DE2903593C3 - Kobalt-dotierte ferrimagnetische Eisenoxide und Verfahren zu deren Herstellung - Google Patents
Kobalt-dotierte ferrimagnetische Eisenoxide und Verfahren zu deren HerstellungInfo
- Publication number
- DE2903593C3 DE2903593C3 DE2903593A DE2903593A DE2903593C3 DE 2903593 C3 DE2903593 C3 DE 2903593C3 DE 2903593 A DE2903593 A DE 2903593A DE 2903593 A DE2903593 A DE 2903593A DE 2903593 C3 DE2903593 C3 DE 2903593C3
- Authority
- DE
- Germany
- Prior art keywords
- cobalt
- content
- precipitation
- iron oxides
- iron
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 title claims description 47
- 235000013980 iron oxide Nutrition 0.000 title claims description 13
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 230000005293 ferrimagnetic effect Effects 0.000 title claims description 4
- 239000010941 cobalt Substances 0.000 claims description 28
- 229910017052 cobalt Inorganic materials 0.000 claims description 28
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 28
- 238000001556 precipitation Methods 0.000 claims description 17
- 230000005291 magnetic effect Effects 0.000 claims description 16
- 239000001034 iron oxide pigment Substances 0.000 claims description 11
- 229910002588 FeOOH Inorganic materials 0.000 claims description 10
- 239000000725 suspension Substances 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000011701 zinc Substances 0.000 claims description 6
- 229910052725 zinc Inorganic materials 0.000 claims description 6
- 229910001429 cobalt ion Inorganic materials 0.000 claims description 5
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 claims description 5
- 239000007789 gas Substances 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 238000005245 sintering Methods 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 2
- 229910052698 phosphorus Inorganic materials 0.000 claims 2
- 239000011574 phosphorus Substances 0.000 claims 2
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims 1
- MSNWSDPPULHLDL-UHFFFAOYSA-K ferric hydroxide Chemical compound [OH-].[OH-].[OH-].[Fe+3] MSNWSDPPULHLDL-UHFFFAOYSA-K 0.000 claims 1
- 150000002927 oxygen compounds Chemical class 0.000 claims 1
- 230000001681 protective effect Effects 0.000 claims 1
- 239000012266 salt solution Substances 0.000 claims 1
- 239000000049 pigment Substances 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- 230000005415 magnetization Effects 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000005496 tempering Methods 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- -1 Iron ions Chemical class 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- IEECXTSVVFWGSE-UHFFFAOYSA-M iron(3+);oxygen(2-);hydroxide Chemical compound [OH-].[O-2].[Fe+3] IEECXTSVVFWGSE-UHFFFAOYSA-M 0.000 description 2
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 2
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- NHUXFMNHQIITCP-UHFFFAOYSA-N 2-butoxyethyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCCOCCCC NHUXFMNHQIITCP-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 229940090961 chromium dioxide Drugs 0.000 description 1
- IAQWMWUKBQPOIY-UHFFFAOYSA-N chromium(4+);oxygen(2-) Chemical compound [O-2].[O-2].[Cr+4] IAQWMWUKBQPOIY-UHFFFAOYSA-N 0.000 description 1
- AYTAKQFHWFYBMA-UHFFFAOYSA-N chromium(IV) oxide Inorganic materials O=[Cr]=O AYTAKQFHWFYBMA-UHFFFAOYSA-N 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910000462 iron(III) oxide hydroxide Inorganic materials 0.000 description 1
- 229910021519 iron(III) oxide-hydroxide Inorganic materials 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000010405 reoxidation reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910052596 spinel Inorganic materials 0.000 description 1
- 239000011029 spinel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B5/00—Recording by magnetisation or demagnetisation of a record carrier; Reproducing by magnetic means; Record carriers therefor
- G11B5/62—Record carriers characterised by the selection of the material
- G11B5/68—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent
- G11B5/70—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent on a base layer
- G11B5/706—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent on a base layer characterised by the composition of the magnetic material
- G11B5/70626—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent on a base layer characterised by the composition of the magnetic material containing non-metallic substances
- G11B5/70642—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent on a base layer characterised by the composition of the magnetic material containing non-metallic substances iron oxides
- G11B5/70678—Ferrites
- G11B5/70684—Ferro-ferrioxydes
- G11B5/70694—Non-stoechiometric ferro-ferrioxydes, e.g. berthollide
Landscapes
- Hard Magnetic Materials (AREA)
- Compounds Of Iron (AREA)
- Paints Or Removers (AREA)
- Magnetic Record Carriers (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2903593A DE2903593C3 (de) | 1979-01-31 | 1979-01-31 | Kobalt-dotierte ferrimagnetische Eisenoxide und Verfahren zu deren Herstellung |
| US06/110,876 US4297395A (en) | 1979-01-31 | 1980-01-10 | Production of cobalt-doped ferrimagnetic iron oxides |
| EP80100264A EP0014363B1 (de) | 1979-01-31 | 1980-01-21 | Kobalt-dotierte ferrimagnetische Eisenoxide und Verfahren zu deren Herstellung |
| DE8080100264T DE3061081D1 (en) | 1979-01-31 | 1980-01-21 | Cobalt-doped ferrimagnetic iron oxides and process for producing them |
| PL1980221636A PL121668B1 (en) | 1979-01-31 | 1980-01-28 | Cobalt containing ferrimagnetic iron oxide pigments and method of making the samebal't,i sposob ikh poluchenija |
| JP841080A JPS55104922A (en) | 1979-01-31 | 1980-01-29 | Cobalt compounded ferrimagnetic iron oxide and its manufacture |
| JP61238208A JPS62183025A (ja) | 1979-01-31 | 1986-10-08 | 磁気的信号記録用テ−プ |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2903593A DE2903593C3 (de) | 1979-01-31 | 1979-01-31 | Kobalt-dotierte ferrimagnetische Eisenoxide und Verfahren zu deren Herstellung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2903593A1 DE2903593A1 (de) | 1980-08-07 |
| DE2903593B2 DE2903593B2 (de) | 1981-07-30 |
| DE2903593C3 true DE2903593C3 (de) | 1982-05-06 |
Family
ID=6061787
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2903593A Expired DE2903593C3 (de) | 1979-01-31 | 1979-01-31 | Kobalt-dotierte ferrimagnetische Eisenoxide und Verfahren zu deren Herstellung |
| DE8080100264T Expired DE3061081D1 (en) | 1979-01-31 | 1980-01-21 | Cobalt-doped ferrimagnetic iron oxides and process for producing them |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8080100264T Expired DE3061081D1 (en) | 1979-01-31 | 1980-01-21 | Cobalt-doped ferrimagnetic iron oxides and process for producing them |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4297395A (enExample) |
| EP (1) | EP0014363B1 (enExample) |
| JP (2) | JPS55104922A (enExample) |
| DE (2) | DE2903593C3 (enExample) |
| PL (1) | PL121668B1 (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57158015A (en) * | 1981-03-26 | 1982-09-29 | Tdk Corp | Magnetic recording medium |
| JPS5825202A (ja) * | 1981-07-21 | 1983-02-15 | Ishihara Sangyo Kaisha Ltd | 磁気記録材料用針状α−FeOOHの製造方法 |
| NL8204897A (nl) * | 1982-12-20 | 1984-07-16 | Philips Nv | Magneetkop met een kern van mn-zn-co-ferroferriet. |
| DE3413752A1 (de) * | 1984-04-12 | 1985-10-24 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung isotroper magnetischer, kobalthaltiger eisenoxide |
| DE3500471A1 (de) * | 1985-01-09 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von isometrischen magnetischen eisenoxidpigmenten |
| DE3500470A1 (de) * | 1985-01-09 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung heller farbreiner eisenoxidrotpigmente |
| DE3516885A1 (de) * | 1985-05-10 | 1986-11-13 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung nadelfoermiger, kobalthaltiger ferrimagnetischer eisenoxide |
| US4770951A (en) * | 1985-08-16 | 1988-09-13 | Graham Magnetics, Inc. | Magnetic flexible disks |
| JPS62108737A (ja) * | 1985-11-08 | 1987-05-20 | Fuji Photo Film Co Ltd | 強磁性酸化鉄粉末の製造方法 |
| DE3619746A1 (de) * | 1986-06-12 | 1987-12-17 | Basf Ag | Superparamagnetische feststoffteilchen |
| DE3631194A1 (de) * | 1986-09-13 | 1988-03-24 | Bayer Ag | Magnetische eisenoxidpigmente sowie verfahren zu ihrer herstellung |
| DE3631193A1 (de) * | 1986-09-13 | 1988-03-24 | Bayer Ag | Magnetische eisenoxidpigmente und verfahren zu ihrer herstellung |
| DE3910782C2 (de) * | 1988-12-24 | 2003-08-28 | Toda Kogyo Corp | Verfahren zur Herstellung von magnetischen Eisenoxiden und so erhaltene Pigmente |
| DE68923544T2 (de) * | 1988-12-29 | 1996-03-28 | Toda Kogyo Corp | Magnetische Eisenoxydteilchen und Verfahren zu ihrer Herstellung. |
| MY107614A (en) * | 1990-09-26 | 1996-05-15 | Ishihara Sangyo Kaisha | Acicular ferromagnetic iron oxide particles and process for producing the same |
| JP2974452B2 (ja) * | 1991-06-19 | 1999-11-10 | キヤノン株式会社 | 磁性トナー |
| DE4319572A1 (de) * | 1993-06-14 | 1994-12-15 | Toda Kogyo Corp | Co-haltige Eisenoxidpigmente, Verfahren zu ihrer Herstellung und diese enthaltende magnetische Medien |
| FR2714205A1 (fr) * | 1993-12-17 | 1995-06-23 | Atg Sa | Matériau composite pour l'enregistrement magnéto-optique, sa préparation et son utilisation. |
| CN114621298B (zh) * | 2022-03-25 | 2024-04-19 | 宿迁学院 | 具有高亚铁磁有序温度的钴有机膦酸化合物及其制备方法 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3573980A (en) * | 1968-02-19 | 1971-04-06 | Minnesota Mining & Mfg | Method of making magnetic particles and recording tape |
| GB1268458A (en) * | 1969-05-07 | 1972-03-29 | Ampex | Improvements in and relating to the preparation of cobalt doped gamma ferric oxide |
| BE790376A (fr) * | 1971-10-27 | 1973-02-15 | Ampex | Particules d'oxyde de fer magnétique dopé au cobalt |
| JPS4887397A (enExample) * | 1972-02-23 | 1973-11-16 | ||
| JPS5321119B2 (enExample) * | 1973-03-20 | 1978-06-30 | ||
| DE2243231C2 (de) * | 1972-09-01 | 1982-01-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Cobalt-dotiertem γ-Eisen(III)oxid |
| DE2254810C2 (de) * | 1972-11-09 | 1985-12-12 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Verbesserung der magnetischen Eigenschaften von Gamma-Eisen (III)oxiden |
| JPS5242363B2 (enExample) * | 1973-03-20 | 1977-10-24 | ||
| US3931025A (en) * | 1973-09-21 | 1976-01-06 | Bayer Aktiengesellschaft | Magnetic iron oxides with improved orientability and a process for their production |
| DE2352440C2 (de) * | 1973-10-19 | 1983-11-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von γ- Eisen(III)oxid |
| US4052326A (en) * | 1973-10-19 | 1977-10-04 | Basf Aktiengesellschaft | Manufacture of γ-iron(III) oxide |
| JPS5719049B2 (enExample) * | 1974-06-13 | 1982-04-20 | ||
| JPS604566B2 (ja) * | 1974-06-28 | 1985-02-05 | 富士写真フイルム株式会社 | 強磁性粉末及びこれを使用した磁気記録体の安定化方法 |
| DE2507420A1 (de) * | 1975-02-21 | 1976-08-26 | Bayer Ag | Remanenzstabilisierte hochkoerzitive cobalthaltige magnetische eisenoxide |
| JPS525497A (en) * | 1975-07-02 | 1977-01-17 | Fuji Photo Film Co Ltd | Ferromagnetic grit manufacturing process |
| AT345252B (de) * | 1975-10-31 | 1978-09-11 | Unibra Sa | Verfahren zur herstellung von magnetoxiden |
| JPS5319998A (en) * | 1976-08-09 | 1978-02-23 | Toda Kogyo Corp | Process for preparing cobalttdoped acicular magnetite particle having magnetic stability |
| DE2705967C2 (de) * | 1977-02-12 | 1990-01-04 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von nadelförmigem kobalthaltigem magnetischem Eisenoxid |
| JPS5413997A (en) * | 1977-07-04 | 1979-02-01 | Sony Corp | Magnetic recording medium and its manufacture |
| DE2801395C2 (de) * | 1978-01-13 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Thermisch stabilisiertes ferrimagnetisches Eisenoxid |
-
1979
- 1979-01-31 DE DE2903593A patent/DE2903593C3/de not_active Expired
-
1980
- 1980-01-10 US US06/110,876 patent/US4297395A/en not_active Expired - Lifetime
- 1980-01-21 EP EP80100264A patent/EP0014363B1/de not_active Expired
- 1980-01-21 DE DE8080100264T patent/DE3061081D1/de not_active Expired
- 1980-01-28 PL PL1980221636A patent/PL121668B1/pl unknown
- 1980-01-29 JP JP841080A patent/JPS55104922A/ja active Granted
-
1986
- 1986-10-08 JP JP61238208A patent/JPS62183025A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0014363B1 (de) | 1982-11-17 |
| JPS6320771B2 (enExample) | 1988-04-30 |
| JPS62183025A (ja) | 1987-08-11 |
| DE2903593A1 (de) | 1980-08-07 |
| PL121668B1 (en) | 1982-05-31 |
| JPS55104922A (en) | 1980-08-11 |
| PL221636A1 (enExample) | 1980-11-03 |
| DE3061081D1 (en) | 1982-12-23 |
| DE2903593B2 (de) | 1981-07-30 |
| US4297395A (en) | 1981-10-27 |
| JPH0247010B2 (enExample) | 1990-10-18 |
| EP0014363A1 (de) | 1980-08-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2903593C3 (de) | Kobalt-dotierte ferrimagnetische Eisenoxide und Verfahren zu deren Herstellung | |
| EP0004652B2 (de) | Verfahren zur Herstellung von Eisenoxiden zur magnetischen Signalaufzeichnung | |
| DE2243231C2 (de) | Verfahren zur Herstellung von Cobalt-dotiertem γ-Eisen(III)oxid | |
| DE69310223T2 (de) | Magnetische Eisenoxidteilchen, Verfahren zur Herstellung und magnetischer Aufnahmeträger | |
| DE2254810C2 (de) | Verfahren zur Verbesserung der magnetischen Eigenschaften von Gamma-Eisen (III)oxiden | |
| EP0014902A1 (de) | Verfahren zur Herstellung von nadelförmigem kobalthaltigem magnetischem Eisenoxid | |
| EP0003100B1 (de) | Ferrimagnetisches Eisenoxid und Verfahren zu dessen Herstellung | |
| DE2920733C2 (enExample) | ||
| DE3516884A1 (de) | Verfahren zur herstellung nadelfoermiger, im wesentlichen aus eisen bestehender ferromagnetischer metallteilchen | |
| DE2943017A1 (de) | Verbessertes, mit kobalt modifiziertes magnetisches eisenoxid | |
| DE2550308C3 (de) | Verfahren zur Herstellung von nadeiförmigem a-Eisen(III)-Oxidhydrat | |
| DE2550225C3 (de) | Verfahren zur Herstellung von nadeiförmigem Y-Eisen(IID-oxid | |
| DE2507420A1 (de) | Remanenzstabilisierte hochkoerzitive cobalthaltige magnetische eisenoxide | |
| EP0200992B1 (de) | Verfahren zur Herstellung isometrischer kobalt- und titanhaltiger magnetischer Eisenoxide | |
| EP0201822B1 (de) | Verfahren zur Herstellung nadelförmiger, kobalthaltiger ferrimagnetischer Eisenoxide | |
| DE3941578A1 (de) | Verfahren zur herstellung von stabilisiertem chromdioxid und magnetischer aufzeichnungstraeger enthaltend dieses material | |
| EP0387629B1 (de) | Co-haltige magnetische Pigmente, Verfahren zu ihrer Herstellung sowie deren Verwendung | |
| DE2221264C3 (de) | Cobalt- und siliciumoxidhaltige nadeiförmige ferrimagnetische Eisenoxide | |
| DE2221218C3 (de) | Verfahren zur Herstellung cobalthaltiger nadeiförmiger ferrimagnetischer Eisenoxide mit verringertem Remanenzverlust bei thermischer Belastung | |
| DE3627133A1 (de) | Verfahren zur herstellung von nadelfoermigem, ferrimagnetischem eisenoxid | |
| DE2347486C3 (de) | Magnetische Eisenoxid-Pigmente mit verbesserter Ausrichtbarkeit und Verfahren zu ihrer Herstellung | |
| EP0198436B1 (de) | Verfahren zur Herstellung isotroper magnetischer, kobalthaltiger Eisenoxide aus Eisen(III)-Salzen | |
| DE3732526A1 (de) | Verfahren zur herstellung von nadelfoermigem (alpha)-eisen(iii)oxidhydroxid | |
| DE2221218B2 (de) | Verfahren zur Herstellung cobalthaltiger nadeiförmiger ferrimagnetischer Eisenoxide mit verringertem Remanenzverlust bei thermischer Belastung | |
| DE2221264B2 (de) | Cobalt- und siliciumoxidhaltige nadelfoermige ferrimagnetische eisenoxide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8330 | Complete disclaimer |