CH623409A5 - - Google Patents
Download PDFInfo
- Publication number
- CH623409A5 CH623409A5 CH1285877A CH1285877A CH623409A5 CH 623409 A5 CH623409 A5 CH 623409A5 CH 1285877 A CH1285877 A CH 1285877A CH 1285877 A CH1285877 A CH 1285877A CH 623409 A5 CH623409 A5 CH 623409A5
- Authority
- CH
- Switzerland
- Prior art keywords
- ignition
- propellant
- cartridge
- electrical
- housing
- Prior art date
Links
- 239000003380 propellant Substances 0.000 claims description 47
- 239000000463 material Substances 0.000 claims description 29
- 229910052751 metal Inorganic materials 0.000 claims description 27
- 239000002184 metal Substances 0.000 claims description 27
- 230000006378 damage Effects 0.000 claims description 12
- 239000000843 powder Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- 238000007789 sealing Methods 0.000 claims description 8
- 238000010304 firing Methods 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 238000002485 combustion reaction Methods 0.000 claims description 6
- 239000000020 Nitrocellulose Substances 0.000 claims description 5
- 230000000694 effects Effects 0.000 claims description 5
- 229920001220 nitrocellulos Polymers 0.000 claims description 5
- 239000011230 binding agent Substances 0.000 claims description 3
- 238000011161 development Methods 0.000 claims description 3
- 238000005516 engineering process Methods 0.000 claims description 3
- 239000000446 fuel Substances 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 108090000623 proteins and genes Proteins 0.000 claims description 2
- 239000000028 HMX Substances 0.000 claims 2
- YSIBQULRFXITSW-OWOJBTEDSA-N 1,3,5-trinitro-2-[(e)-2-(2,4,6-trinitrophenyl)ethenyl]benzene Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C1\C=C\C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O YSIBQULRFXITSW-OWOJBTEDSA-N 0.000 claims 1
- OOKDYUQHMDBHMB-UHFFFAOYSA-N 3,6-dichloro-2-methoxybenzoic acid;2-(2,4-dichlorophenoxy)acetic acid;n-methylmethanamine Chemical compound CNC.CNC.COC1=C(Cl)C=CC(Cl)=C1C(O)=O.OC(=O)COC1=CC=C(Cl)C=C1Cl OOKDYUQHMDBHMB-UHFFFAOYSA-N 0.000 claims 1
- 239000004604 Blowing Agent Substances 0.000 claims 1
- 239000002131 composite material Substances 0.000 claims 1
- 239000002360 explosive Substances 0.000 claims 1
- 239000003292 glue Substances 0.000 claims 1
- UAGLZAPCOXRKPH-UHFFFAOYSA-N nitric acid;1,2,3-triaminoguanidine Chemical compound O[N+]([O-])=O.NNC(NN)=NN UAGLZAPCOXRKPH-UHFFFAOYSA-N 0.000 claims 1
- UZGLIIJVICEWHF-UHFFFAOYSA-N octogen Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)CN([N+]([O-])=O)C1 UZGLIIJVICEWHF-UHFFFAOYSA-N 0.000 claims 1
- 230000003014 reinforcing effect Effects 0.000 claims 1
- 239000004020 conductor Substances 0.000 description 16
- 230000008901 benefit Effects 0.000 description 9
- 239000000853 adhesive Substances 0.000 description 8
- 230000001070 adhesive effect Effects 0.000 description 8
- 239000000919 ceramic Substances 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 239000004033 plastic Substances 0.000 description 6
- 229920003023 plastic Polymers 0.000 description 6
- 239000003990 capacitor Substances 0.000 description 5
- 239000007789 gas Substances 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 3
- 238000004026 adhesive bonding Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- 230000001960 triggered effect Effects 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 2
- 229910000906 Bronze Inorganic materials 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- 239000010974 bronze Substances 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 230000007257 malfunction Effects 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- 229920001225 polyester resin Polymers 0.000 description 2
- 239000004645 polyester resin Substances 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- -1 pyrometal Chemical compound 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000007650 screen-printing Methods 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000209035 Ilex Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910001252 Pd alloy Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004323 axial length Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000009529 body temperature measurement Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000004590 computer program Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000011889 copper foil Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000009429 electrical wiring Methods 0.000 description 1
- 239000012776 electronic material Substances 0.000 description 1
- 238000009713 electroplating Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 210000000744 eyelid Anatomy 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 210000003128 head Anatomy 0.000 description 1
- 239000002648 laminated material Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000615 nonconductor Substances 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/0823—Primers or igniters for the initiation or the propellant charge in a cartridged ammunition
- F42C19/0826—Primers or igniters for the initiation or the propellant charge in a cartridged ammunition comprising an elongated perforated tube, i.e. flame tube, for the transmission of the initial energy to the propellant charge, e.g. used for artillery shells and kinetic energy penetrators
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/0807—Primers; Detonators characterised by the particular configuration of the transmission channels from the priming energy source to the charge to be ignited, e.g. multiple channels, nozzles, diaphragms or filters
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/12—Primers; Detonators electric
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Air Bags (AREA)
- Lighters Containing Fuel (AREA)
- Paints Or Removers (AREA)
- Cosmetics (AREA)
- Fats And Perfumes (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Fuel-Injection Apparatus (AREA)
- Ignition Installations For Internal Combustion Engines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2648137A DE2648137C2 (de) | 1976-10-23 | 1976-10-23 | Treibladungsanzünder für Munition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH623409A5 true CH623409A5 (enExample) | 1981-05-29 |
Family
ID=5991280
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1285877A CH623409A5 (enExample) | 1976-10-23 | 1977-10-21 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4770099A (enExample) |
| BE (1) | BE859969A (enExample) |
| CA (1) | CA1125091A (enExample) |
| CH (1) | CH623409A5 (enExample) |
| DE (1) | DE2648137C2 (enExample) |
| FR (1) | FR2368689B1 (enExample) |
| GB (2) | GB1593678A (enExample) |
| IT (1) | IT1091322B (enExample) |
| NO (2) | NO148939C (enExample) |
| SE (1) | SE432481B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3512942A1 (de) * | 1985-04-11 | 1986-10-16 | Bundesrepublik Deutschland, vertreten durch den Bundesminister der Verteidigung, dieser vertreten durch den Präsidenten des Bundesamtes für Wehrtechnik und Beschaffung, 5400 Koblenz | Treibladungsanzuender |
| DE19534211A1 (de) * | 1995-09-15 | 1997-03-20 | Diehl Gmbh & Co | Sekundärgeschoß für einen Tandemgefechtskopf |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2832879A1 (de) * | 1978-07-27 | 1980-02-14 | Dynamit Nobel Ag | Treibladungsanzuender |
| US4494459A (en) * | 1980-09-05 | 1985-01-22 | General Electric Company | Explosive projectile |
| US4386568A (en) * | 1980-09-05 | 1983-06-07 | General Electric Company | Detonator assembly |
| DE3226269C2 (de) * | 1982-07-14 | 1986-04-17 | Dynamit Nobel Ag, 5210 Troisdorf | Teilverbrennbarer Treibladungsanzünder |
| DE3303722A1 (de) * | 1983-02-04 | 1984-08-09 | Diehl GmbH & Co, 8500 Nürnberg | Vorrichtung zur befestigung eines elektrischen anzuendhuetchens einer patronenhuelse |
| DE3303724C2 (de) * | 1983-02-04 | 1986-12-04 | Mauser-Werke Oberndorf Gmbh, 7238 Oberndorf | Gehäuse für elektrisches Zündmittel |
| DE3606762A1 (de) * | 1986-03-01 | 1987-09-24 | Messerschmitt Boelkow Blohm | Munition |
| DE3614173C1 (de) * | 1986-04-26 | 1989-03-02 | Dynamit Nobel Ag | Granuliertes,stabilisiertes alpha- und beta-Oktogen und Verfahren zur Herstellung von alpha-Oktogen |
| GB2191770A (en) * | 1986-06-17 | 1987-12-23 | Secr Defence | Ignition transfer medium |
| US4887534A (en) * | 1988-06-10 | 1989-12-19 | Honeywell Inc. | Ignition system for high intrusion projectile |
| US5052302A (en) * | 1990-07-26 | 1991-10-01 | Olin Corporation | Unpressurized combustible primer for cannon cartridges |
| US5048421A (en) * | 1990-08-06 | 1991-09-17 | Olin Corporation | Combustible cartridge case base |
| US5138949A (en) * | 1990-09-20 | 1992-08-18 | Olin Corporation | Combustible ammunition cartridge case |
| EP0600039A1 (en) * | 1991-08-16 | 1994-06-08 | Alliant Techsystems Inc. | Insensitive propellant ignitor |
| DE4138269C2 (de) * | 1991-11-21 | 1998-01-15 | Rheinmetall Ind Ag | Munition |
| US5162604A (en) * | 1992-03-12 | 1992-11-10 | The United States Of America As Represented By The Secretary Of The Army | Implosive cartridge case for recoilless rifles |
| DE4240273A1 (de) * | 1992-12-01 | 1994-06-09 | Dynamit Nobel Ag | Treibladungsanzünder |
| US5465665A (en) * | 1993-10-29 | 1995-11-14 | Olin Corporation | Primer |
| RU2151364C1 (ru) * | 1995-03-23 | 2000-06-20 | Максвелл Текнолоджиз Инк. | Электротермический химический патрон |
| US5689083A (en) * | 1996-05-09 | 1997-11-18 | The Ensign-Bickford Company | Obturating initiation fitting |
| DE19654314A1 (de) * | 1996-12-24 | 1998-06-25 | Dynamit Nobel Ag | Anzündeelement, insbesondere für pyrotechnische Mischungen |
| US6202560B1 (en) * | 1999-01-06 | 2001-03-20 | The United States Of America As Represented By The Secretary Of The Navy | Explosively started projectile gun ammunition |
| FR2802297B1 (fr) * | 1999-12-08 | 2002-10-11 | Giat Ind Sa | Tube allumeur pour munition d'artillerie |
| US7047885B1 (en) * | 2000-02-14 | 2006-05-23 | Alliant Techsystems Inc. | Multiple pulse cartridge ignition system |
| FI120708B (fi) * | 2008-01-31 | 2010-01-29 | Patria Weapon Systems Oy | Sovitelma ammuksen tukemiseksi aseen putkeen, tukielementti ja menetelmä |
| FI120894B (fi) * | 2008-01-31 | 2010-04-15 | Patria Weapon Systems Oy | Sovitelma kranaatin tukemiseksi aseen putkeen sekä tukielin |
| FI20085083A7 (fi) * | 2008-01-31 | 2009-08-01 | Patria Weapon Systems Oy | Sovitelma ja menetelmä kranaatin tukemiseksi takaaladattavan aseen putkeen |
| US8297191B2 (en) * | 2009-07-31 | 2012-10-30 | The United States Of America As Represented By The Secretary Of The Navy | Pressure seal |
| JP6145159B2 (ja) * | 2012-04-24 | 2017-06-07 | ファイク・コーポレーションFike Corporation | エネルギー伝達装置 |
| CN106334279A (zh) * | 2016-11-01 | 2017-01-18 | 株洲耐尔紧固器械有限公司 | 一种破玻装置 |
| US10782113B2 (en) * | 2018-10-05 | 2020-09-22 | Axon Enterprise, Inc. | Systems and methods for ignition in a conducted electrical weapon |
| US11668550B2 (en) * | 2019-10-04 | 2023-06-06 | Bae Systems Land & Armaments L.P. | Scalable insensitive munitions primer |
| US11988491B1 (en) * | 2021-07-29 | 2024-05-21 | Revolutionary Rounds L.L.C. | Projectile and caseless cartridge |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US606440A (en) * | 1898-06-28 | Thomas g | ||
| US1887122A (en) * | 1931-01-20 | 1932-11-08 | Hercules Powder Co Ltd | Connecter for cordeau bickford |
| DE661306C (de) * | 1936-04-02 | 1938-07-05 | Rudolf Etzkorn Dipl Ing | Schlagbolzenlose Feuerwaffe und Patrone zum Verschiessen aus derselben |
| GB605135A (en) * | 1945-12-14 | 1948-07-16 | John Norman Pring | Improvements in or relating to magazines or containers for cartridge priming compositions |
| US2743580A (en) * | 1952-10-07 | 1956-05-01 | Hughes Aircraft Co | Igniter for rocket motors |
| DE1062148B (de) * | 1957-03-12 | 1959-07-23 | Diehl G M B H | Verfahren und Vorrichtung zum Zuenden einer Geschosstreibladung |
| US2973713A (en) * | 1957-12-31 | 1961-03-07 | Phillips Petroleum Co | Ignition of solid rocket propellants |
| US3332353A (en) * | 1959-03-03 | 1967-07-25 | Lohr A Burkardt | Auxiliary igniter and sustainer |
| US3062147A (en) * | 1959-09-28 | 1962-11-06 | Du Pont | Igniter for solid propellant grains |
| US3182595A (en) * | 1962-07-20 | 1965-05-11 | Harry F Hassmann | Igniter assembly containing strands of benite |
| US3397639A (en) * | 1967-01-03 | 1968-08-20 | Sterling Alderfer Company | Reinforced ignition tube |
| US3392673A (en) * | 1967-05-29 | 1968-07-16 | Navy Usa | Consumable pyrogen igniter |
| FR1575687A (enExample) * | 1968-04-10 | 1969-07-25 | ||
| US3621781A (en) * | 1968-06-11 | 1971-11-23 | Erich Cornelius Johnsen | Hand weapon and cartridge therefor |
| US3608492A (en) * | 1969-10-02 | 1971-09-28 | Gen Electric | Ammunition high-voltage electrical ignition system |
| US3696749A (en) * | 1969-11-18 | 1972-10-10 | Remington Arms Co Inc | Expendable case with vented base cap |
| DE2020016C3 (de) * | 1970-04-24 | 1974-12-12 | Dynamit Nobel Ag, 5210 Troisdorf | Metallschichtzündmittel |
| US3706277A (en) * | 1970-10-28 | 1972-12-19 | Us Navy | Destruct system improvement |
| DE2059665C3 (de) * | 1970-12-04 | 1978-04-20 | Rheinmetall Gmbh, 4000 Duesseldorf | Verfahren und Anordnung zur Berücksichtigung von Munitionseigenschaften beim Richten eines Geschützes und/ oder beim Einstellen des Zünders der Munition |
| US3726222A (en) * | 1971-06-02 | 1973-04-10 | Us Army | Ignition system for caseless ammunition |
| FR2174406A5 (en) * | 1972-03-03 | 1973-10-12 | France Etat | Explosion initiator of the percussion type - for automatic weapons |
| US3901153A (en) * | 1972-10-04 | 1975-08-26 | Us Air Force | Wrapped laminated felted monolithic combustible cartridge case |
| DE2261376C2 (de) * | 1972-12-15 | 1982-11-25 | Dynamit Nobel Ag, 5210 Troisdorf | Treibladung für rückstoßfreie Waffen |
| US4263070A (en) * | 1973-01-17 | 1981-04-21 | Thiokol Corporation | Thermally stable gun and caseless cartridge propellants |
| NO133382C (enExample) * | 1973-05-25 | 1976-04-21 | Raufoss Ammunisjonsfabrikker | |
| US4115167A (en) * | 1974-11-11 | 1978-09-19 | The United States Of America As Represented By The Secretary Of The Navy | Castable binder for cast plastic-bonded explosives |
| ES211994Y (es) * | 1975-04-29 | 1976-11-01 | Cartucho mejorado. |
-
1976
- 1976-10-23 DE DE2648137A patent/DE2648137C2/de not_active Expired
-
1977
- 1977-10-19 GB GB13030/80A patent/GB1593678A/en not_active Expired
- 1977-10-19 GB GB43595/77A patent/GB1593677A/en not_active Expired
- 1977-10-20 SE SE7711826A patent/SE432481B/xx not_active IP Right Cessation
- 1977-10-21 CA CA289,250A patent/CA1125091A/en not_active Expired
- 1977-10-21 NO NO773611A patent/NO148939C/no unknown
- 1977-10-21 BE BE181939A patent/BE859969A/xx not_active IP Right Cessation
- 1977-10-21 CH CH1285877A patent/CH623409A5/de not_active IP Right Cessation
- 1977-10-21 FR FR7731821A patent/FR2368689B1/fr not_active Expired
- 1977-10-21 IT IT51523/77A patent/IT1091322B/it active
-
1979
- 1979-12-12 US US06/102,830 patent/US4770099A/en not_active Expired - Lifetime
-
1980
- 1980-09-15 NO NO802734A patent/NO802734L/no unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3512942A1 (de) * | 1985-04-11 | 1986-10-16 | Bundesrepublik Deutschland, vertreten durch den Bundesminister der Verteidigung, dieser vertreten durch den Präsidenten des Bundesamtes für Wehrtechnik und Beschaffung, 5400 Koblenz | Treibladungsanzuender |
| DE19534211A1 (de) * | 1995-09-15 | 1997-03-20 | Diehl Gmbh & Co | Sekundärgeschoß für einen Tandemgefechtskopf |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2648137C2 (de) | 1984-04-12 |
| IT1091322B (it) | 1985-07-06 |
| FR2368689A1 (fr) | 1978-05-19 |
| FR2368689B1 (fr) | 1986-03-21 |
| SE432481B (sv) | 1984-04-02 |
| SE7711826L (sv) | 1978-04-24 |
| NO148939B (no) | 1983-10-03 |
| NO148939C (no) | 1984-01-11 |
| DE2648137A1 (de) | 1978-04-27 |
| CA1125091A (en) | 1982-06-08 |
| BE859969A (fr) | 1978-02-15 |
| GB1593677A (en) | 1981-07-22 |
| NO773611L (no) | 1978-04-25 |
| GB1593678A (en) | 1981-07-22 |
| NO802734L (no) | 1978-04-25 |
| US4770099A (en) | 1988-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH623409A5 (enExample) | ||
| DE2443793C2 (de) | Kombiniertes Anzündhütchen | |
| DE69834939T2 (de) | Elektrisches Zündelement | |
| DE69308004T2 (de) | Pyrotechnische elektrische Anzünder | |
| DE69413135T2 (de) | Elektropyrotechnischer Anzünder | |
| DE69803262T2 (de) | Zündbauelement für pyrotechnische Zusammensetzungen oder Treibladungen | |
| DE69218650T2 (de) | Behälter, vorgesehen mit elektrischen Verbindungsmitteln | |
| EP0158121A2 (de) | Patronierte Munition für Rohrwaffen | |
| DE1001160B (de) | Elektrischer Aufschlagzuender fuer Geschosse | |
| DE3629371A1 (de) | Sprengzeitzuender | |
| DE2206468C2 (de) | Elektrische Zündung | |
| DE60216671T2 (de) | Anzünder für Treibladungen | |
| DE4445990C2 (de) | Patrone mit einer Patronenhülse und einem Pfeilgeschoß | |
| DE4445989C2 (de) | Patrone mit einer Patronenhülse und einem Pfeilgeschoß | |
| EP1102029A2 (de) | Treibladung mit einer Mehrpunktanzündung | |
| EP0185875B1 (de) | Kraftelement | |
| DE19830134B4 (de) | Leuchtfackel für einen Hubschrauber und Verfahren zum Erzeugen einer Köderspur | |
| DE2364272A1 (de) | Anzuendhuetchen fuer mechanische und elektrische zuendung | |
| EP1357349B1 (de) | Patrone | |
| DE3872818T2 (de) | Geschossboden fuer eine mit einem elektrischen zuender versehene grosskalibermunition. | |
| DE2506055A1 (de) | Elektrisches anzuendelement | |
| DE19848758B4 (de) | Induktives Anzündelement und Verfahren zum Herstellen eines induktiv initiierbaren Anzündelementes, insbesondere für hülsenlose Munition | |
| DE158580C (enExample) | ||
| EP2405229B1 (de) | Verbessertes Zündsystem für pyrotechnische Gegenstände | |
| AT251450B (de) | Hülse für Feuerwaffenmunition |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |