DE2554922A1 - Semipermeable membranen aus copolyamiden - Google Patents
Semipermeable membranen aus copolyamidenInfo
- Publication number
- DE2554922A1 DE2554922A1 DE19752554922 DE2554922A DE2554922A1 DE 2554922 A1 DE2554922 A1 DE 2554922A1 DE 19752554922 DE19752554922 DE 19752554922 DE 2554922 A DE2554922 A DE 2554922A DE 2554922 A1 DE2554922 A1 DE 2554922A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- nhoc
- aromatic
- semipermeable membranes
- units
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000012528 membrane Substances 0.000 title claims description 58
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 24
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 20
- 239000002904 solvent Substances 0.000 claims description 20
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 150000004985 diamines Chemical class 0.000 claims description 16
- 238000010521 absorption reaction Methods 0.000 claims description 14
- 229920000642 polymer Polymers 0.000 claims description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 12
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 238000010438 heat treatment Methods 0.000 claims description 9
- 238000005266 casting Methods 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- 238000005345 coagulation Methods 0.000 claims description 7
- 230000015271 coagulation Effects 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 6
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 6
- 239000012510 hollow fiber Substances 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 claims description 6
- 125000004957 naphthylene group Chemical group 0.000 claims description 6
- 238000001223 reverse osmosis Methods 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 238000000108 ultra-filtration Methods 0.000 claims description 6
- 229910013553 LiNO Inorganic materials 0.000 claims description 5
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 claims description 5
- 238000001816 cooling Methods 0.000 claims description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- 238000010612 desalination reaction Methods 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- 229920006254 polymer film Polymers 0.000 claims description 3
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 2
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical group C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 claims description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims 2
- 239000011888 foil Substances 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 31
- 229920002301 cellulose acetate Polymers 0.000 description 8
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 7
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 7
- 238000000926 separation method Methods 0.000 description 7
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 6
- 229940018564 m-phenylenediamine Drugs 0.000 description 6
- 230000035699 permeability Effects 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 208000029422 Hypernatremia Diseases 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000006068 polycondensation reaction Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- -1 m-phenylene, p-phenylene, biphenylene Chemical group 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001408 amides Chemical group 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000004760 aramid Substances 0.000 description 2
- 229920003235 aromatic polyamide Polymers 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- 229920005597 polymer membrane Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- KTFJPMPXSYUEIP-UHFFFAOYSA-N 3-benzoylphthalic acid Chemical compound OC(=O)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1C(O)=O KTFJPMPXSYUEIP-UHFFFAOYSA-N 0.000 description 1
- HSSYVKMJJLDTKZ-UHFFFAOYSA-N 3-phenylphthalic acid Chemical compound OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1C(O)=O HSSYVKMJJLDTKZ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 238000012696 Interfacial polycondensation Methods 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000035622 drinking Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D71/00—Semi-permeable membranes for separation processes or apparatus characterised by the material; Manufacturing processes specially adapted therefor
- B01D71/06—Organic material
- B01D71/56—Polyamides, e.g. polyester-amides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/32—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from aromatic diamines and aromatic dicarboxylic acids with both amino and carboxylic groups aromatically bound
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Polyamides (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752554922 DE2554922A1 (de) | 1975-12-06 | 1975-12-06 | Semipermeable membranen aus copolyamiden |
| GB49610/76A GB1539265A (en) | 1975-12-06 | 1976-11-29 | Semipermeable membranes of copolyamides |
| CA267,137A CA1102972A (en) | 1975-12-06 | 1976-12-03 | Semipermeable membranes of copolyamides |
| JP51144877A JPS5270990A (en) | 1975-12-06 | 1976-12-03 | Copolyamide semipermeable membrane |
| NL7613508A NL7613508A (nl) | 1975-12-06 | 1976-12-03 | Semipermeabele membranen uit copolyamiden. |
| AT897376A AT360048B (de) | 1975-12-06 | 1976-12-03 | Semipermeable membranen aus copolyamiden |
| IT30102/76A IT1124738B (it) | 1975-12-06 | 1976-12-03 | Membrane semipermeabili costituite da copoliammidi e procedimento per la loro preparazione |
| FR7636694A FR2333547A1 (fr) | 1975-12-06 | 1976-12-06 | Membranes semi-permeables en copolyamides et leur utilisation pour l'ultra-filtration ou l'osmose inverse |
| BE172993A BE849098A (fr) | 1975-12-06 | 1976-12-06 | Membranes semi-permeables en copolyamides, |
| US05/927,609 US4221903A (en) | 1975-12-06 | 1978-07-24 | Semipermeable membranes of heterocyclic copolyamides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752554922 DE2554922A1 (de) | 1975-12-06 | 1975-12-06 | Semipermeable membranen aus copolyamiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2554922A1 true DE2554922A1 (de) | 1977-06-16 |
Family
ID=5963654
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752554922 Withdrawn DE2554922A1 (de) | 1975-12-06 | 1975-12-06 | Semipermeable membranen aus copolyamiden |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4221903A (OSRAM) |
| JP (1) | JPS5270990A (OSRAM) |
| AT (1) | AT360048B (OSRAM) |
| BE (1) | BE849098A (OSRAM) |
| CA (1) | CA1102972A (OSRAM) |
| DE (1) | DE2554922A1 (OSRAM) |
| FR (1) | FR2333547A1 (OSRAM) |
| GB (1) | GB1539265A (OSRAM) |
| IT (1) | IT1124738B (OSRAM) |
| NL (1) | NL7613508A (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0068459A1 (en) * | 1981-06-25 | 1983-01-05 | E.I. Du Pont De Nemours And Company | Reverse osmosis membrane preparation |
| EP0077691A1 (en) * | 1981-10-21 | 1983-04-27 | E.I. Du Pont De Nemours And Company | Supported reverse osmosis membranes |
| DE3707851A1 (de) * | 1986-03-12 | 1987-09-17 | Toyo Boseki | Permselektive membran |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4260652A (en) * | 1977-06-08 | 1981-04-07 | Teijin Limited | Preparation of permselective composite membrane |
| JPS5850521B2 (ja) * | 1979-10-09 | 1983-11-11 | 日東電工株式会社 | ポリキナゾロン系重合体よりなる選択性透過膜 |
| JPS5855006A (ja) * | 1981-09-28 | 1983-04-01 | Mitsubishi Chem Ind Ltd | ポリスルホンエ−テルアミド膜 |
| US4454176A (en) * | 1981-10-21 | 1984-06-12 | E. I. Du Pont De Nemours And Company | Supported reverse osmosis membranes |
| US4661526A (en) * | 1983-02-02 | 1987-04-28 | Memtec Limited | Cross linked porous membranes |
| US4544484A (en) * | 1983-06-24 | 1985-10-01 | E. I. Du Pont De Nemours And Company | Reverse osmosis membrane quenching |
| JPS61259727A (ja) * | 1985-05-13 | 1986-11-18 | Agency Of Ind Science & Technol | 分離膜 |
| JPS62102802A (ja) * | 1985-10-31 | 1987-05-13 | Agency Of Ind Science & Technol | 気体分離膜 |
| JPS62102803A (ja) * | 1985-10-31 | 1987-05-13 | Agency Of Ind Science & Technol | 気体分離膜 |
| DE3744601A1 (de) * | 1987-12-31 | 1989-07-13 | Hoechst Ag | Faeden-, faser- oder filmbildende aromatische copolyamide, verfahren zu ihrer herstellung und verwendung |
| US5196501A (en) * | 1988-10-04 | 1993-03-23 | Hoechst Aktiengesellschaft | Substituted aromatic polyamides as orientation layers for liquid crystal display elements and liquid crystal switching elements |
| DE4123602A1 (de) * | 1991-07-17 | 1993-01-21 | Bayer Ag | Membranen aus aromatisch-heterocyclischen polyamiden, verfahren zu ihrer herstellung und ihre verwendung |
| US20080135721A1 (en) * | 2006-12-06 | 2008-06-12 | General Electric Company | Casting compositions for manufacturing metal casting and methods of manufacturing thereof |
| EP2844839A1 (en) | 2012-04-23 | 2015-03-11 | General Electric Company | Turbine airfoil with local wall thickness control |
| CN111921378B (zh) * | 2020-08-11 | 2021-12-21 | 郑州大学 | 一种可用于染料与盐分离的聚酰胺膜及其制备方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3376268A (en) * | 1964-02-26 | 1968-04-02 | Monsanto Co | Amide-heterocyclic polymers |
| US3567632A (en) * | 1968-09-04 | 1971-03-02 | Du Pont | Permselective,aromatic,nitrogen-containing polymeric membranes |
| US3696031A (en) * | 1969-07-08 | 1972-10-03 | Consiglio Nazionale Ricerche | Osmosis process |
| US3664986A (en) * | 1969-10-14 | 1972-05-23 | Du Pont | 1,2,5-thiadiazole polymers |
| DE1953358C3 (de) * | 1969-10-23 | 1980-09-11 | Bayer Ag, 5090 Leverkusen | Aromatische Copolyamide |
| DE2009741C3 (de) * | 1970-03-03 | 1980-07-31 | Bayer Ag, 5090 Leverkusen | Aromatische Copolyamide |
| DE2224506A1 (de) * | 1972-05-19 | 1973-11-29 | Bayer Ag | Hochmolekulare aromatische copolyamide |
| DE2224507A1 (de) * | 1972-05-19 | 1973-12-06 | Bayer Ag | Hochmolekulare aromatische copolyamide |
| US4123424A (en) * | 1973-05-07 | 1978-10-31 | Montedison S.P.A. | Polymeric piperazinamides and membranes for reverse osmosis made therefrom |
| US3993625A (en) * | 1973-05-28 | 1976-11-23 | Toray Industries, Inc. | Permselective polymeric membranes of organic polyamide or polyhydrazide |
-
1975
- 1975-12-06 DE DE19752554922 patent/DE2554922A1/de not_active Withdrawn
-
1976
- 1976-11-29 GB GB49610/76A patent/GB1539265A/en not_active Expired
- 1976-12-03 NL NL7613508A patent/NL7613508A/xx not_active Application Discontinuation
- 1976-12-03 JP JP51144877A patent/JPS5270990A/ja active Pending
- 1976-12-03 AT AT897376A patent/AT360048B/de not_active IP Right Cessation
- 1976-12-03 IT IT30102/76A patent/IT1124738B/it active
- 1976-12-03 CA CA267,137A patent/CA1102972A/en not_active Expired
- 1976-12-06 FR FR7636694A patent/FR2333547A1/fr active Granted
- 1976-12-06 BE BE172993A patent/BE849098A/xx not_active IP Right Cessation
-
1978
- 1978-07-24 US US05/927,609 patent/US4221903A/en not_active Expired - Lifetime
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0068459A1 (en) * | 1981-06-25 | 1983-01-05 | E.I. Du Pont De Nemours And Company | Reverse osmosis membrane preparation |
| EP0077691A1 (en) * | 1981-10-21 | 1983-04-27 | E.I. Du Pont De Nemours And Company | Supported reverse osmosis membranes |
| DE3707851A1 (de) * | 1986-03-12 | 1987-09-17 | Toyo Boseki | Permselektive membran |
| DE3707851C2 (de) * | 1986-03-12 | 1998-04-09 | Toyo Boseki | Permselektive Membran |
Also Published As
| Publication number | Publication date |
|---|---|
| BE849098A (fr) | 1977-06-06 |
| AT360048B (de) | 1980-12-10 |
| NL7613508A (nl) | 1977-06-08 |
| US4221903A (en) | 1980-09-09 |
| CA1102972A (en) | 1981-06-16 |
| FR2333547A1 (fr) | 1977-07-01 |
| GB1539265A (en) | 1979-01-31 |
| JPS5270990A (en) | 1977-06-13 |
| FR2333547B1 (OSRAM) | 1983-01-28 |
| ATA897376A (de) | 1980-05-15 |
| IT1124738B (it) | 1986-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2554922A1 (de) | Semipermeable membranen aus copolyamiden | |
| DE2642979C2 (de) | Semipermeable Membranen aus Polyamiden | |
| DE60212670T2 (de) | Verbundmembranen für nanofiltration und umkehrosmose sowie verfahren zu ihrer herstellung | |
| DE69110795T2 (de) | Mehrschichtige Umkehrosmose-Membran aus Polyamidharnstoff. | |
| DE2849978C3 (de) | Selektivdurchlässige Membran und Verfahren zu deren Herstellung | |
| DE69002165T2 (de) | Semipermeable membranen mit hohem fluss. | |
| DE69111531T2 (de) | Umkehrosmose-Membranen aus Polyamidurethan. | |
| US4217227A (en) | Semipermeable membranes of copolyamides | |
| DE2425563B2 (de) | Semipermeable membran | |
| DE69620720T2 (de) | Halbdurchlässige, zusammengesetzte Membran, Verfahren zur Herstellung einer derartigen Membran, und ihre Verwendung | |
| DE1949847A1 (de) | Neue semipermeable Membranen | |
| EP0382009B1 (de) | Semipermeable Membran aus einer homogen gemischten Polymerlegierung | |
| DE2531159A1 (de) | Semipermeable polymere membran und verfahren zu ihrer herstellung | |
| DE2554932A1 (de) | Semipermeable membranen aus copolyamiden | |
| DE2536492A1 (de) | Semipermeable membranen aus sulfonierten polybenz-1,3-oxazindionen- (2,4) | |
| EP0604882A2 (de) | Semipermeable membranen aus homogen mischbarenen Polymerlegierungen | |
| DE2418996A1 (de) | Asymmetrische, semipermeable membranen aus polybenz-1,3-oxazindionen-2,4 | |
| EP0102752B1 (en) | Polyamide of disulfonated diamine and permselective membrane thereof | |
| DE1950594A1 (de) | Neue semipermeable Membranen | |
| DE3038012C2 (de) | Selektiv durchlässige Membran auf Basis eines Polychinazolon-Polymers | |
| JPS5837842B2 (ja) | 限外濾過膜の製造方法 | |
| DE69030314T2 (de) | Semipermeable verbundmembran und deren herstellung | |
| DE60110738T2 (de) | Neuartige Verbund-Umkehrosmose-Membran und Verfahren zu ihrer Herstellung | |
| DE69010727T2 (de) | Verbundmembranen aus P-Xylylendiamid oder -diimid zur Umkehrosmose. | |
| JPS6151928B2 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |