DE2648137C2 - Treibladungsanzünder für Munition - Google Patents
Treibladungsanzünder für MunitionInfo
- Publication number
- DE2648137C2 DE2648137C2 DE2648137A DE2648137A DE2648137C2 DE 2648137 C2 DE2648137 C2 DE 2648137C2 DE 2648137 A DE2648137 A DE 2648137A DE 2648137 A DE2648137 A DE 2648137A DE 2648137 C2 DE2648137 C2 DE 2648137C2
- Authority
- DE
- Germany
- Prior art keywords
- ignition
- housing
- propellant charge
- guide housing
- charge lighter
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003380 propellant Substances 0.000 title claims description 23
- 239000002360 explosive Substances 0.000 claims description 11
- 239000000463 material Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 7
- 239000011230 binding agent Substances 0.000 claims description 6
- 229920003002 synthetic resin Polymers 0.000 claims description 6
- 239000000057 synthetic resin Substances 0.000 claims description 6
- 238000002485 combustion reaction Methods 0.000 claims description 5
- 239000000028 HMX Substances 0.000 claims description 2
- 239000012876 carrier material Substances 0.000 claims description 2
- 239000003365 glass fiber Substances 0.000 claims description 2
- UZGLIIJVICEWHF-UHFFFAOYSA-N octogen Chemical group [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)CN([N+]([O-])=O)C1 UZGLIIJVICEWHF-UHFFFAOYSA-N 0.000 claims description 2
- 239000004020 conductor Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 3
- 239000003721 gunpowder Substances 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- BZMUENLPCVDNIK-UHFFFAOYSA-N 1,2,3,4,5-pentanitro-6-(1-nitro-2-phenylethenyl)benzene Chemical compound [O-][N+](=O)C=1C([N+]([O-])=O)=C([N+]([O-])=O)C([N+]([O-])=O)=C([N+]([O-])=O)C=1C([N+](=O)[O-])=CC1=CC=CC=C1 BZMUENLPCVDNIK-UHFFFAOYSA-N 0.000 description 1
- DYSXLQBUUOPLBB-UHFFFAOYSA-N 2,3-dinitrotoluene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O DYSXLQBUUOPLBB-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- 239000000006 Nitroglycerin Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 239000011889 copper foil Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 229960003711 glyceryl trinitrate Drugs 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/0823—Primers or igniters for the initiation or the propellant charge in a cartridged ammunition
- F42C19/0826—Primers or igniters for the initiation or the propellant charge in a cartridged ammunition comprising an elongated perforated tube, i.e. flame tube, for the transmission of the initial energy to the propellant charge, e.g. used for artillery shells and kinetic energy penetrators
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/0807—Primers; Detonators characterised by the particular configuration of the transmission channels from the priming energy source to the charge to be ignited, e.g. multiple channels, nozzles, diaphragms or filters
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/12—Primers; Detonators electric
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Air Bags (AREA)
- Paints Or Removers (AREA)
- Lighters Containing Fuel (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Fuel-Injection Apparatus (AREA)
- Cosmetics (AREA)
- Fats And Perfumes (AREA)
- Ignition Installations For Internal Combustion Engines (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2648137A DE2648137C2 (de) | 1976-10-23 | 1976-10-23 | Treibladungsanzünder für Munition |
| GB43595/77A GB1593677A (en) | 1976-10-23 | 1977-10-19 | Propellant charge igniter |
| GB13030/80A GB1593678A (en) | 1976-10-23 | 1977-10-19 | Propellant charge igniter |
| SE7711826A SE432481B (sv) | 1976-10-23 | 1977-10-20 | Drivladdningstendare for ammunition med elektriskt tendsystem |
| BE181939A BE859969A (fr) | 1976-10-23 | 1977-10-21 | Amorce de charge propulsive |
| CH1285877A CH623409A5 (enExample) | 1976-10-23 | 1977-10-21 | |
| CA289,250A CA1125091A (en) | 1976-10-23 | 1977-10-21 | Propellant charge igniter |
| IT51523/77A IT1091322B (it) | 1976-10-23 | 1977-10-21 | Innesco di carica di lancio |
| NO773611A NO148939C (no) | 1976-10-23 | 1977-10-21 | Drivladningstenner. |
| FR7731821A FR2368689B1 (fr) | 1976-10-23 | 1977-10-21 | Amorce electrique de charge propulsive pour munitions |
| US06/102,830 US4770099A (en) | 1976-10-23 | 1979-12-12 | Propellant charge igniter |
| NO802734A NO802734L (no) | 1976-10-23 | 1980-09-15 | Drivladningstenner for ammunisjon. |
| CA000378487A CA1150108A (en) | 1976-10-23 | 1981-05-27 | Propellant charge igniter with an electrical ignition system in middle zone of a flame guiding duct |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2648137A DE2648137C2 (de) | 1976-10-23 | 1976-10-23 | Treibladungsanzünder für Munition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2648137A1 DE2648137A1 (de) | 1978-04-27 |
| DE2648137C2 true DE2648137C2 (de) | 1984-04-12 |
Family
ID=5991280
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2648137A Expired DE2648137C2 (de) | 1976-10-23 | 1976-10-23 | Treibladungsanzünder für Munition |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4770099A (enExample) |
| BE (1) | BE859969A (enExample) |
| CA (1) | CA1125091A (enExample) |
| CH (1) | CH623409A5 (enExample) |
| DE (1) | DE2648137C2 (enExample) |
| FR (1) | FR2368689B1 (enExample) |
| GB (2) | GB1593677A (enExample) |
| IT (1) | IT1091322B (enExample) |
| NO (2) | NO148939C (enExample) |
| SE (1) | SE432481B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3606762A1 (de) * | 1986-03-01 | 1987-09-24 | Messerschmitt Boelkow Blohm | Munition |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2832879A1 (de) * | 1978-07-27 | 1980-02-14 | Dynamit Nobel Ag | Treibladungsanzuender |
| US4494459A (en) * | 1980-09-05 | 1985-01-22 | General Electric Company | Explosive projectile |
| US4386568A (en) * | 1980-09-05 | 1983-06-07 | General Electric Company | Detonator assembly |
| DE3226269C2 (de) * | 1982-07-14 | 1986-04-17 | Dynamit Nobel Ag, 5210 Troisdorf | Teilverbrennbarer Treibladungsanzünder |
| DE3303724C2 (de) * | 1983-02-04 | 1986-12-04 | Mauser-Werke Oberndorf Gmbh, 7238 Oberndorf | Gehäuse für elektrisches Zündmittel |
| DE3303722A1 (de) * | 1983-02-04 | 1984-08-09 | Diehl GmbH & Co, 8500 Nürnberg | Vorrichtung zur befestigung eines elektrischen anzuendhuetchens einer patronenhuelse |
| DE3512942A1 (de) * | 1985-04-11 | 1986-10-16 | Bundesrepublik Deutschland, vertreten durch den Bundesminister der Verteidigung, dieser vertreten durch den Präsidenten des Bundesamtes für Wehrtechnik und Beschaffung, 5400 Koblenz | Treibladungsanzuender |
| DE3614173C1 (de) * | 1986-04-26 | 1989-03-02 | Dynamit Nobel Ag | Granuliertes,stabilisiertes alpha- und beta-Oktogen und Verfahren zur Herstellung von alpha-Oktogen |
| GB2191770A (en) * | 1986-06-17 | 1987-12-23 | Secr Defence | Ignition transfer medium |
| US4887534A (en) * | 1988-06-10 | 1989-12-19 | Honeywell Inc. | Ignition system for high intrusion projectile |
| US5052302A (en) * | 1990-07-26 | 1991-10-01 | Olin Corporation | Unpressurized combustible primer for cannon cartridges |
| US5048421A (en) * | 1990-08-06 | 1991-09-17 | Olin Corporation | Combustible cartridge case base |
| US5138949A (en) * | 1990-09-20 | 1992-08-18 | Olin Corporation | Combustible ammunition cartridge case |
| EP0600039A1 (en) * | 1991-08-16 | 1994-06-08 | Alliant Techsystems Inc. | Insensitive propellant ignitor |
| DE4138269C2 (de) * | 1991-11-21 | 1998-01-15 | Rheinmetall Ind Ag | Munition |
| US5162604A (en) * | 1992-03-12 | 1992-11-10 | The United States Of America As Represented By The Secretary Of The Army | Implosive cartridge case for recoilless rifles |
| DE4240273A1 (de) * | 1992-12-01 | 1994-06-09 | Dynamit Nobel Ag | Treibladungsanzünder |
| US5465665A (en) * | 1993-10-29 | 1995-11-14 | Olin Corporation | Primer |
| RU2151364C1 (ru) * | 1995-03-23 | 2000-06-20 | Максвелл Текнолоджиз Инк. | Электротермический химический патрон |
| DE19534211A1 (de) * | 1995-09-15 | 1997-03-20 | Diehl Gmbh & Co | Sekundärgeschoß für einen Tandemgefechtskopf |
| US5689083A (en) * | 1996-05-09 | 1997-11-18 | The Ensign-Bickford Company | Obturating initiation fitting |
| DE19654314A1 (de) * | 1996-12-24 | 1998-06-25 | Dynamit Nobel Ag | Anzündeelement, insbesondere für pyrotechnische Mischungen |
| US6202560B1 (en) * | 1999-01-06 | 2001-03-20 | The United States Of America As Represented By The Secretary Of The Navy | Explosively started projectile gun ammunition |
| FR2802297B1 (fr) * | 1999-12-08 | 2002-10-11 | Giat Ind Sa | Tube allumeur pour munition d'artillerie |
| US7047885B1 (en) * | 2000-02-14 | 2006-05-23 | Alliant Techsystems Inc. | Multiple pulse cartridge ignition system |
| FI20085083A7 (fi) * | 2008-01-31 | 2009-08-01 | Patria Weapon Systems Oy | Sovitelma ja menetelmä kranaatin tukemiseksi takaaladattavan aseen putkeen |
| FI120894B (fi) * | 2008-01-31 | 2010-04-15 | Patria Weapon Systems Oy | Sovitelma kranaatin tukemiseksi aseen putkeen sekä tukielin |
| FI120708B (fi) * | 2008-01-31 | 2010-01-29 | Patria Weapon Systems Oy | Sovitelma ammuksen tukemiseksi aseen putkeen, tukielementti ja menetelmä |
| US8297191B2 (en) * | 2009-07-31 | 2012-10-30 | The United States Of America As Represented By The Secretary Of The Navy | Pressure seal |
| RU2634960C2 (ru) * | 2012-04-24 | 2017-11-08 | Файк Корпорейшн | Устройство передачи энергии |
| CN106334279A (zh) * | 2016-11-01 | 2017-01-18 | 株洲耐尔紧固器械有限公司 | 一种破玻装置 |
| US10782113B2 (en) * | 2018-10-05 | 2020-09-22 | Axon Enterprise, Inc. | Systems and methods for ignition in a conducted electrical weapon |
| US11668550B2 (en) * | 2019-10-04 | 2023-06-06 | Bae Systems Land & Armaments L.P. | Scalable insensitive munitions primer |
| US11988491B1 (en) * | 2021-07-29 | 2024-05-21 | Revolutionary Rounds L.L.C. | Projectile and caseless cartridge |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US606440A (en) * | 1898-06-28 | Thomas g | ||
| US1887122A (en) * | 1931-01-20 | 1932-11-08 | Hercules Powder Co Ltd | Connecter for cordeau bickford |
| DE661306C (de) * | 1936-04-02 | 1938-07-05 | Rudolf Etzkorn Dipl Ing | Schlagbolzenlose Feuerwaffe und Patrone zum Verschiessen aus derselben |
| GB605135A (en) * | 1945-12-14 | 1948-07-16 | John Norman Pring | Improvements in or relating to magazines or containers for cartridge priming compositions |
| US2743580A (en) * | 1952-10-07 | 1956-05-01 | Hughes Aircraft Co | Igniter for rocket motors |
| DE1062148B (de) * | 1957-03-12 | 1959-07-23 | Diehl G M B H | Verfahren und Vorrichtung zum Zuenden einer Geschosstreibladung |
| US2973713A (en) * | 1957-12-31 | 1961-03-07 | Phillips Petroleum Co | Ignition of solid rocket propellants |
| US3332353A (en) * | 1959-03-03 | 1967-07-25 | Lohr A Burkardt | Auxiliary igniter and sustainer |
| US3062147A (en) * | 1959-09-28 | 1962-11-06 | Du Pont | Igniter for solid propellant grains |
| US3182595A (en) * | 1962-07-20 | 1965-05-11 | Harry F Hassmann | Igniter assembly containing strands of benite |
| US3397639A (en) * | 1967-01-03 | 1968-08-20 | Sterling Alderfer Company | Reinforced ignition tube |
| US3392673A (en) * | 1967-05-29 | 1968-07-16 | Navy Usa | Consumable pyrogen igniter |
| FR1575687A (enExample) * | 1968-04-10 | 1969-07-25 | ||
| US3621781A (en) * | 1968-06-11 | 1971-11-23 | Erich Cornelius Johnsen | Hand weapon and cartridge therefor |
| US3608492A (en) * | 1969-10-02 | 1971-09-28 | Gen Electric | Ammunition high-voltage electrical ignition system |
| US3696749A (en) * | 1969-11-18 | 1972-10-10 | Remington Arms Co Inc | Expendable case with vented base cap |
| DE2020016C3 (de) * | 1970-04-24 | 1974-12-12 | Dynamit Nobel Ag, 5210 Troisdorf | Metallschichtzündmittel |
| US3706277A (en) * | 1970-10-28 | 1972-12-19 | Us Navy | Destruct system improvement |
| DE2059665C3 (de) * | 1970-12-04 | 1978-04-20 | Rheinmetall Gmbh, 4000 Duesseldorf | Verfahren und Anordnung zur Berücksichtigung von Munitionseigenschaften beim Richten eines Geschützes und/ oder beim Einstellen des Zünders der Munition |
| US3726222A (en) * | 1971-06-02 | 1973-04-10 | Us Army | Ignition system for caseless ammunition |
| FR2174406A5 (en) * | 1972-03-03 | 1973-10-12 | France Etat | Explosion initiator of the percussion type - for automatic weapons |
| US3901153A (en) * | 1972-10-04 | 1975-08-26 | Us Air Force | Wrapped laminated felted monolithic combustible cartridge case |
| DE2261376C2 (de) * | 1972-12-15 | 1982-11-25 | Dynamit Nobel Ag, 5210 Troisdorf | Treibladung für rückstoßfreie Waffen |
| US4263070A (en) * | 1973-01-17 | 1981-04-21 | Thiokol Corporation | Thermally stable gun and caseless cartridge propellants |
| NO133382C (enExample) * | 1973-05-25 | 1976-04-21 | Raufoss Ammunisjonsfabrikker | |
| US4115167A (en) * | 1974-11-11 | 1978-09-19 | The United States Of America As Represented By The Secretary Of The Navy | Castable binder for cast plastic-bonded explosives |
| ES211994Y (es) * | 1975-04-29 | 1976-11-01 | Cartucho mejorado. |
-
1976
- 1976-10-23 DE DE2648137A patent/DE2648137C2/de not_active Expired
-
1977
- 1977-10-19 GB GB43595/77A patent/GB1593677A/en not_active Expired
- 1977-10-19 GB GB13030/80A patent/GB1593678A/en not_active Expired
- 1977-10-20 SE SE7711826A patent/SE432481B/xx not_active IP Right Cessation
- 1977-10-21 NO NO773611A patent/NO148939C/no unknown
- 1977-10-21 CA CA289,250A patent/CA1125091A/en not_active Expired
- 1977-10-21 CH CH1285877A patent/CH623409A5/de not_active IP Right Cessation
- 1977-10-21 BE BE181939A patent/BE859969A/xx not_active IP Right Cessation
- 1977-10-21 FR FR7731821A patent/FR2368689B1/fr not_active Expired
- 1977-10-21 IT IT51523/77A patent/IT1091322B/it active
-
1979
- 1979-12-12 US US06/102,830 patent/US4770099A/en not_active Expired - Lifetime
-
1980
- 1980-09-15 NO NO802734A patent/NO802734L/no unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3606762A1 (de) * | 1986-03-01 | 1987-09-24 | Messerschmitt Boelkow Blohm | Munition |
Also Published As
| Publication number | Publication date |
|---|---|
| NO773611L (no) | 1978-04-25 |
| NO148939C (no) | 1984-01-11 |
| FR2368689A1 (fr) | 1978-05-19 |
| NO802734L (no) | 1978-04-25 |
| SE432481B (sv) | 1984-04-02 |
| FR2368689B1 (fr) | 1986-03-21 |
| DE2648137A1 (de) | 1978-04-27 |
| GB1593678A (en) | 1981-07-22 |
| GB1593677A (en) | 1981-07-22 |
| NO148939B (no) | 1983-10-03 |
| IT1091322B (it) | 1985-07-06 |
| CA1125091A (en) | 1982-06-08 |
| BE859969A (fr) | 1978-02-15 |
| CH623409A5 (enExample) | 1981-05-29 |
| SE7711826L (sv) | 1978-04-24 |
| US4770099A (en) | 1988-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2648137C2 (de) | Treibladungsanzünder für Munition | |
| DE68912066T2 (de) | Initialelement für primärsprengstofffreie Detonatoren. | |
| DE69828539T2 (de) | Hohlladung | |
| DE3334464A1 (de) | Industriekartusche | |
| DE1453837A1 (de) | Artillerie-Kartusche | |
| DE3031369A1 (de) | Pyrotechnische ladung | |
| DE1918046A1 (de) | Zuender | |
| DE3707694C2 (enExample) | ||
| DE69218650T2 (de) | Behälter, vorgesehen mit elektrischen Verbindungsmitteln | |
| EP0265608B1 (de) | Vorrichtung zum Ausstossen von Behältern, insbesondere von Munition | |
| DE903320C (de) | Verzoegerungsvorrichtung fuer Sprengladungen | |
| DE19749133C2 (de) | Notabschalter für elektrische Stromkreise | |
| DE69925247T2 (de) | Verfahren zum zünden von geschütztreibladungen, geschütztreibladungsmodul und geschütztreibladung | |
| EP0340761B1 (de) | Treibladungen für grosskalibrige Geschosse | |
| DE1129099B (de) | Elektrischer Zuender | |
| DE2306872A1 (de) | Explosivstoff-formkoerper mit pyrometall | |
| DE1924626C3 (de) | Zündvorrichtung für Treibladungen | |
| EP1064241B1 (de) | Durch elektrische auslösung anzündbare initialexplosivstoffe und anzündsätze | |
| DE69106341T2 (de) | Piezoelektrischer zünder. | |
| DE60124304T2 (de) | Zündvorrichtung für sauerstofflanze zum thermischen schneiden, bohren usw. | |
| DE3843443A1 (de) | Sprengkoerper | |
| EP0265609A2 (de) | Vorrichtung zum Ausstossen von Behältern, insbesondere von Munition | |
| DE1024415B (de) | Blaslochfreie elektrische Verzoegerungskapsel | |
| DE3139525A1 (de) | Verfahren zum zuenden einer gaserzeugenden treibladungskartusche und konstruktion einer derartigen kartusche | |
| DE60027676T2 (de) | Treibladungszünder für Artilleriemunition |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: DYNAMIT NOBEL AG, 5210 TROISDORF, DE |
|
| 8339 | Ceased/non-payment of the annual fee |