-06-07 GB GB7919834A patent/GB2023585B/en not_active Expired
- 1979-06-09 PL PL1979216217A patent/PL118131B1/pl unknown
- 1979-06-11 CH CH544779A patent/CH640532A5/fr not_active IP Right Cessation
- 1979-06-11 CA CA000329513A patent/CA1121823A/en not_active Expired
- 1979-06-11 SE SE7905060A patent/SE439161B/sv not_active IP Right Cessation
- 1979-06-11 US US06/047,585 patent/US4299768A/en not_active Expired - Lifetime
- 1979-06-11 NO NO791937A patent/NO791937L/no unknown
- 1979-06-11 HU HU79LA959A patent/HU180258B/hu unknown
- 1979-06-11 NL NL7904560A patent/NL7904560A/xx not_active Application Discontinuation
- 1979-06-11 DK DK241679A patent/DK241679A/da unknown
- 1979-06-12 SU SU792775352A patent/SU843737A3/ru active
- 1979-06-12 ES ES481486A patent/ES481486A1/es not_active Expired
- 1979-06-12 JP JP7453079A patent/JPS5540663A/ja active Granted
- 1979-06-12 DD DD79213563A patent/DD144262A5/de unknown
- 1979-06-12 DE DE19792923697 patent/DE2923697A1/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| SE7905060L (sv) | 1979-12-13 |
| PL216217A1 (enExample) | 1980-07-01 |
| ES481486A1 (es) | 1980-07-01 |
| JPS6340186B2 (enExample) | 1988-08-10 |
| DD144262A5 (de) | 1980-10-08 |
| IT1121530B (it) | 1986-04-02 |
| DK241679A (da) | 1979-12-13 |
| NL7904560A (nl) | 1979-12-14 |
| PL118131B1 (en) | 1981-09-30 |
| GB2023585B (en) | 1982-10-13 |
| HU180258B (en) | 1983-02-28 |
| FR2428641A1 (fr) | 1980-01-11 |
| IT7923119A0 (it) | 1979-05-30 |
| FR2428641B1 (enExample) | 1981-04-17 |
| JPS5540663A (en) | 1980-03-22 |
| SE439161B (sv) | 1985-06-03 |
| CH640532A5 (fr) | 1984-01-13 |
| GB2023585A (en) | 1980-01-03 |
| BE876786A (fr) | 1979-12-06 |
| NO791937L (no) | 1979-12-13 |
| CA1121823A (en) | 1982-04-13 |
| SU843737A3 (ru) | 1981-06-30 |
| US4299768A (en) | 1981-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2654796A1 (de) | Polyoxygenierte labdan-derivate | |
| DE2604119A1 (de) | Neue organische verbindungen und verfahren zu deren herstellung | |
| DE2132761A1 (de) | 2-AEthynylcyclopropanverbindungen und Verfahren zur Herstellung derselben | |
| DE2241012A1 (de) | Neue 3,1-benzoxazin-4-on-derivate und verfahren zur herstellung derselben | |
| DE2923697A1 (de) | Neue 1-pyrrol- und pyrrolidin-carbonsaeure-derivate und verfahren zu deren herstellung | |
| DE2852975C2 (de) | 5-Cyano-1-alkylpyrrol-2-essigsäure-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1567045A1 (de) | Parasitizides,insbesondere fungizides Mittel | |
| DD201792A5 (de) | Verfahren zur herstellung der 2,3,4,5-tetrahydro-1-benzoxepin-3,5-dion-derivate | |
| DE2558356A1 (de) | Dehydrobiotinverbindungen | |
| DE2653477A1 (de) | Spiro eckige klammer auf cyclopropan- 1,2'-indolin eckige klammer zu -3'-one | |
| DD209443A5 (de) | Verfahren zur herstellung von acylaminoderivaten von 1-(aryl- oder subst.-aryl)amino-1-thioalkancarboxysaeuren | |
| DE2534601A1 (de) | Verfahren zur herstellung von camptothecin-aehnlichen verbindungen | |
| DE3310174C2 (de) | Verfahren zur Herstellung von Hydroxyäthyltetrazolthiol | |
| DE2331044A1 (de) | Diphenylmethan-derivate und verfahren zu deren herstellung | |
| AT262268B (de) | Verfahren zur Herstellung von neuen 1-Phenyl-2-alkylcyclohexanolen | |
| DE2362877A1 (de) | 5,8-dihydro-5,8-methanonaphthaline mit kardiovaskulaerer wirkung | |
| DE2628469B2 (de) | Verfahren zur Herstellung von γ -Aminoalkoholen | |
| AT252899B (de) | Verfahren zur Herstellung von neuen 5-(3'-Aminopropyl)-5H-dibenzo-[a, d]-cycloheptenen bzw. den 10, 11-Dihydroderivaten derselben | |
| AT218509B (de) | Verfahren zur Herstellung von basisch substituierten Carbinolen, sowie von ihren sterisch einheitlichen Razematen und deren optisch aktiven Komponenten und/oder ihren Säureadditionssalzen | |
| DE2708184A1 (de) | Verfahren zur herstellung von alpha- ketocarbonsaeureamiden (a) | |
| AT211818B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| DE2443742A1 (de) | Cyclopenten-derivate und zwischenprodukte und verfahren zu ihrer herstellung | |
| DE2730269C2 (enExample) | ||
| AT368996B (de) | Verfahren zur herstellung von neuen hexahydro -gamma-carbolinverbindungen | |
| AT218506B (de) | Verfahren zur Herstellung von basisch substituierten Carbinolen, sowie von ihren sterisch einheitlichen Razematen und deren optisch aktiven Komponenten und/oder ihren Säureadditionssalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |