DE2745178B2 - Wandelement und Verfahren zu seiner Herstellung - Google Patents
Wandelement und Verfahren zu seiner HerstellungInfo
- Publication number
- DE2745178B2 DE2745178B2 DE2745178A DE2745178A DE2745178B2 DE 2745178 B2 DE2745178 B2 DE 2745178B2 DE 2745178 A DE2745178 A DE 2745178A DE 2745178 A DE2745178 A DE 2745178A DE 2745178 B2 DE2745178 B2 DE 2745178B2
- Authority
- DE
- Germany
- Prior art keywords
- wall element
- rubber
- element according
- elastic material
- sintered bodies
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 238000000034 method Methods 0.000 title claims description 5
- 239000000463 material Substances 0.000 claims description 51
- 239000013013 elastic material Substances 0.000 claims description 30
- 229910000831 Steel Inorganic materials 0.000 claims description 14
- 239000010959 steel Substances 0.000 claims description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 13
- 239000000654 additive Substances 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- 239000002131 composite material Substances 0.000 claims description 7
- 229920001971 elastomer Polymers 0.000 claims description 7
- 239000010425 asbestos Substances 0.000 claims description 6
- 239000013536 elastomeric material Substances 0.000 claims description 6
- 229910052895 riebeckite Inorganic materials 0.000 claims description 6
- 239000005060 rubber Substances 0.000 claims description 6
- 239000000377 silicon dioxide Substances 0.000 claims description 6
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 5
- 150000004760 silicates Chemical class 0.000 claims description 5
- 239000003365 glass fiber Substances 0.000 claims description 4
- 229920003052 natural elastomer Polymers 0.000 claims description 4
- 229920001194 natural rubber Polymers 0.000 claims description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 3
- 244000043261 Hevea brasiliensis Species 0.000 claims description 3
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 claims description 3
- 239000004744 fabric Substances 0.000 claims description 3
- 239000003063 flame retardant Substances 0.000 claims description 3
- 229910001679 gibbsite Inorganic materials 0.000 claims description 3
- 239000000779 smoke Substances 0.000 claims description 3
- 229920001169 thermoplastic Polymers 0.000 claims description 3
- 239000004416 thermosoftening plastic Substances 0.000 claims description 3
- CWBIFDGMOSWLRQ-UHFFFAOYSA-N trimagnesium;hydroxy(trioxido)silane;hydrate Chemical compound O.[Mg+2].[Mg+2].[Mg+2].O[Si]([O-])([O-])[O-].O[Si]([O-])([O-])[O-] CWBIFDGMOSWLRQ-UHFFFAOYSA-N 0.000 claims description 3
- 239000004115 Sodium Silicate Substances 0.000 claims description 2
- 239000003822 epoxy resin Substances 0.000 claims description 2
- 238000005187 foaming Methods 0.000 claims description 2
- 239000006259 organic additive Substances 0.000 claims description 2
- 229920000647 polyepoxide Polymers 0.000 claims description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 2
- 239000000155 melt Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 238000010276 construction Methods 0.000 description 3
- 238000005520 cutting process Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 2
- 238000005553 drilling Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 239000011224 oxide ceramic Substances 0.000 description 2
- 229910052574 oxide ceramic Inorganic materials 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 229920001084 poly(chloroprene) Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- 229910052580 B4C Inorganic materials 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- INAHAJYZKVIDIZ-UHFFFAOYSA-N boron carbide Chemical compound B12B3B4C32B41 INAHAJYZKVIDIZ-UHFFFAOYSA-N 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000000374 eutectic mixture Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E05—LOCKS; KEYS; WINDOW OR DOOR FITTINGS; SAFES
- E05G—SAFES OR STRONG-ROOMS FOR VALUABLES; BANK PROTECTION DEVICES; SAFETY TRANSACTION PARTITIONS
- E05G1/00—Safes or strong-rooms for valuables
- E05G1/02—Details
- E05G1/024—Wall or panel structure
Landscapes
- Laminated Bodies (AREA)
- Finishing Walls (AREA)
- Building Environments (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB42123/76A GB1513609A (en) | 1976-10-11 | 1976-10-11 | Wall element for safes and the like |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2745178A1 DE2745178A1 (de) | 1978-04-20 |
| DE2745178B2 true DE2745178B2 (de) | 1979-11-22 |
| DE2745178C3 DE2745178C3 (enExample) | 1985-01-03 |
Family
ID=10422962
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2745178A Granted DE2745178B2 (de) | 1976-10-11 | 1977-10-07 | Wandelement und Verfahren zu seiner Herstellung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4158338A (enExample) |
| AT (1) | AT372745B (enExample) |
| BE (1) | BE859528A (enExample) |
| CH (1) | CH624175A5 (enExample) |
| DE (1) | DE2745178B2 (enExample) |
| FR (1) | FR2367177A1 (enExample) |
| GB (1) | GB1513609A (enExample) |
| IT (1) | IT1143858B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3400818A1 (de) * | 1984-01-12 | 1985-07-18 | Bode-Panzer Ag, 3000 Hannover | Bautafel zur sicherung von bankraeumen oder dergleichen |
| EP0187499A3 (en) * | 1985-01-10 | 1987-05-20 | Micropore International Limited | Fire-resistant container |
| WO1993023648A1 (en) * | 1992-05-10 | 1993-11-25 | Kjell Lindskog | Laminate and use of the same |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH642592A5 (de) * | 1978-08-31 | 1984-04-30 | Alusuisse | Verbundplatte mit zwei deckschichten und einem kern. |
| US4388874A (en) * | 1980-11-26 | 1983-06-21 | Stone Frank K | Prefabricated concrete vault |
| FR2539800A1 (fr) * | 1983-01-26 | 1984-07-27 | Bordier Sa | Paroi d'enceinte de securite, et enceinte correspondante |
| DE3608863A1 (de) * | 1986-03-17 | 1987-09-24 | Bernd Poley | Ertuechtigung von ein zu schuetzendes objekt umgebenden waenden und tueren |
| GB8626700D0 (en) * | 1986-11-07 | 1986-12-10 | Chubb & Sons Lock & Safe Co | Security receptacles |
| DE3840497A1 (de) * | 1988-12-01 | 1990-06-07 | Doering Erich | Einbruchhemmende tuer oder wand |
| DE3841616C1 (en) * | 1988-12-10 | 1990-05-31 | Verschleiss-Technik Dr.-Ing. Hans Wahl Gmbh & Co, 7302 Ostfildern, De | Armoured panel |
| GB8916380D0 (en) * | 1989-07-18 | 1989-09-06 | Chubb Research | Security barrier structure |
| US6215397B1 (en) | 1996-08-13 | 2001-04-10 | Lindskog Innovation Ab | Electrical manually portable security case for the storage of theft attractive articles with an electrical mat having at least one elongated electrically conductive wire in a substantially continuous mesh, loop or eye structure |
| US5386788A (en) * | 1992-11-12 | 1995-02-07 | Sandia Corporation | Modular, security enclosure and method of assembly |
| RU2110659C1 (ru) * | 1996-01-31 | 1998-05-10 | Российский Федеральный Ядерный Центр - Всероссийский Научно-Исследовательский Институт Экспериментальной Физики | Защитная плита против взлома |
| DE29617639U1 (de) * | 1996-10-10 | 1996-11-28 | Bode-Panzer Ag, 30419 Hannover | Sicherheitsbehältnis |
| DE19643504C2 (de) * | 1996-10-21 | 1998-07-23 | Matthias Collin | Einstückiges Tresorgehäuse und Tresor mit hoher Sicherheitsstufe und Verfahren zu dessen Herstellung |
| US5970890A (en) * | 1996-11-27 | 1999-10-26 | Interbold | Method of making secure enclosure for automated banking machine |
| RU2159316C1 (ru) * | 1996-11-27 | 2000-11-20 | Интерболд | Способ изготовления защитного кожуха для автоматического банковского аппарата |
| SI9700085A (en) | 1997-04-07 | 1997-08-31 | Erih Stefanec | Lamelar armour system of burglar-proof container casing and door safety lining, made of prefabricated armour plates |
| GB9717838D0 (en) | 1997-08-23 | 1997-10-29 | Chubb Research | Security receptacles |
| US5946954A (en) * | 1997-09-03 | 1999-09-07 | John D. Brush & Co., Inc. | Door bushing system for insulated steel shell safe |
| US6848372B2 (en) * | 1999-03-18 | 2005-02-01 | Karl Alizade | Modular security safe with offset security bolt box having expandable characteristics and method of manufacturing same |
| US6044776A (en) | 1999-03-18 | 2000-04-04 | Alizade; Karl | Modular security safe with offset security bolt box and method of manufacturing same |
| US6637353B2 (en) | 1999-03-18 | 2003-10-28 | Karl Alizade | Modular security safe with offset security bolt box and method of manufacturing same |
| US6386122B2 (en) | 1999-03-18 | 2002-05-14 | Karl Alizade | Modular security safe with offset security bolt box and method of manufacturing same |
| US6543371B1 (en) * | 2000-01-04 | 2003-04-08 | Diebold, Incorporated | Modular vault panel |
| US6786009B1 (en) | 2000-08-16 | 2004-09-07 | Corporate Safe Specialists | Kit for securable enclosure |
| FR2827375B1 (fr) * | 2001-07-12 | 2004-01-16 | France Etat | Blindage composite multicouches |
| US6564850B1 (en) * | 2002-04-30 | 2003-05-20 | Chang Than Chen | Sliding door assembly having integral door panels |
| SE0400144D0 (sv) * | 2004-01-22 | 2004-01-22 | Cesium Ab | Modulsats för en monterbar och låsbar förvaringsbehållare, behållare samt skyddad låsanordning för nämnda behållare |
| RU2278937C2 (ru) * | 2004-09-13 | 2006-06-27 | Федеральное государственное унитарное предприятие Российский федеральный ядерный центр - Всероссийский научно-исследовательский институт экспериментальной физики - ФГУП РФЯЦ - ВНИИЭФ | Слоистая структура |
| US8677698B2 (en) * | 2008-03-06 | 2014-03-25 | Stuart C. Segall | Relocatable habitat unit |
| US9157249B2 (en) | 2013-03-15 | 2015-10-13 | Stuart Charles Segall | Relocatable habitat unit |
| US9016002B2 (en) * | 2008-03-06 | 2015-04-28 | Stuart Charles Segall | Relocatable habitat unit having interchangeable panels |
| US20100148446A1 (en) * | 2008-12-11 | 2010-06-17 | Baker Hughes Incorporated | Seal assembly and method for making and using the same |
| IT1399543B1 (it) * | 2010-03-31 | 2013-04-19 | Technomax S R L | Cassaforte, porta per cassaforte e parete per cassaforte |
| WO2014127384A1 (en) * | 2013-02-18 | 2014-08-21 | Eclipse Cash Systems, Llc | Jacket for automated teller machine and related methods |
| CN103485655A (zh) * | 2013-09-02 | 2014-01-01 | 德清科迪特安保设备有限公司 | 一种用于保险箱的复合板 |
| CN105155871A (zh) * | 2015-07-10 | 2015-12-16 | 山东银维科技有限公司 | 一种自组装式atm防护舱 |
| US9689193B1 (en) * | 2015-12-09 | 2017-06-27 | Ryszard Gulik | Bolted safe modules made from three types of formed edge rails |
| US20210040723A1 (en) * | 2018-03-05 | 2021-02-11 | Fluxus Llc | Prefabricated Building System |
| TR201808161A2 (tr) * | 2018-06-08 | 2018-07-23 | Ufuk Mahmutyazicioglu | Kompakt dolaplarda yeni̇li̇k |
| SE543721C2 (en) * | 2019-01-04 | 2021-06-29 | Cesium Ab | Upper construction element and lower construction element for a container and a container |
| BR112021026157A2 (pt) * | 2019-06-25 | 2022-08-16 | Diebold Nixdorf Inc | Estrutura de máquina de transação automatizada |
| US12553275B2 (en) * | 2022-07-29 | 2026-02-17 | Ncr Atleos Corporation | Recyclable safe |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1546403A (en) * | 1925-07-21 | Burglarproof wall structure fob vaults | ||
| US952877A (en) * | 1909-05-28 | 1910-03-22 | Sherard Osborn Cowper-Coles | Armor-plate. |
| US1084986A (en) * | 1913-02-24 | 1914-01-20 | Otto H L Wernicke | Insulating-lining for safes. |
| US1423652A (en) * | 1921-08-18 | 1922-07-25 | American Abrasive Metals Compa | Plate for resisting flame and cutting tools |
| FR1464564A (fr) * | 1964-06-17 | 1967-01-06 | Bauche Ets | Perfectionnement aux cuirasses de coffres-forts et analogues |
| DE1942005U (de) * | 1965-12-01 | 1966-07-07 | Xaver Hersacher | Wertbehaelter, wie tresor, panzerschrank, geldschrank od. dgl. |
| CH435051A (de) * | 1966-05-13 | 1967-04-30 | Bollag Moses | Strassenmarkierungsfahrzeug mit Kompressor |
| DE1945893U (de) * | 1966-07-02 | 1966-09-08 | Ostertag Werke Ag | Panzerplatte bzw. gepanzertes gehaeuseteil fuer wertbehaelter wie geldschraenke und tresoren. |
| DE6607917U (de) * | 1966-10-20 | 1971-05-27 | Rautenbach Gmbh Geb | Giessform zum herstellen metallkeramischer verbundkoerper. |
| AT343007B (de) * | 1972-02-05 | 1978-05-10 | Feldmuehle Anlagen Prod | Wandelement fur wertbehalter und verfahren zur herstellung desselben |
-
1976
- 1976-10-11 GB GB42123/76A patent/GB1513609A/en not_active Expired
-
1977
- 1977-10-07 US US05/840,171 patent/US4158338A/en not_active Expired - Lifetime
- 1977-10-07 DE DE2745178A patent/DE2745178B2/de active Granted
- 1977-10-07 IT IT12794/77A patent/IT1143858B/it active
- 1977-10-10 BE BE181576A patent/BE859528A/xx not_active IP Right Cessation
- 1977-10-10 FR FR7730457A patent/FR2367177A1/fr active Granted
- 1977-10-10 AT AT0721677A patent/AT372745B/de not_active IP Right Cessation
- 1977-10-10 CH CH1235077A patent/CH624175A5/de not_active IP Right Cessation
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3400818A1 (de) * | 1984-01-12 | 1985-07-18 | Bode-Panzer Ag, 3000 Hannover | Bautafel zur sicherung von bankraeumen oder dergleichen |
| EP0187499A3 (en) * | 1985-01-10 | 1987-05-20 | Micropore International Limited | Fire-resistant container |
| WO1993023648A1 (en) * | 1992-05-10 | 1993-11-25 | Kjell Lindskog | Laminate and use of the same |
Also Published As
| Publication number | Publication date |
|---|---|
| BE859528A (fr) | 1978-04-10 |
| AT372745B (de) | 1983-11-10 |
| IT1143858B (it) | 1986-10-22 |
| DE2745178A1 (de) | 1978-04-20 |
| GB1513609A (en) | 1978-06-07 |
| CH624175A5 (enExample) | 1981-07-15 |
| FR2367177A1 (fr) | 1978-05-05 |
| US4158338A (en) | 1979-06-19 |
| ATA721677A (de) | 1983-03-15 |
| FR2367177B1 (enExample) | 1983-05-20 |
| DE2745178C3 (enExample) | 1985-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2745178B2 (de) | Wandelement und Verfahren zu seiner Herstellung | |
| DE202008000808U1 (de) | Absorberelement für einen Behälter zur Aufbewahrung von Gegenständen | |
| DE1584264C2 (de) | Panzerwand fuer Geldschraenke od. dgl. | |
| DE1634382A1 (de) | Nachgiebige Schalung zum Herstellen von Betonwaenden oder Betonplatten | |
| EP1538297B2 (de) | Geteilte Feuerschutztüreinlage | |
| DE7833654U1 (de) | Einbruchhemmende Fenster | |
| DE4411003C2 (de) | Schallschutzelement und Verfahren zum Herstellen eines Schallschutzelementes | |
| DE4322262A1 (de) | Verbundplatte zum Erstellen von gegen Feuer, Wasser und Einbruch gesicherten Räumen, Schränken, Tresoren u. dgl. Sicherheitseinrichtungen | |
| CH679244A5 (en) | Armoured vehicle cladding - comprises flat elastic prestressed and reinforced plates between enclosing layers | |
| DE102018125362A1 (de) | Mehrkammerhohlprofil für Brandschutztüren oder -fenster und Verfahren sowie Vorrichtung zum Herstellen eines solchen Mehrkammerhohlprofils | |
| DE3425429C2 (enExample) | ||
| EP4081452B1 (de) | Umweltfreundlicher schwimmkörper mit verbesserten auftriebseigenschaften und erhöhter kippstabilität | |
| DE3324723A1 (de) | Feuerschutztuer | |
| DE102013105368B4 (de) | Sicherungsbehälter zur Aufbewahrung von vor unberechtigtem Zugriff zu schützenden Gegenständen | |
| AT505272A1 (de) | Türe | |
| EP2034120B1 (de) | Ausrüstung für Feuerschutzabschlüsse | |
| DE3723924A1 (de) | Tuer mit bewehrter fuellung | |
| DE4417312A1 (de) | Schutzschicht für Deponie- und andere Abdichtungen | |
| EP0562554A2 (de) | Heizgerät, insbesondere elektrisches Speicherheizgerät | |
| EP0629746A2 (de) | Schutzschicht für Deponie und andere Abdichtungen | |
| DE3533555A1 (de) | Sicherheitsbehaeltnis, insbesondere geldschrank oder tresor | |
| DE2205498A1 (de) | Wandelement fuer wertbehaelter, wie tresore, geldschraenke und dgl | |
| DE2936799C2 (de) | Feuerschutztor | |
| DE7626523U1 (de) | Feuerschutztuer | |
| DE3600693A1 (de) | Tresor nach art eines stahlschrankes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| 8281 | Inventor (new situation) |
Free format text: DIPPOLD, JOHANN, ING.(GRAD.), 7310 PLOCHINGEN, DE TIRPITZ, WOLF V., DIPL.-CHEM. DR., 7441 REUDERN, DE |
|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |