DE2545194C2 - Mittel zur Behandlung von Hyperhidrose zur topischen Anwendung - Google Patents
Mittel zur Behandlung von Hyperhidrose zur topischen AnwendungInfo
- Publication number
- DE2545194C2 DE2545194C2 DE2545194A DE2545194A DE2545194C2 DE 2545194 C2 DE2545194 C2 DE 2545194C2 DE 2545194 A DE2545194 A DE 2545194A DE 2545194 A DE2545194 A DE 2545194A DE 2545194 C2 DE2545194 C2 DE 2545194C2
- Authority
- DE
- Germany
- Prior art keywords
- hyperhidrosis
- agent
- treatment
- coo
- topical use
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 208000008454 Hyperhidrosis Diseases 0.000 title claims description 4
- 230000037315 hyperhidrosis Effects 0.000 title claims description 4
- 230000000699 topical effect Effects 0.000 title claims description 4
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000004480 active ingredient Substances 0.000 claims description 2
- 239000003883 ointment base Substances 0.000 claims 1
- 239000002253 acid Substances 0.000 description 6
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 6
- 235000008206 alpha-amino acids Nutrition 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- 241000283973 Oryctolagus cuniculus Species 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical class CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- JGDITNMASUZKPW-UHFFFAOYSA-K aluminium trichloride hexahydrate Chemical compound O.O.O.O.O.O.Cl[Al](Cl)Cl JGDITNMASUZKPW-UHFFFAOYSA-K 0.000 description 3
- 229940009861 aluminum chloride hexahydrate Drugs 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 230000000622 irritating effect Effects 0.000 description 3
- 235000018102 proteins Nutrition 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 102000008186 Collagen Human genes 0.000 description 2
- 108010035532 Collagen Proteins 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 229920001436 collagen Polymers 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 2
- 125000005480 straight-chain fatty acid group Chemical group 0.000 description 2
- -1 Caprylyl Glycinate Chemical compound 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 102000004895 Lipoproteins Human genes 0.000 description 1
- 108090001030 Lipoproteins Proteins 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 231100000460 acute oral toxicity Toxicity 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- RKKNSBRXYGXYTL-UHFFFAOYSA-N octanoyloxysulfonylmethanesulfonic acid Chemical compound CCCCCCCC(=O)OS(=O)(=O)CS(=O)(=O)O RKKNSBRXYGXYTL-UHFFFAOYSA-N 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Peptides Or Proteins (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicinal Preparation (AREA)
- Cosmetics (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7435929A FR2289179A1 (fr) | 1974-10-28 | 1974-10-28 | Sels metalliques de lipoaminoacides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2545194A1 DE2545194A1 (de) | 1976-04-29 |
| DE2545194C2 true DE2545194C2 (de) | 1985-06-20 |
Family
ID=9144464
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2545194A Expired DE2545194C2 (de) | 1974-10-28 | 1975-10-09 | Mittel zur Behandlung von Hyperhidrose zur topischen Anwendung |
| DE19752559717 Granted DE2559717A1 (de) | 1974-10-28 | 1975-10-09 | Metallverbindungen und ihre verwendung zum behandeln von metallmangelerscheinungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752559717 Granted DE2559717A1 (de) | 1974-10-28 | 1975-10-09 | Metallverbindungen und ihre verwendung zum behandeln von metallmangelerscheinungen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4089954A (OSRAM) |
| DE (2) | DE2545194C2 (OSRAM) |
| FR (1) | FR2289179A1 (OSRAM) |
| GB (1) | GB1468646A (OSRAM) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2715711A1 (de) * | 1977-04-07 | 1978-10-19 | Robugen Gmbh | Topisch anwendbares arzneimittel zur behandlung von viruserkrankungen der haut und der schleimhaut |
| JPS55118971A (en) * | 1979-03-08 | 1980-09-12 | Nippon Shikizai Kogyo Kenkyusho:Kk | Brightness modifier and modification of brightness |
| FR2462192B1 (fr) * | 1979-08-02 | 1986-08-01 | Oreal | Emulsions du type " eau-dans-l'huile " utilisables comme supports cosmetiques ou excipients pharmaceutiques |
| JPS58140026A (ja) * | 1982-01-14 | 1983-08-19 | Toyo Jozo Co Ltd | 吸収性良好な製剤 |
| FR2503153A1 (fr) * | 1981-04-02 | 1982-10-08 | Morelle Jean | Butyrylaminoacides. mode de preparation. emploi dans les domaines cosmetique, hygienique, therapeutique et agricole |
| JPS5872512A (ja) * | 1981-10-26 | 1983-04-30 | Miyoshi Kasei:Kk | メ−クアツプ化粧料 |
| US4675422A (en) * | 1985-10-23 | 1987-06-23 | Stepan Company | Organometallic compounds |
| FR2636238B1 (fr) * | 1988-09-14 | 1994-01-21 | Morelle Jean | Nouvelles compositions antisudorales |
| DE69013477T2 (de) * | 1989-06-12 | 1995-02-23 | Shiseido Co Ltd | Mittel gegen juckreiz. |
| FR2649697A1 (fr) * | 1989-07-11 | 1991-01-18 | Oreal | Nouveaux derives d'urethanne, leur preparation et leur application notamment comme agents hydratants dans des compositions cosmetiques ou pharmaceutiques destinees au traitement des peaux seches |
| JPH0578243A (ja) * | 1990-12-11 | 1993-03-30 | Shiseido Co Ltd | 鎮痒剤及び鎮痒組成物 |
| US5889050A (en) * | 1991-06-21 | 1999-03-30 | Astra Aktiebolag | 3,3'-dithiobis (propionic acids) and esters thereof |
| FR2698869B1 (fr) * | 1992-12-09 | 1995-02-24 | Morelle Jean | Acylaminoacides obtenus à partir de fibres issues du Bombyx Mori. |
| SE9500897D0 (sv) * | 1995-03-14 | 1995-03-14 | Astra Ab | The pharmacological use of certain cystine derivatives |
| FR2834215B1 (fr) * | 2001-12-27 | 2004-07-16 | Physica | Composes amphiphiles a usage pharmaceutique ou cosmetique |
| DE10257738A1 (de) * | 2002-12-10 | 2004-06-24 | Henkel Kgaa | 5-Lipoxigenase-Inhibitoren in Deodorantien und Antitranspirantien |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2463779A (en) * | 1947-08-26 | 1949-03-08 | Ernest B Kester | N-acylated derivatives of glutamic acid and process for preparing them |
| US2909535A (en) * | 1955-03-15 | 1959-10-20 | Colgate Palmolive Co | Novel higher aliphatic acid derivatives and compositions containing the same |
| US2842479A (en) * | 1955-05-24 | 1958-07-08 | Colgate Palmolive Co | Nu-higher aliphatic acyl alpha-amino aryl acetic acids and compositions therewith |
| NL123441C (OSRAM) * | 1964-01-17 | |||
| NL132126C (OSRAM) * | 1966-10-13 | |||
| GB1168302A (en) * | 1967-05-12 | 1969-10-22 | Roland-Yves Mauvernay | Aluminium N-Acetylglycinate and Pharmaceutical Compositions containing the same |
| US3836551A (en) * | 1970-01-30 | 1974-09-17 | Roehm Gmbh | Method for making salts of n-acylamino carboxylic acids |
| DE2111361B2 (de) * | 1971-03-10 | 1973-02-15 | Verwendung von n-acylaminosaeuren, deren salzen und/oder estern als emulgatoren | |
| FR2147822B1 (OSRAM) * | 1971-07-30 | 1974-10-18 | Centre Etd Ind Pharma | |
| GB1356370A (en) * | 1972-03-06 | 1974-06-12 | Howard A N | Methods and formulations for the treatment of obesity |
| GB1433314A (en) | 1973-08-09 | 1976-04-28 | Rhone Poulenc Sa | Aluminium and/or magnesium salts |
-
1974
- 1974-10-28 FR FR7435929A patent/FR2289179A1/fr active Granted
-
1975
- 1975-10-09 DE DE2545194A patent/DE2545194C2/de not_active Expired
- 1975-10-09 DE DE19752559717 patent/DE2559717A1/de active Granted
- 1975-10-14 US US05/621,954 patent/US4089954A/en not_active Expired - Lifetime
- 1975-10-27 GB GB4403775A patent/GB1468646A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4089954A (en) | 1978-05-16 |
| DE2559717A1 (de) | 1977-08-11 |
| GB1468646A (en) | 1977-03-30 |
| DE2545194A1 (de) | 1976-04-29 |
| FR2289179B1 (OSRAM) | 1978-07-21 |
| FR2289179A1 (fr) | 1976-05-28 |
| DE2559717C2 (OSRAM) | 1988-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2545194C2 (de) | Mittel zur Behandlung von Hyperhidrose zur topischen Anwendung | |
| DE69909135T2 (de) | Orale zubereitung zur bekämpfung von mundgeruch | |
| DE2350315C2 (de) | Pharmazeutische und kosmetische Präparate zur äußerlichen Anwendung | |
| DE69600120T2 (de) | Verwendung eines Antagonisten der Substanz P in einer topischen Zusammensetzung als Antitranspirationsmittel | |
| DE2449880A1 (de) | Adstringens-zubereitung und deren verwendung als antiperspirant | |
| DE3930638A1 (de) | Verbindungen gegen uebermaessiges schwitzen | |
| DE3832219A1 (de) | Zusammensetzungen zur topischen anwendung mit melaninsynthese-inhibitoraktivitaet | |
| DE69501105T2 (de) | L-Carnitin-Salz, dieses enthaltende kosmetische und pharmazeutische Zusammensetzungen zur Behandlung von Dermatosen | |
| DE2931379A1 (de) | Kosmetisches mittel | |
| DE3415413A1 (de) | Melanin-inhibitor | |
| CH644755A5 (de) | Antitranspirations-zubereitung mit einem traeger und einer aktiven, transpirationsverhindernden komponente. | |
| DE69400996T2 (de) | Kosmetische Haarwaschmittel | |
| EP0027655A2 (de) | Verwendung von kosmetischen Mitteln zur Behandlung der Haare und der Kopfhaut | |
| DE2438534A1 (de) | Kopfhautpflegemittel und dessen verwendung | |
| DE3544267C2 (OSRAM) | ||
| DE2523866A1 (de) | Schweisshemmendes mittel | |
| DE2018599A1 (de) | Aknemittel | |
| WO2022069744A1 (de) | Zusammensetzung zur behandlung von haaren und der kopfhaut | |
| DE69120992T2 (de) | Alkyldiamide und kosmetische Behandlungszusammensetzungen | |
| DE3784821T2 (de) | Zusammensetzung zur anwendung an haaren. | |
| DE2504615B2 (de) | Verfahren zur herstellung eines geles mit einem gehalt an beta-methason- 17-benzoat bzw. fluocinolonacetonid und neomycin | |
| DE3133425A1 (de) | "percarbonsaeuren als antiseborrohische zusaetze fuer kosmetische mittel" | |
| DE1908574A1 (de) | Neue antiseborrhoeische Verbindungen,Verfahren zu ihrer Herstellung,kosmetische Mittel,Shampoos und oral verabreichbare Produkte mit einem Gehalt an diesen neuen Verbindungen | |
| DE3500972A1 (de) | Sebosuppressive kosmetische mittel, enthaltend alkoxy- oder alkylbenzyloxy-benzoesaeuren oder deren salze | |
| DE1492071A1 (de) | Antiseborrhoeisch wirksame Mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 2559717 Format of ref document f/p: P |