DE2546251B2 - - Google Patents
Info
- Publication number
- DE2546251B2 DE2546251B2 DE2546251A DE2546251A DE2546251B2 DE 2546251 B2 DE2546251 B2 DE 2546251B2 DE 2546251 A DE2546251 A DE 2546251A DE 2546251 A DE2546251 A DE 2546251A DE 2546251 B2 DE2546251 B2 DE 2546251B2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- group
- parts
- weeds
- oxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 claims description 25
- 239000000460 chlorine Substances 0.000 description 36
- 241000196324 Embryophyta Species 0.000 description 35
- -1 pyridyl p-hydroxyphenyl ether Chemical class 0.000 description 23
- 239000000203 mixture Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 230000002363 herbicidal effect Effects 0.000 description 12
- 244000068988 Glycine max Species 0.000 description 11
- 235000010469 Glycine max Nutrition 0.000 description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 11
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- 230000009036 growth inhibition Effects 0.000 description 9
- 238000009472 formulation Methods 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 239000011734 sodium Substances 0.000 description 7
- 238000005507 spraying Methods 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- 235000005474 African couch grass Nutrition 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 241001520106 Eustachys Species 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 231100000674 Phytotoxicity Toxicity 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 240000002439 Sorghum halepense Species 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 244000105624 Arachis hypogaea Species 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 244000088415 Raphanus sativus Species 0.000 description 3
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 235000003130 Arctium lappa Nutrition 0.000 description 2
- 235000008078 Arctium minus Nutrition 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 244000025670 Eleusine indica Species 0.000 description 2
- 235000014716 Eleusine indica Nutrition 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 240000003461 Setaria viridis Species 0.000 description 2
- 235000002248 Setaria viridis Nutrition 0.000 description 2
- 235000010086 Setaria viridis var. viridis Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000001976 improved effect Effects 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000017066 negative regulation of growth Effects 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- SXERGJJQSKIUIC-UHFFFAOYSA-N 2-Phenoxypropionic acid Chemical compound OC(=O)C(C)OC1=CC=CC=C1 SXERGJJQSKIUIC-UHFFFAOYSA-N 0.000 description 1
- NDVWOBYBJYUSMF-UHFFFAOYSA-N 2-methylcyclohexan-1-ol Chemical compound CC1CCCCC1O NDVWOBYBJYUSMF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 240000005528 Arctium lappa Species 0.000 description 1
- 244000294263 Arctium minus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 235000002566 Capsicum Nutrition 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 240000003176 Digitaria ciliaris Species 0.000 description 1
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 244000048927 Lolium temulentum Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 239000006002 Pepper Substances 0.000 description 1
- 240000000275 Persicaria hydropiper Species 0.000 description 1
- 235000017337 Persicaria hydropiper Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 235000016761 Piper aduncum Nutrition 0.000 description 1
- 235000017804 Piper guineense Nutrition 0.000 description 1
- 244000203593 Piper nigrum Species 0.000 description 1
- 235000008184 Piper nigrum Nutrition 0.000 description 1
- 244000292697 Polygonum aviculare Species 0.000 description 1
- 235000006386 Polygonum aviculare Nutrition 0.000 description 1
- 206010041243 Social avoidant behaviour Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- 235000015872 dietary supplement Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- NVVZQXQBYZPMLJ-UHFFFAOYSA-N formaldehyde;naphthalene-1-sulfonic acid Chemical compound O=C.C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 NVVZQXQBYZPMLJ-UHFFFAOYSA-N 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000000442 meristematic effect Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 235000014571 nuts Nutrition 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920000259 polyoxyethylene lauryl ether Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- HLPHHOLZSKWDAK-UHFFFAOYSA-M sodium;formaldehyde;naphthalene-1-sulfonate Chemical compound [Na+].O=C.C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HLPHHOLZSKWDAK-UHFFFAOYSA-M 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11867674A JPS5327768B2 (enExample) | 1974-10-17 | 1974-10-17 | |
| JP2955675A JPS51106735A (ja) | 1975-03-13 | 1975-03-13 | Josozai |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2546251A1 DE2546251A1 (de) | 1976-04-29 |
| DE2546251B2 true DE2546251B2 (enExample) | 1980-01-31 |
| DE2546251C3 DE2546251C3 (enExample) | 1980-10-02 |
Family
ID=26367766
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752546251 Granted DE2546251A1 (de) | 1974-10-17 | 1975-10-15 | Alpha- eckige klammer auf 4-(5- mono-substituiert- oder 3,5-disubstituiert-pyridyl-2-oxy)phenoxy eckige klammer zu alkancarbonsaeuren und ihre derivate |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US4046553A (enExample) |
| AR (1) | AR209784A1 (enExample) |
| AT (1) | AT350317B (enExample) |
| AU (1) | AU496882B2 (enExample) |
| BG (1) | BG28025A3 (enExample) |
| BR (1) | BR7506722A (enExample) |
| CA (1) | CA1061786A (enExample) |
| CH (1) | CH616662A5 (enExample) |
| CS (1) | CS189723B2 (enExample) |
| DD (1) | DD123425A5 (enExample) |
| DE (1) | DE2546251A1 (enExample) |
| DK (1) | DK154074C (enExample) |
| EG (1) | EG12043A (enExample) |
| ES (1) | ES456653A1 (enExample) |
| FR (1) | FR2288089A1 (enExample) |
| GB (1) | GB1491274A (enExample) |
| IN (1) | IN143116B (enExample) |
| IT (1) | IT1047828B (enExample) |
| MX (1) | MX3476E (enExample) |
| MY (1) | MY7800323A (enExample) |
| NL (1) | NL166468C (enExample) |
| NZ (1) | NZ178959A (enExample) |
| OA (1) | OA05134A (enExample) |
| PH (1) | PH12116A (enExample) |
| PL (1) | PL99026B1 (enExample) |
| RO (1) | RO68925A (enExample) |
| SE (1) | SE426241C (enExample) |
| SU (1) | SU634640A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2640730A1 (de) * | 1976-09-10 | 1978-03-16 | Hoechst Ag | Heterocyclische phenylaether und diese enthaltende herbizide mittel |
Families Citing this family (69)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083714A (en) * | 1974-10-17 | 1978-04-11 | Ishihara Sangyo Kaisha, Ltd. | Alkoxyalkyl esters of substituted pyridyloxyphenoxy-2-propanoic acids, herbicidal composition containing the same and method of use thereof |
| GB1512189A (en) * | 1975-10-29 | 1978-05-24 | Ishihara Mining & Chemical Co | Herbicidal composition and method of use thereof |
| JPS52131544A (en) | 1976-04-08 | 1977-11-04 | Ishihara Sangyo Kaisha Ltd | Phenoxymalonic acid derivatives and herbicides containing them |
| JPS52131540A (en) * | 1976-04-14 | 1977-11-04 | Ishihara Sangyo Kaisha Ltd | Phenoxyvaleric acid derivatives and herbicides therefrom |
| US4133675A (en) * | 1976-07-23 | 1979-01-09 | Ciba-Geigy Corporation | Pyridyloxy-phenoxy-alkanecarboxylic acid derivatives which are effective as herbicides and as agents regulating plant growth |
| US4198416A (en) * | 1976-09-30 | 1980-04-15 | Meiji Seika Kaisha, Ltd. | 5-Alkoxy-picolinic esters and anti-hypertensive composition containing 5-alkoxy-picolinic esters |
| US4248618A (en) * | 1977-05-06 | 1981-02-03 | Ici Australia Limited | Derivatives of (pyrimidyloxy)phenoxy-alkanecarboxylic acid and herbicidal compositions thereof |
| EP0000176B1 (de) * | 1977-06-29 | 1981-09-16 | Ciba-Geigy Ag | Pyridyloxy-phenoxy-alkancarbonsäurederivate, Verfahren zu deren Herstellung, und deren Verwendung als Herbizide oder als pflanzenwachstumsregulierende Mittel |
| US4149872A (en) * | 1977-07-21 | 1979-04-17 | Shell Oil Company | N-pyridinyl urea and cyclopropanecarboxamide herbicides |
| JPS54119476A (en) * | 1978-03-10 | 1979-09-17 | Ishihara Sangyo Kaisha Ltd | 4-(5-fluoromethyl-2-pyridyloxy)phenoxyalkanecarbocyic acid derivatives and their preparation |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| UA6300A1 (uk) * | 1977-07-21 | 1994-12-29 | Ісіхара Сангіо Кайся Лтд | Гербіцидний склад |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| US4628099A (en) * | 1977-07-22 | 1986-12-09 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy propanoic acid chlorides |
| US4479001A (en) * | 1977-07-22 | 1984-10-23 | The Dow Chemical Company | Trifluoromethyl pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof |
| US4523017A (en) * | 1977-07-22 | 1985-06-11 | The Dow Chemical Company | Preparation of trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof |
| US4491468A (en) * | 1977-07-22 | 1985-01-01 | The Dow Chemical Company | Herbicidal trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanenitriles and derivatives thereof |
| DE2862490D1 (en) * | 1977-08-12 | 1988-04-21 | Ici Plc | Phenoxypyridine compound |
| US4275212A (en) * | 1977-08-15 | 1981-06-23 | The Dow Chemical Company | Method of preparing pyridinyloxyphenols and derivatives |
| EP0002204B1 (de) * | 1977-11-24 | 1981-09-02 | Ciba-Geigy Ag | Alpha-phenoxy-propionthiolsäuren und Salze, ihre Herstellung und Verwendung als Herbizide oder Zwischenprodukte |
| US4325729A (en) * | 1977-12-13 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal and plant growth regulating pyridyloxy-phenoxy-propionic acid derivatives |
| DE2755536A1 (de) * | 1977-12-13 | 1979-06-21 | Ciba Geigy Ag | Neue herbizid und pflanzenregulatorisch wirksame pyridyloxy-phenoxy-propionsaeurederivate |
| WO1979000427A1 (en) * | 1977-12-23 | 1979-07-12 | Ici Ltd | Herbicidal pyridine derivative |
| CH650493A5 (en) * | 1977-12-24 | 1985-07-31 | Hoechst Ag | D-(+)-alpha-phenoxypropionic acid derivatives |
| DE2861615D1 (en) * | 1978-01-02 | 1982-03-11 | Ciba Geigy Ag | Phenoxy-alkyl oxazolines, their preparation, compositions containing them and their application as herbicides |
| DE2961917D1 (en) * | 1978-01-18 | 1982-03-11 | Ciba Geigy Ag | Herbicidal active unsaturated esters of 4- (3',5'-dihalogenpyridyl-(2')-oxy)-alpha-phenoxy propionic acids, process for their preparation, herbicidal compositions containing them and their use |
| AT379802B (de) * | 1978-01-27 | 1986-03-10 | Ciba Geigy Ag | Verfahren zur herstellung von neuen alpha-(pyridyloxy-phenoxy-propionsaeure-aminoalk l-estern |
| EP0003648A3 (en) * | 1978-02-15 | 1979-09-05 | Imperial Chemical Industries Plc | 4-aryloxy-substituted phenoxypropionamide derivatives useful as herbicides, compositions containing them, and processes for making them |
| WO1979000624A1 (en) * | 1978-02-15 | 1979-09-06 | Ici Ltd | Herbicidal derivatives of 2-(4(2-pyridyloxy)phenoxy)propane,processes for preparing them,and herbicidal compositions containing them |
| EP0003890B2 (en) * | 1978-03-01 | 1990-04-04 | Imperial Chemical Industries Plc | Herbicidal pyridine compounds and herbicidal compositions containing them |
| DE2967486D1 (en) * | 1978-03-01 | 1985-08-29 | Ici Plc | Mixtures of herbicidal pyridyloxyphenoxypropanoic acid derivatives with other herbicides, and processes of killing unwanted plants therewith |
| DE2961736D1 (en) * | 1978-03-17 | 1982-02-25 | Ciba Geigy Ag | Derivatives of phenoxy-alkanecarboxylic acids, their preparation, weed-killing products containing them and their use |
| JPS54144375A (en) * | 1978-04-27 | 1979-11-10 | Ishihara Sangyo Kaisha Ltd | 4-(5-trifluoromethyl-2-pyridyloxy)phenoxyalkane derivative and herbicide containing the same |
| JPS54163582A (en) * | 1978-06-09 | 1979-12-26 | Ishihara Mining & Chemical Co | 22phenoxyy55 trifluoromethypiridine compound |
| ATE1284T1 (de) * | 1978-06-29 | 1982-07-15 | Ciba-Geigy Ag | Herbizid wirksame, optisch aktive r(+)-dichlorpyridyloxy-al pha-phenoxy-propionsaeure-propargylester, verfahren zu ihrer herstellung und deren verwendung in mitteln zur unkrautbekaempfung. |
| ATE721T1 (de) * | 1978-07-03 | 1982-03-15 | Ciba-Geigy Ag | Ester von o-(pyridyloxy-phenyl)-milchsaeuren, verfahren zu ihrer herstellung und ihre verwendung als herbizide und pflanzenwachstumsregulatoren. |
| US4325728A (en) * | 1978-07-20 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal compositions containing N-(3-trifluoromethyl-1,2,4-thiadiazolyl-5)-N'-methyl-N'-methoxy urea and α-[4-(3'-5'-dichloropyridyl-2'-oxy)-phenoxy]-propionic acid propargyl ester for control of weeds in wheat cultures |
| US4272281A (en) * | 1978-07-20 | 1981-06-09 | Ciba-Geigy Corporation | Composition for and method of selectively controlling weeds in cereals |
| US4284566A (en) * | 1979-01-04 | 1981-08-18 | Ciba-Geigy Corporation | Herbicidal α-[4-trifluoromethylphenoxy)-propionic acid γ-butyrolactone ester and thioester |
| JPS6033389B2 (ja) * | 1979-02-22 | 1985-08-02 | 日産化学工業株式会社 | 複素環エ−テル系フェノシキ脂肪酸誘導体、その製造法および該誘導体を含有する除草剤 |
| US4236912A (en) * | 1979-03-05 | 1980-12-02 | The Dow Chemical Company | Quinolinyloxyphenoxy and quinolyinylthiophenoxy alkanoic acids and derivatives thereof and methods of herbicidal use |
| JPS55139361A (en) * | 1979-04-19 | 1980-10-31 | Ishihara Sangyo Kaisha Ltd | Preparation of 4-(pyridyl-2-oxy)phenoxyalkane-carboxylic acid or its derivative |
| WO1981000563A1 (en) * | 1979-08-23 | 1981-03-05 | Du Pont | Pyridinyloxyphenoxy lower alkenoic acids,esters or amides thereof as selective weed control agents |
| US4311513A (en) * | 1979-08-24 | 1982-01-19 | Ciba-Geigy Corporation | Herbicidal α-phenoxypropionylazoles, compositions containing them, and method of use thereof |
| US4266063A (en) * | 1979-12-17 | 1981-05-05 | E. I. Du Pont De Nemours And Company | Process for preparing substituted pyridinyloxy ether intermediate |
| WO1982000400A1 (en) * | 1980-07-30 | 1982-02-18 | Smith L | Method for selectively controlling grassy weeds in rice |
| US5364831A (en) * | 1980-08-06 | 1994-11-15 | Nissan Chemical Industries Ltd. | Quinoxaline derivatives and herbicidal composition |
| US4410701A (en) * | 1981-06-01 | 1983-10-18 | The Dow Chemical Company | Process for making pyridyloxyphenol compounds |
| AU547854B2 (en) * | 1981-06-01 | 1985-11-07 | Dow Chemical Company, The | Preparation of pyridyloxyphenol compounds |
| DE3151589A1 (de) * | 1981-12-28 | 1983-07-07 | Basf Ag, 6700 Ludwigshafen | Diether von m- oder p-hydroxyphenolen und verfahren zur herstellung der diether oder monoether von m- oder p-hydroxyphenolen |
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
| JPS58183688A (ja) * | 1982-04-20 | 1983-10-26 | Nippon Tokushu Noyaku Seizo Kk | オキサジアゾ−ル誘導体、その製法及び除草剤 |
| IL68822A (en) * | 1982-06-18 | 1990-07-12 | Dow Chemical Co | Pyridyl(oxy/thio)phenoxy compounds,herbicidal compositions and methods of using them |
| IL71668A (en) * | 1983-05-13 | 1988-07-31 | Dow Chemical Co | Method of preparing esters of aryloxyphenoxy propanoic acid |
| US4681941A (en) * | 1983-05-13 | 1987-07-21 | The Dow Chemical Company | Method of preparing esters of aryloxyphenoxy propanoic acid |
| US4517368A (en) * | 1983-09-06 | 1985-05-14 | The Dow Chemical Company | 2,3-Dichloro-5-iodopyridine and methods of making and using the same |
| JPS60136561A (ja) * | 1983-11-28 | 1985-07-20 | ザ・ダウ・ケミカル・カンパニ− | 2−(4−〔(3−クロロ−5−ヨ−ド−2−ピリジニル)オキシ〕フエノキシ)プロピオン酸及びその誘導体並びにそれらの製造方法 |
| US4537620A (en) * | 1984-07-02 | 1985-08-27 | Stauffer Chemical Company | Aryloxyphenoxy proponyl isothioureas and use as herbicides |
| US4613356A (en) * | 1984-08-06 | 1986-09-23 | Stauffer Chemical Company | Aryloxyphenoxy propionylthioureas which are useful as herbicides |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| US4897481A (en) * | 1988-05-31 | 1990-01-30 | The Dow Chemical Company | Process for the minimization of racemization in the preparation of optically active ((aryloxy)phenoxy)propionate herbicides |
| US5049675A (en) * | 1990-01-29 | 1991-09-17 | Dowelanco | Solvent-free process for the preparation of ((pyridinyloxy)phenoxy) propionate derivatives |
| IL109104A (en) * | 1993-03-26 | 1998-08-16 | Shell Int Research | History of pyridine from wool - 2,6 Preparation and use as herbicides containing them |
| KR100884933B1 (ko) * | 2007-07-03 | 2009-02-23 | 주식회사경농 | 광활성 (r)-알릴옥시프로피온산 아마이드 화합물 및 이를포함하는 제초제 조성물 |
| US10543481B2 (en) | 2011-08-19 | 2020-01-28 | Trustees Of Princeton Univesity | Targeted, metal-catalyzed fluorination of complex compounds with fluoride ion via decarboxylation |
| US20180368403A1 (en) * | 2015-12-01 | 2018-12-27 | Basf Se | Pyridine compounds as fungicides |
| CN106632258B (zh) * | 2016-12-15 | 2019-04-02 | 三峡大学 | 四氢异喹啉-2-基芳氧基苯氧基烷基酮化合物及其应用 |
| CN110627782B (zh) * | 2019-10-14 | 2023-03-31 | 山东胜邦绿野化学有限公司 | 一种含二硫键的吡啶氧基苯氧基丙酰胺化合物的制备方法与应用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH434868A (de) * | 1964-02-10 | 1967-04-30 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| GB1210151A (en) * | 1967-06-15 | 1970-10-28 | Ishihara Sangyo Co Ltd | Novel compounds of chloro- or methyl substituted pyridyl phenyl ethers |
| US3651072A (en) * | 1967-08-21 | 1972-03-21 | Monsanto Co | 3-(halophenoxy) pyridines |
| US3563998A (en) * | 1968-07-08 | 1971-02-16 | Sandoz Ag | 2 - (4 - (2',6' - diphenyl - 4 - pyridyl)phenoxy)-and 2 - (4 - (4',6' - diphenyl - 2 -pyridyl)phenoxy) lower aliphatic monocarbocylic acids and esters |
| US3609158A (en) * | 1969-03-17 | 1971-09-28 | Dow Chemical Co | Certain substituted (pyridyl)-oxy acetic acid derivatives |
| US3576616A (en) * | 1969-05-15 | 1971-04-27 | Monsanto Co | Herbicidal compositions and methods |
| JPS5517027B2 (enExample) * | 1972-05-15 | 1980-05-08 | ||
| DE2223894C3 (de) * | 1972-05-17 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Herbizide Mittel auf Basis von Phenoxycarbonsäurederivaten |
| US3962265A (en) * | 1974-01-22 | 1976-06-08 | The Dow Chemical Company | H'-(4-((6-chloro-2-pyridinyl)oxy)phenyl)-n-methyl-n-(1-methyl-2-propynyl)urea |
| US3931201A (en) * | 1974-01-22 | 1976-01-06 | The Dow Chemical Company | Substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives |
-
1975
- 1975-10-09 DK DK454775A patent/DK154074C/da active
- 1975-10-10 GB GB41560/75A patent/GB1491274A/en not_active Expired
- 1975-10-10 AU AU85623/75A patent/AU496882B2/en not_active Expired
- 1975-10-15 CS CS756969A patent/CS189723B2/cs unknown
- 1975-10-15 NZ NZ178959A patent/NZ178959A/xx unknown
- 1975-10-15 IT IT7551774A patent/IT1047828B/it active
- 1975-10-15 BR BR7506722*A patent/BR7506722A/pt unknown
- 1975-10-15 DE DE19752546251 patent/DE2546251A1/de active Granted
- 1975-10-15 NL NL7512095.A patent/NL166468C/xx not_active IP Right Cessation
- 1975-10-16 CA CA237,770A patent/CA1061786A/en not_active Expired
- 1975-10-16 CH CH1342875A patent/CH616662A5/de not_active IP Right Cessation
- 1975-10-16 MX MX006399U patent/MX3476E/es unknown
- 1975-10-16 SU SU752180109A patent/SU634640A3/ru active
- 1975-10-16 AR AR260838A patent/AR209784A1/es active
- 1975-10-16 SE SE7511634A patent/SE426241C/xx not_active IP Right Cessation
- 1975-10-17 PH PH17670A patent/PH12116A/en unknown
- 1975-10-17 BG BG031254A patent/BG28025A3/xx unknown
- 1975-10-17 IN IN2013/CAL/1975A patent/IN143116B/en unknown
- 1975-10-17 PL PL1975184059A patent/PL99026B1/pl unknown
- 1975-10-17 OA OA55637A patent/OA05134A/xx unknown
- 1975-10-17 RO RO7583636A patent/RO68925A/ro unknown
- 1975-10-17 AT AT790775A patent/AT350317B/de not_active IP Right Cessation
- 1975-10-17 FR FR7531887A patent/FR2288089A1/fr active Granted
- 1975-10-17 DD DD188924A patent/DD123425A5/xx unknown
- 1975-10-17 US US05/623,517 patent/US4046553A/en not_active Expired - Lifetime
- 1975-10-18 EG EG613/75A patent/EG12043A/xx active
-
1977
- 1977-03-01 ES ES456653A patent/ES456653A1/es not_active Expired
-
1978
- 1978-12-30 MY MY323/78A patent/MY7800323A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2640730A1 (de) * | 1976-09-10 | 1978-03-16 | Hoechst Ag | Heterocyclische phenylaether und diese enthaltende herbizide mittel |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2546251B2 (enExample) | ||
| DE2649706C2 (de) | ß-[4-(Pyridyl-2-oxy)phenoxy] - propanderivate und Herbicide, welche diese enthalten | |
| DE2812571C2 (de) | 2-[4-(5-Trifluormethyl-2-pyridyloxy)-phenoxy]-propionsäurederivate und Herbicide, die diese Verbindungen enthalten | |
| DE3786185T2 (de) | 5H-1,3,4-Thiazol[3,2-a]pyrimidin-5-on-Derivate und diese enthaltende fungizide Zubereitungen. | |
| DE2531643A1 (de) | Herbizide verbindungen, unkrautvertilgungsmittel, worin diese enthalten sind, und verfahren zu ihrer anwendung | |
| DE2406475C2 (de) | 5-Acetamido-2,4-dimethyltrifluormethansulfonanilid und dessen landwirtschaftlich geeignete Salze, Verfahren zur Herstellung dieser Verbindungen und diese Verbindungen enthaltende Mittel | |
| DE2428372C2 (de) | Fluoralkoxyphenylsubstituierte Stickstoffheterozyklen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende wachstumsinhibierende Zubereitung | |
| DD142418A5 (de) | Herbicide zum selektiven bekaempfen von grasartigen unkraeutern | |
| DE3146309A1 (de) | Substituierte 2-/1-(oxyamino)-alkyliden/-cyclohexan-1,3-dione, diese enthaltende herbizide mittel und verfahren zum abtoeten einer vegetation | |
| DE1518432A1 (de) | Pesticide Mittel und Verfahren zu ihrer Herstellung | |
| DE69017383T2 (de) | Substituierte bicycloheptadionderivate. | |
| CH620339A5 (enExample) | ||
| EP0007089B1 (de) | Acylanilide mit herbicider und fungicider Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0058639B1 (de) | 2-(4-(6-Halogen-chinoxalinyl-2-oxy)-phenoxy)-propionsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide und Pflanzenwuchsregulatoren | |
| DD210190A5 (de) | Herbizides mittel | |
| DE1567131A1 (de) | Herbizide Komposition und Verfahren zu ihrer Anwendung | |
| DE2714662C3 (de) | Phenoxymalonsäuren und deren Derivate sowie herbizide Zusammensetzungen, welche diese enthalten | |
| CH657847A5 (de) | 2-(1-oximino-butyl)-5-(2-aethylthiopropyl)-3-oxy-2-cyclohexenone, herbizide zusammensetzungen, welche diese enthalten und verfahren zur bekaempfung von unkraeutern. | |
| DE2524578B2 (de) | 5-hydroxylaminomethylen-barbitursaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als herbicide | |
| DE2114018C3 (de) | 3-(2-Tetrahydropyranyl)-l,23,4tetrahydropyrimidin-2,4-dione, Verfahren zu ihrer Herstellung und pesticide Zusammensetzungen | |
| DD262992A5 (de) | Nematizide und insektizide zusammensetzung | |
| EP0249858B1 (de) | Fluoralkylsubstituierte Chinolinderivate. ihre Herstellung sowie Verwendung zur Bekämpfung unerwünschten Pflanzenwachstums | |
| DD290570A5 (de) | Herbizides mittel | |
| DE3144526A1 (de) | N-phenyl-dichlormaleinimid-derivate sowie ihre verwendung als agrikultur- und hortikultur-fungizide | |
| DE2523742A1 (de) | Benzofuranylverbindungen, verfahren zu deren herstellung und deren verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |